diff options
author | 2024-08-19 06:43:48 -0400 | |
---|---|---|
committer | 2024-08-19 06:43:48 -0400 | |
commit | ac66d464126392309fbcb35eabc0a837680cc92d (patch) | |
tree | 51bad7ffaf4fed4267c23855c5bf7890d32f5a07 | |
parent | Removed redundant patch for real this time (diff) | |
download | linux-patches-ac66d464126392309fbcb35eabc0a837680cc92d.tar.gz linux-patches-ac66d464126392309fbcb35eabc0a837680cc92d.tar.bz2 linux-patches-ac66d464126392309fbcb35eabc0a837680cc92d.zip |
Linux patch 5.15.1655.15-175
Signed-off-by: Mike Pagano <mpagano@gentoo.org>
-rw-r--r-- | 0000_README | 4 | ||||
-rw-r--r-- | 1164_linux-5.15.165.patch | 16983 |
2 files changed, 16987 insertions, 0 deletions
diff --git a/0000_README b/0000_README index afb15eaa..2cbaab9c 100644 --- a/0000_README +++ b/0000_README @@ -699,6 +699,10 @@ Patch: 1163_linux-5.15.164.patch From: https://www.kernel.org Desc: Linux 5.15.164 +Patch: 1164_linux-5.15.165.patch +From: https://www.kernel.org +Desc: Linux 5.15.165 + Patch: 1500_XATTR_USER_PREFIX.patch From: https://bugs.gentoo.org/show_bug.cgi?id=470644 Desc: Support for namespace user.pax.* on tmpfs. diff --git a/1164_linux-5.15.165.patch b/1164_linux-5.15.165.patch new file mode 100644 index 00000000..11cfb966 --- /dev/null +++ b/1164_linux-5.15.165.patch @@ -0,0 +1,16983 @@ +diff --git a/Documentation/admin-guide/kernel-parameters.txt b/Documentation/admin-guide/kernel-parameters.txt +index e61f0d038c6d76..cf35b2cf90c276 100644 +--- a/Documentation/admin-guide/kernel-parameters.txt ++++ b/Documentation/admin-guide/kernel-parameters.txt +@@ -600,12 +600,6 @@ + loops can be debugged more effectively on production + systems. + +- clocksource.max_cswd_read_retries= [KNL] +- Number of clocksource_watchdog() retries due to +- external delays before the clock will be marked +- unstable. Defaults to three retries, that is, +- four attempts to read the clock under test. +- + clocksource.verify_n_cpus= [KNL] + Limit the number of CPUs checked for clocksources + marked with CLOCK_SOURCE_VERIFY_PERCPU that +@@ -4355,11 +4349,9 @@ + + profile= [KNL] Enable kernel profiling via /proc/profile + Format: [<profiletype>,]<number> +- Param: <profiletype>: "schedule", "sleep", or "kvm" ++ Param: <profiletype>: "schedule" or "kvm" + [defaults to kernel profiling] + Param: "schedule" - profile schedule points. +- Param: "sleep" - profile D-state sleeping (millisecs). +- Requires CONFIG_SCHEDSTATS + Param: "kvm" - profile VM exits. + Param: <number> - step/bucket size as a power of 2 for + statistical time based profiling. +diff --git a/Documentation/arm64/cpu-feature-registers.rst b/Documentation/arm64/cpu-feature-registers.rst +index 749ae970c31955..8aaa5d13d3cc20 100644 +--- a/Documentation/arm64/cpu-feature-registers.rst ++++ b/Documentation/arm64/cpu-feature-registers.rst +@@ -92,7 +92,7 @@ operation if the source belongs to the supported system register space. + + The infrastructure emulates only the following system register space:: + +- Op0=3, Op1=0, CRn=0, CRm=0,4,5,6,7 ++ Op0=3, Op1=0, CRn=0, CRm=0,2,3,4,5,6,7 + + (See Table C5-6 'System instruction encodings for non-Debug System + register accesses' in ARMv8 ARM DDI 0487A.h, for the list of +@@ -291,6 +291,42 @@ infrastructure: + | RPRES | [7-4] | y | + +------------------------------+---------+---------+ + ++ 10) MVFR0_EL1 - AArch32 Media and VFP Feature Register 0 ++ ++ +------------------------------+---------+---------+ ++ | Name | bits | visible | ++ +------------------------------+---------+---------+ ++ | FPDP | [11-8] | y | ++ +------------------------------+---------+---------+ ++ ++ 11) MVFR1_EL1 - AArch32 Media and VFP Feature Register 1 ++ ++ +------------------------------+---------+---------+ ++ | Name | bits | visible | ++ +------------------------------+---------+---------+ ++ | SIMDFMAC | [31-28] | y | ++ +------------------------------+---------+---------+ ++ | SIMDSP | [19-16] | y | ++ +------------------------------+---------+---------+ ++ | SIMDInt | [15-12] | y | ++ +------------------------------+---------+---------+ ++ | SIMDLS | [11-8] | y | ++ +------------------------------+---------+---------+ ++ ++ 12) ID_ISAR5_EL1 - AArch32 Instruction Set Attribute Register 5 ++ ++ +------------------------------+---------+---------+ ++ | Name | bits | visible | ++ +------------------------------+---------+---------+ ++ | CRC32 | [19-16] | y | ++ +------------------------------+---------+---------+ ++ | SHA2 | [15-12] | y | ++ +------------------------------+---------+---------+ ++ | SHA1 | [11-8] | y | ++ +------------------------------+---------+---------+ ++ | AES | [7-4] | y | ++ +------------------------------+---------+---------+ ++ + + Appendix I: Example + ------------------- +diff --git a/Documentation/arm64/silicon-errata.rst b/Documentation/arm64/silicon-errata.rst +index df7c53102a5f92..9868eb45c56a04 100644 +--- a/Documentation/arm64/silicon-errata.rst ++++ b/Documentation/arm64/silicon-errata.rst +@@ -96,8 +96,16 @@ stable kernels. + +----------------+-----------------+-----------------+-----------------------------+ + | ARM | Cortex-A76 | #1463225 | ARM64_ERRATUM_1463225 | + +----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-A76 | #3324349 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ + | ARM | Cortex-A77 | #1508412 | ARM64_ERRATUM_1508412 | + +----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-A77 | #3324348 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-A78 | #3324344 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-A78C | #3324346,3324347| ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ + | ARM | Cortex-A510 | #2441009 | ARM64_ERRATUM_2441009 | + +----------------+-----------------+-----------------+-----------------------------+ + | ARM | Cortex-A510 | #2457168 | ARM64_ERRATUM_2457168 | +@@ -108,18 +116,46 @@ stable kernels. + +----------------+-----------------+-----------------+-----------------------------+ + | ARM | Cortex-A710 | #2224489 | ARM64_ERRATUM_2224489 | + +----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-A710 | #3324338 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-A720 | #3456091 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-A725 | #3456106 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-X1 | #3324344 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-X1C | #3324346 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-X2 | #3324338 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-X3 | #3324335 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-X4 | #3194386 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Cortex-X925 | #3324334 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ + | ARM | Neoverse-N1 | #1188873,1418040| ARM64_ERRATUM_1418040 | + +----------------+-----------------+-----------------+-----------------------------+ + | ARM | Neoverse-N1 | #1349291 | N/A | + +----------------+-----------------+-----------------+-----------------------------+ + | ARM | Neoverse-N1 | #1542419 | ARM64_ERRATUM_1542419 | + +----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Neoverse-N1 | #3324349 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ + | ARM | Neoverse-N2 | #2139208 | ARM64_ERRATUM_2139208 | + +----------------+-----------------+-----------------+-----------------------------+ + | ARM | Neoverse-N2 | #2067961 | ARM64_ERRATUM_2067961 | + +----------------+-----------------+-----------------+-----------------------------+ + | ARM | Neoverse-N2 | #2253138 | ARM64_ERRATUM_2253138 | + +----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Neoverse-N2 | #3324339 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Neoverse-V1 | #3324341 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Neoverse-V2 | #3324336 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ ++| ARM | Neoverse-V3 | #3312417 | ARM64_ERRATUM_3194386 | +++----------------+-----------------+-----------------+-----------------------------+ + | ARM | MMU-500 | #841119,826419 | N/A | + +----------------+-----------------+-----------------+-----------------------------+ + | ARM | MMU-600 | #1076982,1209401| N/A | +diff --git a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml +index 2d34f3ccb2572d..b5e9f22b28f07c 100644 +--- a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml ++++ b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml +@@ -49,7 +49,10 @@ properties: + to take when the temperature crosses those thresholds. + + patternProperties: +- "^[a-zA-Z][a-zA-Z0-9\\-]{1,12}-thermal$": ++ # Node name is limited in size due to Linux kernel requirements - 19 ++ # characters in total (see THERMAL_NAME_LENGTH, including terminating NUL ++ # byte): ++ "^[a-zA-Z][a-zA-Z0-9\\-]{1,10}-thermal$": + type: object + description: + Each thermal zone node contains information about how frequently it +diff --git a/Makefile b/Makefile +index 78f5cc32b7298f..2105600c8d7c29 100644 +--- a/Makefile ++++ b/Makefile +@@ -1,7 +1,7 @@ + # SPDX-License-Identifier: GPL-2.0 + VERSION = 5 + PATCHLEVEL = 15 +-SUBLEVEL = 164 ++SUBLEVEL = 165 + EXTRAVERSION = + NAME = Trick or Treat + +diff --git a/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi b/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi +index 4d6a0c3e8455f9..ff062f4fd726eb 100644 +--- a/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi ++++ b/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi +@@ -5,31 +5,8 @@ + + #include "imx6q.dtsi" + #include "imx6qdl-kontron-samx6i.dtsi" +-#include <dt-bindings/gpio/gpio.h> + + / { + model = "Kontron SMARC sAMX6i Quad/Dual"; + compatible = "kontron,imx6q-samx6i", "fsl,imx6q"; + }; +- +-/* Quad/Dual SoMs have 3 chip-select signals */ +-&ecspi4 { +- cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>, +- <&gpio3 29 GPIO_ACTIVE_LOW>, +- <&gpio3 25 GPIO_ACTIVE_LOW>; +-}; +- +-&pinctrl_ecspi4 { +- fsl,pins = < +- MX6QDL_PAD_EIM_D21__ECSPI4_SCLK 0x100b1 +- MX6QDL_PAD_EIM_D28__ECSPI4_MOSI 0x100b1 +- MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1 +- +- /* SPI4_IMX_CS2# - connected to internal flash */ +- MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0 +- /* SPI4_IMX_CS0# - connected to SMARC SPI0_CS0# */ +- MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0 +- /* SPI4_CS3# - connected to SMARC SPI0_CS1# */ +- MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0 +- >; +-}; +diff --git a/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi b/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi +index 683f6e58ab230f..668d33d1ff0c1c 100644 +--- a/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi ++++ b/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi +@@ -244,7 +244,8 @@ &ecspi4 { + pinctrl-names = "default"; + pinctrl-0 = <&pinctrl_ecspi4>; + cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>, +- <&gpio3 29 GPIO_ACTIVE_LOW>; ++ <&gpio3 29 GPIO_ACTIVE_LOW>, ++ <&gpio3 25 GPIO_ACTIVE_LOW>; + status = "okay"; + + /* default boot source: workaround #1 for errata ERR006282 */ +@@ -259,8 +260,20 @@ smarc_flash: flash@0 { + &fec { + pinctrl-names = "default"; + pinctrl-0 = <&pinctrl_enet>; +- phy-mode = "rgmii"; +- phy-reset-gpios = <&gpio1 25 GPIO_ACTIVE_LOW>; ++ phy-connection-type = "rgmii-id"; ++ phy-handle = <ðphy>; ++ ++ mdio { ++ #address-cells = <1>; ++ #size-cells = <0>; ++ ++ ethphy: ethernet-phy@1 { ++ compatible = "ethernet-phy-ieee802.3-c22"; ++ reg = <1>; ++ reset-gpios = <&gpio2 1 GPIO_ACTIVE_LOW>; ++ reset-assert-us = <1000>; ++ }; ++ }; + }; + + &hdmi { +@@ -452,6 +465,8 @@ MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1 + MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0 + /* SPI_IMX_CS0# - connected to SMARC SPI0_CS0# */ + MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0 ++ /* SPI4_CS3# - connected to SMARC SPI0_CS1# */ ++ MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0 + >; + }; + +@@ -504,7 +519,7 @@ MX6QDL_PAD_RGMII_RX_CTL__RGMII_RX_CTL 0x1b0b0 + MX6QDL_PAD_ENET_MDIO__ENET_MDIO 0x1b0b0 + MX6QDL_PAD_ENET_MDC__ENET_MDC 0x1b0b0 + MX6QDL_PAD_ENET_REF_CLK__ENET_TX_CLK 0x1b0b0 +- MX6QDL_PAD_ENET_CRS_DV__GPIO1_IO25 0x1b0b0 /* RST_GBE0_PHY# */ ++ MX6QDL_PAD_NANDF_D1__GPIO2_IO01 0x1b0b0 /* RST_GBE0_PHY# */ + >; + }; + +@@ -717,7 +732,7 @@ &pcie { + pinctrl-names = "default"; + pinctrl-0 = <&pinctrl_pcie>; + wake-up-gpio = <&gpio6 18 GPIO_ACTIVE_HIGH>; +- reset-gpio = <&gpio3 13 GPIO_ACTIVE_HIGH>; ++ reset-gpio = <&gpio3 13 GPIO_ACTIVE_LOW>; + }; + + /* LCD_BKLT_PWM */ +@@ -805,5 +820,6 @@ &wdog1 { + /* CPLD is feeded by watchdog (hardwired) */ + pinctrl-names = "default"; + pinctrl-0 = <&pinctrl_wdog1>; ++ fsl,ext-reset-output; + status = "okay"; + }; +diff --git a/arch/arm/mach-pxa/include/mach/spitz.h b/arch/arm/mach-pxa/include/mach/spitz.h +deleted file mode 100644 +index 04828d8918aa3f..00000000000000 +--- a/arch/arm/mach-pxa/include/mach/spitz.h ++++ /dev/null +@@ -1,185 +0,0 @@ +-/* SPDX-License-Identifier: GPL-2.0-only */ +-/* +- * Hardware specific definitions for SL-Cx000 series of PDAs +- * +- * Copyright (c) 2005 Alexander Wykes +- * Copyright (c) 2005 Richard Purdie +- * +- * Based on Sharp's 2.4 kernel patches +- */ +-#ifndef __ASM_ARCH_SPITZ_H +-#define __ASM_ARCH_SPITZ_H 1 +-#endif +- +-#include "irqs.h" /* PXA_NR_BUILTIN_GPIO, PXA_GPIO_TO_IRQ */ +-#include <linux/fb.h> +- +-/* Spitz/Akita GPIOs */ +- +-#define SPITZ_GPIO_KEY_INT (0) /* Key Interrupt */ +-#define SPITZ_GPIO_RESET (1) +-#define SPITZ_GPIO_nSD_DETECT (9) +-#define SPITZ_GPIO_TP_INT (11) /* Touch Panel interrupt */ +-#define SPITZ_GPIO_AK_INT (13) /* Remote Control */ +-#define SPITZ_GPIO_ADS7846_CS (14) +-#define SPITZ_GPIO_SYNC (16) +-#define SPITZ_GPIO_MAX1111_CS (20) +-#define SPITZ_GPIO_FATAL_BAT (21) +-#define SPITZ_GPIO_HSYNC (22) +-#define SPITZ_GPIO_nSD_CLK (32) +-#define SPITZ_GPIO_USB_DEVICE (35) +-#define SPITZ_GPIO_USB_HOST (37) +-#define SPITZ_GPIO_USB_CONNECT (41) +-#define SPITZ_GPIO_LCDCON_CS (53) +-#define SPITZ_GPIO_nPCE (54) +-#define SPITZ_GPIO_nSD_WP (81) +-#define SPITZ_GPIO_ON_RESET (89) +-#define SPITZ_GPIO_BAT_COVER (90) +-#define SPITZ_GPIO_CF_CD (94) +-#define SPITZ_GPIO_ON_KEY (95) +-#define SPITZ_GPIO_SWA (97) +-#define SPITZ_GPIO_SWB (96) +-#define SPITZ_GPIO_CHRG_FULL (101) +-#define SPITZ_GPIO_CO (101) +-#define SPITZ_GPIO_CF_IRQ (105) +-#define SPITZ_GPIO_AC_IN (115) +-#define SPITZ_GPIO_HP_IN (116) +- +-/* Spitz Only GPIOs */ +- +-#define SPITZ_GPIO_CF2_IRQ (106) /* CF slot1 Ready */ +-#define SPITZ_GPIO_CF2_CD (93) +- +- +-/* Spitz/Akita Keyboard Definitions */ +- +-#define SPITZ_KEY_STROBE_NUM (11) +-#define SPITZ_KEY_SENSE_NUM (7) +-#define SPITZ_GPIO_G0_STROBE_BIT 0x0f800000 +-#define SPITZ_GPIO_G1_STROBE_BIT 0x00100000 +-#define SPITZ_GPIO_G2_STROBE_BIT 0x01000000 +-#define SPITZ_GPIO_G3_STROBE_BIT 0x00041880 +-#define SPITZ_GPIO_G0_SENSE_BIT 0x00021000 +-#define SPITZ_GPIO_G1_SENSE_BIT 0x000000d4 +-#define SPITZ_GPIO_G2_SENSE_BIT 0x08000000 +-#define SPITZ_GPIO_G3_SENSE_BIT 0x00000000 +- +-#define SPITZ_GPIO_KEY_STROBE0 88 +-#define SPITZ_GPIO_KEY_STROBE1 23 +-#define SPITZ_GPIO_KEY_STROBE2 24 +-#define SPITZ_GPIO_KEY_STROBE3 25 +-#define SPITZ_GPIO_KEY_STROBE4 26 +-#define SPITZ_GPIO_KEY_STROBE5 27 +-#define SPITZ_GPIO_KEY_STROBE6 52 +-#define SPITZ_GPIO_KEY_STROBE7 103 +-#define SPITZ_GPIO_KEY_STROBE8 107 +-#define SPITZ_GPIO_KEY_STROBE9 108 +-#define SPITZ_GPIO_KEY_STROBE10 114 +- +-#define SPITZ_GPIO_KEY_SENSE0 12 +-#define SPITZ_GPIO_KEY_SENSE1 17 +-#define SPITZ_GPIO_KEY_SENSE2 91 +-#define SPITZ_GPIO_KEY_SENSE3 34 +-#define SPITZ_GPIO_KEY_SENSE4 36 +-#define SPITZ_GPIO_KEY_SENSE5 38 +-#define SPITZ_GPIO_KEY_SENSE6 39 +- +- +-/* Spitz Scoop Device (No. 1) GPIOs */ +-/* Suspend States in comments */ +-#define SPITZ_SCP_LED_GREEN SCOOP_GPCR_PA11 /* Keep */ +-#define SPITZ_SCP_JK_B SCOOP_GPCR_PA12 /* Keep */ +-#define SPITZ_SCP_CHRG_ON SCOOP_GPCR_PA13 /* Keep */ +-#define SPITZ_SCP_MUTE_L SCOOP_GPCR_PA14 /* Low */ +-#define SPITZ_SCP_MUTE_R SCOOP_GPCR_PA15 /* Low */ +-#define SPITZ_SCP_CF_POWER SCOOP_GPCR_PA16 /* Keep */ +-#define SPITZ_SCP_LED_ORANGE SCOOP_GPCR_PA17 /* Keep */ +-#define SPITZ_SCP_JK_A SCOOP_GPCR_PA18 /* Low */ +-#define SPITZ_SCP_ADC_TEMP_ON SCOOP_GPCR_PA19 /* Low */ +- +-#define SPITZ_SCP_IO_DIR (SPITZ_SCP_JK_B | SPITZ_SCP_CHRG_ON | \ +- SPITZ_SCP_MUTE_L | SPITZ_SCP_MUTE_R | \ +- SPITZ_SCP_CF_POWER | SPITZ_SCP_JK_A | SPITZ_SCP_ADC_TEMP_ON) +-#define SPITZ_SCP_IO_OUT (SPITZ_SCP_CHRG_ON | SPITZ_SCP_MUTE_L | SPITZ_SCP_MUTE_R) +-#define SPITZ_SCP_SUS_CLR (SPITZ_SCP_MUTE_L | SPITZ_SCP_MUTE_R | SPITZ_SCP_JK_A | SPITZ_SCP_ADC_TEMP_ON) +-#define SPITZ_SCP_SUS_SET 0 +- +-#define SPITZ_SCP_GPIO_BASE (PXA_NR_BUILTIN_GPIO) +-#define SPITZ_GPIO_LED_GREEN (SPITZ_SCP_GPIO_BASE + 0) +-#define SPITZ_GPIO_JK_B (SPITZ_SCP_GPIO_BASE + 1) +-#define SPITZ_GPIO_CHRG_ON (SPITZ_SCP_GPIO_BASE + 2) +-#define SPITZ_GPIO_MUTE_L (SPITZ_SCP_GPIO_BASE + 3) +-#define SPITZ_GPIO_MUTE_R (SPITZ_SCP_GPIO_BASE + 4) +-#define SPITZ_GPIO_CF_POWER (SPITZ_SCP_GPIO_BASE + 5) +-#define SPITZ_GPIO_LED_ORANGE (SPITZ_SCP_GPIO_BASE + 6) +-#define SPITZ_GPIO_JK_A (SPITZ_SCP_GPIO_BASE + 7) +-#define SPITZ_GPIO_ADC_TEMP_ON (SPITZ_SCP_GPIO_BASE + 8) +- +-/* Spitz Scoop Device (No. 2) GPIOs */ +-/* Suspend States in comments */ +-#define SPITZ_SCP2_IR_ON SCOOP_GPCR_PA11 /* High */ +-#define SPITZ_SCP2_AKIN_PULLUP SCOOP_GPCR_PA12 /* Keep */ +-#define SPITZ_SCP2_RESERVED_1 SCOOP_GPCR_PA13 /* High */ +-#define SPITZ_SCP2_RESERVED_2 SCOOP_GPCR_PA14 /* Low */ +-#define SPITZ_SCP2_RESERVED_3 SCOOP_GPCR_PA15 /* Low */ +-#define SPITZ_SCP2_RESERVED_4 SCOOP_GPCR_PA16 /* Low */ +-#define SPITZ_SCP2_BACKLIGHT_CONT SCOOP_GPCR_PA17 /* Low */ +-#define SPITZ_SCP2_BACKLIGHT_ON SCOOP_GPCR_PA18 /* Low */ +-#define SPITZ_SCP2_MIC_BIAS SCOOP_GPCR_PA19 /* Low */ +- +-#define SPITZ_SCP2_IO_DIR (SPITZ_SCP2_AKIN_PULLUP | SPITZ_SCP2_RESERVED_1 | \ +- SPITZ_SCP2_RESERVED_2 | SPITZ_SCP2_RESERVED_3 | SPITZ_SCP2_RESERVED_4 | \ +- SPITZ_SCP2_BACKLIGHT_CONT | SPITZ_SCP2_BACKLIGHT_ON | SPITZ_SCP2_MIC_BIAS) +- +-#define SPITZ_SCP2_IO_OUT (SPITZ_SCP2_AKIN_PULLUP | SPITZ_SCP2_RESERVED_1) +-#define SPITZ_SCP2_SUS_CLR (SPITZ_SCP2_RESERVED_2 | SPITZ_SCP2_RESERVED_3 | SPITZ_SCP2_RESERVED_4 | \ +- SPITZ_SCP2_BACKLIGHT_CONT | SPITZ_SCP2_BACKLIGHT_ON | SPITZ_SCP2_MIC_BIAS) +-#define SPITZ_SCP2_SUS_SET (SPITZ_SCP2_IR_ON | SPITZ_SCP2_RESERVED_1) +- +-#define SPITZ_SCP2_GPIO_BASE (PXA_NR_BUILTIN_GPIO + 12) +-#define SPITZ_GPIO_IR_ON (SPITZ_SCP2_GPIO_BASE + 0) +-#define SPITZ_GPIO_AKIN_PULLUP (SPITZ_SCP2_GPIO_BASE + 1) +-#define SPITZ_GPIO_RESERVED_1 (SPITZ_SCP2_GPIO_BASE + 2) +-#define SPITZ_GPIO_RESERVED_2 (SPITZ_SCP2_GPIO_BASE + 3) +-#define SPITZ_GPIO_RESERVED_3 (SPITZ_SCP2_GPIO_BASE + 4) +-#define SPITZ_GPIO_RESERVED_4 (SPITZ_SCP2_GPIO_BASE + 5) +-#define SPITZ_GPIO_BACKLIGHT_CONT (SPITZ_SCP2_GPIO_BASE + 6) +-#define SPITZ_GPIO_BACKLIGHT_ON (SPITZ_SCP2_GPIO_BASE + 7) +-#define SPITZ_GPIO_MIC_BIAS (SPITZ_SCP2_GPIO_BASE + 8) +- +-/* Akita IO Expander GPIOs */ +-#define AKITA_IOEXP_GPIO_BASE (PXA_NR_BUILTIN_GPIO + 12) +-#define AKITA_GPIO_RESERVED_0 (AKITA_IOEXP_GPIO_BASE + 0) +-#define AKITA_GPIO_RESERVED_1 (AKITA_IOEXP_GPIO_BASE + 1) +-#define AKITA_GPIO_MIC_BIAS (AKITA_IOEXP_GPIO_BASE + 2) +-#define AKITA_GPIO_BACKLIGHT_ON (AKITA_IOEXP_GPIO_BASE + 3) +-#define AKITA_GPIO_BACKLIGHT_CONT (AKITA_IOEXP_GPIO_BASE + 4) +-#define AKITA_GPIO_AKIN_PULLUP (AKITA_IOEXP_GPIO_BASE + 5) +-#define AKITA_GPIO_IR_ON (AKITA_IOEXP_GPIO_BASE + 6) +-#define AKITA_GPIO_RESERVED_7 (AKITA_IOEXP_GPIO_BASE + 7) +- +-/* Spitz IRQ Definitions */ +- +-#define SPITZ_IRQ_GPIO_KEY_INT PXA_GPIO_TO_IRQ(SPITZ_GPIO_KEY_INT) +-#define SPITZ_IRQ_GPIO_AC_IN PXA_GPIO_TO_IRQ(SPITZ_GPIO_AC_IN) +-#define SPITZ_IRQ_GPIO_AK_INT PXA_GPIO_TO_IRQ(SPITZ_GPIO_AK_INT) +-#define SPITZ_IRQ_GPIO_HP_IN PXA_GPIO_TO_IRQ(SPITZ_GPIO_HP_IN) +-#define SPITZ_IRQ_GPIO_TP_INT PXA_GPIO_TO_IRQ(SPITZ_GPIO_TP_INT) +-#define SPITZ_IRQ_GPIO_SYNC PXA_GPIO_TO_IRQ(SPITZ_GPIO_SYNC) +-#define SPITZ_IRQ_GPIO_ON_KEY PXA_GPIO_TO_IRQ(SPITZ_GPIO_ON_KEY) +-#define SPITZ_IRQ_GPIO_SWA PXA_GPIO_TO_IRQ(SPITZ_GPIO_SWA) +-#define SPITZ_IRQ_GPIO_SWB PXA_GPIO_TO_IRQ(SPITZ_GPIO_SWB) +-#define SPITZ_IRQ_GPIO_BAT_COVER PXA_GPIO_TO_IRQ(SPITZ_GPIO_BAT_COVER) +-#define SPITZ_IRQ_GPIO_FATAL_BAT PXA_GPIO_TO_IRQ(SPITZ_GPIO_FATAL_BAT) +-#define SPITZ_IRQ_GPIO_CO PXA_GPIO_TO_IRQ(SPITZ_GPIO_CO) +-#define SPITZ_IRQ_GPIO_CF_IRQ PXA_GPIO_TO_IRQ(SPITZ_GPIO_CF_IRQ) +-#define SPITZ_IRQ_GPIO_CF_CD PXA_GPIO_TO_IRQ(SPITZ_GPIO_CF_CD) +-#define SPITZ_IRQ_GPIO_CF2_IRQ PXA_GPIO_TO_IRQ(SPITZ_GPIO_CF2_IRQ) +-#define SPITZ_IRQ_GPIO_nSD_INT PXA_GPIO_TO_IRQ(SPITZ_GPIO_nSD_INT) +-#define SPITZ_IRQ_GPIO_nSD_DETECT PXA_GPIO_TO_IRQ(SPITZ_GPIO_nSD_DETECT) +- +-/* +- * Shared data structures +- */ +-extern struct platform_device spitzssp_device; +-extern struct sharpsl_charger_machinfo spitz_pm_machinfo; +diff --git a/arch/arm/mach-pxa/spitz.c b/arch/arm/mach-pxa/spitz.c +index 264de0bc97d689..9bdc20706d187b 100644 +--- a/arch/arm/mach-pxa/spitz.c ++++ b/arch/arm/mach-pxa/spitz.c +@@ -43,7 +43,7 @@ + #include <linux/platform_data/mmc-pxamci.h> + #include <linux/platform_data/usb-ohci-pxa27x.h> + #include <linux/platform_data/video-pxafb.h> +-#include <mach/spitz.h> ++#include "spitz.h" + #include "sharpsl_pm.h" + #include <mach/smemc.h> + +@@ -516,10 +516,8 @@ static struct pxa2xx_spi_chip spitz_ads7846_chip = { + static struct gpiod_lookup_table spitz_lcdcon_gpio_table = { + .dev_id = "spi2.1", + .table = { +- GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_CONT, +- "BL_CONT", GPIO_ACTIVE_LOW), +- GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_ON, +- "BL_ON", GPIO_ACTIVE_HIGH), ++ GPIO_LOOKUP("sharp-scoop.1", 6, "BL_CONT", GPIO_ACTIVE_LOW), ++ GPIO_LOOKUP("sharp-scoop.1", 7, "BL_ON", GPIO_ACTIVE_HIGH), + { }, + }, + }; +@@ -527,10 +525,8 @@ static struct gpiod_lookup_table spitz_lcdcon_gpio_table = { + static struct gpiod_lookup_table akita_lcdcon_gpio_table = { + .dev_id = "spi2.1", + .table = { +- GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_CONT, +- "BL_CONT", GPIO_ACTIVE_LOW), +- GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_ON, +- "BL_ON", GPIO_ACTIVE_HIGH), ++ GPIO_LOOKUP("i2c-max7310", 3, "BL_ON", GPIO_ACTIVE_HIGH), ++ GPIO_LOOKUP("i2c-max7310", 4, "BL_CONT", GPIO_ACTIVE_LOW), + { }, + }, + }; +@@ -954,11 +950,36 @@ static void __init spitz_i2c_init(void) + static inline void spitz_i2c_init(void) {} + #endif + ++static struct gpiod_lookup_table spitz_audio_gpio_table = { ++ .dev_id = "spitz-audio", ++ .table = { ++ GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH), ++ GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH), ++ GPIO_LOOKUP("sharp-scoop.1", 8, "mic", GPIO_ACTIVE_HIGH), ++ { }, ++ }, ++}; ++ ++static struct gpiod_lookup_table akita_audio_gpio_table = { ++ .dev_id = "spitz-audio", ++ .table = { ++ GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH), ++ GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH), ++ GPIO_LOOKUP("i2c-max7310", 2, "mic", GPIO_ACTIVE_HIGH), ++ { }, ++ }, ++}; ++ + /****************************************************************************** + * Audio devices + ******************************************************************************/ + static inline void spitz_audio_init(void) + { ++ if (machine_is_akita()) ++ gpiod_add_lookup_table(&akita_audio_gpio_table); ++ else ++ gpiod_add_lookup_table(&spitz_audio_gpio_table); ++ + platform_device_register_simple("spitz-audio", -1, NULL, 0); + } + +diff --git a/arch/arm/mach-pxa/spitz.h b/arch/arm/mach-pxa/spitz.h +new file mode 100644 +index 00000000000000..f97e3ebd762d51 +--- /dev/null ++++ b/arch/arm/mach-pxa/spitz.h +@@ -0,0 +1,185 @@ ++/* SPDX-License-Identifier: GPL-2.0-only */ ++/* ++ * Hardware specific definitions for SL-Cx000 series of PDAs ++ * ++ * Copyright (c) 2005 Alexander Wykes ++ * Copyright (c) 2005 Richard Purdie ++ * ++ * Based on Sharp's 2.4 kernel patches ++ */ ++#ifndef __ASM_ARCH_SPITZ_H ++#define __ASM_ARCH_SPITZ_H 1 ++#endif ++ ++#include <mach/irqs.h> /* PXA_NR_BUILTIN_GPIO, PXA_GPIO_TO_IRQ */ ++#include <linux/fb.h> ++ ++/* Spitz/Akita GPIOs */ ++ ++#define SPITZ_GPIO_KEY_INT (0) /* Key Interrupt */ ++#define SPITZ_GPIO_RESET (1) ++#define SPITZ_GPIO_nSD_DETECT (9) ++#define SPITZ_GPIO_TP_INT (11) /* Touch Panel interrupt */ ++#define SPITZ_GPIO_AK_INT (13) /* Remote Control */ ++#define SPITZ_GPIO_ADS7846_CS (14) ++#define SPITZ_GPIO_SYNC (16) ++#define SPITZ_GPIO_MAX1111_CS (20) ++#define SPITZ_GPIO_FATAL_BAT (21) ++#define SPITZ_GPIO_HSYNC (22) ++#define SPITZ_GPIO_nSD_CLK (32) ++#define SPITZ_GPIO_USB_DEVICE (35) ++#define SPITZ_GPIO_USB_HOST (37) ++#define SPITZ_GPIO_USB_CONNECT (41) ++#define SPITZ_GPIO_LCDCON_CS (53) ++#define SPITZ_GPIO_nPCE (54) ++#define SPITZ_GPIO_nSD_WP (81) ++#define SPITZ_GPIO_ON_RESET (89) ++#define SPITZ_GPIO_BAT_COVER (90) ++#define SPITZ_GPIO_CF_CD (94) ++#define SPITZ_GPIO_ON_KEY (95) ++#define SPITZ_GPIO_SWA (97) ++#define SPITZ_GPIO_SWB (96) ++#define SPITZ_GPIO_CHRG_FULL (101) ++#define SPITZ_GPIO_CO (101) ++#define SPITZ_GPIO_CF_IRQ (105) ++#define SPITZ_GPIO_AC_IN (115) ++#define SPITZ_GPIO_HP_IN (116) ++ ++/* Spitz Only GPIOs */ ++ ++#define SPITZ_GPIO_CF2_IRQ (106) /* CF slot1 Ready */ ++#define SPITZ_GPIO_CF2_CD (93) ++ ++ ++/* Spitz/Akita Keyboard Definitions */ ++ ++#define SPITZ_KEY_STROBE_NUM (11) ++#define SPITZ_KEY_SENSE_NUM (7) ++#define SPITZ_GPIO_G0_STROBE_BIT 0x0f800000 ++#define SPITZ_GPIO_G1_STROBE_BIT 0x00100000 ++#define SPITZ_GPIO_G2_STROBE_BIT 0x01000000 ++#define SPITZ_GPIO_G3_STROBE_BIT 0x00041880 ++#define SPITZ_GPIO_G0_SENSE_BIT 0x00021000 ++#define SPITZ_GPIO_G1_SENSE_BIT 0x000000d4 ++#define SPITZ_GPIO_G2_SENSE_BIT 0x08000000 ++#define SPITZ_GPIO_G3_SENSE_BIT 0x00000000 ++ ++#define SPITZ_GPIO_KEY_STROBE0 88 ++#define SPITZ_GPIO_KEY_STROBE1 23 ++#define SPITZ_GPIO_KEY_STROBE2 24 ++#define SPITZ_GPIO_KEY_STROBE3 25 ++#define SPITZ_GPIO_KEY_STROBE4 26 ++#define SPITZ_GPIO_KEY_STROBE5 27 ++#define SPITZ_GPIO_KEY_STROBE6 52 ++#define SPITZ_GPIO_KEY_STROBE7 103 ++#define SPITZ_GPIO_KEY_STROBE8 107 ++#define SPITZ_GPIO_KEY_STROBE9 108 ++#define SPITZ_GPIO_KEY_STROBE10 114 ++ ++#define SPITZ_GPIO_KEY_SENSE0 12 ++#define SPITZ_GPIO_KEY_SENSE1 17 ++#define SPITZ_GPIO_KEY_SENSE2 91 ++#define SPITZ_GPIO_KEY_SENSE3 34 ++#define SPITZ_GPIO_KEY_SENSE4 36 ++#define SPITZ_GPIO_KEY_SENSE5 38 ++#define SPITZ_GPIO_KEY_SENSE6 39 ++ ++ ++/* Spitz Scoop Device (No. 1) GPIOs */ ++/* Suspend States in comments */ ++#define SPITZ_SCP_LED_GREEN SCOOP_GPCR_PA11 /* Keep */ ++#define SPITZ_SCP_JK_B SCOOP_GPCR_PA12 /* Keep */ ++#define SPITZ_SCP_CHRG_ON SCOOP_GPCR_PA13 /* Keep */ ++#define SPITZ_SCP_MUTE_L SCOOP_GPCR_PA14 /* Low */ ++#define SPITZ_SCP_MUTE_R SCOOP_GPCR_PA15 /* Low */ ++#define SPITZ_SCP_CF_POWER SCOOP_GPCR_PA16 /* Keep */ ++#define SPITZ_SCP_LED_ORANGE SCOOP_GPCR_PA17 /* Keep */ ++#define SPITZ_SCP_JK_A SCOOP_GPCR_PA18 /* Low */ ++#define SPITZ_SCP_ADC_TEMP_ON SCOOP_GPCR_PA19 /* Low */ ++ ++#define SPITZ_SCP_IO_DIR (SPITZ_SCP_JK_B | SPITZ_SCP_CHRG_ON | \ ++ SPITZ_SCP_MUTE_L | SPITZ_SCP_MUTE_R | \ ++ SPITZ_SCP_CF_POWER | SPITZ_SCP_JK_A | SPITZ_SCP_ADC_TEMP_ON) ++#define SPITZ_SCP_IO_OUT (SPITZ_SCP_CHRG_ON | SPITZ_SCP_MUTE_L | SPITZ_SCP_MUTE_R) ++#define SPITZ_SCP_SUS_CLR (SPITZ_SCP_MUTE_L | SPITZ_SCP_MUTE_R | SPITZ_SCP_JK_A | SPITZ_SCP_ADC_TEMP_ON) ++#define SPITZ_SCP_SUS_SET 0 ++ ++#define SPITZ_SCP_GPIO_BASE (PXA_NR_BUILTIN_GPIO) ++#define SPITZ_GPIO_LED_GREEN (SPITZ_SCP_GPIO_BASE + 0) ++#define SPITZ_GPIO_JK_B (SPITZ_SCP_GPIO_BASE + 1) ++#define SPITZ_GPIO_CHRG_ON (SPITZ_SCP_GPIO_BASE + 2) ++#define SPITZ_GPIO_MUTE_L (SPITZ_SCP_GPIO_BASE + 3) ++#define SPITZ_GPIO_MUTE_R (SPITZ_SCP_GPIO_BASE + 4) ++#define SPITZ_GPIO_CF_POWER (SPITZ_SCP_GPIO_BASE + 5) ++#define SPITZ_GPIO_LED_ORANGE (SPITZ_SCP_GPIO_BASE + 6) ++#define SPITZ_GPIO_JK_A (SPITZ_SCP_GPIO_BASE + 7) ++#define SPITZ_GPIO_ADC_TEMP_ON (SPITZ_SCP_GPIO_BASE + 8) ++ ++/* Spitz Scoop Device (No. 2) GPIOs */ ++/* Suspend States in comments */ ++#define SPITZ_SCP2_IR_ON SCOOP_GPCR_PA11 /* High */ ++#define SPITZ_SCP2_AKIN_PULLUP SCOOP_GPCR_PA12 /* Keep */ ++#define SPITZ_SCP2_RESERVED_1 SCOOP_GPCR_PA13 /* High */ ++#define SPITZ_SCP2_RESERVED_2 SCOOP_GPCR_PA14 /* Low */ ++#define SPITZ_SCP2_RESERVED_3 SCOOP_GPCR_PA15 /* Low */ ++#define SPITZ_SCP2_RESERVED_4 SCOOP_GPCR_PA16 /* Low */ ++#define SPITZ_SCP2_BACKLIGHT_CONT SCOOP_GPCR_PA17 /* Low */ ++#define SPITZ_SCP2_BACKLIGHT_ON SCOOP_GPCR_PA18 /* Low */ ++#define SPITZ_SCP2_MIC_BIAS SCOOP_GPCR_PA19 /* Low */ ++ ++#define SPITZ_SCP2_IO_DIR (SPITZ_SCP2_AKIN_PULLUP | SPITZ_SCP2_RESERVED_1 | \ ++ SPITZ_SCP2_RESERVED_2 | SPITZ_SCP2_RESERVED_3 | SPITZ_SCP2_RESERVED_4 | \ ++ SPITZ_SCP2_BACKLIGHT_CONT | SPITZ_SCP2_BACKLIGHT_ON | SPITZ_SCP2_MIC_BIAS) ++ ++#define SPITZ_SCP2_IO_OUT (SPITZ_SCP2_AKIN_PULLUP | SPITZ_SCP2_RESERVED_1) ++#define SPITZ_SCP2_SUS_CLR (SPITZ_SCP2_RESERVED_2 | SPITZ_SCP2_RESERVED_3 | SPITZ_SCP2_RESERVED_4 | \ ++ SPITZ_SCP2_BACKLIGHT_CONT | SPITZ_SCP2_BACKLIGHT_ON | SPITZ_SCP2_MIC_BIAS) ++#define SPITZ_SCP2_SUS_SET (SPITZ_SCP2_IR_ON | SPITZ_SCP2_RESERVED_1) ++ ++#define SPITZ_SCP2_GPIO_BASE (PXA_NR_BUILTIN_GPIO + 12) ++#define SPITZ_GPIO_IR_ON (SPITZ_SCP2_GPIO_BASE + 0) ++#define SPITZ_GPIO_AKIN_PULLUP (SPITZ_SCP2_GPIO_BASE + 1) ++#define SPITZ_GPIO_RESERVED_1 (SPITZ_SCP2_GPIO_BASE + 2) ++#define SPITZ_GPIO_RESERVED_2 (SPITZ_SCP2_GPIO_BASE + 3) ++#define SPITZ_GPIO_RESERVED_3 (SPITZ_SCP2_GPIO_BASE + 4) ++#define SPITZ_GPIO_RESERVED_4 (SPITZ_SCP2_GPIO_BASE + 5) ++#define SPITZ_GPIO_BACKLIGHT_CONT (SPITZ_SCP2_GPIO_BASE + 6) ++#define SPITZ_GPIO_BACKLIGHT_ON (SPITZ_SCP2_GPIO_BASE + 7) ++#define SPITZ_GPIO_MIC_BIAS (SPITZ_SCP2_GPIO_BASE + 8) ++ ++/* Akita IO Expander GPIOs */ ++#define AKITA_IOEXP_GPIO_BASE (PXA_NR_BUILTIN_GPIO + 12) ++#define AKITA_GPIO_RESERVED_0 (AKITA_IOEXP_GPIO_BASE + 0) ++#define AKITA_GPIO_RESERVED_1 (AKITA_IOEXP_GPIO_BASE + 1) ++#define AKITA_GPIO_MIC_BIAS (AKITA_IOEXP_GPIO_BASE + 2) ++#define AKITA_GPIO_BACKLIGHT_ON (AKITA_IOEXP_GPIO_BASE + 3) ++#define AKITA_GPIO_BACKLIGHT_CONT (AKITA_IOEXP_GPIO_BASE + 4) ++#define AKITA_GPIO_AKIN_PULLUP (AKITA_IOEXP_GPIO_BASE + 5) ++#define AKITA_GPIO_IR_ON (AKITA_IOEXP_GPIO_BASE + 6) ++#define AKITA_GPIO_RESERVED_7 (AKITA_IOEXP_GPIO_BASE + 7) ++ ++/* Spitz IRQ Definitions */ ++ ++#define SPITZ_IRQ_GPIO_KEY_INT PXA_GPIO_TO_IRQ(SPITZ_GPIO_KEY_INT) ++#define SPITZ_IRQ_GPIO_AC_IN PXA_GPIO_TO_IRQ(SPITZ_GPIO_AC_IN) ++#define SPITZ_IRQ_GPIO_AK_INT PXA_GPIO_TO_IRQ(SPITZ_GPIO_AK_INT) ++#define SPITZ_IRQ_GPIO_HP_IN PXA_GPIO_TO_IRQ(SPITZ_GPIO_HP_IN) ++#define SPITZ_IRQ_GPIO_TP_INT PXA_GPIO_TO_IRQ(SPITZ_GPIO_TP_INT) ++#define SPITZ_IRQ_GPIO_SYNC PXA_GPIO_TO_IRQ(SPITZ_GPIO_SYNC) ++#define SPITZ_IRQ_GPIO_ON_KEY PXA_GPIO_TO_IRQ(SPITZ_GPIO_ON_KEY) ++#define SPITZ_IRQ_GPIO_SWA PXA_GPIO_TO_IRQ(SPITZ_GPIO_SWA) ++#define SPITZ_IRQ_GPIO_SWB PXA_GPIO_TO_IRQ(SPITZ_GPIO_SWB) ++#define SPITZ_IRQ_GPIO_BAT_COVER PXA_GPIO_TO_IRQ(SPITZ_GPIO_BAT_COVER) ++#define SPITZ_IRQ_GPIO_FATAL_BAT PXA_GPIO_TO_IRQ(SPITZ_GPIO_FATAL_BAT) ++#define SPITZ_IRQ_GPIO_CO PXA_GPIO_TO_IRQ(SPITZ_GPIO_CO) ++#define SPITZ_IRQ_GPIO_CF_IRQ PXA_GPIO_TO_IRQ(SPITZ_GPIO_CF_IRQ) ++#define SPITZ_IRQ_GPIO_CF_CD PXA_GPIO_TO_IRQ(SPITZ_GPIO_CF_CD) ++#define SPITZ_IRQ_GPIO_CF2_IRQ PXA_GPIO_TO_IRQ(SPITZ_GPIO_CF2_IRQ) ++#define SPITZ_IRQ_GPIO_nSD_INT PXA_GPIO_TO_IRQ(SPITZ_GPIO_nSD_INT) ++#define SPITZ_IRQ_GPIO_nSD_DETECT PXA_GPIO_TO_IRQ(SPITZ_GPIO_nSD_DETECT) ++ ++/* ++ * Shared data structures ++ */ ++extern struct platform_device spitzssp_device; ++extern struct sharpsl_charger_machinfo spitz_pm_machinfo; +diff --git a/arch/arm/mach-pxa/spitz_pm.c b/arch/arm/mach-pxa/spitz_pm.c +index 25a1f8c5a7382d..6167f96d7b41ee 100644 +--- a/arch/arm/mach-pxa/spitz_pm.c ++++ b/arch/arm/mach-pxa/spitz_pm.c +@@ -20,7 +20,7 @@ + #include <asm/mach-types.h> + #include <mach/hardware.h> + +-#include <mach/spitz.h> ++#include "spitz.h" + #include "pxa27x.h" + #include "sharpsl_pm.h" + +diff --git a/arch/arm64/Kconfig b/arch/arm64/Kconfig +index 68874d3856b911..2d77e9269eb500 100644 +--- a/arch/arm64/Kconfig ++++ b/arch/arm64/Kconfig +@@ -848,6 +848,44 @@ config ARM64_ERRATUM_2224489 + + If unsure, say Y. + ++config ARM64_ERRATUM_3194386 ++ bool "Cortex-*/Neoverse-*: workaround for MSR SSBS not self-synchronizing" ++ default y ++ help ++ This option adds the workaround for the following errata: ++ ++ * ARM Cortex-A76 erratum 3324349 ++ * ARM Cortex-A77 erratum 3324348 ++ * ARM Cortex-A78 erratum 3324344 ++ * ARM Cortex-A78C erratum 3324346 ++ * ARM Cortex-A78C erratum 3324347 ++ * ARM Cortex-A710 erratam 3324338 ++ * ARM Cortex-A720 erratum 3456091 ++ * ARM Cortex-A725 erratum 3456106 ++ * ARM Cortex-X1 erratum 3324344 ++ * ARM Cortex-X1C erratum 3324346 ++ * ARM Cortex-X2 erratum 3324338 ++ * ARM Cortex-X3 erratum 3324335 ++ * ARM Cortex-X4 erratum 3194386 ++ * ARM Cortex-X925 erratum 3324334 ++ * ARM Neoverse-N1 erratum 3324349 ++ * ARM Neoverse N2 erratum 3324339 ++ * ARM Neoverse-V1 erratum 3324341 ++ * ARM Neoverse V2 erratum 3324336 ++ * ARM Neoverse-V3 erratum 3312417 ++ ++ On affected cores "MSR SSBS, #0" instructions may not affect ++ subsequent speculative instructions, which may permit unexepected ++ speculative store bypassing. ++ ++ Work around this problem by placing a Speculation Barrier (SB) or ++ Instruction Synchronization Barrier (ISB) after kernel changes to ++ SSBS. The presence of the SSBS special-purpose register is hidden ++ from hwcaps and EL0 reads of ID_AA64PFR1_EL1, such that userspace ++ will use the PR_SPEC_STORE_BYPASS prctl to change SSBS. ++ ++ If unsure, say Y. ++ + config CAVIUM_ERRATUM_22375 + bool "Cavium erratum 22375, 24313" + default y +diff --git a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi +index 7c029f552a23b3..256c46771db782 100644 +--- a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi ++++ b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi +@@ -311,8 +311,8 @@ &hdmi_tx { + <&reset RESET_HDMI_SYSTEM_RESET>, + <&reset RESET_HDMI_TX>; + reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy"; +- clocks = <&clkc CLKID_HDMI_PCLK>, +- <&clkc CLKID_CLK81>, ++ clocks = <&clkc CLKID_HDMI>, ++ <&clkc CLKID_HDMI_PCLK>, + <&clkc CLKID_GCLK_VENCI_INT0>; + clock-names = "isfr", "iahb", "venci"; + }; +diff --git a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi +index 35002293505224..a689bd14ece999 100644 +--- a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi ++++ b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi +@@ -323,8 +323,8 @@ &hdmi_tx { + <&reset RESET_HDMI_SYSTEM_RESET>, + <&reset RESET_HDMI_TX>; + reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy"; +- clocks = <&clkc CLKID_HDMI_PCLK>, +- <&clkc CLKID_CLK81>, ++ clocks = <&clkc CLKID_HDMI>, ++ <&clkc CLKID_HDMI_PCLK>, + <&clkc CLKID_GCLK_VENCI_INT0>; + clock-names = "isfr", "iahb", "venci"; + }; +diff --git a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts +index 483f7ab4f31c71..b4aa9a9712fe53 100644 +--- a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts ++++ b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts +@@ -285,8 +285,8 @@ asm_sel { + /* eMMC is shared pin with parallel NAND */ + emmc_pins_default: emmc-pins-default { + mux { +- function = "emmc", "emmc_rst"; +- groups = "emmc"; ++ function = "emmc"; ++ groups = "emmc", "emmc_rst"; + }; + + /* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7", +diff --git a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts +index 28e17a7e2a5a66..e1ad840dc3175c 100644 +--- a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts ++++ b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts +@@ -249,8 +249,8 @@ &pio { + /* eMMC is shared pin with parallel NAND */ + emmc_pins_default: emmc-pins-default { + mux { +- function = "emmc", "emmc_rst"; +- groups = "emmc"; ++ function = "emmc"; ++ groups = "emmc", "emmc_rst"; + }; + + /* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7", +diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi +index 88fca67dead018..13757d7ac792aa 100644 +--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi ++++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi +@@ -169,21 +169,24 @@ anx_bridge: anx7625@58 { + vdd18-supply = <&pp1800_mipibrdg>; + vdd33-supply = <&vddio_mipibrdg>; + +- #address-cells = <1>; +- #size-cells = <0>; +- port@0 { +- reg = <0>; ++ ports { ++ #address-cells = <1>; ++ #size-cells = <0>; + +- anx7625_in: endpoint { +- remote-endpoint = <&dsi_out>; ++ port@0 { ++ reg = <0>; ++ ++ anx7625_in: endpoint { ++ remote-endpoint = <&dsi_out>; ++ }; + }; +- }; + +- port@1 { +- reg = <1>; ++ port@1 { ++ reg = <1>; + +- anx7625_out: endpoint { +- remote-endpoint = <&panel_in>; ++ anx7625_out: endpoint { ++ remote-endpoint = <&panel_in>; ++ }; + }; + }; + }; +diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi +index 22a1c66325c29e..5e77f3b1b84be5 100644 +--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi ++++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi +@@ -703,7 +703,6 @@ pins-tx { + }; + pins-rts { + pinmux = <PINMUX_GPIO47__FUNC_URTS1>; +- output-enable; + }; + pins-cts { + pinmux = <PINMUX_GPIO46__FUNC_UCTS1>; +@@ -722,7 +721,6 @@ pins-tx { + }; + pins-rts { + pinmux = <PINMUX_GPIO47__FUNC_URTS1>; +- output-enable; + }; + pins-cts { + pinmux = <PINMUX_GPIO46__FUNC_UCTS1>; +diff --git a/arch/arm64/boot/dts/qcom/ipq8074.dtsi b/arch/arm64/boot/dts/qcom/ipq8074.dtsi +index 17eeff106bab74..384904344baf0c 100644 +--- a/arch/arm64/boot/dts/qcom/ipq8074.dtsi ++++ b/arch/arm64/boot/dts/qcom/ipq8074.dtsi +@@ -91,7 +91,6 @@ soc: soc { + ssphy_1: phy@58000 { + compatible = "qcom,ipq8074-qmp-usb3-phy"; + reg = <0x00058000 0x1c4>; +- #clock-cells = <1>; + #address-cells = <1>; + #size-cells = <1>; + ranges; +@@ -112,6 +111,7 @@ usb1_ssphy: phy@58200 { + <0x00058800 0x1f8>, /* PCS */ + <0x00058600 0x044>; /* PCS misc*/ + #phy-cells = <0>; ++ #clock-cells = <1>; + clocks = <&gcc GCC_USB1_PIPE_CLK>; + clock-names = "pipe0"; + clock-output-names = "usb3phy_1_cc_pipe_clk"; +@@ -134,7 +134,6 @@ qusb_phy_1: phy@59000 { + ssphy_0: phy@78000 { + compatible = "qcom,ipq8074-qmp-usb3-phy"; + reg = <0x00078000 0x1c4>; +- #clock-cells = <1>; + #address-cells = <1>; + #size-cells = <1>; + ranges; +@@ -155,6 +154,7 @@ usb0_ssphy: phy@78200 { + <0x00078800 0x1f8>, /* PCS */ + <0x00078600 0x044>; /* PCS misc*/ + #phy-cells = <0>; ++ #clock-cells = <1>; + clocks = <&gcc GCC_USB0_PIPE_CLK>; + clock-names = "pipe0"; + clock-output-names = "usb3phy_0_cc_pipe_clk"; +@@ -514,6 +514,7 @@ dwc_0: dwc3@8a00000 { + interrupts = <GIC_SPI 140 IRQ_TYPE_LEVEL_HIGH>; + phys = <&qusb_phy_0>, <&usb0_ssphy>; + phy-names = "usb2-phy", "usb3-phy"; ++ snps,parkmode-disable-ss-quirk; + snps,is-utmi-l1-suspend; + snps,hird-threshold = /bits/ 8 <0x0>; + snps,dis_u2_susphy_quirk; +@@ -554,6 +555,7 @@ dwc_1: dwc3@8c00000 { + interrupts = <GIC_SPI 99 IRQ_TYPE_LEVEL_HIGH>; + phys = <&qusb_phy_1>, <&usb1_ssphy>; + phy-names = "usb2-phy", "usb3-phy"; ++ snps,parkmode-disable-ss-quirk; + snps,is-utmi-l1-suspend; + snps,hird-threshold = /bits/ 8 <0x0>; + snps,dis_u2_susphy_quirk; +diff --git a/arch/arm64/boot/dts/qcom/msm8996.dtsi b/arch/arm64/boot/dts/qcom/msm8996.dtsi +index 8b3e753c1a2a14..9ee8eebfcdb519 100644 +--- a/arch/arm64/boot/dts/qcom/msm8996.dtsi ++++ b/arch/arm64/boot/dts/qcom/msm8996.dtsi +@@ -615,7 +615,6 @@ soc: soc { + pcie_phy: phy@34000 { + compatible = "qcom,msm8996-qmp-pcie-phy"; + reg = <0x00034000 0x488>; +- #clock-cells = <1>; + #address-cells = <1>; + #size-cells = <1>; + ranges; +@@ -637,6 +636,7 @@ pciephy_0: phy@35000 { + <0x00035400 0x1dc>; + #phy-cells = <0>; + ++ #clock-cells = <0>; + clock-output-names = "pcie_0_pipe_clk_src"; + clocks = <&gcc GCC_PCIE_0_PIPE_CLK>; + clock-names = "pipe0"; +@@ -650,6 +650,7 @@ pciephy_1: phy@36000 { + <0x00036400 0x1dc>; + #phy-cells = <0>; + ++ #clock-cells = <0>; + clock-output-names = "pcie_1_pipe_clk_src"; + clocks = <&gcc GCC_PCIE_1_PIPE_CLK>; + clock-names = "pipe1"; +@@ -663,6 +664,7 @@ pciephy_2: phy@37000 { + <0x00037400 0x1dc>; + #phy-cells = <0>; + ++ #clock-cells = <0>; + clock-output-names = "pcie_2_pipe_clk_src"; + clocks = <&gcc GCC_PCIE_2_PIPE_CLK>; + clock-names = "pipe2"; +@@ -1756,7 +1758,7 @@ ufshc: ufshc@624000 { + <&gcc GCC_UFS_RX_SYMBOL_0_CLK>; + freq-table-hz = + <100000000 200000000>, +- <0 0>, ++ <100000000 200000000>, + <0 0>, + <0 0>, + <0 0>, +@@ -2642,7 +2644,6 @@ usb3_dwc3: dwc3@6a00000 { + usb3phy: phy@7410000 { + compatible = "qcom,msm8996-qmp-usb3-phy"; + reg = <0x07410000 0x1c4>; +- #clock-cells = <1>; + #address-cells = <1>; + #size-cells = <1>; + ranges; +@@ -2663,6 +2664,7 @@ ssusb_phy_0: phy@7410200 { + <0x07410600 0x1a8>; + #phy-cells = <0>; + ++ #clock-cells = <0>; + clock-output-names = "usb3_phy_pipe_clk_src"; + clocks = <&gcc GCC_USB3_PHY_PIPE_CLK>; + clock-names = "pipe0"; +diff --git a/arch/arm64/boot/dts/qcom/msm8998.dtsi b/arch/arm64/boot/dts/qcom/msm8998.dtsi +index d636718adbde29..8ca6a6f1a541da 100644 +--- a/arch/arm64/boot/dts/qcom/msm8998.dtsi ++++ b/arch/arm64/boot/dts/qcom/msm8998.dtsi +@@ -1982,7 +1982,8 @@ usb3_dwc3: dwc3@a800000 { + interrupts = <GIC_SPI 131 IRQ_TYPE_LEVEL_HIGH>; + snps,dis_u2_susphy_quirk; + snps,dis_enblslpm_quirk; +- phys = <&qusb2phy>, <&usb1_ssphy>; ++ snps,parkmode-disable-ss-quirk; ++ phys = <&qusb2phy>, <&usb3phy>; + phy-names = "usb2-phy", "usb3-phy"; + snps,has-lpm-erratum; + snps,hird-threshold = /bits/ 8 <0x10>; +@@ -1991,33 +1992,26 @@ usb3_dwc3: dwc3@a800000 { + + usb3phy: phy@c010000 { + compatible = "qcom,msm8998-qmp-usb3-phy"; +- reg = <0x0c010000 0x18c>; +- status = "disabled"; +- #clock-cells = <1>; +- #address-cells = <1>; +- #size-cells = <1>; +- ranges; ++ reg = <0x0c010000 0x1000>; + + clocks = <&gcc GCC_USB3_PHY_AUX_CLK>, ++ <&gcc GCC_USB3_CLKREF_CLK>, + <&gcc GCC_USB_PHY_CFG_AHB2PHY_CLK>, +- <&gcc GCC_USB3_CLKREF_CLK>; +- clock-names = "aux", "cfg_ahb", "ref"; ++ <&gcc GCC_USB3_PHY_PIPE_CLK>; ++ clock-names = "aux", ++ "ref", ++ "cfg_ahb", ++ "pipe"; ++ clock-output-names = "usb3_phy_pipe_clk_src"; ++ #clock-cells = <0>; ++ #phy-cells = <0>; + + resets = <&gcc GCC_USB3_PHY_BCR>, + <&gcc GCC_USB3PHY_PHY_BCR>; +- reset-names = "phy", "common"; ++ reset-names = "phy", ++ "phy_phy"; + +- usb1_ssphy: phy@c010200 { +- reg = <0xc010200 0x128>, +- <0xc010400 0x200>, +- <0xc010c00 0x20c>, +- <0xc010600 0x128>, +- <0xc010800 0x200>; +- #phy-cells = <0>; +- clocks = <&gcc GCC_USB3_PHY_PIPE_CLK>; +- clock-names = "pipe0"; +- clock-output-names = "usb3_phy_pipe_clk_src"; +- }; ++ status = "disabled"; + }; + + qusb2phy: phy@c012000 { +diff --git a/arch/arm64/boot/dts/qcom/sdm845.dtsi b/arch/arm64/boot/dts/qcom/sdm845.dtsi +index 6f7061c878e4a8..cff5423e9c88dc 100644 +--- a/arch/arm64/boot/dts/qcom/sdm845.dtsi ++++ b/arch/arm64/boot/dts/qcom/sdm845.dtsi +@@ -2299,6 +2299,8 @@ ufs_mem_phy: phy@1d87000 { + clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>, + <&gcc GCC_UFS_PHY_PHY_AUX_CLK>; + ++ power-domains = <&gcc UFS_PHY_GDSC>; ++ + resets = <&ufs_mem_hc 0>; + reset-names = "ufsphy"; + status = "disabled"; +diff --git a/arch/arm64/boot/dts/qcom/sm8250.dtsi b/arch/arm64/boot/dts/qcom/sm8250.dtsi +index 8880e9cbc97435..5f504569731a99 100644 +--- a/arch/arm64/boot/dts/qcom/sm8250.dtsi ++++ b/arch/arm64/boot/dts/qcom/sm8250.dtsi +@@ -1702,7 +1702,7 @@ ufs_mem_hc: ufshc@1d84000 { + "jedec,ufs-2.0"; + reg = <0 0x01d84000 0 0x3000>; + interrupts = <GIC_SPI 265 IRQ_TYPE_LEVEL_HIGH>; +- phys = <&ufs_mem_phy_lanes>; ++ phys = <&ufs_mem_phy>; + phy-names = "ufsphy"; + lanes-per-direction = <2>; + #reset-cells = <1>; +@@ -1746,10 +1746,8 @@ ufs_mem_hc: ufshc@1d84000 { + + ufs_mem_phy: phy@1d87000 { + compatible = "qcom,sm8250-qmp-ufs-phy"; +- reg = <0 0x01d87000 0 0x1c0>; +- #address-cells = <2>; +- #size-cells = <2>; +- ranges; ++ reg = <0 0x01d87000 0 0x1000>; ++ + clock-names = "ref", + "ref_aux"; + clocks = <&rpmhcc RPMH_CXO_CLK>, +@@ -1757,16 +1755,12 @@ ufs_mem_phy: phy@1d87000 { + + resets = <&ufs_mem_hc 0>; + reset-names = "ufsphy"; +- status = "disabled"; + +- ufs_mem_phy_lanes: phy@1d87400 { +- reg = <0 0x01d87400 0 0x16c>, +- <0 0x01d87600 0 0x200>, +- <0 0x01d87c00 0 0x200>, +- <0 0x01d87800 0 0x16c>, +- <0 0x01d87a00 0 0x200>; +- #phy-cells = <0>; +- }; ++ power-domains = <&gcc UFS_PHY_GDSC>; ++ ++ #phy-cells = <0>; ++ ++ status = "disabled"; + }; + + ipa_virt: interconnect@1e00000 { +diff --git a/arch/arm64/boot/dts/qcom/sm8350.dtsi b/arch/arm64/boot/dts/qcom/sm8350.dtsi +index b0ba63b5869d20..8506dc841c8690 100644 +--- a/arch/arm64/boot/dts/qcom/sm8350.dtsi ++++ b/arch/arm64/boot/dts/qcom/sm8350.dtsi +@@ -1119,7 +1119,6 @@ ufs_mem_phy: phy@1d87000 { + reg = <0 0x01d87000 0 0x1c4>; + #address-cells = <2>; + #size-cells = <2>; +- #clock-cells = <1>; + ranges; + clock-names = "ref", + "ref_aux"; +@@ -1254,7 +1253,6 @@ usb_1_qmpphy: phy-wrapper@88e9000 { + <0 0x088e8000 0 0x20>; + reg-names = "reg-base", "dp_com"; + status = "disabled"; +- #clock-cells = <1>; + #address-cells = <2>; + #size-cells = <2>; + ranges; +@@ -1287,7 +1285,6 @@ usb_2_qmpphy: phy-wrapper@88eb000 { + compatible = "qcom,sm8350-qmp-usb3-uni-phy"; + reg = <0 0x088eb000 0 0x200>; + status = "disabled"; +- #clock-cells = <1>; + #address-cells = <2>; + #size-cells = <2>; + ranges; +diff --git a/arch/arm64/boot/dts/rockchip/rk3328.dtsi b/arch/arm64/boot/dts/rockchip/rk3328.dtsi +index 26f02cc70dc5dc..21755dd5b4c45e 100644 +--- a/arch/arm64/boot/dts/rockchip/rk3328.dtsi ++++ b/arch/arm64/boot/dts/rockchip/rk3328.dtsi +@@ -807,8 +807,8 @@ cru: clock-controller@ff440000 { + <0>, <24000000>, + <24000000>, <24000000>, + <15000000>, <15000000>, +- <100000000>, <100000000>, +- <100000000>, <100000000>, ++ <300000000>, <100000000>, ++ <400000000>, <100000000>, + <50000000>, <100000000>, + <100000000>, <100000000>, + <50000000>, <50000000>, +diff --git a/arch/arm64/include/asm/barrier.h b/arch/arm64/include/asm/barrier.h +index 1c5a005984582e..6e3f4eea1f34d3 100644 +--- a/arch/arm64/include/asm/barrier.h ++++ b/arch/arm64/include/asm/barrier.h +@@ -26,6 +26,10 @@ + #define __tsb_csync() asm volatile("hint #18" : : : "memory") + #define csdb() asm volatile("hint #20" : : : "memory") + ++#define spec_bar() asm volatile(ALTERNATIVE("dsb nsh\nisb\n", \ ++ SB_BARRIER_INSN"nop\n", \ ++ ARM64_HAS_SB)) ++ + #ifdef CONFIG_ARM64_PSEUDO_NMI + #define pmr_sync() \ + do { \ +diff --git a/arch/arm64/include/asm/cputype.h b/arch/arm64/include/asm/cputype.h +index 3656bbbb7c7b6b..59f135b280a8a6 100644 +--- a/arch/arm64/include/asm/cputype.h ++++ b/arch/arm64/include/asm/cputype.h +@@ -85,6 +85,14 @@ + #define ARM_CPU_PART_CORTEX_X2 0xD48 + #define ARM_CPU_PART_NEOVERSE_N2 0xD49 + #define ARM_CPU_PART_CORTEX_A78C 0xD4B ++#define ARM_CPU_PART_CORTEX_X1C 0xD4C ++#define ARM_CPU_PART_CORTEX_X3 0xD4E ++#define ARM_CPU_PART_NEOVERSE_V2 0xD4F ++#define ARM_CPU_PART_CORTEX_A720 0xD81 ++#define ARM_CPU_PART_CORTEX_X4 0xD82 ++#define ARM_CPU_PART_NEOVERSE_V3 0xD84 ++#define ARM_CPU_PART_CORTEX_X925 0xD85 ++#define ARM_CPU_PART_CORTEX_A725 0xD87 + + #define APM_CPU_PART_POTENZA 0x000 + +@@ -139,6 +147,14 @@ + #define MIDR_CORTEX_X2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X2) + #define MIDR_NEOVERSE_N2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_N2) + #define MIDR_CORTEX_A78C MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_A78C) ++#define MIDR_CORTEX_X1C MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X1C) ++#define MIDR_CORTEX_X3 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X3) ++#define MIDR_NEOVERSE_V2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_V2) ++#define MIDR_CORTEX_A720 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_A720) ++#define MIDR_CORTEX_X4 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X4) ++#define MIDR_NEOVERSE_V3 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_V3) ++#define MIDR_CORTEX_X925 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X925) ++#define MIDR_CORTEX_A725 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_A725) + #define MIDR_THUNDERX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX) + #define MIDR_THUNDERX_81XX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX_81XX) + #define MIDR_THUNDERX_83XX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX_83XX) +diff --git a/arch/arm64/kernel/cpu_errata.c b/arch/arm64/kernel/cpu_errata.c +index 4f12d8c1e55b9a..c358bc1c2954e0 100644 +--- a/arch/arm64/kernel/cpu_errata.c ++++ b/arch/arm64/kernel/cpu_errata.c +@@ -402,6 +402,30 @@ static struct midr_range trbe_write_out_of_range_cpus[] = { + }; + #endif /* CONFIG_ARM64_WORKAROUND_TRBE_WRITE_OUT_OF_RANGE */ + ++#ifdef CONFIG_ARM64_ERRATUM_3194386 ++static const struct midr_range erratum_spec_ssbs_list[] = { ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_A76), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_A77), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_A78), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_A78C), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_A710), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_A720), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_A725), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_X1), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_X1C), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_X2), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_X3), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_X4), ++ MIDR_ALL_VERSIONS(MIDR_CORTEX_X925), ++ MIDR_ALL_VERSIONS(MIDR_NEOVERSE_N1), ++ MIDR_ALL_VERSIONS(MIDR_NEOVERSE_N2), ++ MIDR_ALL_VERSIONS(MIDR_NEOVERSE_V1), ++ MIDR_ALL_VERSIONS(MIDR_NEOVERSE_V2), ++ MIDR_ALL_VERSIONS(MIDR_NEOVERSE_V3), ++ {} ++}; ++#endif ++ + const struct arm64_cpu_capabilities arm64_errata[] = { + #ifdef CONFIG_ARM64_WORKAROUND_CLEAN_CACHE + { +@@ -648,6 +672,13 @@ const struct arm64_cpu_capabilities arm64_errata[] = { + .type = ARM64_CPUCAP_WEAK_LOCAL_CPU_FEATURE, + CAP_MIDR_RANGE_LIST(trbe_write_out_of_range_cpus), + }, ++#endif ++#ifdef CONFIG_ARM64_ERRATUM_3194386 ++ { ++ .desc = "SSBS not fully self-synchronizing", ++ .capability = ARM64_WORKAROUND_SPECULATIVE_SSBS, ++ ERRATA_MIDR_RANGE_LIST(erratum_spec_ssbs_list), ++ }, + #endif + { + } +diff --git a/arch/arm64/kernel/cpufeature.c b/arch/arm64/kernel/cpufeature.c +index f17d6cdea26059..e9d1e429456f12 100644 +--- a/arch/arm64/kernel/cpufeature.c ++++ b/arch/arm64/kernel/cpufeature.c +@@ -422,6 +422,30 @@ static const struct arm64_ftr_bits ftr_id_aa64dfr0[] = { + ARM64_FTR_END, + }; + ++static const struct arm64_ftr_bits ftr_mvfr0[] = { ++ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPROUND_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPSHVEC_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPSQRT_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPDIVIDE_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPTRAP_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPDP_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPSP_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_SIMD_SHIFT, 4, 0), ++ ARM64_FTR_END, ++}; ++ ++static const struct arm64_ftr_bits ftr_mvfr1[] = { ++ ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDFMAC_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_FPHP_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDHP_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDSP_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDINT_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDLS_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_FPDNAN_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_FPFTZ_SHIFT, 4, 0), ++ ARM64_FTR_END, ++}; ++ + static const struct arm64_ftr_bits ftr_mvfr2[] = { + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR2_FPMISC_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR2_SIMDMISC_SHIFT, 4, 0), +@@ -452,10 +476,10 @@ static const struct arm64_ftr_bits ftr_id_isar0[] = { + + static const struct arm64_ftr_bits ftr_id_isar5[] = { + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_RDM_SHIFT, 4, 0), +- ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_CRC32_SHIFT, 4, 0), +- ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA2_SHIFT, 4, 0), +- ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA1_SHIFT, 4, 0), +- ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_AES_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_CRC32_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA2_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA1_SHIFT, 4, 0), ++ ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_AES_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SEVL_SHIFT, 4, 0), + ARM64_FTR_END, + }; +@@ -562,7 +586,7 @@ static const struct arm64_ftr_bits ftr_zcr[] = { + * Common ftr bits for a 32bit register with all hidden, strict + * attributes, with 4bit feature fields and a default safe value of + * 0. Covers the following 32bit registers: +- * id_isar[1-4], id_mmfr[1-3], id_pfr1, mvfr[0-1] ++ * id_isar[1-3], id_mmfr[1-3] + */ + static const struct arm64_ftr_bits ftr_generic_32bits[] = { + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, 28, 4, 0), +@@ -629,8 +653,8 @@ static const struct __ftr_reg_entry { + ARM64_FTR_REG(SYS_ID_ISAR6_EL1, ftr_id_isar6), + + /* Op1 = 0, CRn = 0, CRm = 3 */ +- ARM64_FTR_REG(SYS_MVFR0_EL1, ftr_generic_32bits), +- ARM64_FTR_REG(SYS_MVFR1_EL1, ftr_generic_32bits), ++ ARM64_FTR_REG(SYS_MVFR0_EL1, ftr_mvfr0), ++ ARM64_FTR_REG(SYS_MVFR1_EL1, ftr_mvfr1), + ARM64_FTR_REG(SYS_MVFR2_EL1, ftr_mvfr2), + ARM64_FTR_REG(SYS_ID_PFR2_EL1, ftr_id_pfr2), + ARM64_FTR_REG(SYS_ID_DFR1_EL1, ftr_id_dfr1), +@@ -1319,20 +1343,42 @@ feature_matches(u64 reg, const struct arm64_cpu_capabilities *entry) + return val >= entry->min_field_value; + } + +-static bool +-has_cpuid_feature(const struct arm64_cpu_capabilities *entry, int scope) ++static u64 ++read_scoped_sysreg(const struct arm64_cpu_capabilities *entry, int scope) + { +- u64 val; +- + WARN_ON(scope == SCOPE_LOCAL_CPU && preemptible()); + if (scope == SCOPE_SYSTEM) +- val = read_sanitised_ftr_reg(entry->sys_reg); ++ return read_sanitised_ftr_reg(entry->sys_reg); + else +- val = __read_sysreg_by_encoding(entry->sys_reg); ++ return __read_sysreg_by_encoding(entry->sys_reg); ++} ++ ++static bool ++has_user_cpuid_feature(const struct arm64_cpu_capabilities *entry, int scope) ++{ ++ int mask; ++ struct arm64_ftr_reg *regp; ++ u64 val = read_scoped_sysreg(entry, scope); ++ ++ regp = get_arm64_ftr_reg(entry->sys_reg); ++ if (!regp) ++ return false; ++ ++ mask = cpuid_feature_extract_unsigned_field(regp->user_mask, ++ entry->field_pos); ++ if (!mask) ++ return false; + + return feature_matches(val, entry); + } + ++static bool ++has_cpuid_feature(const struct arm64_cpu_capabilities *entry, int scope) ++{ ++ u64 val = read_scoped_sysreg(entry, scope); ++ return feature_matches(val, entry); ++} ++ + const struct cpumask *system_32bit_el0_cpumask(void) + { + if (!system_supports_32bit_el0()) +@@ -1917,6 +1963,17 @@ static void cpu_enable_mte(struct arm64_cpu_capabilities const *cap) + } + #endif /* CONFIG_ARM64_MTE */ + ++static void user_feature_fixup(void) ++{ ++ if (cpus_have_cap(ARM64_WORKAROUND_SPECULATIVE_SSBS)) { ++ struct arm64_ftr_reg *regp; ++ ++ regp = get_arm64_ftr_reg(SYS_ID_AA64PFR1_EL1); ++ if (regp) ++ regp->user_mask &= ~GENMASK(7, 4); /* SSBS */ ++ } ++} ++ + static void elf_hwcap_fixup(void) + { + #ifdef CONFIG_ARM64_ERRATUM_1742098 +@@ -2376,7 +2433,7 @@ static const struct arm64_cpu_capabilities arm64_features[] = { + }; + + #define HWCAP_CPUID_MATCH(reg, field, s, min_value) \ +- .matches = has_cpuid_feature, \ ++ .matches = has_user_cpuid_feature, \ + .sys_reg = reg, \ + .field_pos = field, \ + .sign = s, \ +@@ -2950,6 +3007,7 @@ void __init setup_cpu_features(void) + u32 cwg; + + setup_system_capabilities(); ++ user_feature_fixup(); + setup_elf_hwcaps(arm64_elf_hwcaps); + + if (system_supports_32bit_el0()) { +@@ -3034,7 +3092,7 @@ static void __maybe_unused cpu_enable_cnp(struct arm64_cpu_capabilities const *c + + /* + * We emulate only the following system register space. +- * Op0 = 0x3, CRn = 0x0, Op1 = 0x0, CRm = [0, 4 - 7] ++ * Op0 = 0x3, CRn = 0x0, Op1 = 0x0, CRm = [0, 2 - 7] + * See Table C5-6 System instruction encodings for System register accesses, + * ARMv8 ARM(ARM DDI 0487A.f) for more details. + */ +@@ -3044,7 +3102,7 @@ static inline bool __attribute_const__ is_emulated(u32 id) + sys_reg_CRn(id) == 0x0 && + sys_reg_Op1(id) == 0x0 && + (sys_reg_CRm(id) == 0 || +- ((sys_reg_CRm(id) >= 4) && (sys_reg_CRm(id) <= 7)))); ++ ((sys_reg_CRm(id) >= 2) && (sys_reg_CRm(id) <= 7)))); + } + + /* +diff --git a/arch/arm64/kernel/proton-pack.c b/arch/arm64/kernel/proton-pack.c +index 7515ed1f0669a2..ebce46c4e942c6 100644 +--- a/arch/arm64/kernel/proton-pack.c ++++ b/arch/arm64/kernel/proton-pack.c +@@ -558,6 +558,18 @@ static enum mitigation_state spectre_v4_enable_hw_mitigation(void) + + /* SCTLR_EL1.DSSBS was initialised to 0 during boot */ + set_pstate_ssbs(0); ++ ++ /* ++ * SSBS is self-synchronizing and is intended to affect subsequent ++ * speculative instructions, but some CPUs can speculate with a stale ++ * value of SSBS. ++ * ++ * Mitigate this with an unconditional speculation barrier, as CPUs ++ * could mis-speculate branches and bypass a conditional barrier. ++ */ ++ if (IS_ENABLED(CONFIG_ARM64_ERRATUM_3194386)) ++ spec_bar(); ++ + return SPECTRE_MITIGATED; + } + +diff --git a/arch/arm64/tools/cpucaps b/arch/arm64/tools/cpucaps +index fcaeec5a51258e..e7f4ae17f31b00 100644 +--- a/arch/arm64/tools/cpucaps ++++ b/arch/arm64/tools/cpucaps +@@ -70,3 +70,4 @@ WORKAROUND_NVIDIA_CARMEL_CNP + WORKAROUND_QCOM_FALKOR_E1003 + WORKAROUND_REPEAT_TLBI + WORKAROUND_SPECULATIVE_AT ++WORKAROUND_SPECULATIVE_SSBS +diff --git a/arch/m68k/amiga/config.c b/arch/m68k/amiga/config.c +index be2dfab48fd429..ed54c55c69349a 100644 +--- a/arch/m68k/amiga/config.c ++++ b/arch/m68k/amiga/config.c +@@ -179,6 +179,15 @@ int __init amiga_parse_bootinfo(const struct bi_record *record) + dev->slotsize = be16_to_cpu(cd->cd_SlotSize); + dev->boardaddr = be32_to_cpu(cd->cd_BoardAddr); + dev->boardsize = be32_to_cpu(cd->cd_BoardSize); ++ ++ /* CS-LAB Warp 1260 workaround */ ++ if (be16_to_cpu(dev->rom.er_Manufacturer) == ZORRO_MANUF(ZORRO_PROD_CSLAB_WARP_1260) && ++ dev->rom.er_Product == ZORRO_PROD(ZORRO_PROD_CSLAB_WARP_1260)) { ++ ++ /* turn off all interrupts */ ++ pr_info("Warp 1260 card detected: applying interrupt storm workaround\n"); ++ *(uint32_t *)(dev->boardaddr + 0x1000) = 0xfff; ++ } + } else + pr_warn("amiga_parse_bootinfo: too many AutoConfig devices\n"); + #endif /* CONFIG_ZORRO */ +diff --git a/arch/m68k/atari/ataints.c b/arch/m68k/atari/ataints.c +index 56f02ea2c248d8..715d1e0d973e61 100644 +--- a/arch/m68k/atari/ataints.c ++++ b/arch/m68k/atari/ataints.c +@@ -302,11 +302,7 @@ void __init atari_init_IRQ(void) + + if (ATARIHW_PRESENT(SCU)) { + /* init the SCU if present */ +- tt_scu.sys_mask = 0x10; /* enable VBL (for the cursor) and +- * disable HSYNC interrupts (who +- * needs them?) MFP and SCC are +- * enabled in VME mask +- */ ++ tt_scu.sys_mask = 0x0; /* disable all interrupts */ + tt_scu.vme_mask = 0x60; /* enable MFP and SCC ints */ + } else { + /* If no SCU and no Hades, the HSYNC interrupt needs to be +diff --git a/arch/m68k/include/asm/cmpxchg.h b/arch/m68k/include/asm/cmpxchg.h +index e8ca4b0ccefaa8..9765910d0ad278 100644 +--- a/arch/m68k/include/asm/cmpxchg.h ++++ b/arch/m68k/include/asm/cmpxchg.h +@@ -33,7 +33,7 @@ static inline unsigned long __xchg(unsigned long x, volatile void * ptr, int siz + x = tmp; + break; + default: +- tmp = __invalid_xchg_size(x, ptr, size); ++ x = __invalid_xchg_size(x, ptr, size); + break; + } + +diff --git a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi +index d73d8f4fd78e60..f3fad477ddce2a 100644 +--- a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi ++++ b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi +@@ -23,14 +23,6 @@ cpu0: cpu@0 { + }; + }; + +- memory@200000 { +- compatible = "memory"; +- device_type = "memory"; +- reg = <0x00000000 0x00200000 0x00000000 0x0ee00000>, /* 238 MB at 2 MB */ +- <0x00000000 0x20000000 0x00000000 0x1f000000>, /* 496 MB at 512 MB */ +- <0x00000001 0x10000000 0x00000001 0xb0000000>; /* 6912 MB at 4352MB */ +- }; +- + cpu_clk: cpu_clk { + #clock-cells = <0>; + compatible = "fixed-clock"; +@@ -92,12 +84,19 @@ liointc1: interrupt-controller@1fe11440 { + <0x00000000>; /* int3 */ + }; + ++ rtc0: rtc@1fe07800 { ++ compatible = "loongson,ls2k1000-rtc"; ++ reg = <0 0x1fe07800 0 0x78>; ++ interrupt-parent = <&liointc1>; ++ interrupts = <8 IRQ_TYPE_LEVEL_HIGH>; ++ }; ++ + uart0: serial@1fe00000 { + compatible = "ns16550a"; + reg = <0 0x1fe00000 0 0x8>; + clock-frequency = <125000000>; + interrupt-parent = <&liointc0>; +- interrupts = <0 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <0 IRQ_TYPE_LEVEL_HIGH>; + no-loopback-test; + }; + +@@ -106,7 +105,6 @@ pci@1a000000 { + device_type = "pci"; + #address-cells = <3>; + #size-cells = <2>; +- #interrupt-cells = <2>; + + reg = <0 0x1a000000 0 0x02000000>, + <0xfe 0x00000000 0 0x20000000>; +@@ -121,11 +119,12 @@ gmac@3,0 { + "pciclass0c03"; + + reg = <0x1800 0x0 0x0 0x0 0x0>; +- interrupts = <12 IRQ_TYPE_LEVEL_LOW>, +- <13 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <12 IRQ_TYPE_LEVEL_HIGH>, ++ <13 IRQ_TYPE_LEVEL_HIGH>; + interrupt-names = "macirq", "eth_lpi"; + interrupt-parent = <&liointc0>; +- phy-mode = "rgmii"; ++ phy-mode = "rgmii-id"; ++ phy-handle = <&phy1>; + mdio { + #address-cells = <1>; + #size-cells = <0>; +@@ -144,11 +143,12 @@ gmac@3,1 { + "loongson, pci-gmac"; + + reg = <0x1900 0x0 0x0 0x0 0x0>; +- interrupts = <14 IRQ_TYPE_LEVEL_LOW>, +- <15 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <14 IRQ_TYPE_LEVEL_HIGH>, ++ <15 IRQ_TYPE_LEVEL_HIGH>; + interrupt-names = "macirq", "eth_lpi"; + interrupt-parent = <&liointc0>; +- phy-mode = "rgmii"; ++ phy-mode = "rgmii-id"; ++ phy-handle = <&phy1>; + mdio { + #address-cells = <1>; + #size-cells = <0>; +@@ -166,7 +166,7 @@ ehci@4,1 { + "pciclass0c03"; + + reg = <0x2100 0x0 0x0 0x0 0x0>; +- interrupts = <18 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <18 IRQ_TYPE_LEVEL_HIGH>; + interrupt-parent = <&liointc1>; + }; + +@@ -177,7 +177,7 @@ ohci@4,2 { + "pciclass0c03"; + + reg = <0x2200 0x0 0x0 0x0 0x0>; +- interrupts = <19 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <19 IRQ_TYPE_LEVEL_HIGH>; + interrupt-parent = <&liointc1>; + }; + +@@ -188,97 +188,121 @@ sata@8,0 { + "pciclass0106"; + + reg = <0x4000 0x0 0x0 0x0 0x0>; +- interrupts = <19 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <19 IRQ_TYPE_LEVEL_HIGH>; + interrupt-parent = <&liointc0>; + }; + +- pci_bridge@9,0 { ++ pcie@9,0 { + compatible = "pci0014,7a19.0", + "pci0014,7a19", + "pciclass060400", + "pciclass0604"; + + reg = <0x4800 0x0 0x0 0x0 0x0>; ++ #address-cells = <3>; ++ #size-cells = <2>; ++ device_type = "pci"; + #interrupt-cells = <1>; +- interrupts = <0 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <0 IRQ_TYPE_LEVEL_HIGH>; + interrupt-parent = <&liointc1>; + interrupt-map-mask = <0 0 0 0>; +- interrupt-map = <0 0 0 0 &liointc1 0 IRQ_TYPE_LEVEL_LOW>; ++ interrupt-map = <0 0 0 0 &liointc1 0 IRQ_TYPE_LEVEL_HIGH>; ++ ranges; + external-facing; + }; + +- pci_bridge@a,0 { ++ pcie@a,0 { + compatible = "pci0014,7a09.0", + "pci0014,7a09", + "pciclass060400", + "pciclass0604"; + + reg = <0x5000 0x0 0x0 0x0 0x0>; ++ #address-cells = <3>; ++ #size-cells = <2>; ++ device_type = "pci"; + #interrupt-cells = <1>; +- interrupts = <1 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <1 IRQ_TYPE_LEVEL_HIGH>; + interrupt-parent = <&liointc1>; + interrupt-map-mask = <0 0 0 0>; +- interrupt-map = <0 0 0 0 &liointc1 1 IRQ_TYPE_LEVEL_LOW>; ++ interrupt-map = <0 0 0 0 &liointc1 1 IRQ_TYPE_LEVEL_HIGH>; ++ ranges; + external-facing; + }; + +- pci_bridge@b,0 { ++ pcie@b,0 { + compatible = "pci0014,7a09.0", + "pci0014,7a09", + "pciclass060400", + "pciclass0604"; + + reg = <0x5800 0x0 0x0 0x0 0x0>; ++ #address-cells = <3>; ++ #size-cells = <2>; ++ device_type = "pci"; + #interrupt-cells = <1>; +- interrupts = <2 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <2 IRQ_TYPE_LEVEL_HIGH>; + interrupt-parent = <&liointc1>; + interrupt-map-mask = <0 0 0 0>; +- interrupt-map = <0 0 0 0 &liointc1 2 IRQ_TYPE_LEVEL_LOW>; ++ interrupt-map = <0 0 0 0 &liointc1 2 IRQ_TYPE_LEVEL_HIGH>; ++ ranges; + external-facing; + }; + +- pci_bridge@c,0 { ++ pcie@c,0 { + compatible = "pci0014,7a09.0", + "pci0014,7a09", + "pciclass060400", + "pciclass0604"; + + reg = <0x6000 0x0 0x0 0x0 0x0>; ++ #address-cells = <3>; ++ #size-cells = <2>; ++ device_type = "pci"; + #interrupt-cells = <1>; +- interrupts = <3 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <3 IRQ_TYPE_LEVEL_HIGH>; + interrupt-parent = <&liointc1>; + interrupt-map-mask = <0 0 0 0>; +- interrupt-map = <0 0 0 0 &liointc1 3 IRQ_TYPE_LEVEL_LOW>; ++ interrupt-map = <0 0 0 0 &liointc1 3 IRQ_TYPE_LEVEL_HIGH>; ++ ranges; + external-facing; + }; + +- pci_bridge@d,0 { ++ pcie@d,0 { + compatible = "pci0014,7a19.0", + "pci0014,7a19", + "pciclass060400", + "pciclass0604"; + + reg = <0x6800 0x0 0x0 0x0 0x0>; ++ #address-cells = <3>; ++ #size-cells = <2>; ++ device_type = "pci"; + #interrupt-cells = <1>; +- interrupts = <4 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <4 IRQ_TYPE_LEVEL_HIGH>; + interrupt-parent = <&liointc1>; + interrupt-map-mask = <0 0 0 0>; +- interrupt-map = <0 0 0 0 &liointc1 4 IRQ_TYPE_LEVEL_LOW>; ++ interrupt-map = <0 0 0 0 &liointc1 4 IRQ_TYPE_LEVEL_HIGH>; ++ ranges; + external-facing; + }; + +- pci_bridge@e,0 { ++ pcie@e,0 { + compatible = "pci0014,7a09.0", + "pci0014,7a09", + "pciclass060400", + "pciclass0604"; + + reg = <0x7000 0x0 0x0 0x0 0x0>; ++ #address-cells = <3>; ++ #size-cells = <2>; ++ device_type = "pci"; + #interrupt-cells = <1>; +- interrupts = <5 IRQ_TYPE_LEVEL_LOW>; ++ interrupts = <5 IRQ_TYPE_LEVEL_HIGH>; + interrupt-parent = <&liointc1>; + interrupt-map-mask = <0 0 0 0>; +- interrupt-map = <0 0 0 0 &liointc1 5 IRQ_TYPE_LEVEL_LOW>; ++ interrupt-map = <0 0 0 0 &liointc1 5 IRQ_TYPE_LEVEL_HIGH>; ++ ranges; + external-facing; + }; + +diff --git a/arch/mips/include/asm/mach-loongson64/boot_param.h b/arch/mips/include/asm/mach-loongson64/boot_param.h +index e007edd6b60a7e..9218b3ae338322 100644 +--- a/arch/mips/include/asm/mach-loongson64/boot_param.h ++++ b/arch/mips/include/asm/mach-loongson64/boot_param.h +@@ -42,12 +42,14 @@ enum loongson_cpu_type { + Legacy_1B = 0x5, + Legacy_2G = 0x6, + Legacy_2H = 0x7, ++ Legacy_2K = 0x8, + Loongson_1A = 0x100, + Loongson_1B = 0x101, + Loongson_2E = 0x200, + Loongson_2F = 0x201, + Loongson_2G = 0x202, + Loongson_2H = 0x203, ++ Loongson_2K = 0x204, + Loongson_3A = 0x300, + Loongson_3B = 0x301 + }; +diff --git a/arch/mips/include/asm/mips-cm.h b/arch/mips/include/asm/mips-cm.h +index 23c67c0871b17c..696b40beb774f5 100644 +--- a/arch/mips/include/asm/mips-cm.h ++++ b/arch/mips/include/asm/mips-cm.h +@@ -228,6 +228,10 @@ GCR_ACCESSOR_RO(32, 0x0d0, gic_status) + GCR_ACCESSOR_RO(32, 0x0f0, cpc_status) + #define CM_GCR_CPC_STATUS_EX BIT(0) + ++/* GCR_ACCESS - Controls core/IOCU access to GCRs */ ++GCR_ACCESSOR_RW(32, 0x120, access_cm3) ++#define CM_GCR_ACCESS_ACCESSEN GENMASK(7, 0) ++ + /* GCR_L2_CONFIG - Indicates L2 cache configuration when Config5.L2C=1 */ + GCR_ACCESSOR_RW(32, 0x130, l2_config) + #define CM_GCR_L2_CONFIG_BYPASS BIT(20) +diff --git a/arch/mips/kernel/smp-cps.c b/arch/mips/kernel/smp-cps.c +index f2df0cae1b4d9f..7409d46ce31a86 100644 +--- a/arch/mips/kernel/smp-cps.c ++++ b/arch/mips/kernel/smp-cps.c +@@ -230,7 +230,10 @@ static void boot_core(unsigned int core, unsigned int vpe_id) + write_gcr_co_reset_ext_base(CM_GCR_Cx_RESET_EXT_BASE_UEB); + + /* Ensure the core can access the GCRs */ +- set_gcr_access(1 << core); ++ if (mips_cm_revision() < CM_REV_CM3) ++ set_gcr_access(1 << core); ++ else ++ set_gcr_access_cm3(1 << core); + + if (mips_cpc_present()) { + /* Reset the core */ +diff --git a/arch/mips/loongson64/env.c b/arch/mips/loongson64/env.c +index ef3750a6ffacf8..09ff052698614d 100644 +--- a/arch/mips/loongson64/env.c ++++ b/arch/mips/loongson64/env.c +@@ -88,6 +88,12 @@ void __init prom_lefi_init_env(void) + cpu_clock_freq = ecpu->cpu_clock_freq; + loongson_sysconf.cputype = ecpu->cputype; + switch (ecpu->cputype) { ++ case Legacy_2K: ++ case Loongson_2K: ++ smp_group[0] = 0x900000001fe11000; ++ loongson_sysconf.cores_per_node = 2; ++ loongson_sysconf.cores_per_package = 2; ++ break; + case Legacy_3A: + case Loongson_3A: + loongson_sysconf.cores_per_node = 4; +@@ -221,6 +227,8 @@ void __init prom_lefi_init_env(void) + default: + break; + } ++ } else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64R) { ++ loongson_fdt_blob = __dtb_loongson64_2core_2k1000_begin; + } else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64G) { + if (loongson_sysconf.bridgetype == LS7A) + loongson_fdt_blob = __dtb_loongson64g_4core_ls7a_begin; +diff --git a/arch/mips/loongson64/reset.c b/arch/mips/loongson64/reset.c +index e420800043b089..2a8e4cd72605d0 100644 +--- a/arch/mips/loongson64/reset.c ++++ b/arch/mips/loongson64/reset.c +@@ -11,6 +11,7 @@ + #include <linux/init.h> + #include <linux/kexec.h> + #include <linux/pm.h> ++#include <linux/reboot.h> + #include <linux/slab.h> + + #include <asm/bootinfo.h> +@@ -21,36 +22,21 @@ + #include <loongson.h> + #include <boot_param.h> + +-static void loongson_restart(char *command) ++static int firmware_restart(struct sys_off_data *unusedd) + { + + void (*fw_restart)(void) = (void *)loongson_sysconf.restart_addr; + + fw_restart(); +- while (1) { +- if (cpu_wait) +- cpu_wait(); +- } ++ return NOTIFY_DONE; + } + +-static void loongson_poweroff(void) ++static int firmware_poweroff(struct sys_off_data *unused) + { + void (*fw_poweroff)(void) = (void *)loongson_sysconf.poweroff_addr; + + fw_poweroff(); +- while (1) { +- if (cpu_wait) +- cpu_wait(); +- } +-} +- +-static void loongson_halt(void) +-{ +- pr_notice("\n\n** You can safely turn off the power now **\n\n"); +- while (1) { +- if (cpu_wait) +- cpu_wait(); +- } ++ return NOTIFY_DONE; + } + + #ifdef CONFIG_KEXEC +@@ -154,9 +140,17 @@ static void loongson_crash_shutdown(struct pt_regs *regs) + + static int __init mips_reboot_setup(void) + { +- _machine_restart = loongson_restart; +- _machine_halt = loongson_halt; +- pm_power_off = loongson_poweroff; ++ if (loongson_sysconf.restart_addr) { ++ register_sys_off_handler(SYS_OFF_MODE_RESTART, ++ SYS_OFF_PRIO_FIRMWARE, ++ firmware_restart, NULL); ++ } ++ ++ if (loongson_sysconf.poweroff_addr) { ++ register_sys_off_handler(SYS_OFF_MODE_POWER_OFF, ++ SYS_OFF_PRIO_FIRMWARE, ++ firmware_poweroff, NULL); ++ } + + #ifdef CONFIG_KEXEC + kexec_argv = kmalloc(KEXEC_ARGV_SIZE, GFP_KERNEL); +diff --git a/arch/mips/loongson64/smp.c b/arch/mips/loongson64/smp.c +index 09ebe84a17fe4e..ae33661cd187d5 100644 +--- a/arch/mips/loongson64/smp.c ++++ b/arch/mips/loongson64/smp.c +@@ -479,12 +479,25 @@ static void loongson3_smp_finish(void) + static void __init loongson3_smp_setup(void) + { + int i = 0, num = 0; /* i: physical id, num: logical id */ ++ int max_cpus = 0; + + init_cpu_possible(cpu_none_mask); + ++ for (i = 0; i < ARRAY_SIZE(smp_group); i++) { ++ if (!smp_group[i]) ++ break; ++ max_cpus += loongson_sysconf.cores_per_node; ++ } ++ ++ if (max_cpus < loongson_sysconf.nr_cpus) { ++ pr_err("SMP Groups are less than the number of CPUs\n"); ++ loongson_sysconf.nr_cpus = max_cpus ? max_cpus : 1; ++ } ++ + /* For unified kernel, NR_CPUS is the maximum possible value, + * loongson_sysconf.nr_cpus is the really present value + */ ++ i = 0; + while (i < loongson_sysconf.nr_cpus) { + if (loongson_sysconf.reserved_cpus_mask & (1<<i)) { + /* Reserved physical CPU cores */ +@@ -505,14 +518,14 @@ static void __init loongson3_smp_setup(void) + __cpu_logical_map[num] = -1; + num++; + } +- + csr_ipi_probe(); + ipi_set0_regs_init(); + ipi_clear0_regs_init(); + ipi_status0_regs_init(); + ipi_en0_regs_init(); + ipi_mailbox_buf_init(); +- ipi_write_enable(0); ++ if (smp_group[0]) ++ ipi_write_enable(0); + + cpu_set_core(&cpu_data[0], + cpu_logical_map(0) % loongson_sysconf.cores_per_package); +@@ -830,6 +843,9 @@ static int loongson3_disable_clock(unsigned int cpu) + uint64_t core_id = cpu_core(&cpu_data[cpu]); + uint64_t package_id = cpu_data[cpu].package; + ++ if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id]) ++ return 0; ++ + if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) { + LOONGSON_CHIPCFG(package_id) &= ~(1 << (12 + core_id)); + } else { +@@ -844,6 +860,9 @@ static int loongson3_enable_clock(unsigned int cpu) + uint64_t core_id = cpu_core(&cpu_data[cpu]); + uint64_t package_id = cpu_data[cpu].package; + ++ if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id]) ++ return 0; ++ + if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) { + LOONGSON_CHIPCFG(package_id) |= 1 << (12 + core_id); + } else { +diff --git a/arch/mips/pci/pcie-octeon.c b/arch/mips/pci/pcie-octeon.c +old mode 100755 +new mode 100644 +diff --git a/arch/mips/sgi-ip30/ip30-console.c b/arch/mips/sgi-ip30/ip30-console.c +index b91f8c4fdc7860..a087b7ebe12936 100644 +--- a/arch/mips/sgi-ip30/ip30-console.c ++++ b/arch/mips/sgi-ip30/ip30-console.c +@@ -1,6 +1,7 @@ + // SPDX-License-Identifier: GPL-2.0 + + #include <linux/io.h> ++#include <linux/processor.h> + + #include <asm/sn/ioc3.h> + +diff --git a/arch/powerpc/configs/85xx-hw.config b/arch/powerpc/configs/85xx-hw.config +index 524db76f47b737..8aff8321739778 100644 +--- a/arch/powerpc/configs/85xx-hw.config ++++ b/arch/powerpc/configs/85xx-hw.config +@@ -24,6 +24,7 @@ CONFIG_FS_ENET=y + CONFIG_FSL_CORENET_CF=y + CONFIG_FSL_DMA=y + CONFIG_FSL_HV_MANAGER=y ++CONFIG_FSL_IFC=y + CONFIG_FSL_PQ_MDIO=y + CONFIG_FSL_RIO=y + CONFIG_FSL_XGMAC_MDIO=y +@@ -58,6 +59,7 @@ CONFIG_INPUT_FF_MEMLESS=m + CONFIG_MARVELL_PHY=y + CONFIG_MDIO_BUS_MUX_GPIO=y + CONFIG_MDIO_BUS_MUX_MMIOREG=y ++CONFIG_MEMORY=y + CONFIG_MMC_SDHCI_OF_ESDHC=y + CONFIG_MMC_SDHCI_PLTFM=y + CONFIG_MMC_SDHCI=y +diff --git a/arch/powerpc/include/asm/interrupt.h b/arch/powerpc/include/asm/interrupt.h +index e592e65e7665c3..49285b147afe46 100644 +--- a/arch/powerpc/include/asm/interrupt.h ++++ b/arch/powerpc/include/asm/interrupt.h +@@ -285,18 +285,24 @@ static inline void interrupt_nmi_enter_prepare(struct pt_regs *regs, struct inte + /* + * Do not use nmi_enter() for pseries hash guest taking a real-mode + * NMI because not everything it touches is within the RMA limit. ++ * ++ * Likewise, do not use it in real mode if percpu first chunk is not ++ * embedded. With CONFIG_NEED_PER_CPU_PAGE_FIRST_CHUNK enabled there ++ * are chances where percpu allocation can come from vmalloc area. + */ +- if (!IS_ENABLED(CONFIG_PPC_BOOK3S_64) || ++ if ((!IS_ENABLED(CONFIG_PPC_BOOK3S_64) || + !firmware_has_feature(FW_FEATURE_LPAR) || +- radix_enabled() || (mfmsr() & MSR_DR)) ++ radix_enabled() || (mfmsr() & MSR_DR)) && ++ !percpu_first_chunk_is_paged) + nmi_enter(); + } + + static inline void interrupt_nmi_exit_prepare(struct pt_regs *regs, struct interrupt_nmi_state *state) + { +- if (!IS_ENABLED(CONFIG_PPC_BOOK3S_64) || ++ if ((!IS_ENABLED(CONFIG_PPC_BOOK3S_64) || + !firmware_has_feature(FW_FEATURE_LPAR) || +- radix_enabled() || (mfmsr() & MSR_DR)) ++ radix_enabled() || (mfmsr() & MSR_DR)) && ++ !percpu_first_chunk_is_paged) + nmi_exit(); + + /* +diff --git a/arch/powerpc/include/asm/percpu.h b/arch/powerpc/include/asm/percpu.h +index 8e5b7d0b851c61..634970ce13c6b9 100644 +--- a/arch/powerpc/include/asm/percpu.h ++++ b/arch/powerpc/include/asm/percpu.h +@@ -15,6 +15,16 @@ + #endif /* CONFIG_SMP */ + #endif /* __powerpc64__ */ + ++#if defined(CONFIG_NEED_PER_CPU_PAGE_FIRST_CHUNK) && defined(CONFIG_SMP) ++#include <linux/jump_label.h> ++DECLARE_STATIC_KEY_FALSE(__percpu_first_chunk_is_paged); ++ ++#define percpu_first_chunk_is_paged \ ++ (static_key_enabled(&__percpu_first_chunk_is_paged.key)) ++#else ++#define percpu_first_chunk_is_paged false ++#endif /* CONFIG_PPC64 && CONFIG_SMP */ ++ + #include <asm-generic/percpu.h> + + #include <asm/paca.h> +diff --git a/arch/powerpc/kernel/setup_64.c b/arch/powerpc/kernel/setup_64.c +index eaa79a0996d1b5..37d5683ab298ec 100644 +--- a/arch/powerpc/kernel/setup_64.c ++++ b/arch/powerpc/kernel/setup_64.c +@@ -825,6 +825,7 @@ static int pcpu_cpu_distance(unsigned int from, unsigned int to) + + unsigned long __per_cpu_offset[NR_CPUS] __read_mostly; + EXPORT_SYMBOL(__per_cpu_offset); ++DEFINE_STATIC_KEY_FALSE(__percpu_first_chunk_is_paged); + + static void __init pcpu_populate_pte(unsigned long addr) + { +@@ -904,6 +905,7 @@ void __init setup_per_cpu_areas(void) + if (rc < 0) + panic("cannot initialize percpu area (err=%d)", rc); + ++ static_key_enable(&__percpu_first_chunk_is_paged.key); + delta = (unsigned long)pcpu_base_addr - (unsigned long)__per_cpu_start; + for_each_possible_cpu(cpu) { + __per_cpu_offset[cpu] = delta + pcpu_unit_offsets[cpu]; +diff --git a/arch/powerpc/kvm/powerpc.c b/arch/powerpc/kvm/powerpc.c +index ee305455bd8db4..fc7174b32e9823 100644 +--- a/arch/powerpc/kvm/powerpc.c ++++ b/arch/powerpc/kvm/powerpc.c +@@ -1963,8 +1963,10 @@ static int kvm_vcpu_ioctl_enable_cap(struct kvm_vcpu *vcpu, + break; + + r = -ENXIO; +- if (!xive_enabled()) ++ if (!xive_enabled()) { ++ fdput(f); + break; ++ } + + r = -EPERM; + dev = kvm_device_from_filp(f.file); +diff --git a/arch/powerpc/xmon/ppc-dis.c b/arch/powerpc/xmon/ppc-dis.c +index 75fa98221d485d..af105e1bc3fca4 100644 +--- a/arch/powerpc/xmon/ppc-dis.c ++++ b/arch/powerpc/xmon/ppc-dis.c +@@ -122,32 +122,21 @@ int print_insn_powerpc (unsigned long insn, unsigned long memaddr) + bool insn_is_short; + ppc_cpu_t dialect; + +- dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON +- | PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_ALTIVEC; ++ dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON; + +- if (cpu_has_feature(CPU_FTRS_POWER5)) +- dialect |= PPC_OPCODE_POWER5; ++ if (IS_ENABLED(CONFIG_PPC64)) ++ dialect |= PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_CELL | ++ PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 | PPC_OPCODE_POWER8 | ++ PPC_OPCODE_POWER9; + +- if (cpu_has_feature(CPU_FTRS_CELL)) +- dialect |= (PPC_OPCODE_CELL | PPC_OPCODE_ALTIVEC); ++ if (cpu_has_feature(CPU_FTR_TM)) ++ dialect |= PPC_OPCODE_HTM; + +- if (cpu_has_feature(CPU_FTRS_POWER6)) +- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_ALTIVEC); ++ if (cpu_has_feature(CPU_FTR_ALTIVEC)) ++ dialect |= PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2; + +- if (cpu_has_feature(CPU_FTRS_POWER7)) +- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 +- | PPC_OPCODE_ALTIVEC | PPC_OPCODE_VSX); +- +- if (cpu_has_feature(CPU_FTRS_POWER8)) +- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 +- | PPC_OPCODE_POWER8 | PPC_OPCODE_HTM +- | PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2 | PPC_OPCODE_VSX); +- +- if (cpu_has_feature(CPU_FTRS_POWER9)) +- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 +- | PPC_OPCODE_POWER8 | PPC_OPCODE_POWER9 | PPC_OPCODE_HTM +- | PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2 +- | PPC_OPCODE_VSX | PPC_OPCODE_VSX3); ++ if (cpu_has_feature(CPU_FTR_VSX)) ++ dialect |= PPC_OPCODE_VSX | PPC_OPCODE_VSX3; + + /* Get the major opcode of the insn. */ + opcode = NULL; +diff --git a/arch/riscv/mm/fault.c b/arch/riscv/mm/fault.c +index 884a3c76573cf5..3fc62e05bac110 100644 +--- a/arch/riscv/mm/fault.c ++++ b/arch/riscv/mm/fault.c +@@ -60,26 +60,27 @@ static inline void no_context(struct pt_regs *regs, unsigned long addr) + + static inline void mm_fault_error(struct pt_regs *regs, unsigned long addr, vm_fault_t fault) + { ++ if (!user_mode(regs)) { ++ no_context(regs, addr); ++ return; ++ } ++ + if (fault & VM_FAULT_OOM) { + /* + * We ran out of memory, call the OOM killer, and return the userspace + * (which will retry the fault, or kill us if we got oom-killed). + */ +- if (!user_mode(regs)) { +- no_context(regs, addr); +- return; +- } + pagefault_out_of_memory(); + return; + } else if (fault & VM_FAULT_SIGBUS) { + /* Kernel mode? Handle exceptions or die */ +- if (!user_mode(regs)) { +- no_context(regs, addr); +- return; +- } + do_trap(regs, SIGBUS, BUS_ADRERR, addr); + return; ++ } else if (fault & VM_FAULT_SIGSEGV) { ++ do_trap(regs, SIGSEGV, SEGV_MAPERR, addr); ++ return; + } ++ + BUG(); + } + +diff --git a/arch/sparc/include/asm/oplib_64.h b/arch/sparc/include/asm/oplib_64.h +index a67abebd43592f..1b86d02a84556a 100644 +--- a/arch/sparc/include/asm/oplib_64.h ++++ b/arch/sparc/include/asm/oplib_64.h +@@ -247,6 +247,7 @@ void prom_sun4v_guest_soft_state(void); + int prom_ihandle2path(int handle, char *buffer, int bufsize); + + /* Client interface level routines. */ ++void prom_cif_init(void *cif_handler); + void p1275_cmd_direct(unsigned long *); + + #endif /* !(__SPARC64_OPLIB_H) */ +diff --git a/arch/sparc/prom/init_64.c b/arch/sparc/prom/init_64.c +index 103aa910431856..f7b8a1a865b8fe 100644 +--- a/arch/sparc/prom/init_64.c ++++ b/arch/sparc/prom/init_64.c +@@ -26,9 +26,6 @@ phandle prom_chosen_node; + * routines in the prom library. + * It gets passed the pointer to the PROM vector. + */ +- +-extern void prom_cif_init(void *); +- + void __init prom_init(void *cif_handler) + { + phandle node; +diff --git a/arch/sparc/prom/p1275.c b/arch/sparc/prom/p1275.c +index 889aa602f8d860..51c3f984bbf728 100644 +--- a/arch/sparc/prom/p1275.c ++++ b/arch/sparc/prom/p1275.c +@@ -49,7 +49,7 @@ void p1275_cmd_direct(unsigned long *args) + local_irq_restore(flags); + } + +-void prom_cif_init(void *cif_handler, void *cif_stack) ++void prom_cif_init(void *cif_handler) + { + p1275buf.prom_cif_handler = (void (*)(long *))cif_handler; + } +diff --git a/arch/um/kernel/time.c b/arch/um/kernel/time.c +index 3e270da6b6f67e..c8c4ef94c753f1 100644 +--- a/arch/um/kernel/time.c ++++ b/arch/um/kernel/time.c +@@ -874,9 +874,9 @@ int setup_time_travel_start(char *str) + return 1; + } + +-__setup("time-travel-start", setup_time_travel_start); ++__setup("time-travel-start=", setup_time_travel_start); + __uml_help(setup_time_travel_start, +-"time-travel-start=<seconds>\n" ++"time-travel-start=<nanoseconds>\n" + "Configure the UML instance's wall clock to start at this value rather than\n" + "the host's wall clock at the time of UML boot.\n"); + #endif +diff --git a/arch/um/os-Linux/signal.c b/arch/um/os-Linux/signal.c +index 24a403a70a0201..850d21e6473eec 100644 +--- a/arch/um/os-Linux/signal.c ++++ b/arch/um/os-Linux/signal.c +@@ -8,6 +8,7 @@ + + #include <stdlib.h> + #include <stdarg.h> ++#include <stdbool.h> + #include <errno.h> + #include <signal.h> + #include <string.h> +@@ -65,9 +66,7 @@ static void sig_handler_common(int sig, struct siginfo *si, mcontext_t *mc) + + int signals_enabled; + #ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT +-static int signals_blocked; +-#else +-#define signals_blocked 0 ++static int signals_blocked, signals_blocked_pending; + #endif + static unsigned int signals_pending; + static unsigned int signals_active = 0; +@@ -76,14 +75,27 @@ void sig_handler(int sig, struct siginfo *si, mcontext_t *mc) + { + int enabled = signals_enabled; + +- if ((signals_blocked || !enabled) && (sig == SIGIO)) { ++#ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT ++ if ((signals_blocked || ++ __atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) && ++ (sig == SIGIO)) { ++ /* increment so unblock will do another round */ ++ __atomic_add_fetch(&signals_blocked_pending, 1, ++ __ATOMIC_SEQ_CST); ++ return; ++ } ++#endif ++ ++ if (!enabled && (sig == SIGIO)) { + /* + * In TT_MODE_EXTERNAL, need to still call time-travel +- * handlers unless signals are also blocked for the +- * external time message processing. This will mark +- * signals_pending by itself (only if necessary.) ++ * handlers. This will mark signals_pending by itself ++ * (only if necessary.) ++ * Note we won't get here if signals are hard-blocked ++ * (which is handled above), in that case the hard- ++ * unblock will handle things. + */ +- if (!signals_blocked && time_travel_mode == TT_MODE_EXTERNAL) ++ if (time_travel_mode == TT_MODE_EXTERNAL) + sigio_run_timetravel_handlers(); + else + signals_pending |= SIGIO_MASK; +@@ -380,33 +392,99 @@ int um_set_signals_trace(int enable) + #ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT + void mark_sigio_pending(void) + { ++ /* ++ * It would seem that this should be atomic so ++ * it isn't a read-modify-write with a signal ++ * that could happen in the middle, losing the ++ * value set by the signal. ++ * ++ * However, this function is only called when in ++ * time-travel=ext simulation mode, in which case ++ * the only signal ever pending is SIGIO, which ++ * is blocked while this can be called, and the ++ * timer signal (SIGALRM) cannot happen. ++ */ + signals_pending |= SIGIO_MASK; + } + + void block_signals_hard(void) + { +- if (signals_blocked) +- return; +- signals_blocked = 1; ++ signals_blocked++; + barrier(); + } + + void unblock_signals_hard(void) + { ++ static bool unblocking; ++ + if (!signals_blocked) ++ panic("unblocking signals while not blocked"); ++ ++ if (--signals_blocked) + return; +- /* Must be set to 0 before we check the pending bits etc. */ +- signals_blocked = 0; ++ /* ++ * Must be set to 0 before we check pending so the ++ * SIGIO handler will run as normal unless we're still ++ * going to process signals_blocked_pending. ++ */ + barrier(); + +- if (signals_pending && signals_enabled) { +- /* this is a bit inefficient, but that's not really important */ +- block_signals(); +- unblock_signals(); +- } else if (signals_pending & SIGIO_MASK) { +- /* we need to run time-travel handlers even if not enabled */ +- sigio_run_timetravel_handlers(); ++ /* ++ * Note that block_signals_hard()/unblock_signals_hard() can be called ++ * within the unblock_signals()/sigio_run_timetravel_handlers() below. ++ * This would still be prone to race conditions since it's actually a ++ * call _within_ e.g. vu_req_read_message(), where we observed this ++ * issue, which loops. Thus, if the inner call handles the recorded ++ * pending signals, we can get out of the inner call with the real ++ * signal hander no longer blocked, and still have a race. Thus don't ++ * handle unblocking in the inner call, if it happens, but only in ++ * the outermost call - 'unblocking' serves as an ownership for the ++ * signals_blocked_pending decrement. ++ */ ++ if (unblocking) ++ return; ++ unblocking = true; ++ ++ while (__atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) { ++ if (signals_enabled) { ++ /* signals are enabled so we can touch this */ ++ signals_pending |= SIGIO_MASK; ++ /* ++ * this is a bit inefficient, but that's ++ * not really important ++ */ ++ block_signals(); ++ unblock_signals(); ++ } else { ++ /* ++ * we need to run time-travel handlers even ++ * if not enabled ++ */ ++ sigio_run_timetravel_handlers(); ++ } ++ ++ /* ++ * The decrement of signals_blocked_pending must be atomic so ++ * that the signal handler will either happen before or after ++ * the decrement, not during a read-modify-write: ++ * - If it happens before, it can increment it and we'll ++ * decrement it and do another round in the loop. ++ * - If it happens after it'll see 0 for both signals_blocked ++ * and signals_blocked_pending and thus run the handler as ++ * usual (subject to signals_enabled, but that's unrelated.) ++ * ++ * Note that a call to unblock_signals_hard() within the calls ++ * to unblock_signals() or sigio_run_timetravel_handlers() above ++ * will do nothing due to the 'unblocking' state, so this cannot ++ * underflow as the only one decrementing will be the outermost ++ * one. ++ */ ++ if (__atomic_sub_fetch(&signals_blocked_pending, 1, ++ __ATOMIC_SEQ_CST) < 0) ++ panic("signals_blocked_pending underflow"); + } ++ ++ unblocking = false; + } + #endif + +diff --git a/arch/x86/events/intel/pt.c b/arch/x86/events/intel/pt.c +index a85d3138839c5e..adaaed466e5c58 100644 +--- a/arch/x86/events/intel/pt.c ++++ b/arch/x86/events/intel/pt.c +@@ -861,7 +861,7 @@ static void pt_update_head(struct pt *pt) + */ + static void *pt_buffer_region(struct pt_buffer *buf) + { +- return phys_to_virt(TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT); ++ return phys_to_virt((phys_addr_t)TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT); + } + + /** +@@ -973,7 +973,7 @@ pt_topa_entry_for_page(struct pt_buffer *buf, unsigned int pg) + * order allocations, there shouldn't be many of these. + */ + list_for_each_entry(topa, &buf->tables, list) { +- if (topa->offset + topa->size > pg << PAGE_SHIFT) ++ if (topa->offset + topa->size > (unsigned long)pg << PAGE_SHIFT) + goto found; + } + +diff --git a/arch/x86/events/intel/pt.h b/arch/x86/events/intel/pt.h +index 96906a62aacdad..f5e46c04c145d0 100644 +--- a/arch/x86/events/intel/pt.h ++++ b/arch/x86/events/intel/pt.h +@@ -33,8 +33,8 @@ struct topa_entry { + u64 rsvd2 : 1; + u64 size : 4; + u64 rsvd3 : 2; +- u64 base : 36; +- u64 rsvd4 : 16; ++ u64 base : 40; ++ u64 rsvd4 : 12; + }; + + /* TSC to Core Crystal Clock Ratio */ +diff --git a/arch/x86/events/intel/uncore_snbep.c b/arch/x86/events/intel/uncore_snbep.c +index 9b5859812f4fb0..d081eb89ba1238 100644 +--- a/arch/x86/events/intel/uncore_snbep.c ++++ b/arch/x86/events/intel/uncore_snbep.c +@@ -459,6 +459,7 @@ + #define SPR_RAW_EVENT_MASK_EXT 0xffffff + + /* SPR CHA */ ++#define SPR_CHA_EVENT_MASK_EXT 0xffffffff + #define SPR_CHA_PMON_CTL_TID_EN (1 << 16) + #define SPR_CHA_PMON_EVENT_MASK (SNBEP_PMON_RAW_EVENT_MASK | \ + SPR_CHA_PMON_CTL_TID_EN) +@@ -475,6 +476,7 @@ DEFINE_UNCORE_FORMAT_ATTR(umask_ext, umask, "config:8-15,32-43,45-55"); + DEFINE_UNCORE_FORMAT_ATTR(umask_ext2, umask, "config:8-15,32-57"); + DEFINE_UNCORE_FORMAT_ATTR(umask_ext3, umask, "config:8-15,32-39"); + DEFINE_UNCORE_FORMAT_ATTR(umask_ext4, umask, "config:8-15,32-55"); ++DEFINE_UNCORE_FORMAT_ATTR(umask_ext5, umask, "config:8-15,32-63"); + DEFINE_UNCORE_FORMAT_ATTR(qor, qor, "config:16"); + DEFINE_UNCORE_FORMAT_ATTR(edge, edge, "config:18"); + DEFINE_UNCORE_FORMAT_ATTR(tid_en, tid_en, "config:19"); +@@ -5648,7 +5650,7 @@ static struct intel_uncore_ops spr_uncore_chabox_ops = { + + static struct attribute *spr_uncore_cha_formats_attr[] = { + &format_attr_event.attr, +- &format_attr_umask_ext4.attr, ++ &format_attr_umask_ext5.attr, + &format_attr_tid_en2.attr, + &format_attr_edge.attr, + &format_attr_inv.attr, +@@ -5684,7 +5686,7 @@ ATTRIBUTE_GROUPS(uncore_alias); + static struct intel_uncore_type spr_uncore_chabox = { + .name = "cha", + .event_mask = SPR_CHA_PMON_EVENT_MASK, +- .event_mask_ext = SPR_RAW_EVENT_MASK_EXT, ++ .event_mask_ext = SPR_CHA_EVENT_MASK_EXT, + .num_shared_regs = 1, + .constraints = skx_uncore_chabox_constraints, + .ops = &spr_uncore_chabox_ops, +diff --git a/arch/x86/kernel/cpu/mtrr/mtrr.c b/arch/x86/kernel/cpu/mtrr/mtrr.c +index 2746cac9d8a946..dbebb646c9fc69 100644 +--- a/arch/x86/kernel/cpu/mtrr/mtrr.c ++++ b/arch/x86/kernel/cpu/mtrr/mtrr.c +@@ -816,7 +816,7 @@ void mtrr_save_state(void) + { + int first_cpu; + +- if (!mtrr_enabled()) ++ if (!mtrr_enabled() || !mtrr_state.have_fixed) + return; + + first_cpu = cpumask_first(cpu_online_mask); +diff --git a/arch/x86/kernel/devicetree.c b/arch/x86/kernel/devicetree.c +index 6a4cb71c24983e..bd4386bf51ac9d 100644 +--- a/arch/x86/kernel/devicetree.c ++++ b/arch/x86/kernel/devicetree.c +@@ -92,7 +92,7 @@ static int x86_of_pci_irq_enable(struct pci_dev *dev) + + ret = pci_read_config_byte(dev, PCI_INTERRUPT_PIN, &pin); + if (ret) +- return ret; ++ return pcibios_err_to_errno(ret); + if (!pin) + return 0; + +diff --git a/arch/x86/kvm/vmx/vmx.c b/arch/x86/kvm/vmx/vmx.c +index bedbd077e50efb..283f3205d7d701 100644 +--- a/arch/x86/kvm/vmx/vmx.c ++++ b/arch/x86/kvm/vmx/vmx.c +@@ -4706,14 +4706,19 @@ static int vmx_nmi_allowed(struct kvm_vcpu *vcpu, bool for_injection) + return !vmx_nmi_blocked(vcpu); + } + ++bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu) ++{ ++ return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) || ++ (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) & ++ (GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS)); ++} ++ + bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu) + { + if (is_guest_mode(vcpu) && nested_exit_on_intr(vcpu)) + return false; + +- return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) || +- (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) & +- (GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS)); ++ return __vmx_interrupt_blocked(vcpu); + } + + static int vmx_interrupt_allowed(struct kvm_vcpu *vcpu, bool for_injection) +diff --git a/arch/x86/kvm/vmx/vmx.h b/arch/x86/kvm/vmx/vmx.h +index 20f1213a93685f..a1792d96618a2c 100644 +--- a/arch/x86/kvm/vmx/vmx.h ++++ b/arch/x86/kvm/vmx/vmx.h +@@ -388,6 +388,7 @@ u64 construct_eptp(struct kvm_vcpu *vcpu, hpa_t root_hpa, int root_level); + bool vmx_guest_inject_ac(struct kvm_vcpu *vcpu); + void vmx_update_exception_bitmap(struct kvm_vcpu *vcpu); + bool vmx_nmi_blocked(struct kvm_vcpu *vcpu); ++bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu); + bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu); + bool vmx_get_nmi_mask(struct kvm_vcpu *vcpu); + void vmx_set_nmi_mask(struct kvm_vcpu *vcpu, bool masked); +diff --git a/arch/x86/mm/pti.c b/arch/x86/mm/pti.c +index 5d5c7bb50ce9e2..189b242d3e897b 100644 +--- a/arch/x86/mm/pti.c ++++ b/arch/x86/mm/pti.c +@@ -374,14 +374,14 @@ pti_clone_pgtable(unsigned long start, unsigned long end, + */ + *target_pmd = *pmd; + +- addr += PMD_SIZE; ++ addr = round_up(addr + 1, PMD_SIZE); + + } else if (level == PTI_CLONE_PTE) { + + /* Walk the page-table down to the pte level */ + pte = pte_offset_kernel(pmd, addr); + if (pte_none(*pte)) { +- addr += PAGE_SIZE; ++ addr = round_up(addr + 1, PAGE_SIZE); + continue; + } + +@@ -401,7 +401,7 @@ pti_clone_pgtable(unsigned long start, unsigned long end, + /* Clone the PTE */ + *target_pte = *pte; + +- addr += PAGE_SIZE; ++ addr = round_up(addr + 1, PAGE_SIZE); + + } else { + BUG(); +@@ -496,7 +496,7 @@ static void pti_clone_entry_text(void) + { + pti_clone_pgtable((unsigned long) __entry_text_start, + (unsigned long) __entry_text_end, +- PTI_CLONE_PMD); ++ PTI_LEVEL_KERNEL_IMAGE); + } + + /* +diff --git a/arch/x86/pci/intel_mid_pci.c b/arch/x86/pci/intel_mid_pci.c +index 8edd6220660446..722a33be08a186 100644 +--- a/arch/x86/pci/intel_mid_pci.c ++++ b/arch/x86/pci/intel_mid_pci.c +@@ -233,9 +233,9 @@ static int intel_mid_pci_irq_enable(struct pci_dev *dev) + return 0; + + ret = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi); +- if (ret < 0) { ++ if (ret) { + dev_warn(&dev->dev, "Failed to read interrupt line: %d\n", ret); +- return ret; ++ return pcibios_err_to_errno(ret); + } + + id = x86_match_cpu(intel_mid_cpu_ids); +diff --git a/arch/x86/pci/xen.c b/arch/x86/pci/xen.c +index f153e9ab8c966e..8e4165b5b295b4 100644 +--- a/arch/x86/pci/xen.c ++++ b/arch/x86/pci/xen.c +@@ -37,10 +37,10 @@ static int xen_pcifront_enable_irq(struct pci_dev *dev) + u8 gsi; + + rc = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi); +- if (rc < 0) { ++ if (rc) { + dev_warn(&dev->dev, "Xen PCI: failed to read interrupt line: %d\n", + rc); +- return rc; ++ return pcibios_err_to_errno(rc); + } + /* In PV DomU the Xen PCI backend puts the PIRQ in the interrupt line.*/ + pirq = gsi; +diff --git a/arch/x86/platform/intel/iosf_mbi.c b/arch/x86/platform/intel/iosf_mbi.c +index fdd49d70b43738..c81cea208c2c43 100644 +--- a/arch/x86/platform/intel/iosf_mbi.c ++++ b/arch/x86/platform/intel/iosf_mbi.c +@@ -62,7 +62,7 @@ static int iosf_mbi_pci_read_mdr(u32 mcrx, u32 mcr, u32 *mdr) + + fail_read: + dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result); +- return result; ++ return pcibios_err_to_errno(result); + } + + static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr) +@@ -91,7 +91,7 @@ static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr) + + fail_write: + dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result); +- return result; ++ return pcibios_err_to_errno(result); + } + + int iosf_mbi_read(u8 port, u8 opcode, u32 offset, u32 *mdr) +diff --git a/arch/x86/xen/p2m.c b/arch/x86/xen/p2m.c +index 5e6e236977c75f..9b3a9fa4a0ade3 100644 +--- a/arch/x86/xen/p2m.c ++++ b/arch/x86/xen/p2m.c +@@ -736,7 +736,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops, + * immediate unmapping. + */ + map_ops[i].status = GNTST_general_error; +- unmap[0].host_addr = map_ops[i].host_addr, ++ unmap[0].host_addr = map_ops[i].host_addr; + unmap[0].handle = map_ops[i].handle; + map_ops[i].handle = INVALID_GRANT_HANDLE; + if (map_ops[i].flags & GNTMAP_device_map) +@@ -746,7 +746,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops, + + if (kmap_ops) { + kmap_ops[i].status = GNTST_general_error; +- unmap[1].host_addr = kmap_ops[i].host_addr, ++ unmap[1].host_addr = kmap_ops[i].host_addr; + unmap[1].handle = kmap_ops[i].handle; + kmap_ops[i].handle = INVALID_GRANT_HANDLE; + if (kmap_ops[i].flags & GNTMAP_device_map) +diff --git a/block/bio-integrity.c b/block/bio-integrity.c +index 4f34ac27c47dd5..bb364a25ac8699 100644 +--- a/block/bio-integrity.c ++++ b/block/bio-integrity.c +@@ -203,8 +203,7 @@ bool bio_integrity_prep(struct bio *bio) + unsigned long start, end; + unsigned int len, nr_pages; + unsigned int bytes, offset, i; +- unsigned int intervals; +- blk_status_t status; ++ gfp_t gfp = GFP_NOIO; + + if (!bi) + return true; +@@ -227,13 +226,19 @@ bool bio_integrity_prep(struct bio *bio) + if (!bi->profile->generate_fn || + !(bi->flags & BLK_INTEGRITY_GENERATE)) + return true; ++ ++ /* ++ * Zero the memory allocated to not leak uninitialized kernel ++ * memory to disk. For PI this only affects the app tag, but ++ * for non-integrity metadata it affects the entire metadata ++ * buffer. ++ */ ++ gfp |= __GFP_ZERO; + } +- intervals = bio_integrity_intervals(bi, bio_sectors(bio)); + + /* Allocate kernel buffer for protection data */ +- len = intervals * bi->tuple_size; +- buf = kmalloc(len, GFP_NOIO); +- status = BLK_STS_RESOURCE; ++ len = bio_integrity_bytes(bi, bio_sectors(bio)); ++ buf = kmalloc(len, gfp); + if (unlikely(buf == NULL)) { + printk(KERN_ERR "could not allocate integrity buffer\n"); + goto err_end_io; +@@ -248,7 +253,6 @@ bool bio_integrity_prep(struct bio *bio) + if (IS_ERR(bip)) { + printk(KERN_ERR "could not allocate data integrity bioset\n"); + kfree(buf); +- status = BLK_STS_RESOURCE; + goto err_end_io; + } + +@@ -276,7 +280,6 @@ bool bio_integrity_prep(struct bio *bio) + + if (ret == 0) { + printk(KERN_ERR "could not attach integrity payload\n"); +- status = BLK_STS_RESOURCE; + goto err_end_io; + } + +@@ -298,7 +301,7 @@ bool bio_integrity_prep(struct bio *bio) + return true; + + err_end_io: +- bio->bi_status = status; ++ bio->bi_status = BLK_STS_RESOURCE; + bio_endio(bio); + return false; + +diff --git a/drivers/acpi/battery.c b/drivers/acpi/battery.c +index c7569151fd02a5..aed4132985a961 100644 +--- a/drivers/acpi/battery.c ++++ b/drivers/acpi/battery.c +@@ -676,12 +676,18 @@ static ssize_t acpi_battery_alarm_store(struct device *dev, + return count; + } + +-static const struct device_attribute alarm_attr = { ++static struct device_attribute alarm_attr = { + .attr = {.name = "alarm", .mode = 0644}, + .show = acpi_battery_alarm_show, + .store = acpi_battery_alarm_store, + }; + ++static struct attribute *acpi_battery_attrs[] = { ++ &alarm_attr.attr, ++ NULL ++}; ++ATTRIBUTE_GROUPS(acpi_battery); ++ + /* + * The Battery Hooking API + * +@@ -818,7 +824,10 @@ static void __exit battery_hook_exit(void) + + static int sysfs_add_battery(struct acpi_battery *battery) + { +- struct power_supply_config psy_cfg = { .drv_data = battery, }; ++ struct power_supply_config psy_cfg = { ++ .drv_data = battery, ++ .attr_grp = acpi_battery_groups, ++ }; + bool full_cap_broken = false; + + if (!ACPI_BATTERY_CAPACITY_VALID(battery->full_charge_capacity) && +@@ -863,7 +872,7 @@ static int sysfs_add_battery(struct acpi_battery *battery) + return result; + } + battery_hook_add_battery(battery); +- return device_create_file(&battery->bat->dev, &alarm_attr); ++ return 0; + } + + static void sysfs_remove_battery(struct acpi_battery *battery) +@@ -874,7 +883,6 @@ static void sysfs_remove_battery(struct acpi_battery *battery) + return; + } + battery_hook_remove_battery(battery); +- device_remove_file(&battery->bat->dev, &alarm_attr); + power_supply_unregister(battery->bat); + battery->bat = NULL; + mutex_unlock(&battery->sysfs_lock); +diff --git a/drivers/acpi/sbs.c b/drivers/acpi/sbs.c +index 4938010fcac78d..11083d0333d16c 100644 +--- a/drivers/acpi/sbs.c ++++ b/drivers/acpi/sbs.c +@@ -77,7 +77,6 @@ struct acpi_battery { + u16 spec; + u8 id; + u8 present:1; +- u8 have_sysfs_alarm:1; + }; + + #define to_acpi_battery(x) power_supply_get_drvdata(x) +@@ -462,12 +461,18 @@ static ssize_t acpi_battery_alarm_store(struct device *dev, + return count; + } + +-static const struct device_attribute alarm_attr = { ++static struct device_attribute alarm_attr = { + .attr = {.name = "alarm", .mode = 0644}, + .show = acpi_battery_alarm_show, + .store = acpi_battery_alarm_store, + }; + ++static struct attribute *acpi_battery_attrs[] = { ++ &alarm_attr.attr, ++ NULL ++}; ++ATTRIBUTE_GROUPS(acpi_battery); ++ + /* -------------------------------------------------------------------------- + Driver Interface + -------------------------------------------------------------------------- */ +@@ -509,7 +514,10 @@ static int acpi_battery_read(struct acpi_battery *battery) + static int acpi_battery_add(struct acpi_sbs *sbs, int id) + { + struct acpi_battery *battery = &sbs->battery[id]; +- struct power_supply_config psy_cfg = { .drv_data = battery, }; ++ struct power_supply_config psy_cfg = { ++ .drv_data = battery, ++ .attr_grp = acpi_battery_groups, ++ }; + int result; + + battery->id = id; +@@ -539,10 +547,6 @@ static int acpi_battery_add(struct acpi_sbs *sbs, int id) + goto end; + } + +- result = device_create_file(&battery->bat->dev, &alarm_attr); +- if (result) +- goto end; +- battery->have_sysfs_alarm = 1; + end: + pr_info("%s [%s]: Battery Slot [%s] (battery %s)\n", + ACPI_SBS_DEVICE_NAME, acpi_device_bid(sbs->device), +@@ -554,11 +558,8 @@ static void acpi_battery_remove(struct acpi_sbs *sbs, int id) + { + struct acpi_battery *battery = &sbs->battery[id]; + +- if (battery->bat) { +- if (battery->have_sysfs_alarm) +- device_remove_file(&battery->bat->dev, &alarm_attr); ++ if (battery->bat) + power_supply_unregister(battery->bat); +- } + } + + static int acpi_charger_add(struct acpi_sbs *sbs) +diff --git a/drivers/android/binder.c b/drivers/android/binder.c +index 3abd5619a9e6fd..269d314e73a79e 100644 +--- a/drivers/android/binder.c ++++ b/drivers/android/binder.c +@@ -542,9 +542,7 @@ static bool binder_has_work(struct binder_thread *thread, bool do_proc_work) + static bool binder_available_for_proc_work_ilocked(struct binder_thread *thread) + { + return !thread->transaction_stack && +- binder_worklist_empty_ilocked(&thread->todo) && +- (thread->looper & (BINDER_LOOPER_STATE_ENTERED | +- BINDER_LOOPER_STATE_REGISTERED)); ++ binder_worklist_empty_ilocked(&thread->todo); + } + + static void binder_wakeup_poll_threads_ilocked(struct binder_proc *proc, +diff --git a/drivers/ata/libata-scsi.c b/drivers/ata/libata-scsi.c +index 9d0596dabfb9fc..66a43b16e400a5 100644 +--- a/drivers/ata/libata-scsi.c ++++ b/drivers/ata/libata-scsi.c +@@ -874,7 +874,15 @@ static void ata_gen_passthru_sense(struct ata_queued_cmd *qc) + } else { + /* + * ATA PASS-THROUGH INFORMATION AVAILABLE +- * Always in descriptor format sense. ++ * ++ * Note: we are supposed to call ata_scsi_set_sense(), which ++ * respects the D_SENSE bit, instead of unconditionally ++ * generating the sense data in descriptor format. However, ++ * because hdparm, hddtemp, and udisks incorrectly assume sense ++ * data in descriptor format, without even looking at the ++ * RESPONSE CODE field in the returned sense data (to see which ++ * format the returned sense data is in), we are stuck with ++ * being bug compatible with older kernels. + */ + scsi_build_sense(cmd, 1, RECOVERED_ERROR, 0, 0x1D); + } +diff --git a/drivers/base/core.c b/drivers/base/core.c +index d995d768c362ac..81572c0813338d 100644 +--- a/drivers/base/core.c ++++ b/drivers/base/core.c +@@ -25,6 +25,7 @@ + #include <linux/mutex.h> + #include <linux/pm_runtime.h> + #include <linux/netdevice.h> ++#include <linux/rcupdate.h> + #include <linux/sched/signal.h> + #include <linux/sched/mm.h> + #include <linux/swiotlb.h> +@@ -2305,6 +2306,7 @@ static int dev_uevent(struct kset *kset, struct kobject *kobj, + struct kobj_uevent_env *env) + { + struct device *dev = kobj_to_dev(kobj); ++ struct device_driver *driver; + int retval = 0; + + /* add device node properties if present */ +@@ -2333,8 +2335,12 @@ static int dev_uevent(struct kset *kset, struct kobject *kobj, + if (dev->type && dev->type->name) + add_uevent_var(env, "DEVTYPE=%s", dev->type->name); + +- if (dev->driver) +- add_uevent_var(env, "DRIVER=%s", dev->driver->name); ++ /* Synchronize with module_remove_driver() */ ++ rcu_read_lock(); ++ driver = READ_ONCE(dev->driver); ++ if (driver) ++ add_uevent_var(env, "DRIVER=%s", driver->name); ++ rcu_read_unlock(); + + /* Add common DT information about the device */ + of_device_uevent(dev, env); +@@ -2404,11 +2410,8 @@ static ssize_t uevent_show(struct device *dev, struct device_attribute *attr, + if (!env) + return -ENOMEM; + +- /* Synchronize with really_probe() */ +- device_lock(dev); + /* let the kset specific function add its keys */ + retval = kset->uevent_ops->uevent(kset, &dev->kobj, env); +- device_unlock(dev); + if (retval) + goto out; + +diff --git a/drivers/base/devres.c b/drivers/base/devres.c +index eaa9a5cd1db9dc..27a43b4960f5be 100644 +--- a/drivers/base/devres.c ++++ b/drivers/base/devres.c +@@ -890,9 +890,12 @@ void *devm_krealloc(struct device *dev, void *ptr, size_t new_size, gfp_t gfp) + /* + * Otherwise: allocate new, larger chunk. We need to allocate before + * taking the lock as most probably the caller uses GFP_KERNEL. ++ * alloc_dr() will call check_dr_size() to reserve extra memory ++ * for struct devres automatically, so size @new_size user request ++ * is delivered to it directly as devm_kmalloc() does. + */ + new_dr = alloc_dr(devm_kmalloc_release, +- total_new_size, gfp, dev_to_node(dev)); ++ new_size, gfp, dev_to_node(dev)); + if (!new_dr) + return NULL; + +@@ -1216,7 +1219,11 @@ EXPORT_SYMBOL_GPL(__devm_alloc_percpu); + */ + void devm_free_percpu(struct device *dev, void __percpu *pdata) + { +- WARN_ON(devres_destroy(dev, devm_percpu_release, devm_percpu_match, ++ /* ++ * Use devres_release() to prevent memory leakage as ++ * devm_free_pages() does. ++ */ ++ WARN_ON(devres_release(dev, devm_percpu_release, devm_percpu_match, + (__force void *)pdata)); + } + EXPORT_SYMBOL_GPL(devm_free_percpu); +diff --git a/drivers/base/module.c b/drivers/base/module.c +index 46ad4d636731dd..851cc5367c04c0 100644 +--- a/drivers/base/module.c ++++ b/drivers/base/module.c +@@ -7,6 +7,7 @@ + #include <linux/errno.h> + #include <linux/slab.h> + #include <linux/string.h> ++#include <linux/rcupdate.h> + #include "base.h" + + static char *make_driver_name(struct device_driver *drv) +@@ -77,6 +78,9 @@ void module_remove_driver(struct device_driver *drv) + if (!drv) + return; + ++ /* Synchronize with dev_uevent() */ ++ synchronize_rcu(); ++ + sysfs_remove_link(&drv->p->kobj, "module"); + + if (drv->owner) +diff --git a/drivers/block/rbd.c b/drivers/block/rbd.c +index 3d6b12f27d0c65..f617fc3a110227 100644 +--- a/drivers/block/rbd.c ++++ b/drivers/block/rbd.c +@@ -362,7 +362,7 @@ enum rbd_watch_state { + enum rbd_lock_state { + RBD_LOCK_STATE_UNLOCKED, + RBD_LOCK_STATE_LOCKED, +- RBD_LOCK_STATE_RELEASING, ++ RBD_LOCK_STATE_QUIESCING, + }; + + /* WatchNotify::ClientId */ +@@ -422,7 +422,7 @@ struct rbd_device { + struct list_head running_list; + struct completion acquire_wait; + int acquire_err; +- struct completion releasing_wait; ++ struct completion quiescing_wait; + + spinlock_t object_map_lock; + u8 *object_map; +@@ -525,7 +525,7 @@ static bool __rbd_is_lock_owner(struct rbd_device *rbd_dev) + lockdep_assert_held(&rbd_dev->lock_rwsem); + + return rbd_dev->lock_state == RBD_LOCK_STATE_LOCKED || +- rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING; ++ rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING; + } + + static bool rbd_is_lock_owner(struct rbd_device *rbd_dev) +@@ -3459,13 +3459,14 @@ static void rbd_lock_del_request(struct rbd_img_request *img_req) + lockdep_assert_held(&rbd_dev->lock_rwsem); + spin_lock(&rbd_dev->lock_lists_lock); + if (!list_empty(&img_req->lock_item)) { ++ rbd_assert(!list_empty(&rbd_dev->running_list)); + list_del_init(&img_req->lock_item); +- need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING && ++ need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING && + list_empty(&rbd_dev->running_list)); + } + spin_unlock(&rbd_dev->lock_lists_lock); + if (need_wakeup) +- complete(&rbd_dev->releasing_wait); ++ complete(&rbd_dev->quiescing_wait); + } + + static int rbd_img_exclusive_lock(struct rbd_img_request *img_req) +@@ -3478,11 +3479,6 @@ static int rbd_img_exclusive_lock(struct rbd_img_request *img_req) + if (rbd_lock_add_request(img_req)) + return 1; + +- if (rbd_dev->opts->exclusive) { +- WARN_ON(1); /* lock got released? */ +- return -EROFS; +- } +- + /* + * Note the use of mod_delayed_work() in rbd_acquire_lock() + * and cancel_delayed_work() in wake_lock_waiters(). +@@ -4183,16 +4179,16 @@ static bool rbd_quiesce_lock(struct rbd_device *rbd_dev) + /* + * Ensure that all in-flight IO is flushed. + */ +- rbd_dev->lock_state = RBD_LOCK_STATE_RELEASING; +- rbd_assert(!completion_done(&rbd_dev->releasing_wait)); ++ rbd_dev->lock_state = RBD_LOCK_STATE_QUIESCING; ++ rbd_assert(!completion_done(&rbd_dev->quiescing_wait)); + if (list_empty(&rbd_dev->running_list)) + return true; + + up_write(&rbd_dev->lock_rwsem); +- wait_for_completion(&rbd_dev->releasing_wait); ++ wait_for_completion(&rbd_dev->quiescing_wait); + + down_write(&rbd_dev->lock_rwsem); +- if (rbd_dev->lock_state != RBD_LOCK_STATE_RELEASING) ++ if (rbd_dev->lock_state != RBD_LOCK_STATE_QUIESCING) + return false; + + rbd_assert(list_empty(&rbd_dev->running_list)); +@@ -4603,6 +4599,10 @@ static void rbd_reacquire_lock(struct rbd_device *rbd_dev) + rbd_warn(rbd_dev, "failed to update lock cookie: %d", + ret); + ++ if (rbd_dev->opts->exclusive) ++ rbd_warn(rbd_dev, ++ "temporarily releasing lock on exclusive mapping"); ++ + /* + * Lock cookie cannot be updated on older OSDs, so do + * a manual release and queue an acquire. +@@ -5387,7 +5387,7 @@ static struct rbd_device *__rbd_dev_create(struct rbd_spec *spec) + INIT_LIST_HEAD(&rbd_dev->acquiring_list); + INIT_LIST_HEAD(&rbd_dev->running_list); + init_completion(&rbd_dev->acquire_wait); +- init_completion(&rbd_dev->releasing_wait); ++ init_completion(&rbd_dev->quiescing_wait); + + spin_lock_init(&rbd_dev->object_map_lock); + +@@ -6592,11 +6592,6 @@ static int rbd_add_acquire_lock(struct rbd_device *rbd_dev) + if (ret) + return ret; + +- /* +- * The lock may have been released by now, unless automatic lock +- * transitions are disabled. +- */ +- rbd_assert(!rbd_dev->opts->exclusive || rbd_is_lock_owner(rbd_dev)); + return 0; + } + +diff --git a/drivers/bluetooth/btusb.c b/drivers/bluetooth/btusb.c +index 8c3db223d634e7..e45bfe8463a42f 100644 +--- a/drivers/bluetooth/btusb.c ++++ b/drivers/bluetooth/btusb.c +@@ -559,6 +559,10 @@ static const struct usb_device_id blacklist_table[] = { + BTUSB_WIDEBAND_SPEECH }, + { USB_DEVICE(0x0cb5, 0xc547), .driver_info = BTUSB_REALTEK | + BTUSB_WIDEBAND_SPEECH }, ++ { USB_DEVICE(0x13d3, 0x3591), .driver_info = BTUSB_REALTEK | ++ BTUSB_WIDEBAND_SPEECH }, ++ { USB_DEVICE(0x0489, 0xe125), .driver_info = BTUSB_REALTEK | ++ BTUSB_WIDEBAND_SPEECH }, + + /* Silicon Wave based devices */ + { USB_DEVICE(0x0c10, 0x0000), .driver_info = BTUSB_SWAVE }, +diff --git a/drivers/char/hw_random/amd-rng.c b/drivers/char/hw_random/amd-rng.c +index 0555e3838bce1f..5229da114377ae 100644 +--- a/drivers/char/hw_random/amd-rng.c ++++ b/drivers/char/hw_random/amd-rng.c +@@ -142,8 +142,10 @@ static int __init amd_rng_mod_init(void) + + found: + err = pci_read_config_dword(pdev, 0x58, &pmbase); +- if (err) ++ if (err) { ++ err = pcibios_err_to_errno(err); + goto put_dev; ++ } + + pmbase &= 0x0000FF00; + if (pmbase == 0) { +diff --git a/drivers/char/tpm/eventlog/common.c b/drivers/char/tpm/eventlog/common.c +index 8512ec76d5260d..4a6186f9f8899f 100644 +--- a/drivers/char/tpm/eventlog/common.c ++++ b/drivers/char/tpm/eventlog/common.c +@@ -47,6 +47,8 @@ static int tpm_bios_measurements_open(struct inode *inode, + if (!err) { + seq = file->private_data; + seq->private = chip; ++ } else { ++ put_device(&chip->dev); + } + + return err; +diff --git a/drivers/clk/davinci/da8xx-cfgchip.c b/drivers/clk/davinci/da8xx-cfgchip.c +index 77d18276bfe82c..90d96ee4a58b34 100644 +--- a/drivers/clk/davinci/da8xx-cfgchip.c ++++ b/drivers/clk/davinci/da8xx-cfgchip.c +@@ -505,7 +505,7 @@ da8xx_cfgchip_register_usb0_clk48(struct device *dev, + const char * const parent_names[] = { "usb_refclkin", "pll0_auxclk" }; + struct clk *fck_clk; + struct da8xx_usb0_clk48 *usb0; +- struct clk_init_data init; ++ struct clk_init_data init = {}; + int ret; + + fck_clk = devm_clk_get(dev, "fck"); +@@ -580,7 +580,7 @@ da8xx_cfgchip_register_usb1_clk48(struct device *dev, + { + const char * const parent_names[] = { "usb0_clk48", "usb_refclkin" }; + struct da8xx_usb1_clk48 *usb1; +- struct clk_init_data init; ++ struct clk_init_data init = {}; + int ret; + + usb1 = devm_kzalloc(dev, sizeof(*usb1), GFP_KERNEL); +diff --git a/drivers/clk/qcom/clk-branch.h b/drivers/clk/qcom/clk-branch.h +index 17a58119165e89..55b3a2c3afed9b 100644 +--- a/drivers/clk/qcom/clk-branch.h ++++ b/drivers/clk/qcom/clk-branch.h +@@ -37,6 +37,32 @@ struct clk_branch { + struct clk_regmap clkr; + }; + ++/* Branch clock common bits for HLOS-owned clocks */ ++#define CBCR_FORCE_MEM_CORE_ON BIT(14) ++#define CBCR_FORCE_MEM_PERIPH_ON BIT(13) ++#define CBCR_FORCE_MEM_PERIPH_OFF BIT(12) ++ ++static inline void qcom_branch_set_force_mem_core(struct regmap *regmap, ++ struct clk_branch clk, bool on) ++{ ++ regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_CORE_ON, ++ on ? CBCR_FORCE_MEM_CORE_ON : 0); ++} ++ ++static inline void qcom_branch_set_force_periph_on(struct regmap *regmap, ++ struct clk_branch clk, bool on) ++{ ++ regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_PERIPH_ON, ++ on ? CBCR_FORCE_MEM_PERIPH_ON : 0); ++} ++ ++static inline void qcom_branch_set_force_periph_off(struct regmap *regmap, ++ struct clk_branch clk, bool on) ++{ ++ regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_PERIPH_OFF, ++ on ? CBCR_FORCE_MEM_PERIPH_OFF : 0); ++} ++ + extern const struct clk_ops clk_branch_ops; + extern const struct clk_ops clk_branch2_ops; + extern const struct clk_ops clk_branch_simple_ops; +diff --git a/drivers/clk/qcom/gcc-sc7280.c b/drivers/clk/qcom/gcc-sc7280.c +index d10efbf260b7ae..76d5a9f49d8e61 100644 +--- a/drivers/clk/qcom/gcc-sc7280.c ++++ b/drivers/clk/qcom/gcc-sc7280.c +@@ -3573,6 +3573,9 @@ static int gcc_sc7280_probe(struct platform_device *pdev) + regmap_update_bits(regmap, 0x71004, BIT(0), BIT(0)); + regmap_update_bits(regmap, 0x7100C, BIT(13), BIT(13)); + ++ /* FORCE_MEM_CORE_ON for ufs phy ice core clocks */ ++ qcom_branch_set_force_mem_core(regmap, gcc_ufs_phy_ice_core_clk, true); ++ + ret = qcom_cc_register_rcg_dfs(regmap, gcc_dfs_clocks, + ARRAY_SIZE(gcc_dfs_clocks)); + if (ret) +diff --git a/drivers/clocksource/sh_cmt.c b/drivers/clocksource/sh_cmt.c +index d35548aa026fb8..8e06767e0d4cb3 100644 +--- a/drivers/clocksource/sh_cmt.c ++++ b/drivers/clocksource/sh_cmt.c +@@ -529,6 +529,7 @@ static void sh_cmt_set_next(struct sh_cmt_channel *ch, unsigned long delta) + static irqreturn_t sh_cmt_interrupt(int irq, void *dev_id) + { + struct sh_cmt_channel *ch = dev_id; ++ unsigned long flags; + + /* clear flags */ + sh_cmt_write_cmcsr(ch, sh_cmt_read_cmcsr(ch) & +@@ -559,6 +560,8 @@ static irqreturn_t sh_cmt_interrupt(int irq, void *dev_id) + + ch->flags &= ~FLAG_SKIPEVENT; + ++ raw_spin_lock_irqsave(&ch->lock, flags); ++ + if (ch->flags & FLAG_REPROGRAM) { + ch->flags &= ~FLAG_REPROGRAM; + sh_cmt_clock_event_program_verify(ch, 1); +@@ -571,6 +574,8 @@ static irqreturn_t sh_cmt_interrupt(int irq, void *dev_id) + + ch->flags &= ~FLAG_IRQCONTEXT; + ++ raw_spin_unlock_irqrestore(&ch->lock, flags); ++ + return IRQ_HANDLED; + } + +@@ -781,12 +786,18 @@ static int sh_cmt_clock_event_next(unsigned long delta, + struct clock_event_device *ced) + { + struct sh_cmt_channel *ch = ced_to_sh_cmt(ced); ++ unsigned long flags; + + BUG_ON(!clockevent_state_oneshot(ced)); ++ ++ raw_spin_lock_irqsave(&ch->lock, flags); ++ + if (likely(ch->flags & FLAG_IRQCONTEXT)) + ch->next_match_value = delta - 1; + else +- sh_cmt_set_next(ch, delta - 1); ++ __sh_cmt_set_next(ch, delta - 1); ++ ++ raw_spin_unlock_irqrestore(&ch->lock, flags); + + return 0; + } +diff --git a/drivers/dma/ti/k3-udma.c b/drivers/dma/ti/k3-udma.c +index 698fb898847c1b..9db45c4eaaf246 100644 +--- a/drivers/dma/ti/k3-udma.c ++++ b/drivers/dma/ti/k3-udma.c +@@ -4415,7 +4415,9 @@ static int udma_get_mmrs(struct platform_device *pdev, struct udma_dev *ud) + ud->rchan_cnt = UDMA_CAP2_RCHAN_CNT(cap2); + break; + case DMA_TYPE_BCDMA: +- ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2); ++ ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2) + ++ BCDMA_CAP3_HBCHAN_CNT(cap3) + ++ BCDMA_CAP3_UBCHAN_CNT(cap3); + ud->tchan_cnt = BCDMA_CAP2_TCHAN_CNT(cap2); + ud->rchan_cnt = BCDMA_CAP2_RCHAN_CNT(cap2); + ud->rflow_cnt = ud->rchan_cnt; +diff --git a/drivers/edac/Makefile b/drivers/edac/Makefile +index 2d1641a27a28f5..a98e1981df1579 100644 +--- a/drivers/edac/Makefile ++++ b/drivers/edac/Makefile +@@ -54,11 +54,13 @@ obj-$(CONFIG_EDAC_MPC85XX) += mpc85xx_edac_mod.o + layerscape_edac_mod-y := fsl_ddr_edac.o layerscape_edac.o + obj-$(CONFIG_EDAC_LAYERSCAPE) += layerscape_edac_mod.o + +-skx_edac-y := skx_common.o skx_base.o +-obj-$(CONFIG_EDAC_SKX) += skx_edac.o ++skx_edac_common-y := skx_common.o + +-i10nm_edac-y := skx_common.o i10nm_base.o +-obj-$(CONFIG_EDAC_I10NM) += i10nm_edac.o ++skx_edac-y := skx_base.o ++obj-$(CONFIG_EDAC_SKX) += skx_edac.o skx_edac_common.o ++ ++i10nm_edac-y := i10nm_base.o ++obj-$(CONFIG_EDAC_I10NM) += i10nm_edac.o skx_edac_common.o + + obj-$(CONFIG_EDAC_CELL) += cell_edac.o + obj-$(CONFIG_EDAC_PPC4XX) += ppc4xx_edac.o +diff --git a/drivers/edac/skx_common.c b/drivers/edac/skx_common.c +index 19c17c5198c5f9..88c44d5359076e 100644 +--- a/drivers/edac/skx_common.c ++++ b/drivers/edac/skx_common.c +@@ -46,7 +46,7 @@ static u64 skx_tolm, skx_tohm; + static LIST_HEAD(dev_edac_list); + static bool skx_mem_cfg_2lm; + +-int __init skx_adxl_get(void) ++int skx_adxl_get(void) + { + const char * const *names; + int i, j; +@@ -108,12 +108,14 @@ int __init skx_adxl_get(void) + + return -ENODEV; + } ++EXPORT_SYMBOL_GPL(skx_adxl_get); + +-void __exit skx_adxl_put(void) ++void skx_adxl_put(void) + { + kfree(adxl_values); + kfree(adxl_msg); + } ++EXPORT_SYMBOL_GPL(skx_adxl_put); + + static bool skx_adxl_decode(struct decoded_addr *res, bool error_in_1st_level_mem) + { +@@ -180,12 +182,14 @@ void skx_set_mem_cfg(bool mem_cfg_2lm) + { + skx_mem_cfg_2lm = mem_cfg_2lm; + } ++EXPORT_SYMBOL_GPL(skx_set_mem_cfg); + + void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log) + { + skx_decode = decode; + skx_show_retry_rd_err_log = show_retry_log; + } ++EXPORT_SYMBOL_GPL(skx_set_decode); + + int skx_get_src_id(struct skx_dev *d, int off, u8 *id) + { +@@ -199,6 +203,7 @@ int skx_get_src_id(struct skx_dev *d, int off, u8 *id) + *id = GET_BITFIELD(reg, 12, 14); + return 0; + } ++EXPORT_SYMBOL_GPL(skx_get_src_id); + + int skx_get_node_id(struct skx_dev *d, u8 *id) + { +@@ -212,6 +217,7 @@ int skx_get_node_id(struct skx_dev *d, u8 *id) + *id = GET_BITFIELD(reg, 0, 2); + return 0; + } ++EXPORT_SYMBOL_GPL(skx_get_node_id); + + static int get_width(u32 mtr) + { +@@ -277,6 +283,7 @@ int skx_get_all_bus_mappings(struct res_config *cfg, struct list_head **list) + *list = &dev_edac_list; + return ndev; + } ++EXPORT_SYMBOL_GPL(skx_get_all_bus_mappings); + + int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm) + { +@@ -316,6 +323,7 @@ int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm) + pci_dev_put(pdev); + return -ENODEV; + } ++EXPORT_SYMBOL_GPL(skx_get_hi_lo); + + static int skx_get_dimm_attr(u32 reg, int lobit, int hibit, int add, + int minval, int maxval, const char *name) +@@ -387,6 +395,7 @@ int skx_get_dimm_info(u32 mtr, u32 mcmtr, u32 amap, struct dimm_info *dimm, + + return 1; + } ++EXPORT_SYMBOL_GPL(skx_get_dimm_info); + + int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc, + int chan, int dimmno, const char *mod_str) +@@ -435,6 +444,7 @@ int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc, + + return (size == 0 || size == ~0ull) ? 0 : 1; + } ++EXPORT_SYMBOL_GPL(skx_get_nvdimm_info); + + int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev, + const char *ctl_name, const char *mod_str, +@@ -505,6 +515,7 @@ int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev, + imc->mci = NULL; + return rc; + } ++EXPORT_SYMBOL_GPL(skx_register_mci); + + static void skx_unregister_mci(struct skx_imc *imc) + { +@@ -686,6 +697,7 @@ int skx_mce_check_error(struct notifier_block *nb, unsigned long val, + mce->kflags |= MCE_HANDLED_EDAC; + return NOTIFY_DONE; + } ++EXPORT_SYMBOL_GPL(skx_mce_check_error); + + void skx_remove(void) + { +@@ -723,3 +735,8 @@ void skx_remove(void) + kfree(d); + } + } ++EXPORT_SYMBOL_GPL(skx_remove); ++ ++MODULE_LICENSE("GPL v2"); ++MODULE_AUTHOR("Tony Luck"); ++MODULE_DESCRIPTION("MC Driver for Intel server processors"); +diff --git a/drivers/edac/skx_common.h b/drivers/edac/skx_common.h +index 03ac067a80b9f7..13f761930b4f86 100644 +--- a/drivers/edac/skx_common.h ++++ b/drivers/edac/skx_common.h +@@ -162,8 +162,8 @@ typedef int (*get_dimm_config_f)(struct mem_ctl_info *mci, + typedef bool (*skx_decode_f)(struct decoded_addr *res); + typedef void (*skx_show_retry_log_f)(struct decoded_addr *res, char *msg, int len, bool scrub_err); + +-int __init skx_adxl_get(void); +-void __exit skx_adxl_put(void); ++int skx_adxl_get(void); ++void skx_adxl_put(void); + void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log); + void skx_set_mem_cfg(bool mem_cfg_2lm); + +diff --git a/drivers/firmware/turris-mox-rwtm.c b/drivers/firmware/turris-mox-rwtm.c +index c2d34dc8ba4628..c3d49fcc53305f 100644 +--- a/drivers/firmware/turris-mox-rwtm.c ++++ b/drivers/firmware/turris-mox-rwtm.c +@@ -2,7 +2,7 @@ + /* + * Turris Mox rWTM firmware driver + * +- * Copyright (C) 2019 Marek Behún <kabel@kernel.org> ++ * Copyright (C) 2019, 2024 Marek Behún <kabel@kernel.org> + */ + + #include <linux/armada-37xx-rwtm-mailbox.h> +@@ -174,6 +174,9 @@ static void mox_rwtm_rx_callback(struct mbox_client *cl, void *data) + struct mox_rwtm *rwtm = dev_get_drvdata(cl->dev); + struct armada_37xx_rwtm_rx_msg *msg = data; + ++ if (completion_done(&rwtm->cmd_done)) ++ return; ++ + rwtm->reply = *msg; + complete(&rwtm->cmd_done); + } +@@ -199,9 +202,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm) + if (ret < 0) + return ret; + +- ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2); +- if (ret < 0) +- return ret; ++ if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2)) ++ return -ETIMEDOUT; + + ret = mox_get_status(MBOX_CMD_BOARD_INFO, reply->retval); + if (ret == -ENODATA) { +@@ -235,9 +237,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm) + if (ret < 0) + return ret; + +- ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2); +- if (ret < 0) +- return ret; ++ if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2)) ++ return -ETIMEDOUT; + + ret = mox_get_status(MBOX_CMD_ECDSA_PUB_KEY, reply->retval); + if (ret == -ENODATA) { +@@ -274,9 +275,8 @@ static int check_get_random_support(struct mox_rwtm *rwtm) + if (ret < 0) + return ret; + +- ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2); +- if (ret < 0) +- return ret; ++ if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2)) ++ return -ETIMEDOUT; + + return mox_get_status(MBOX_CMD_GET_RANDOM, rwtm->reply.retval); + } +@@ -499,6 +499,7 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev) + platform_set_drvdata(pdev, rwtm); + + mutex_init(&rwtm->busy); ++ init_completion(&rwtm->cmd_done); + + rwtm->mbox_client.dev = dev; + rwtm->mbox_client.rx_callback = mox_rwtm_rx_callback; +@@ -512,8 +513,6 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev) + goto remove_files; + } + +- init_completion(&rwtm->cmd_done); +- + ret = mox_get_board_info(rwtm); + if (ret < 0) + dev_warn(dev, "Cannot read board information: %i\n", ret); +diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c +index 5f6c32ec674d39..300d3b236bb351 100644 +--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c ++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c +@@ -5531,7 +5531,7 @@ int amdgpu_device_baco_exit(struct drm_device *dev) + adev->nbio.funcs->enable_doorbell_interrupt) + adev->nbio.funcs->enable_doorbell_interrupt(adev, true); + +- if (amdgpu_passthrough(adev) && ++ if (amdgpu_passthrough(adev) && adev->nbio.funcs && + adev->nbio.funcs->clear_doorbell_interrupt) + adev->nbio.funcs->clear_doorbell_interrupt(adev); + +diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c +index c963b87014b69d..92a4f07858785f 100644 +--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c ++++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c +@@ -1509,12 +1509,15 @@ static void amdgpu_ras_interrupt_process_handler(struct work_struct *work) + int amdgpu_ras_interrupt_dispatch(struct amdgpu_device *adev, + struct ras_dispatch_if *info) + { +- struct ras_manager *obj = amdgpu_ras_find_obj(adev, &info->head); +- struct ras_ih_data *data = &obj->ih_data; ++ struct ras_manager *obj; ++ struct ras_ih_data *data; + ++ obj = amdgpu_ras_find_obj(adev, &info->head); + if (!obj) + return -EINVAL; + ++ data = &obj->ih_data; ++ + if (data->inuse == 0) + return 0; + +diff --git a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c +index 3ed9e8ed351805..1a39103ac10f0a 100644 +--- a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c ++++ b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c +@@ -298,6 +298,14 @@ static void sdma_v5_2_ring_set_wptr(struct amdgpu_ring *ring) + DRM_DEBUG("calling WDOORBELL64(0x%08x, 0x%016llx)\n", + ring->doorbell_index, ring->wptr << 2); + WDOORBELL64(ring->doorbell_index, ring->wptr << 2); ++ /* SDMA seems to miss doorbells sometimes when powergating kicks in. ++ * Updating the wptr directly will wake it. This is only safe because ++ * we disallow gfxoff in begin_use() and then allow it again in end_use(). ++ */ ++ WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR), ++ lower_32_bits(ring->wptr << 2)); ++ WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR_HI), ++ upper_32_bits(ring->wptr << 2)); + } else { + DRM_DEBUG("Not using doorbell -- " + "mmSDMA%i_GFX_RB_WPTR == 0x%08x " +@@ -1675,6 +1683,10 @@ static void sdma_v5_2_ring_begin_use(struct amdgpu_ring *ring) + * but it shouldn't hurt for other parts since + * this GFXOFF will be disallowed anyway when SDMA is + * active, this just makes it explicit. ++ * sdma_v5_2_ring_set_wptr() takes advantage of this ++ * to update the wptr because sometimes SDMA seems to miss ++ * doorbells when entering PG. If you remove this, update ++ * sdma_v5_2_ring_set_wptr() as well! + */ + amdgpu_gfx_off_ctrl(adev, false); + } +diff --git a/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c b/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c +index b821abb56ac3b7..333be054189351 100644 +--- a/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c ++++ b/drivers/gpu/drm/amd/display/amdgpu_dm/amdgpu_dm.c +@@ -2431,7 +2431,8 @@ static int dm_suspend(void *handle) + + dm->cached_dc_state = dc_copy_state(dm->dc->current_state); + +- dm_gpureset_toggle_interrupts(adev, dm->cached_dc_state, false); ++ if (dm->cached_dc_state) ++ dm_gpureset_toggle_interrupts(adev, dm->cached_dc_state, false); + + amdgpu_dm_commit_zero_streams(dm->dc); + +@@ -6884,7 +6885,8 @@ static void create_eml_sink(struct amdgpu_dm_connector *aconnector) + aconnector->dc_sink = aconnector->dc_link->local_sink ? + aconnector->dc_link->local_sink : + aconnector->dc_em_sink; +- dc_sink_retain(aconnector->dc_sink); ++ if (aconnector->dc_sink) ++ dc_sink_retain(aconnector->dc_sink); + } + } + +@@ -8218,7 +8220,8 @@ static int amdgpu_dm_connector_get_modes(struct drm_connector *connector) + drm_add_modes_noedid(connector, 640, 480); + } else { + amdgpu_dm_connector_ddc_get_modes(connector, edid); +- amdgpu_dm_connector_add_common_modes(encoder, connector); ++ if (encoder) ++ amdgpu_dm_connector_add_common_modes(encoder, connector); + amdgpu_dm_connector_add_freesync_modes(connector, edid); + } + amdgpu_dm_fbc_init(connector); +diff --git a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c +index e6b9c6a718413a..c8e21c9d2e42ff 100644 +--- a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c ++++ b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c +@@ -154,7 +154,8 @@ const struct dc_plane_status *dc_plane_get_status( + if (pipe_ctx->plane_state != plane_state) + continue; + +- pipe_ctx->plane_state->status.is_flip_pending = false; ++ if (pipe_ctx->plane_state) ++ pipe_ctx->plane_state->status.is_flip_pending = false; + + break; + } +diff --git a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu7_hwmgr.c b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu7_hwmgr.c +index 9bfc465d08fb06..9c7c3c06327d98 100644 +--- a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu7_hwmgr.c ++++ b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu7_hwmgr.c +@@ -2907,6 +2907,7 @@ static int smu7_update_edc_leakage_table(struct pp_hwmgr *hwmgr) + + static int smu7_hwmgr_backend_init(struct pp_hwmgr *hwmgr) + { ++ struct amdgpu_device *adev = hwmgr->adev; + struct smu7_hwmgr *data; + int result = 0; + +@@ -2943,40 +2944,37 @@ static int smu7_hwmgr_backend_init(struct pp_hwmgr *hwmgr) + /* Initalize Dynamic State Adjustment Rule Settings */ + result = phm_initializa_dynamic_state_adjustment_rule_settings(hwmgr); + +- if (0 == result) { +- struct amdgpu_device *adev = hwmgr->adev; ++ if (result) ++ goto fail; + +- data->is_tlu_enabled = false; ++ data->is_tlu_enabled = false; + +- hwmgr->platform_descriptor.hardwareActivityPerformanceLevels = ++ hwmgr->platform_descriptor.hardwareActivityPerformanceLevels = + SMU7_MAX_HARDWARE_POWERLEVELS; +- hwmgr->platform_descriptor.hardwarePerformanceLevels = 2; +- hwmgr->platform_descriptor.minimumClocksReductionPercentage = 50; ++ hwmgr->platform_descriptor.hardwarePerformanceLevels = 2; ++ hwmgr->platform_descriptor.minimumClocksReductionPercentage = 50; + +- data->pcie_gen_cap = adev->pm.pcie_gen_mask; +- if (data->pcie_gen_cap & CAIL_PCIE_LINK_SPEED_SUPPORT_GEN3) +- data->pcie_spc_cap = 20; +- else +- data->pcie_spc_cap = 16; +- data->pcie_lane_cap = adev->pm.pcie_mlw_mask; +- +- hwmgr->platform_descriptor.vbiosInterruptId = 0x20000400; /* IRQ_SOURCE1_SW_INT */ +-/* The true clock step depends on the frequency, typically 4.5 or 9 MHz. Here we use 5. */ +- hwmgr->platform_descriptor.clockStep.engineClock = 500; +- hwmgr->platform_descriptor.clockStep.memoryClock = 500; +- smu7_thermal_parameter_init(hwmgr); +- } else { +- /* Ignore return value in here, we are cleaning up a mess. */ +- smu7_hwmgr_backend_fini(hwmgr); +- } ++ data->pcie_gen_cap = adev->pm.pcie_gen_mask; ++ if (data->pcie_gen_cap & CAIL_PCIE_LINK_SPEED_SUPPORT_GEN3) ++ data->pcie_spc_cap = 20; ++ else ++ data->pcie_spc_cap = 16; ++ data->pcie_lane_cap = adev->pm.pcie_mlw_mask; ++ ++ hwmgr->platform_descriptor.vbiosInterruptId = 0x20000400; /* IRQ_SOURCE1_SW_INT */ ++ /* The true clock step depends on the frequency, typically 4.5 or 9 MHz. Here we use 5. */ ++ hwmgr->platform_descriptor.clockStep.engineClock = 500; ++ hwmgr->platform_descriptor.clockStep.memoryClock = 500; ++ smu7_thermal_parameter_init(hwmgr); + + result = smu7_update_edc_leakage_table(hwmgr); +- if (result) { +- smu7_hwmgr_backend_fini(hwmgr); +- return result; +- } ++ if (result) ++ goto fail; + + return 0; ++fail: ++ smu7_hwmgr_backend_fini(hwmgr); ++ return result; + } + + static int smu7_force_dpm_highest(struct pp_hwmgr *hwmgr) +@@ -3277,8 +3275,7 @@ static int smu7_apply_state_adjust_rules(struct pp_hwmgr *hwmgr, + const struct pp_power_state *current_ps) + { + struct amdgpu_device *adev = hwmgr->adev; +- struct smu7_power_state *smu7_ps = +- cast_phw_smu7_power_state(&request_ps->hardware); ++ struct smu7_power_state *smu7_ps; + uint32_t sclk; + uint32_t mclk; + struct PP_Clocks minimum_clocks = {0}; +@@ -3295,6 +3292,10 @@ static int smu7_apply_state_adjust_rules(struct pp_hwmgr *hwmgr, + uint32_t latency; + bool latency_allowed = false; + ++ smu7_ps = cast_phw_smu7_power_state(&request_ps->hardware); ++ if (!smu7_ps) ++ return -EINVAL; ++ + data->battery_state = (PP_StateUILabel_Battery == + request_ps->classification.ui_label); + data->mclk_ignore_signal = false; +diff --git a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu8_hwmgr.c b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu8_hwmgr.c +index 03bf8f0692228d..f0f8ebffd9f2f7 100644 +--- a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu8_hwmgr.c ++++ b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/smu8_hwmgr.c +@@ -1051,16 +1051,18 @@ static int smu8_apply_state_adjust_rules(struct pp_hwmgr *hwmgr, + struct pp_power_state *prequest_ps, + const struct pp_power_state *pcurrent_ps) + { +- struct smu8_power_state *smu8_ps = +- cast_smu8_power_state(&prequest_ps->hardware); +- +- const struct smu8_power_state *smu8_current_ps = +- cast_const_smu8_power_state(&pcurrent_ps->hardware); +- ++ struct smu8_power_state *smu8_ps; ++ const struct smu8_power_state *smu8_current_ps; + struct smu8_hwmgr *data = hwmgr->backend; + struct PP_Clocks clocks = {0, 0, 0, 0}; + bool force_high; + ++ smu8_ps = cast_smu8_power_state(&prequest_ps->hardware); ++ smu8_current_ps = cast_const_smu8_power_state(&pcurrent_ps->hardware); ++ ++ if (!smu8_ps || !smu8_current_ps) ++ return -EINVAL; ++ + smu8_ps->need_dfs_bypass = true; + + data->battery_state = (PP_StateUILabel_Battery == prequest_ps->classification.ui_label); +diff --git a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/vega10_hwmgr.c b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/vega10_hwmgr.c +index e6336654c5655e..aba8904ac75f71 100644 +--- a/drivers/gpu/drm/amd/pm/powerplay/hwmgr/vega10_hwmgr.c ++++ b/drivers/gpu/drm/amd/pm/powerplay/hwmgr/vega10_hwmgr.c +@@ -3237,8 +3237,7 @@ static int vega10_apply_state_adjust_rules(struct pp_hwmgr *hwmgr, + const struct pp_power_state *current_ps) + { + struct amdgpu_device *adev = hwmgr->adev; +- struct vega10_power_state *vega10_ps = +- cast_phw_vega10_power_state(&request_ps->hardware); ++ struct vega10_power_state *vega10_ps; + uint32_t sclk; + uint32_t mclk; + struct PP_Clocks minimum_clocks = {0}; +@@ -3256,6 +3255,10 @@ static int vega10_apply_state_adjust_rules(struct pp_hwmgr *hwmgr, + uint32_t stable_pstate_sclk = 0, stable_pstate_mclk = 0; + uint32_t latency; + ++ vega10_ps = cast_phw_vega10_power_state(&request_ps->hardware); ++ if (!vega10_ps) ++ return -EINVAL; ++ + data->battery_state = (PP_StateUILabel_Battery == + request_ps->classification.ui_label); + +diff --git a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c +index a3723ba3592315..7671a8b3c195a2 100644 +--- a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c ++++ b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c +@@ -69,8 +69,8 @@ MODULE_FIRMWARE("amdgpu/aldebaran_smc.bin"); + #define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD_MASK 0x00000070L + #define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD__SHIFT 0x4 + #define smnPCIE_LC_SPEED_CNTL 0x11140290 +-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xC000 +-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0xE ++#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xE0 ++#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0x5 + + static const int link_width[] = {0, 1, 2, 4, 8, 12, 16}; + static const int link_speed[] = {25, 50, 80, 160}; +diff --git a/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c b/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c +index 6a4f20fccf8417..7b0bc9704eacb1 100644 +--- a/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c ++++ b/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c +@@ -1027,7 +1027,6 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, + u32 status_reg; + u8 *buffer = msg->buffer; + unsigned int i; +- int num_transferred = 0; + int ret; + + /* Buffer size of AUX CH is 16 bytes */ +@@ -1079,7 +1078,6 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, + reg = buffer[i]; + writel(reg, dp->reg_base + ANALOGIX_DP_BUF_DATA_0 + + 4 * i); +- num_transferred++; + } + } + +@@ -1127,7 +1125,6 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, + reg = readl(dp->reg_base + ANALOGIX_DP_BUF_DATA_0 + + 4 * i); + buffer[i] = (unsigned char)reg; +- num_transferred++; + } + } + +@@ -1144,7 +1141,7 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, + (msg->request & ~DP_AUX_I2C_MOT) == DP_AUX_NATIVE_READ) + msg->reply = DP_AUX_NATIVE_REPLY_ACK; + +- return num_transferred > 0 ? num_transferred : -EBUSY; ++ return msg->size; + + aux_error: + /* if aux err happen, reset aux */ +diff --git a/drivers/gpu/drm/drm_client_modeset.c b/drivers/gpu/drm/drm_client_modeset.c +index 957b6dd0751a8b..a95f9f3c71b062 100644 +--- a/drivers/gpu/drm/drm_client_modeset.c ++++ b/drivers/gpu/drm/drm_client_modeset.c +@@ -867,6 +867,11 @@ int drm_client_modeset_probe(struct drm_client_dev *client, unsigned int width, + + kfree(modeset->mode); + modeset->mode = drm_mode_duplicate(dev, mode); ++ if (!modeset->mode) { ++ ret = -ENOMEM; ++ break; ++ } ++ + drm_connector_get(connector); + modeset->connectors[modeset->num_connectors++] = connector; + modeset->x = offset->x; +diff --git a/drivers/gpu/drm/drm_dp_mst_topology.c b/drivers/gpu/drm/drm_dp_mst_topology.c +index 865c7f39143ecf..f24667a003a2b6 100644 +--- a/drivers/gpu/drm/drm_dp_mst_topology.c ++++ b/drivers/gpu/drm/drm_dp_mst_topology.c +@@ -2974,7 +2974,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr, + + /* FIXME: Actually do some real error handling here */ + ret = drm_dp_mst_wait_tx_reply(mstb, txmsg); +- if (ret <= 0) { ++ if (ret < 0) { + drm_err(mgr->dev, "Sending link address failed with %d\n", ret); + goto out; + } +@@ -3026,7 +3026,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr, + mutex_unlock(&mgr->lock); + + out: +- if (ret <= 0) ++ if (ret < 0) + mstb->link_address_sent = false; + kfree(txmsg); + return ret < 0 ? ret : changed; +diff --git a/drivers/gpu/drm/etnaviv/etnaviv_gem.c b/drivers/gpu/drm/etnaviv/etnaviv_gem.c +index f0b2540e60e46e..87da2278398ae5 100644 +--- a/drivers/gpu/drm/etnaviv/etnaviv_gem.c ++++ b/drivers/gpu/drm/etnaviv/etnaviv_gem.c +@@ -353,9 +353,11 @@ static void *etnaviv_gem_vmap_impl(struct etnaviv_gem_object *obj) + + static inline enum dma_data_direction etnaviv_op_to_dma_dir(u32 op) + { +- if (op & ETNA_PREP_READ) ++ op &= ETNA_PREP_READ | ETNA_PREP_WRITE; ++ ++ if (op == ETNA_PREP_READ) + return DMA_FROM_DEVICE; +- else if (op & ETNA_PREP_WRITE) ++ else if (op == ETNA_PREP_WRITE) + return DMA_TO_DEVICE; + else + return DMA_BIDIRECTIONAL; +diff --git a/drivers/gpu/drm/gma500/cdv_intel_lvds.c b/drivers/gpu/drm/gma500/cdv_intel_lvds.c +index 8a2219fcf9b482..c3eb15c2b3c390 100644 +--- a/drivers/gpu/drm/gma500/cdv_intel_lvds.c ++++ b/drivers/gpu/drm/gma500/cdv_intel_lvds.c +@@ -310,6 +310,9 @@ static int cdv_intel_lvds_get_modes(struct drm_connector *connector) + if (mode_dev->panel_fixed_mode != NULL) { + struct drm_display_mode *mode = + drm_mode_duplicate(dev, mode_dev->panel_fixed_mode); ++ if (!mode) ++ return 0; ++ + drm_mode_probed_add(connector, mode); + return 1; + } +diff --git a/drivers/gpu/drm/gma500/psb_intel_lvds.c b/drivers/gpu/drm/gma500/psb_intel_lvds.c +index ace95d4bdb6f88..cfecebc126c78d 100644 +--- a/drivers/gpu/drm/gma500/psb_intel_lvds.c ++++ b/drivers/gpu/drm/gma500/psb_intel_lvds.c +@@ -508,6 +508,9 @@ static int psb_intel_lvds_get_modes(struct drm_connector *connector) + if (mode_dev->panel_fixed_mode != NULL) { + struct drm_display_mode *mode = + drm_mode_duplicate(dev, mode_dev->panel_fixed_mode); ++ if (!mode) ++ return 0; ++ + drm_mode_probed_add(connector, mode); + return 1; + } +diff --git a/drivers/gpu/drm/i915/display/intel_dp.c b/drivers/gpu/drm/i915/display/intel_dp.c +index 7a3abeca4e5188..40852cb5831f84 100644 +--- a/drivers/gpu/drm/i915/display/intel_dp.c ++++ b/drivers/gpu/drm/i915/display/intel_dp.c +@@ -3627,6 +3627,8 @@ int intel_dp_retrain_link(struct intel_encoder *encoder, + !intel_dp_mst_is_master_trans(crtc_state)) + continue; + ++ intel_dp->link_trained = false; ++ + intel_dp_check_frl_training(intel_dp); + intel_dp_pcon_dsc_configure(intel_dp, crtc_state); + intel_dp_start_link_train(intel_dp, crtc_state); +diff --git a/drivers/gpu/drm/i915/gem/i915_gem_mman.c b/drivers/gpu/drm/i915/gem/i915_gem_mman.c +index 5c6362a55cfa2d..2c4ef176593f0a 100644 +--- a/drivers/gpu/drm/i915/gem/i915_gem_mman.c ++++ b/drivers/gpu/drm/i915/gem/i915_gem_mman.c +@@ -286,6 +286,41 @@ static vm_fault_t vm_fault_cpu(struct vm_fault *vmf) + return i915_error_to_vmf_fault(err); + } + ++static void set_address_limits(struct vm_area_struct *area, ++ struct i915_vma *vma, ++ unsigned long obj_offset, ++ unsigned long *start_vaddr, ++ unsigned long *end_vaddr) ++{ ++ unsigned long vm_start, vm_end, vma_size; /* user's memory parameters */ ++ long start, end; /* memory boundaries */ ++ ++ /* ++ * Let's move into the ">> PAGE_SHIFT" ++ * domain to be sure not to lose bits ++ */ ++ vm_start = area->vm_start >> PAGE_SHIFT; ++ vm_end = area->vm_end >> PAGE_SHIFT; ++ vma_size = vma->size >> PAGE_SHIFT; ++ ++ /* ++ * Calculate the memory boundaries by considering the offset ++ * provided by the user during memory mapping and the offset ++ * provided for the partial mapping. ++ */ ++ start = vm_start; ++ start -= obj_offset; ++ start += vma->ggtt_view.partial.offset; ++ end = start + vma_size; ++ ++ start = max_t(long, start, vm_start); ++ end = min_t(long, end, vm_end); ++ ++ /* Let's move back into the "<< PAGE_SHIFT" domain */ ++ *start_vaddr = (unsigned long)start << PAGE_SHIFT; ++ *end_vaddr = (unsigned long)end << PAGE_SHIFT; ++} ++ + static vm_fault_t vm_fault_gtt(struct vm_fault *vmf) + { + #define MIN_CHUNK_PAGES (SZ_1M >> PAGE_SHIFT) +@@ -298,14 +333,18 @@ static vm_fault_t vm_fault_gtt(struct vm_fault *vmf) + struct i915_ggtt *ggtt = &i915->ggtt; + bool write = area->vm_flags & VM_WRITE; + struct i915_gem_ww_ctx ww; ++ unsigned long obj_offset; ++ unsigned long start, end; /* memory boundaries */ + intel_wakeref_t wakeref; + struct i915_vma *vma; + pgoff_t page_offset; ++ unsigned long pfn; + int srcu; + int ret; + +- /* We don't use vmf->pgoff since that has the fake offset */ ++ obj_offset = area->vm_pgoff - drm_vma_node_start(&mmo->vma_node); + page_offset = (vmf->address - area->vm_start) >> PAGE_SHIFT; ++ page_offset += obj_offset; + + trace_i915_gem_object_fault(obj, page_offset, true, write); + +@@ -376,12 +415,14 @@ static vm_fault_t vm_fault_gtt(struct vm_fault *vmf) + if (ret) + goto err_unpin; + ++ set_address_limits(area, vma, obj_offset, &start, &end); ++ ++ pfn = (ggtt->gmadr.start + i915_ggtt_offset(vma)) >> PAGE_SHIFT; ++ pfn += (start - area->vm_start) >> PAGE_SHIFT; ++ pfn += obj_offset - vma->ggtt_view.partial.offset; ++ + /* Finally, remap it using the new GTT offset */ +- ret = remap_io_mapping(area, +- area->vm_start + (vma->ggtt_view.partial.offset << PAGE_SHIFT), +- (ggtt->gmadr.start + vma->node.start) >> PAGE_SHIFT, +- min_t(u64, vma->size, area->vm_end - area->vm_start), +- &ggtt->iomap); ++ ret = remap_io_mapping(area, start, pfn, end - start, &ggtt->iomap); + if (ret) + goto err_fence; + +diff --git a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c +index eac55083c5745f..02b353641eab63 100644 +--- a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c ++++ b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c +@@ -3231,11 +3231,7 @@ static void remove_from_engine(struct i915_request *rq) + + static bool can_preempt(struct intel_engine_cs *engine) + { +- if (GRAPHICS_VER(engine->i915) > 8) +- return true; +- +- /* GPGPU on bdw requires extra w/a; not implemented */ +- return engine->class != RENDER_CLASS; ++ return GRAPHICS_VER(engine->i915) > 8; + } + + static void kick_execlists(const struct i915_request *rq, int prio) +diff --git a/drivers/gpu/drm/mediatek/mtk_disp_ovl.c b/drivers/gpu/drm/mediatek/mtk_disp_ovl.c +index 411cf0f2166118..c54d56fb7b4c57 100644 +--- a/drivers/gpu/drm/mediatek/mtk_disp_ovl.c ++++ b/drivers/gpu/drm/mediatek/mtk_disp_ovl.c +@@ -204,27 +204,20 @@ int mtk_ovl_layer_check(struct device *dev, unsigned int idx, + struct mtk_plane_state *mtk_state) + { + struct drm_plane_state *state = &mtk_state->base; +- unsigned int rotation = 0; + +- rotation = drm_rotation_simplify(state->rotation, +- DRM_MODE_ROTATE_0 | +- DRM_MODE_REFLECT_X | +- DRM_MODE_REFLECT_Y); +- rotation &= ~DRM_MODE_ROTATE_0; +- +- /* We can only do reflection, not rotation */ +- if ((rotation & DRM_MODE_ROTATE_MASK) != 0) ++ /* check if any unsupported rotation is set */ ++ if (state->rotation & ~mtk_ovl_supported_rotations(dev)) + return -EINVAL; + + /* + * TODO: Rotating/reflecting YUV buffers is not supported at this time. + * Only RGB[AX] variants are supported. ++ * Since DRM_MODE_ROTATE_0 means "no rotation", we should not ++ * reject layers with this property. + */ +- if (state->fb->format->is_yuv && rotation != 0) ++ if (state->fb->format->is_yuv && (state->rotation & ~DRM_MODE_ROTATE_0)) + return -EINVAL; + +- state->rotation = rotation; +- + return 0; + } + +diff --git a/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.h b/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.h +index 25cb50f2391fa6..fa9616505ed6ae 100644 +--- a/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.h ++++ b/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.h +@@ -145,7 +145,11 @@ unsigned int mtk_ddp_comp_supported_rotations(struct mtk_ddp_comp *comp) + if (comp->funcs && comp->funcs->supported_rotations) + return comp->funcs->supported_rotations(comp->dev); + +- return 0; ++ /* ++ * In order to pass IGT tests, DRM_MODE_ROTATE_0 is required when ++ * rotation is not supported. ++ */ ++ return DRM_MODE_ROTATE_0; + } + + static inline unsigned int mtk_ddp_comp_layer_nr(struct mtk_ddp_comp *comp) +diff --git a/drivers/gpu/drm/mediatek/mtk_drm_plane.c b/drivers/gpu/drm/mediatek/mtk_drm_plane.c +index eda072a3bf9aee..b0c3bc2cf2f0f1 100644 +--- a/drivers/gpu/drm/mediatek/mtk_drm_plane.c ++++ b/drivers/gpu/drm/mediatek/mtk_drm_plane.c +@@ -154,6 +154,8 @@ static void mtk_plane_atomic_async_update(struct drm_plane *plane, + plane->state->src_y = new_state->src_y; + plane->state->src_h = new_state->src_h; + plane->state->src_w = new_state->src_w; ++ plane->state->dst.x1 = new_state->dst.x1; ++ plane->state->dst.y1 = new_state->dst.y1; + + mtk_plane_update_new_state(new_state, new_plane_state); + swap(plane->state->fb, new_state->fb); +@@ -256,7 +258,7 @@ int mtk_plane_init(struct drm_device *dev, struct drm_plane *plane, + return err; + } + +- if (supported_rotations & ~DRM_MODE_ROTATE_0) { ++ if (supported_rotations) { + err = drm_plane_create_rotation_property(plane, + DRM_MODE_ROTATE_0, + supported_rotations); +diff --git a/drivers/gpu/drm/meson/meson_drv.c b/drivers/gpu/drm/meson/meson_drv.c +index 207b309a21c07b..829aadc1258a17 100644 +--- a/drivers/gpu/drm/meson/meson_drv.c ++++ b/drivers/gpu/drm/meson/meson_drv.c +@@ -248,29 +248,20 @@ static int meson_drv_bind_master(struct device *dev, bool has_components) + if (ret) + goto free_drm; + ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_0); +- if (ret) { +- meson_canvas_free(priv->canvas, priv->canvas_id_osd1); +- goto free_drm; +- } ++ if (ret) ++ goto free_canvas_osd1; + ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_1); +- if (ret) { +- meson_canvas_free(priv->canvas, priv->canvas_id_osd1); +- meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0); +- goto free_drm; +- } ++ if (ret) ++ goto free_canvas_vd1_0; + ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_2); +- if (ret) { +- meson_canvas_free(priv->canvas, priv->canvas_id_osd1); +- meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0); +- meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1); +- goto free_drm; +- } ++ if (ret) ++ goto free_canvas_vd1_1; + + priv->vsync_irq = platform_get_irq(pdev, 0); + + ret = drm_vblank_init(drm, 1); + if (ret) +- goto free_drm; ++ goto free_canvas_vd1_2; + + /* Assign limits per soc revision/package */ + for (i = 0 ; i < ARRAY_SIZE(meson_drm_soc_attrs) ; ++i) { +@@ -286,11 +277,11 @@ static int meson_drv_bind_master(struct device *dev, bool has_components) + */ + ret = drm_aperture_remove_framebuffers(false, &meson_driver); + if (ret) +- goto free_drm; ++ goto free_canvas_vd1_2; + + ret = drmm_mode_config_init(drm); + if (ret) +- goto free_drm; ++ goto free_canvas_vd1_2; + drm->mode_config.max_width = 3840; + drm->mode_config.max_height = 2160; + drm->mode_config.funcs = &meson_mode_config_funcs; +@@ -305,7 +296,7 @@ static int meson_drv_bind_master(struct device *dev, bool has_components) + if (priv->afbcd.ops) { + ret = priv->afbcd.ops->init(priv); + if (ret) +- goto free_drm; ++ goto free_canvas_vd1_2; + } + + /* Encoder Initialization */ +@@ -364,6 +355,14 @@ static int meson_drv_bind_master(struct device *dev, bool has_components) + exit_afbcd: + if (priv->afbcd.ops) + priv->afbcd.ops->exit(priv); ++free_canvas_vd1_2: ++ meson_canvas_free(priv->canvas, priv->canvas_id_vd1_2); ++free_canvas_vd1_1: ++ meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1); ++free_canvas_vd1_0: ++ meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0); ++free_canvas_osd1: ++ meson_canvas_free(priv->canvas, priv->canvas_id_osd1); + free_drm: + drm_dev_put(drm); + +diff --git a/drivers/gpu/drm/mgag200/mgag200_i2c.c b/drivers/gpu/drm/mgag200/mgag200_i2c.c +index ac8e34eef5138b..07f7e43c0dca35 100644 +--- a/drivers/gpu/drm/mgag200/mgag200_i2c.c ++++ b/drivers/gpu/drm/mgag200/mgag200_i2c.c +@@ -134,7 +134,7 @@ struct mga_i2c_chan *mgag200_i2c_create(struct drm_device *dev) + i2c->adapter.algo_data = &i2c->bit; + + i2c->bit.udelay = 10; +- i2c->bit.timeout = 2; ++ i2c->bit.timeout = usecs_to_jiffies(2200); + i2c->bit.data = i2c; + i2c->bit.setsda = mga_gpio_setsda; + i2c->bit.setscl = mga_gpio_setscl; +diff --git a/drivers/gpu/drm/nouveau/nouveau_prime.c b/drivers/gpu/drm/nouveau/nouveau_prime.c +index 531615719f6da6..89fcbfdb5f0af1 100644 +--- a/drivers/gpu/drm/nouveau/nouveau_prime.c ++++ b/drivers/gpu/drm/nouveau/nouveau_prime.c +@@ -63,7 +63,8 @@ struct drm_gem_object *nouveau_gem_prime_import_sg_table(struct drm_device *dev, + * to the caller, instead of a normal nouveau_bo ttm reference. */ + ret = drm_gem_object_init(dev, &nvbo->bo.base, size); + if (ret) { +- nouveau_bo_ref(NULL, &nvbo); ++ drm_gem_object_release(&nvbo->bo.base); ++ kfree(nvbo); + obj = ERR_PTR(-ENOMEM); + goto unlock; + } +diff --git a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c +index 9e518213a54ff9..0a2d5f461aee8e 100644 +--- a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c ++++ b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c +@@ -553,7 +553,11 @@ static int boe_panel_prepare(struct drm_panel *panel) + usleep_range(5000, 10000); + + if (boe->desc->lp11_before_reset) { +- mipi_dsi_dcs_nop(boe->dsi); ++ ret = mipi_dsi_dcs_nop(boe->dsi); ++ if (ret < 0) { ++ dev_err(&boe->dsi->dev, "Failed to send NOP: %d\n", ret); ++ goto poweroff; ++ } + usleep_range(1000, 2000); + } + gpiod_set_value(boe->enable_gpio, 1); +@@ -574,13 +578,13 @@ static int boe_panel_prepare(struct drm_panel *panel) + return 0; + + poweroff: ++ gpiod_set_value(boe->enable_gpio, 0); + regulator_disable(boe->avee); + poweroffavdd: + regulator_disable(boe->avdd); + poweroff1v8: + usleep_range(5000, 7000); + regulator_disable(boe->pp1800); +- gpiod_set_value(boe->enable_gpio, 0); + + return ret; + } +diff --git a/drivers/gpu/drm/panfrost/panfrost_drv.c b/drivers/gpu/drm/panfrost/panfrost_drv.c +index 4c271244092b49..c2d1633ddec5a9 100644 +--- a/drivers/gpu/drm/panfrost/panfrost_drv.c ++++ b/drivers/gpu/drm/panfrost/panfrost_drv.c +@@ -687,3 +687,4 @@ module_platform_driver(panfrost_driver); + MODULE_AUTHOR("Panfrost Project Developers"); + MODULE_DESCRIPTION("Panfrost DRM Driver"); + MODULE_LICENSE("GPL v2"); ++MODULE_SOFTDEP("pre: governor_simpleondemand"); +diff --git a/drivers/gpu/drm/qxl/qxl_display.c b/drivers/gpu/drm/qxl/qxl_display.c +index dc04412784a0d0..c17b24eee0cf40 100644 +--- a/drivers/gpu/drm/qxl/qxl_display.c ++++ b/drivers/gpu/drm/qxl/qxl_display.c +@@ -233,6 +233,9 @@ static int qxl_add_mode(struct drm_connector *connector, + return 0; + + mode = drm_cvt_mode(dev, width, height, 60, false, false, false); ++ if (!mode) ++ return 0; ++ + if (preferred) + mode->type |= DRM_MODE_TYPE_PREFERRED; + mode->hdisplay = width; +diff --git a/drivers/gpu/drm/vmwgfx/vmwgfx_fence.c b/drivers/gpu/drm/vmwgfx/vmwgfx_fence.c +index 50eba25456bb69..61fcd86edf4e93 100644 +--- a/drivers/gpu/drm/vmwgfx/vmwgfx_fence.c ++++ b/drivers/gpu/drm/vmwgfx/vmwgfx_fence.c +@@ -32,7 +32,6 @@ + #define VMW_FENCE_WRAP (1 << 31) + + struct vmw_fence_manager { +- int num_fence_objects; + struct vmw_private *dev_priv; + spinlock_t lock; + struct list_head fence_list; +@@ -127,13 +126,13 @@ static void vmw_fence_obj_destroy(struct dma_fence *f) + { + struct vmw_fence_obj *fence = + container_of(f, struct vmw_fence_obj, base); +- + struct vmw_fence_manager *fman = fman_from_fence(fence); + +- spin_lock(&fman->lock); +- list_del_init(&fence->head); +- --fman->num_fence_objects; +- spin_unlock(&fman->lock); ++ if (!list_empty(&fence->head)) { ++ spin_lock(&fman->lock); ++ list_del_init(&fence->head); ++ spin_unlock(&fman->lock); ++ } + fence->destroy(fence); + } + +@@ -260,7 +259,6 @@ static const struct dma_fence_ops vmw_fence_ops = { + .release = vmw_fence_obj_destroy, + }; + +- + /* + * Execute signal actions on fences recently signaled. + * This is done from a workqueue so we don't have to execute +@@ -363,7 +361,6 @@ static int vmw_fence_obj_init(struct vmw_fence_manager *fman, + goto out_unlock; + } + list_add_tail(&fence->head, &fman->fence_list); +- ++fman->num_fence_objects; + + out_unlock: + spin_unlock(&fman->lock); +@@ -411,7 +408,7 @@ static bool vmw_fence_goal_new_locked(struct vmw_fence_manager *fman, + u32 passed_seqno) + { + u32 goal_seqno; +- struct vmw_fence_obj *fence; ++ struct vmw_fence_obj *fence, *next_fence; + + if (likely(!fman->seqno_valid)) + return false; +@@ -421,7 +418,7 @@ static bool vmw_fence_goal_new_locked(struct vmw_fence_manager *fman, + return false; + + fman->seqno_valid = false; +- list_for_each_entry(fence, &fman->fence_list, head) { ++ list_for_each_entry_safe(fence, next_fence, &fman->fence_list, head) { + if (!list_empty(&fence->seq_passed_actions)) { + fman->seqno_valid = true; + vmw_fence_goal_write(fman->dev_priv, +diff --git a/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c b/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c +index 54c5d16eb3b79f..ec46b3b70d04db 100644 +--- a/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c ++++ b/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c +@@ -98,7 +98,7 @@ static int vmw_overlay_send_put(struct vmw_private *dev_priv, + { + struct vmw_escape_video_flush *flush; + size_t fifo_size; +- bool have_so = (dev_priv->active_display_unit == vmw_du_screen_object); ++ bool have_so = (dev_priv->active_display_unit != vmw_du_legacy); + int i, num_items; + SVGAGuestPtr ptr; + +diff --git a/drivers/hid/wacom_wac.c b/drivers/hid/wacom_wac.c +index 115d862d3e918a..11d15c83f50214 100644 +--- a/drivers/hid/wacom_wac.c ++++ b/drivers/hid/wacom_wac.c +@@ -714,13 +714,12 @@ static int wacom_intuos_get_tool_type(int tool_id) + case 0x8e2: /* IntuosHT2 pen */ + case 0x022: + case 0x200: /* Pro Pen 3 */ +- case 0x04200: /* Pro Pen 3 */ + case 0x10842: /* MobileStudio Pro Pro Pen slim */ + case 0x14802: /* Intuos4/5 13HD/24HD Classic Pen */ + case 0x16802: /* Cintiq 13HD Pro Pen */ + case 0x18802: /* DTH2242 Pen */ + case 0x10802: /* Intuos4/5 13HD/24HD General Pen */ +- case 0x80842: /* Intuos Pro and Cintiq Pro 3D Pen */ ++ case 0x8842: /* Intuos Pro and Cintiq Pro 3D Pen */ + tool_type = BTN_TOOL_PEN; + break; + +diff --git a/drivers/hwmon/adt7475.c b/drivers/hwmon/adt7475.c +index 22e314725def0b..b4c0f01f52c4ff 100644 +--- a/drivers/hwmon/adt7475.c ++++ b/drivers/hwmon/adt7475.c +@@ -1770,7 +1770,7 @@ static void adt7475_read_pwm(struct i2c_client *client, int index) + data->pwm[CONTROL][index] &= ~0xE0; + data->pwm[CONTROL][index] |= (7 << 5); + +- i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index), ++ i2c_smbus_write_byte_data(client, PWM_REG(index), + data->pwm[INPUT][index]); + + i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index), +diff --git a/drivers/hwmon/max6697.c b/drivers/hwmon/max6697.c +index 2895cea5419349..266baae94e3eec 100644 +--- a/drivers/hwmon/max6697.c ++++ b/drivers/hwmon/max6697.c +@@ -312,6 +312,7 @@ static ssize_t temp_store(struct device *dev, + return ret; + + mutex_lock(&data->update_lock); ++ temp = clamp_val(temp, -1000000, 1000000); /* prevent underflow */ + temp = DIV_ROUND_CLOSEST(temp, 1000) + data->temp_offset; + temp = clamp_val(temp, 0, data->type == max6581 ? 255 : 127); + data->temp[nr][index] = temp; +@@ -429,14 +430,14 @@ static SENSOR_DEVICE_ATTR_RO(temp6_max_alarm, alarm, 20); + static SENSOR_DEVICE_ATTR_RO(temp7_max_alarm, alarm, 21); + static SENSOR_DEVICE_ATTR_RO(temp8_max_alarm, alarm, 23); + +-static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 14); ++static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 15); + static SENSOR_DEVICE_ATTR_RO(temp2_crit_alarm, alarm, 8); + static SENSOR_DEVICE_ATTR_RO(temp3_crit_alarm, alarm, 9); + static SENSOR_DEVICE_ATTR_RO(temp4_crit_alarm, alarm, 10); + static SENSOR_DEVICE_ATTR_RO(temp5_crit_alarm, alarm, 11); + static SENSOR_DEVICE_ATTR_RO(temp6_crit_alarm, alarm, 12); + static SENSOR_DEVICE_ATTR_RO(temp7_crit_alarm, alarm, 13); +-static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 15); ++static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 14); + + static SENSOR_DEVICE_ATTR_RO(temp2_fault, alarm, 1); + static SENSOR_DEVICE_ATTR_RO(temp3_fault, alarm, 2); +diff --git a/drivers/hwtracing/coresight/coresight-platform.c b/drivers/hwtracing/coresight/coresight-platform.c +index c594f45319fc55..dfb8022c4da1af 100644 +--- a/drivers/hwtracing/coresight/coresight-platform.c ++++ b/drivers/hwtracing/coresight/coresight-platform.c +@@ -323,8 +323,10 @@ static int of_get_coresight_platform_data(struct device *dev, + continue; + + ret = of_coresight_parse_endpoint(dev, ep, pdata); +- if (ret) ++ if (ret) { ++ of_node_put(ep); + return ret; ++ } + } + + return 0; +diff --git a/drivers/i2c/i2c-smbus.c b/drivers/i2c/i2c-smbus.c +index d3d06e3b4f3b31..44582cf29e1622 100644 +--- a/drivers/i2c/i2c-smbus.c ++++ b/drivers/i2c/i2c-smbus.c +@@ -34,6 +34,7 @@ static int smbus_do_alert(struct device *dev, void *addrp) + struct i2c_client *client = i2c_verify_client(dev); + struct alert_data *data = addrp; + struct i2c_driver *driver; ++ int ret; + + if (!client || client->addr != data->addr) + return 0; +@@ -47,16 +48,47 @@ static int smbus_do_alert(struct device *dev, void *addrp) + device_lock(dev); + if (client->dev.driver) { + driver = to_i2c_driver(client->dev.driver); +- if (driver->alert) ++ if (driver->alert) { ++ /* Stop iterating after we find the device */ + driver->alert(client, data->type, data->data); +- else ++ ret = -EBUSY; ++ } else { + dev_warn(&client->dev, "no driver alert()!\n"); +- } else ++ ret = -EOPNOTSUPP; ++ } ++ } else { + dev_dbg(&client->dev, "alert with no driver\n"); ++ ret = -ENODEV; ++ } ++ device_unlock(dev); ++ ++ return ret; ++} ++ ++/* Same as above, but call back all drivers with alert handler */ ++ ++static int smbus_do_alert_force(struct device *dev, void *addrp) ++{ ++ struct i2c_client *client = i2c_verify_client(dev); ++ struct alert_data *data = addrp; ++ struct i2c_driver *driver; ++ ++ if (!client || (client->flags & I2C_CLIENT_TEN)) ++ return 0; ++ ++ /* ++ * Drivers should either disable alerts, or provide at least ++ * a minimal handler. Lock so the driver won't change. ++ */ ++ device_lock(dev); ++ if (client->dev.driver) { ++ driver = to_i2c_driver(client->dev.driver); ++ if (driver->alert) ++ driver->alert(client, data->type, data->data); ++ } + device_unlock(dev); + +- /* Stop iterating after we find the device */ +- return -EBUSY; ++ return 0; + } + + /* +@@ -67,6 +99,7 @@ static irqreturn_t smbus_alert(int irq, void *d) + { + struct i2c_smbus_alert *alert = d; + struct i2c_client *ara; ++ unsigned short prev_addr = I2C_CLIENT_END; /* Not a valid address */ + + ara = alert->ara; + +@@ -94,8 +127,25 @@ static irqreturn_t smbus_alert(int irq, void *d) + data.addr, data.data); + + /* Notify driver for the device which issued the alert */ +- device_for_each_child(&ara->adapter->dev, &data, +- smbus_do_alert); ++ status = device_for_each_child(&ara->adapter->dev, &data, ++ smbus_do_alert); ++ /* ++ * If we read the same address more than once, and the alert ++ * was not handled by a driver, it won't do any good to repeat ++ * the loop because it will never terminate. Try again, this ++ * time calling the alert handlers of all devices connected to ++ * the bus, and abort the loop afterwards. If this helps, we ++ * are all set. If it doesn't, there is nothing else we can do, ++ * so we might as well abort the loop. ++ * Note: This assumes that a driver with alert handler handles ++ * the alert properly and clears it if necessary. ++ */ ++ if (data.addr == prev_addr && status != -EBUSY) { ++ device_for_each_child(&ara->adapter->dev, &data, ++ smbus_do_alert_force); ++ break; ++ } ++ prev_addr = data.addr; + } + + return IRQ_HANDLED; +diff --git a/drivers/infiniband/core/cache.c b/drivers/infiniband/core/cache.c +index 0c98dd3dee6783..98f3d8b382c157 100644 +--- a/drivers/infiniband/core/cache.c ++++ b/drivers/infiniband/core/cache.c +@@ -794,7 +794,6 @@ static struct ib_gid_table *alloc_gid_table(int sz) + static void release_gid_table(struct ib_device *device, + struct ib_gid_table *table) + { +- bool leak = false; + int i; + + if (!table) +@@ -803,15 +802,12 @@ static void release_gid_table(struct ib_device *device, + for (i = 0; i < table->sz; i++) { + if (is_gid_entry_free(table->data_vec[i])) + continue; +- if (kref_read(&table->data_vec[i]->kref) > 1) { +- dev_err(&device->dev, +- "GID entry ref leak for index %d ref=%u\n", i, +- kref_read(&table->data_vec[i]->kref)); +- leak = true; +- } ++ ++ WARN_ONCE(true, ++ "GID entry ref leak for dev %s index %d ref=%u\n", ++ dev_name(&device->dev), i, ++ kref_read(&table->data_vec[i]->kref)); + } +- if (leak) +- return; + + mutex_destroy(&table->lock); + kfree(table->data_vec); +diff --git a/drivers/infiniband/core/device.c b/drivers/infiniband/core/device.c +index 725f2719132fb3..5d1ce55fda71ef 100644 +--- a/drivers/infiniband/core/device.c ++++ b/drivers/infiniband/core/device.c +@@ -2145,6 +2145,9 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev, + unsigned long flags; + int ret; + ++ if (!rdma_is_port_valid(ib_dev, port)) ++ return -EINVAL; ++ + /* + * Drivers wish to call this before ib_register_driver, so we have to + * setup the port data early. +@@ -2153,9 +2156,6 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev, + if (ret) + return ret; + +- if (!rdma_is_port_valid(ib_dev, port)) +- return -EINVAL; +- + pdata = &ib_dev->port_data[port]; + spin_lock_irqsave(&pdata->netdev_lock, flags); + old_ndev = rcu_dereference_protected( +diff --git a/drivers/infiniband/core/iwcm.c b/drivers/infiniband/core/iwcm.c +index 2b47073c61a65e..2d09d1be38f19b 100644 +--- a/drivers/infiniband/core/iwcm.c ++++ b/drivers/infiniband/core/iwcm.c +@@ -369,8 +369,10 @@ EXPORT_SYMBOL(iw_cm_disconnect); + * + * Clean up all resources associated with the connection and release + * the initial reference taken by iw_create_cm_id. ++ * ++ * Returns true if and only if the last cm_id_priv reference has been dropped. + */ +-static void destroy_cm_id(struct iw_cm_id *cm_id) ++static bool destroy_cm_id(struct iw_cm_id *cm_id) + { + struct iwcm_id_private *cm_id_priv; + struct ib_qp *qp; +@@ -440,7 +442,7 @@ static void destroy_cm_id(struct iw_cm_id *cm_id) + iwpm_remove_mapping(&cm_id->local_addr, RDMA_NL_IWCM); + } + +- (void)iwcm_deref_id(cm_id_priv); ++ return iwcm_deref_id(cm_id_priv); + } + + /* +@@ -451,7 +453,8 @@ static void destroy_cm_id(struct iw_cm_id *cm_id) + */ + void iw_destroy_cm_id(struct iw_cm_id *cm_id) + { +- destroy_cm_id(cm_id); ++ if (!destroy_cm_id(cm_id)) ++ flush_workqueue(iwcm_wq); + } + EXPORT_SYMBOL(iw_destroy_cm_id); + +@@ -1035,7 +1038,7 @@ static void cm_work_handler(struct work_struct *_work) + if (!test_bit(IWCM_F_DROP_EVENTS, &cm_id_priv->flags)) { + ret = process_event(cm_id_priv, &levent); + if (ret) +- destroy_cm_id(&cm_id_priv->id); ++ WARN_ON_ONCE(destroy_cm_id(&cm_id_priv->id)); + } else + pr_debug("dropping event %d\n", levent.event); + if (iwcm_deref_id(cm_id_priv)) +diff --git a/drivers/infiniband/hw/bnxt_re/ib_verbs.c b/drivers/infiniband/hw/bnxt_re/ib_verbs.c +index 91b71fa3c1216e..e29894197f5caa 100644 +--- a/drivers/infiniband/hw/bnxt_re/ib_verbs.c ++++ b/drivers/infiniband/hw/bnxt_re/ib_verbs.c +@@ -2354,7 +2354,7 @@ static int bnxt_re_build_send_wqe(struct bnxt_re_qp *qp, + break; + case IB_WR_SEND_WITH_IMM: + wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_IMM; +- wqe->send.imm_data = wr->ex.imm_data; ++ wqe->send.imm_data = be32_to_cpu(wr->ex.imm_data); + break; + case IB_WR_SEND_WITH_INV: + wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_INV; +@@ -2384,7 +2384,7 @@ static int bnxt_re_build_rdma_wqe(const struct ib_send_wr *wr, + break; + case IB_WR_RDMA_WRITE_WITH_IMM: + wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_WRITE_WITH_IMM; +- wqe->rdma.imm_data = wr->ex.imm_data; ++ wqe->rdma.imm_data = be32_to_cpu(wr->ex.imm_data); + break; + case IB_WR_RDMA_READ: + wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_READ; +@@ -3334,7 +3334,7 @@ static void bnxt_re_process_res_shadow_qp_wc(struct bnxt_re_qp *gsi_sqp, + wc->byte_len = orig_cqe->length; + wc->qp = &gsi_qp->ib_qp; + +- wc->ex.imm_data = orig_cqe->immdata; ++ wc->ex.imm_data = cpu_to_be32(le32_to_cpu(orig_cqe->immdata)); + wc->src_qp = orig_cqe->src_qp; + memcpy(wc->smac, orig_cqe->smac, ETH_ALEN); + if (bnxt_re_is_vlan_pkt(orig_cqe, &vlan_id, &sl)) { +@@ -3470,7 +3470,7 @@ int bnxt_re_poll_cq(struct ib_cq *ib_cq, int num_entries, struct ib_wc *wc) + (unsigned long)(cqe->qp_handle), + struct bnxt_re_qp, qplib_qp); + wc->qp = &qp->ib_qp; +- wc->ex.imm_data = cqe->immdata; ++ wc->ex.imm_data = cpu_to_be32(le32_to_cpu(cqe->immdata)); + wc->src_qp = cqe->src_qp; + memcpy(wc->smac, cqe->smac, ETH_ALEN); + wc->port_num = 1; +diff --git a/drivers/infiniband/hw/bnxt_re/qplib_fp.h b/drivers/infiniband/hw/bnxt_re/qplib_fp.h +index 49d89c08082754..4f1a845f9be6c4 100644 +--- a/drivers/infiniband/hw/bnxt_re/qplib_fp.h ++++ b/drivers/infiniband/hw/bnxt_re/qplib_fp.h +@@ -164,7 +164,7 @@ struct bnxt_qplib_swqe { + /* Send, with imm, inval key */ + struct { + union { +- __be32 imm_data; ++ u32 imm_data; + u32 inv_key; + }; + u32 q_key; +@@ -182,7 +182,7 @@ struct bnxt_qplib_swqe { + /* RDMA write, with imm, read */ + struct { + union { +- __be32 imm_data; ++ u32 imm_data; + u32 inv_key; + }; + u64 remote_va; +@@ -374,7 +374,7 @@ struct bnxt_qplib_cqe { + u16 cfa_meta; + u64 wr_id; + union { +- __be32 immdata; ++ __le32 immdata; + u32 invrkey; + }; + u64 qp_handle; +diff --git a/drivers/infiniband/hw/hns/hns_roce_device.h b/drivers/infiniband/hw/hns/hns_roce_device.h +index e02107123c970d..f234fd8e4a2bee 100644 +--- a/drivers/infiniband/hw/hns/hns_roce_device.h ++++ b/drivers/infiniband/hw/hns/hns_roce_device.h +@@ -100,6 +100,7 @@ + #define MR_TYPE_DMA 0x03 + + #define HNS_ROCE_FRMR_MAX_PA 512 ++#define HNS_ROCE_FRMR_ALIGN_SIZE 128 + + #define PKEY_ID 0xffff + #define GUID_LEN 8 +@@ -220,6 +221,9 @@ enum { + #define HNS_HW_PAGE_SHIFT 12 + #define HNS_HW_PAGE_SIZE (1 << HNS_HW_PAGE_SHIFT) + ++#define HNS_HW_MAX_PAGE_SHIFT 27 ++#define HNS_HW_MAX_PAGE_SIZE (1 << HNS_HW_MAX_PAGE_SHIFT) ++ + struct hns_roce_uar { + u64 pfn; + unsigned long index; +diff --git a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c +index 4accc9efa69466..3cd65bcca22408 100644 +--- a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c ++++ b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c +@@ -2598,14 +2598,16 @@ static int set_llm_cfg_to_hw(struct hns_roce_dev *hr_dev, + static struct hns_roce_link_table * + alloc_link_table_buf(struct hns_roce_dev *hr_dev) + { ++ u16 total_sl = hr_dev->caps.sl_num * hr_dev->func_num; + struct hns_roce_v2_priv *priv = hr_dev->priv; + struct hns_roce_link_table *link_tbl; + u32 pg_shift, size, min_size; + + link_tbl = &priv->ext_llm; + pg_shift = hr_dev->caps.llm_buf_pg_sz + PAGE_SHIFT; +- size = hr_dev->caps.num_qps * HNS_ROCE_V2_EXT_LLM_ENTRY_SZ; +- min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(hr_dev->caps.sl_num) << pg_shift; ++ size = hr_dev->caps.num_qps * hr_dev->func_num * ++ HNS_ROCE_V2_EXT_LLM_ENTRY_SZ; ++ min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(total_sl) << pg_shift; + + /* Alloc data table */ + size = max(size, min_size); +diff --git a/drivers/infiniband/hw/hns/hns_roce_mr.c b/drivers/infiniband/hw/hns/hns_roce_mr.c +index 7106e51d5fad1b..938db3f5aabe6b 100644 +--- a/drivers/infiniband/hw/hns/hns_roce_mr.c ++++ b/drivers/infiniband/hw/hns/hns_roce_mr.c +@@ -446,6 +446,11 @@ int hns_roce_map_mr_sg(struct ib_mr *ibmr, struct scatterlist *sg, int sg_nents, + struct hns_roce_mtr *mtr = &mr->pbl_mtr; + int ret, sg_num = 0; + ++ if (!IS_ALIGNED(*sg_offset, HNS_ROCE_FRMR_ALIGN_SIZE) || ++ ibmr->page_size < HNS_HW_PAGE_SIZE || ++ ibmr->page_size > HNS_HW_MAX_PAGE_SIZE) ++ return sg_num; ++ + mr->npages = 0; + mr->page_list = kvcalloc(mr->pbl_mtr.hem_cfg.buf_pg_count, + sizeof(dma_addr_t), GFP_KERNEL); +diff --git a/drivers/infiniband/hw/hns/hns_roce_srq.c b/drivers/infiniband/hw/hns/hns_roce_srq.c +index 35001fb99b9444..873069d6ebae9d 100644 +--- a/drivers/infiniband/hw/hns/hns_roce_srq.c ++++ b/drivers/infiniband/hw/hns/hns_roce_srq.c +@@ -295,7 +295,7 @@ static int set_srq_basic_param(struct hns_roce_srq *srq, + + max_sge = proc_srq_sge(hr_dev, srq, !!udata); + if (attr->max_wr > hr_dev->caps.max_srq_wrs || +- attr->max_sge > max_sge) { ++ attr->max_sge > max_sge || !attr->max_sge) { + ibdev_err(&hr_dev->ib_dev, + "invalid SRQ attr, depth = %u, sge = %u.\n", + attr->max_wr, attr->max_sge); +diff --git a/drivers/infiniband/hw/mlx4/alias_GUID.c b/drivers/infiniband/hw/mlx4/alias_GUID.c +index 571d9c542024c2..6b8ad585901453 100644 +--- a/drivers/infiniband/hw/mlx4/alias_GUID.c ++++ b/drivers/infiniband/hw/mlx4/alias_GUID.c +@@ -832,7 +832,7 @@ void mlx4_ib_destroy_alias_guid_service(struct mlx4_ib_dev *dev) + + int mlx4_ib_init_alias_guid_service(struct mlx4_ib_dev *dev) + { +- char alias_wq_name[15]; ++ char alias_wq_name[22]; + int ret = 0; + int i, j; + union ib_gid gid; +diff --git a/drivers/infiniband/hw/mlx4/mad.c b/drivers/infiniband/hw/mlx4/mad.c +index d13ecbdd439171..3d29d5baf503ee 100644 +--- a/drivers/infiniband/hw/mlx4/mad.c ++++ b/drivers/infiniband/hw/mlx4/mad.c +@@ -2158,7 +2158,7 @@ static int mlx4_ib_alloc_demux_ctx(struct mlx4_ib_dev *dev, + struct mlx4_ib_demux_ctx *ctx, + int port) + { +- char name[12]; ++ char name[21]; + int ret = 0; + int i; + +diff --git a/drivers/infiniband/hw/mlx5/mlx5_ib.h b/drivers/infiniband/hw/mlx5/mlx5_ib.h +index bf20a388eabe13..08c59c5a1e108a 100644 +--- a/drivers/infiniband/hw/mlx5/mlx5_ib.h ++++ b/drivers/infiniband/hw/mlx5/mlx5_ib.h +@@ -109,6 +109,19 @@ unsigned long __mlx5_umem_find_best_quantized_pgoff( + __mlx5_bit_sz(typ, page_offset_fld), 0, scale, \ + page_offset_quantized) + ++static inline unsigned long ++mlx5_umem_dmabuf_find_best_pgsz(struct ib_umem_dmabuf *umem_dmabuf) ++{ ++ /* ++ * mkeys used for dmabuf are fixed at PAGE_SIZE because we must be able ++ * to hold any sgl after a move operation. Ideally the mkc page size ++ * could be changed at runtime to be optimal, but right now the driver ++ * cannot do that. ++ */ ++ return ib_umem_find_best_pgsz(&umem_dmabuf->umem, PAGE_SIZE, ++ umem_dmabuf->umem.iova); ++} ++ + enum { + MLX5_IB_MMAP_OFFSET_START = 9, + MLX5_IB_MMAP_OFFSET_END = 255, +diff --git a/drivers/infiniband/hw/mlx5/odp.c b/drivers/infiniband/hw/mlx5/odp.c +index fcf6447b4a4e09..66e53e895d341c 100644 +--- a/drivers/infiniband/hw/mlx5/odp.c ++++ b/drivers/infiniband/hw/mlx5/odp.c +@@ -704,10 +704,8 @@ static int pagefault_dmabuf_mr(struct mlx5_ib_mr *mr, size_t bcnt, + return err; + } + +- page_size = mlx5_umem_find_best_pgsz(&umem_dmabuf->umem, mkc, +- log_page_size, 0, +- umem_dmabuf->umem.iova); +- if (unlikely(page_size < PAGE_SIZE)) { ++ page_size = mlx5_umem_dmabuf_find_best_pgsz(umem_dmabuf); ++ if (!page_size) { + ib_umem_dmabuf_unmap_pages(umem_dmabuf); + err = -EINVAL; + } else { +diff --git a/drivers/infiniband/sw/rxe/rxe_req.c b/drivers/infiniband/sw/rxe/rxe_req.c +index 8c0e7ecd414142..09380841920725 100644 +--- a/drivers/infiniband/sw/rxe/rxe_req.c ++++ b/drivers/infiniband/sw/rxe/rxe_req.c +@@ -374,7 +374,7 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp, + int solicited; + u16 pkey; + u32 qp_num; +- int ack_req; ++ int ack_req = 0; + + /* length from start of bth to end of icrc */ + paylen = rxe_opcode[opcode].length + payload + pad + RXE_ICRC_SIZE; +@@ -407,8 +407,9 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp, + qp_num = (pkt->mask & RXE_DETH_MASK) ? ibwr->wr.ud.remote_qpn : + qp->attr.dest_qp_num; + +- ack_req = ((pkt->mask & RXE_END_MASK) || +- (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK)); ++ if (qp_type(qp) != IB_QPT_UD && qp_type(qp) != IB_QPT_UC) ++ ack_req = ((pkt->mask & RXE_END_MASK) || ++ (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK)); + if (ack_req) + qp->req.noack_pkts = 0; + +diff --git a/drivers/input/keyboard/qt1050.c b/drivers/input/keyboard/qt1050.c +index 403060d05c3b34..7193a4198e214f 100644 +--- a/drivers/input/keyboard/qt1050.c ++++ b/drivers/input/keyboard/qt1050.c +@@ -226,7 +226,12 @@ static bool qt1050_identify(struct qt1050_priv *ts) + int err; + + /* Read Chip ID */ +- regmap_read(ts->regmap, QT1050_CHIP_ID, &val); ++ err = regmap_read(ts->regmap, QT1050_CHIP_ID, &val); ++ if (err) { ++ dev_err(&ts->client->dev, "Failed to read chip ID: %d\n", err); ++ return false; ++ } ++ + if (val != QT1050_CHIP_ID_VER) { + dev_err(&ts->client->dev, "ID %d not supported\n", val); + return false; +diff --git a/drivers/input/mouse/elan_i2c_core.c b/drivers/input/mouse/elan_i2c_core.c +index e1758d5ffe4218..a5f067b93ab9a5 100644 +--- a/drivers/input/mouse/elan_i2c_core.c ++++ b/drivers/input/mouse/elan_i2c_core.c +@@ -1378,6 +1378,8 @@ static int __maybe_unused elan_suspend(struct device *dev) + } + + err: ++ if (ret) ++ enable_irq(client->irq); + mutex_unlock(&data->sysfs_mutex); + return ret; + } +diff --git a/drivers/iommu/sprd-iommu.c b/drivers/iommu/sprd-iommu.c +index 6b11770e3d75af..f9392dbe6511ec 100644 +--- a/drivers/iommu/sprd-iommu.c ++++ b/drivers/iommu/sprd-iommu.c +@@ -234,8 +234,8 @@ static void sprd_iommu_cleanup(struct sprd_iommu_domain *dom) + + pgt_size = sprd_iommu_pgt_size(&dom->domain); + dma_free_coherent(dom->sdev->dev, pgt_size, dom->pgt_va, dom->pgt_pa); +- dom->sdev = NULL; + sprd_iommu_hw_en(dom->sdev, false); ++ dom->sdev = NULL; + } + + static void sprd_iommu_domain_free(struct iommu_domain *domain) +diff --git a/drivers/irqchip/irq-imx-irqsteer.c b/drivers/irqchip/irq-imx-irqsteer.c +index 8d91a02593fc27..44ce85c27f57a0 100644 +--- a/drivers/irqchip/irq-imx-irqsteer.c ++++ b/drivers/irqchip/irq-imx-irqsteer.c +@@ -12,6 +12,7 @@ + #include <linux/kernel.h> + #include <linux/of_irq.h> + #include <linux/of_platform.h> ++#include <linux/pm_runtime.h> + #include <linux/spinlock.h> + + #define CTRL_STRIDE_OFF(_t, _r) (_t * 4 * _r) +@@ -34,6 +35,7 @@ struct irqsteer_data { + int channel; + struct irq_domain *domain; + u32 *saved_reg; ++ struct device *dev; + }; + + static int imx_irqsteer_get_reg_index(struct irqsteer_data *data, +@@ -70,10 +72,26 @@ static void imx_irqsteer_irq_mask(struct irq_data *d) + raw_spin_unlock_irqrestore(&data->lock, flags); + } + +-static struct irq_chip imx_irqsteer_irq_chip = { +- .name = "irqsteer", +- .irq_mask = imx_irqsteer_irq_mask, +- .irq_unmask = imx_irqsteer_irq_unmask, ++static void imx_irqsteer_irq_bus_lock(struct irq_data *d) ++{ ++ struct irqsteer_data *data = d->chip_data; ++ ++ pm_runtime_get_sync(data->dev); ++} ++ ++static void imx_irqsteer_irq_bus_sync_unlock(struct irq_data *d) ++{ ++ struct irqsteer_data *data = d->chip_data; ++ ++ pm_runtime_put_autosuspend(data->dev); ++} ++ ++static const struct irq_chip imx_irqsteer_irq_chip = { ++ .name = "irqsteer", ++ .irq_mask = imx_irqsteer_irq_mask, ++ .irq_unmask = imx_irqsteer_irq_unmask, ++ .irq_bus_lock = imx_irqsteer_irq_bus_lock, ++ .irq_bus_sync_unlock = imx_irqsteer_irq_bus_sync_unlock, + }; + + static int imx_irqsteer_irq_map(struct irq_domain *h, unsigned int irq, +@@ -148,6 +166,7 @@ static int imx_irqsteer_probe(struct platform_device *pdev) + if (!data) + return -ENOMEM; + ++ data->dev = &pdev->dev; + data->regs = devm_platform_ioremap_resource(pdev, 0); + if (IS_ERR(data->regs)) { + dev_err(&pdev->dev, "failed to initialize reg\n"); +@@ -175,7 +194,7 @@ static int imx_irqsteer_probe(struct platform_device *pdev) + data->irq_count = DIV_ROUND_UP(irqs_num, 64); + data->reg_num = irqs_num / 32; + +- if (IS_ENABLED(CONFIG_PM_SLEEP)) { ++ if (IS_ENABLED(CONFIG_PM)) { + data->saved_reg = devm_kzalloc(&pdev->dev, + sizeof(u32) * data->reg_num, + GFP_KERNEL); +@@ -199,6 +218,7 @@ static int imx_irqsteer_probe(struct platform_device *pdev) + ret = -ENOMEM; + goto out; + } ++ irq_domain_set_pm_device(data->domain, &pdev->dev); + + if (!data->irq_count || data->irq_count > CHAN_MAX_OUTPUT_INT) { + ret = -EINVAL; +@@ -219,6 +239,9 @@ static int imx_irqsteer_probe(struct platform_device *pdev) + + platform_set_drvdata(pdev, data); + ++ pm_runtime_set_active(&pdev->dev); ++ pm_runtime_enable(&pdev->dev); ++ + return 0; + out: + clk_disable_unprepare(data->ipg_clk); +@@ -241,7 +264,7 @@ static int imx_irqsteer_remove(struct platform_device *pdev) + return 0; + } + +-#ifdef CONFIG_PM_SLEEP ++#ifdef CONFIG_PM + static void imx_irqsteer_save_regs(struct irqsteer_data *data) + { + int i; +@@ -288,7 +311,10 @@ static int imx_irqsteer_resume(struct device *dev) + #endif + + static const struct dev_pm_ops imx_irqsteer_pm_ops = { +- SET_NOIRQ_SYSTEM_SLEEP_PM_OPS(imx_irqsteer_suspend, imx_irqsteer_resume) ++ SET_NOIRQ_SYSTEM_SLEEP_PM_OPS(pm_runtime_force_suspend, ++ pm_runtime_force_resume) ++ SET_RUNTIME_PM_OPS(imx_irqsteer_suspend, ++ imx_irqsteer_resume, NULL) + }; + + static const struct of_device_id imx_irqsteer_dt_ids[] = { +diff --git a/drivers/irqchip/irq-mbigen.c b/drivers/irqchip/irq-mbigen.c +index 12df2162108ebd..e6f824a2ee5106 100644 +--- a/drivers/irqchip/irq-mbigen.c ++++ b/drivers/irqchip/irq-mbigen.c +@@ -64,6 +64,20 @@ struct mbigen_device { + void __iomem *base; + }; + ++static inline unsigned int get_mbigen_node_offset(unsigned int nid) ++{ ++ unsigned int offset = nid * MBIGEN_NODE_OFFSET; ++ ++ /* ++ * To avoid touched clear register in unexpected way, we need to directly ++ * skip clear register when access to more than 10 mbigen nodes. ++ */ ++ if (nid >= (REG_MBIGEN_CLEAR_OFFSET / MBIGEN_NODE_OFFSET)) ++ offset += MBIGEN_NODE_OFFSET; ++ ++ return offset; ++} ++ + static inline unsigned int get_mbigen_vec_reg(irq_hw_number_t hwirq) + { + unsigned int nid, pin; +@@ -72,8 +86,7 @@ static inline unsigned int get_mbigen_vec_reg(irq_hw_number_t hwirq) + nid = hwirq / IRQS_PER_MBIGEN_NODE + 1; + pin = hwirq % IRQS_PER_MBIGEN_NODE; + +- return pin * 4 + nid * MBIGEN_NODE_OFFSET +- + REG_MBIGEN_VEC_OFFSET; ++ return pin * 4 + get_mbigen_node_offset(nid) + REG_MBIGEN_VEC_OFFSET; + } + + static inline void get_mbigen_type_reg(irq_hw_number_t hwirq, +@@ -88,8 +101,7 @@ static inline void get_mbigen_type_reg(irq_hw_number_t hwirq, + *mask = 1 << (irq_ofst % 32); + ofst = irq_ofst / 32 * 4; + +- *addr = ofst + nid * MBIGEN_NODE_OFFSET +- + REG_MBIGEN_TYPE_OFFSET; ++ *addr = ofst + get_mbigen_node_offset(nid) + REG_MBIGEN_TYPE_OFFSET; + } + + static inline void get_mbigen_clear_reg(irq_hw_number_t hwirq, +diff --git a/drivers/irqchip/irq-meson-gpio.c b/drivers/irqchip/irq-meson-gpio.c +index e50676ce2ec84b..6a3d18d5ba2f0b 100644 +--- a/drivers/irqchip/irq-meson-gpio.c ++++ b/drivers/irqchip/irq-meson-gpio.c +@@ -16,7 +16,7 @@ + #include <linux/of.h> + #include <linux/of_address.h> + +-#define NUM_CHANNEL 8 ++#define MAX_NUM_CHANNEL 64 + #define MAX_INPUT_MUX 256 + + #define REG_EDGE_POL 0x00 +@@ -60,6 +60,7 @@ struct irq_ctl_ops { + + struct meson_gpio_irq_params { + unsigned int nr_hwirq; ++ unsigned int nr_channels; + bool support_edge_both; + unsigned int edge_both_offset; + unsigned int edge_single_offset; +@@ -81,6 +82,7 @@ struct meson_gpio_irq_params { + .edge_single_offset = 0, \ + .pol_low_offset = 16, \ + .pin_sel_mask = 0xff, \ ++ .nr_channels = 8, \ + + #define INIT_MESON_A1_COMMON_DATA(irqs) \ + INIT_MESON_COMMON(irqs, meson_a1_gpio_irq_init, \ +@@ -90,6 +92,7 @@ struct meson_gpio_irq_params { + .edge_single_offset = 8, \ + .pol_low_offset = 0, \ + .pin_sel_mask = 0x7f, \ ++ .nr_channels = 8, \ + + static const struct meson_gpio_irq_params meson8_params = { + INIT_MESON8_COMMON_DATA(134) +@@ -136,9 +139,9 @@ static const struct of_device_id meson_irq_gpio_matches[] = { + struct meson_gpio_irq_controller { + const struct meson_gpio_irq_params *params; + void __iomem *base; +- u32 channel_irqs[NUM_CHANNEL]; +- DECLARE_BITMAP(channel_map, NUM_CHANNEL); +- spinlock_t lock; ++ u32 channel_irqs[MAX_NUM_CHANNEL]; ++ DECLARE_BITMAP(channel_map, MAX_NUM_CHANNEL); ++ raw_spinlock_t lock; + }; + + static void meson_gpio_irq_update_bits(struct meson_gpio_irq_controller *ctl, +@@ -147,14 +150,14 @@ static void meson_gpio_irq_update_bits(struct meson_gpio_irq_controller *ctl, + unsigned long flags; + u32 tmp; + +- spin_lock_irqsave(&ctl->lock, flags); ++ raw_spin_lock_irqsave(&ctl->lock, flags); + + tmp = readl_relaxed(ctl->base + reg); + tmp &= ~mask; + tmp |= val; + writel_relaxed(tmp, ctl->base + reg); + +- spin_unlock_irqrestore(&ctl->lock, flags); ++ raw_spin_unlock_irqrestore(&ctl->lock, flags); + } + + static void meson_gpio_irq_init_dummy(struct meson_gpio_irq_controller *ctl) +@@ -204,12 +207,12 @@ meson_gpio_irq_request_channel(struct meson_gpio_irq_controller *ctl, + unsigned long flags; + unsigned int idx; + +- spin_lock_irqsave(&ctl->lock, flags); ++ raw_spin_lock_irqsave(&ctl->lock, flags); + + /* Find a free channel */ +- idx = find_first_zero_bit(ctl->channel_map, NUM_CHANNEL); +- if (idx >= NUM_CHANNEL) { +- spin_unlock_irqrestore(&ctl->lock, flags); ++ idx = find_first_zero_bit(ctl->channel_map, ctl->params->nr_channels); ++ if (idx >= ctl->params->nr_channels) { ++ raw_spin_unlock_irqrestore(&ctl->lock, flags); + pr_err("No channel available\n"); + return -ENOSPC; + } +@@ -217,7 +220,7 @@ meson_gpio_irq_request_channel(struct meson_gpio_irq_controller *ctl, + /* Mark the channel as used */ + set_bit(idx, ctl->channel_map); + +- spin_unlock_irqrestore(&ctl->lock, flags); ++ raw_spin_unlock_irqrestore(&ctl->lock, flags); + + /* + * Setup the mux of the channel to route the signal of the pad +@@ -451,10 +454,10 @@ static int __init meson_gpio_irq_parse_dt(struct device_node *node, + ret = of_property_read_variable_u32_array(node, + "amlogic,channel-interrupts", + ctl->channel_irqs, +- NUM_CHANNEL, +- NUM_CHANNEL); ++ ctl->params->nr_channels, ++ ctl->params->nr_channels); + if (ret < 0) { +- pr_err("can't get %d channel interrupts\n", NUM_CHANNEL); ++ pr_err("can't get %d channel interrupts\n", ctl->params->nr_channels); + return ret; + } + +@@ -485,7 +488,7 @@ static int __init meson_gpio_irq_of_init(struct device_node *node, + if (!ctl) + return -ENOMEM; + +- spin_lock_init(&ctl->lock); ++ raw_spin_lock_init(&ctl->lock); + + ctl->base = of_iomap(node, 0); + if (!ctl->base) { +@@ -509,7 +512,7 @@ static int __init meson_gpio_irq_of_init(struct device_node *node, + } + + pr_info("%d to %d gpio interrupt mux initialized\n", +- ctl->params->nr_hwirq, NUM_CHANNEL); ++ ctl->params->nr_hwirq, ctl->params->nr_channels); + + return 0; + +diff --git a/drivers/irqchip/irq-xilinx-intc.c b/drivers/irqchip/irq-xilinx-intc.c +index 356a59755d6376..d8c3f5a60e5250 100644 +--- a/drivers/irqchip/irq-xilinx-intc.c ++++ b/drivers/irqchip/irq-xilinx-intc.c +@@ -188,7 +188,7 @@ static int __init xilinx_intc_of_init(struct device_node *intc, + irqc->intr_mask = 0; + } + +- if (irqc->intr_mask >> irqc->nr_irq) ++ if ((u64)irqc->intr_mask >> irqc->nr_irq) + pr_warn("irq-xilinx: mismatch in kind-of-intr param\n"); + + pr_info("irq-xilinx: %pOF: num_irq=%d, edge=0x%x\n", +diff --git a/drivers/isdn/hardware/mISDN/hfcmulti.c b/drivers/isdn/hardware/mISDN/hfcmulti.c +index e840609c50eb74..2063afffd08535 100644 +--- a/drivers/isdn/hardware/mISDN/hfcmulti.c ++++ b/drivers/isdn/hardware/mISDN/hfcmulti.c +@@ -1931,7 +1931,7 @@ hfcmulti_dtmf(struct hfc_multi *hc) + static void + hfcmulti_tx(struct hfc_multi *hc, int ch) + { +- int i, ii, temp, len = 0; ++ int i, ii, temp, tmp_len, len = 0; + int Zspace, z1, z2; /* must be int for calculation */ + int Fspace, f1, f2; + u_char *d; +@@ -2152,14 +2152,15 @@ hfcmulti_tx(struct hfc_multi *hc, int ch) + HFC_wait_nodebug(hc); + } + ++ tmp_len = (*sp)->len; + dev_kfree_skb(*sp); + /* check for next frame */ + if (bch && get_next_bframe(bch)) { +- len = (*sp)->len; ++ len = tmp_len; + goto next_frame; + } + if (dch && get_next_dframe(dch)) { +- len = (*sp)->len; ++ len = tmp_len; + goto next_frame; + } + +diff --git a/drivers/leds/led-class.c b/drivers/leds/led-class.c +index 1024b1562aafc8..6e88df4c87fa81 100644 +--- a/drivers/leds/led-class.c ++++ b/drivers/leds/led-class.c +@@ -235,7 +235,6 @@ struct led_classdev *of_led_get(struct device_node *np, int index) + + led_dev = class_find_device_by_of_node(leds_class, led_node); + of_node_put(led_node); +- put_device(led_dev); + + if (!led_dev) + return ERR_PTR(-EPROBE_DEFER); +diff --git a/drivers/leds/led-triggers.c b/drivers/leds/led-triggers.c +index 4e7b78a84149be..3d3673c197e383 100644 +--- a/drivers/leds/led-triggers.c ++++ b/drivers/leds/led-triggers.c +@@ -157,7 +157,6 @@ EXPORT_SYMBOL_GPL(led_trigger_read); + /* Caller must ensure led_cdev->trigger_lock held */ + int led_trigger_set(struct led_classdev *led_cdev, struct led_trigger *trig) + { +- unsigned long flags; + char *event = NULL; + char *envp[2]; + const char *name; +@@ -171,31 +170,47 @@ int led_trigger_set(struct led_classdev *led_cdev, struct led_trigger *trig) + + /* Remove any existing trigger */ + if (led_cdev->trigger) { +- write_lock_irqsave(&led_cdev->trigger->leddev_list_lock, flags); +- list_del(&led_cdev->trig_list); +- write_unlock_irqrestore(&led_cdev->trigger->leddev_list_lock, +- flags); ++ spin_lock(&led_cdev->trigger->leddev_list_lock); ++ list_del_rcu(&led_cdev->trig_list); ++ spin_unlock(&led_cdev->trigger->leddev_list_lock); ++ ++ /* ensure it's no longer visible on the led_cdevs list */ ++ synchronize_rcu(); ++ + cancel_work_sync(&led_cdev->set_brightness_work); + led_stop_software_blink(led_cdev); ++ device_remove_groups(led_cdev->dev, led_cdev->trigger->groups); + if (led_cdev->trigger->deactivate) + led_cdev->trigger->deactivate(led_cdev); +- device_remove_groups(led_cdev->dev, led_cdev->trigger->groups); + led_cdev->trigger = NULL; + led_cdev->trigger_data = NULL; + led_cdev->activated = false; + led_set_brightness(led_cdev, LED_OFF); + } + if (trig) { +- write_lock_irqsave(&trig->leddev_list_lock, flags); +- list_add_tail(&led_cdev->trig_list, &trig->led_cdevs); +- write_unlock_irqrestore(&trig->leddev_list_lock, flags); ++ spin_lock(&trig->leddev_list_lock); ++ list_add_tail_rcu(&led_cdev->trig_list, &trig->led_cdevs); ++ spin_unlock(&trig->leddev_list_lock); + led_cdev->trigger = trig; + ++ /* ++ * Some activate() calls use led_trigger_event() to initialize ++ * the brightness of the LED for which the trigger is being set. ++ * Ensure the led_cdev is visible on trig->led_cdevs for this. ++ */ ++ synchronize_rcu(); ++ ++ /* ++ * If "set brightness to 0" is pending in workqueue, ++ * we don't want that to be reordered after ->activate() ++ */ ++ flush_work(&led_cdev->set_brightness_work); ++ ++ ret = 0; + if (trig->activate) + ret = trig->activate(led_cdev); + else +- ret = 0; +- ++ led_set_brightness(led_cdev, trig->brightness); + if (ret) + goto err_activate; + +@@ -223,9 +238,10 @@ int led_trigger_set(struct led_classdev *led_cdev, struct led_trigger *trig) + trig->deactivate(led_cdev); + err_activate: + +- write_lock_irqsave(&led_cdev->trigger->leddev_list_lock, flags); +- list_del(&led_cdev->trig_list); +- write_unlock_irqrestore(&led_cdev->trigger->leddev_list_lock, flags); ++ spin_lock(&led_cdev->trigger->leddev_list_lock); ++ list_del_rcu(&led_cdev->trig_list); ++ spin_unlock(&led_cdev->trigger->leddev_list_lock); ++ synchronize_rcu(); + led_cdev->trigger = NULL; + led_cdev->trigger_data = NULL; + led_set_brightness(led_cdev, LED_OFF); +@@ -265,19 +281,6 @@ void led_trigger_set_default(struct led_classdev *led_cdev) + } + EXPORT_SYMBOL_GPL(led_trigger_set_default); + +-void led_trigger_rename_static(const char *name, struct led_trigger *trig) +-{ +- /* new name must be on a temporary string to prevent races */ +- BUG_ON(name == trig->name); +- +- down_write(&triggers_list_lock); +- /* this assumes that trig->name was originaly allocated to +- * non constant storage */ +- strcpy((char *)trig->name, name); +- up_write(&triggers_list_lock); +-} +-EXPORT_SYMBOL_GPL(led_trigger_rename_static); +- + /* LED Trigger Interface */ + + int led_trigger_register(struct led_trigger *trig) +@@ -285,7 +288,7 @@ int led_trigger_register(struct led_trigger *trig) + struct led_classdev *led_cdev; + struct led_trigger *_trig; + +- rwlock_init(&trig->leddev_list_lock); ++ spin_lock_init(&trig->leddev_list_lock); + INIT_LIST_HEAD(&trig->led_cdevs); + + down_write(&triggers_list_lock); +@@ -378,15 +381,16 @@ void led_trigger_event(struct led_trigger *trig, + enum led_brightness brightness) + { + struct led_classdev *led_cdev; +- unsigned long flags; + + if (!trig) + return; + +- read_lock_irqsave(&trig->leddev_list_lock, flags); +- list_for_each_entry(led_cdev, &trig->led_cdevs, trig_list) ++ trig->brightness = brightness; ++ ++ rcu_read_lock(); ++ list_for_each_entry_rcu(led_cdev, &trig->led_cdevs, trig_list) + led_set_brightness(led_cdev, brightness); +- read_unlock_irqrestore(&trig->leddev_list_lock, flags); ++ rcu_read_unlock(); + } + EXPORT_SYMBOL_GPL(led_trigger_event); + +@@ -397,20 +401,19 @@ static void led_trigger_blink_setup(struct led_trigger *trig, + int invert) + { + struct led_classdev *led_cdev; +- unsigned long flags; + + if (!trig) + return; + +- read_lock_irqsave(&trig->leddev_list_lock, flags); +- list_for_each_entry(led_cdev, &trig->led_cdevs, trig_list) { ++ rcu_read_lock(); ++ list_for_each_entry_rcu(led_cdev, &trig->led_cdevs, trig_list) { + if (oneshot) + led_blink_set_oneshot(led_cdev, delay_on, delay_off, + invert); + else + led_blink_set(led_cdev, delay_on, delay_off); + } +- read_unlock_irqrestore(&trig->leddev_list_lock, flags); ++ rcu_read_unlock(); + } + + void led_trigger_blink(struct led_trigger *trig, +diff --git a/drivers/leds/leds-ss4200.c b/drivers/leds/leds-ss4200.c +index fcaa34706b6caa..2ef9fc7371bd1f 100644 +--- a/drivers/leds/leds-ss4200.c ++++ b/drivers/leds/leds-ss4200.c +@@ -356,8 +356,10 @@ static int ich7_lpc_probe(struct pci_dev *dev, + + nas_gpio_pci_dev = dev; + status = pci_read_config_dword(dev, PMBASE, &g_pm_io_base); +- if (status) ++ if (status) { ++ status = pcibios_err_to_errno(status); + goto out; ++ } + g_pm_io_base &= 0x00000ff80; + + status = pci_read_config_dword(dev, GPIO_CTRL, &gc); +@@ -369,8 +371,9 @@ static int ich7_lpc_probe(struct pci_dev *dev, + } + + status = pci_read_config_dword(dev, GPIO_BASE, &nas_gpio_io_base); +- if (0 > status) { ++ if (status) { + dev_info(&dev->dev, "Unable to read GPIOBASE.\n"); ++ status = pcibios_err_to_errno(status); + goto out; + } + dev_dbg(&dev->dev, ": GPIOBASE = 0x%08x\n", nas_gpio_io_base); +diff --git a/drivers/leds/trigger/ledtrig-timer.c b/drivers/leds/trigger/ledtrig-timer.c +index b4688d1d9d2b24..1d213c999d40a5 100644 +--- a/drivers/leds/trigger/ledtrig-timer.c ++++ b/drivers/leds/trigger/ledtrig-timer.c +@@ -110,11 +110,6 @@ static int timer_trig_activate(struct led_classdev *led_cdev) + led_cdev->flags &= ~LED_INIT_DEFAULT_TRIGGER; + } + +- /* +- * If "set brightness to 0" is pending in workqueue, we don't +- * want that to be reordered after blink_set() +- */ +- flush_work(&led_cdev->set_brightness_work); + led_blink_set(led_cdev, &led_cdev->blink_delay_on, + &led_cdev->blink_delay_off); + +diff --git a/drivers/macintosh/therm_windtunnel.c b/drivers/macintosh/therm_windtunnel.c +index f55f6adf5e5ff7..49805eb4d145a2 100644 +--- a/drivers/macintosh/therm_windtunnel.c ++++ b/drivers/macintosh/therm_windtunnel.c +@@ -549,7 +549,7 @@ g4fan_exit( void ) + platform_driver_unregister( &therm_of_driver ); + + if( x.of_dev ) +- of_device_unregister( x.of_dev ); ++ of_platform_device_destroy(&x.of_dev->dev, NULL); + } + + module_init(g4fan_init); +diff --git a/drivers/md/md.c b/drivers/md/md.c +index 45ef1ddd2bd030..5b6c366587d54c 100644 +--- a/drivers/md/md.c ++++ b/drivers/md/md.c +@@ -509,7 +509,6 @@ void mddev_suspend(struct mddev *mddev) + clear_bit_unlock(MD_ALLOW_SB_UPDATE, &mddev->flags); + wait_event(mddev->sb_wait, !test_bit(MD_UPDATING_SB, &mddev->flags)); + +- del_timer_sync(&mddev->safemode_timer); + /* restrict memory reclaim I/O during raid array is suspend */ + mddev->noio_flag = memalloc_noio_save(); + } +diff --git a/drivers/md/raid5.c b/drivers/md/raid5.c +index bcd43cca94f9f2..87b713142e15de 100644 +--- a/drivers/md/raid5.c ++++ b/drivers/md/raid5.c +@@ -6007,7 +6007,9 @@ static sector_t reshape_request(struct mddev *mddev, sector_t sector_nr, int *sk + safepos = conf->reshape_safe; + sector_div(safepos, data_disks); + if (mddev->reshape_backwards) { +- BUG_ON(writepos < reshape_sectors); ++ if (WARN_ON(writepos < reshape_sectors)) ++ return MaxSector; ++ + writepos -= reshape_sectors; + readpos += reshape_sectors; + safepos += reshape_sectors; +@@ -6025,14 +6027,18 @@ static sector_t reshape_request(struct mddev *mddev, sector_t sector_nr, int *sk + * to set 'stripe_addr' which is where we will write to. + */ + if (mddev->reshape_backwards) { +- BUG_ON(conf->reshape_progress == 0); ++ if (WARN_ON(conf->reshape_progress == 0)) ++ return MaxSector; ++ + stripe_addr = writepos; +- BUG_ON((mddev->dev_sectors & +- ~((sector_t)reshape_sectors - 1)) +- - reshape_sectors - stripe_addr +- != sector_nr); ++ if (WARN_ON((mddev->dev_sectors & ++ ~((sector_t)reshape_sectors - 1)) - ++ reshape_sectors - stripe_addr != sector_nr)) ++ return MaxSector; + } else { +- BUG_ON(writepos != sector_nr + reshape_sectors); ++ if (WARN_ON(writepos != sector_nr + reshape_sectors)) ++ return MaxSector; ++ + stripe_addr = sector_nr; + } + +diff --git a/drivers/media/i2c/imx412.c b/drivers/media/i2c/imx412.c +index 84279a6808730e..3d4d813923918a 100644 +--- a/drivers/media/i2c/imx412.c ++++ b/drivers/media/i2c/imx412.c +@@ -535,14 +535,13 @@ static int imx412_update_controls(struct imx412 *imx412, + */ + static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain) + { +- u32 lpfr, shutter; ++ u32 lpfr; + int ret; + + lpfr = imx412->vblank + imx412->cur_mode->height; +- shutter = lpfr - exposure; + +- dev_dbg(imx412->dev, "Set exp %u, analog gain %u, shutter %u, lpfr %u", +- exposure, gain, shutter, lpfr); ++ dev_dbg(imx412->dev, "Set exp %u, analog gain %u, lpfr %u", ++ exposure, gain, lpfr); + + ret = imx412_write_reg(imx412, IMX412_REG_HOLD, 1, 1); + if (ret) +@@ -552,7 +551,7 @@ static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain) + if (ret) + goto error_release_group_hold; + +- ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, shutter); ++ ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, exposure); + if (ret) + goto error_release_group_hold; + +diff --git a/drivers/media/pci/saa7134/saa7134-dvb.c b/drivers/media/pci/saa7134/saa7134-dvb.c +index f359cd5c006a75..c786b83a69d2ba 100644 +--- a/drivers/media/pci/saa7134/saa7134-dvb.c ++++ b/drivers/media/pci/saa7134/saa7134-dvb.c +@@ -466,7 +466,9 @@ static int philips_europa_tuner_sleep(struct dvb_frontend *fe) + /* switch the board to analog mode */ + if (fe->ops.i2c_gate_ctrl) + fe->ops.i2c_gate_ctrl(fe, 1); +- i2c_transfer(&dev->i2c_adap, &analog_msg, 1); ++ if (i2c_transfer(&dev->i2c_adap, &analog_msg, 1) != 1) ++ return -EIO; ++ + return 0; + } + +@@ -1018,7 +1020,9 @@ static int md8800_set_voltage2(struct dvb_frontend *fe, + else + wbuf[1] = rbuf & 0xef; + msg[0].len = 2; +- i2c_transfer(&dev->i2c_adap, msg, 1); ++ if (i2c_transfer(&dev->i2c_adap, msg, 1) != 1) ++ return -EIO; ++ + return 0; + } + +diff --git a/drivers/media/platform/qcom/venus/vdec.c b/drivers/media/platform/qcom/venus/vdec.c +index 6e0466772339ab..42134cde120db4 100644 +--- a/drivers/media/platform/qcom/venus/vdec.c ++++ b/drivers/media/platform/qcom/venus/vdec.c +@@ -1165,7 +1165,7 @@ static int vdec_stop_output(struct venus_inst *inst) + break; + case VENUS_DEC_STATE_INIT: + case VENUS_DEC_STATE_CAPTURE_SETUP: +- ret = hfi_session_flush(inst, HFI_FLUSH_INPUT, true); ++ ret = hfi_session_flush(inst, HFI_FLUSH_ALL, true); + break; + default: + break; +@@ -1632,6 +1632,7 @@ static int vdec_close(struct file *file) + + vdec_pm_get(inst); + ++ cancel_work_sync(&inst->delayed_process_work); + v4l2_m2m_ctx_release(inst->m2m_ctx); + v4l2_m2m_release(inst->m2m_dev); + vdec_ctrl_deinit(inst); +diff --git a/drivers/media/platform/vsp1/vsp1_histo.c b/drivers/media/platform/vsp1/vsp1_histo.c +index 5e5013d2cd2ad8..897dfe99323afc 100644 +--- a/drivers/media/platform/vsp1/vsp1_histo.c ++++ b/drivers/media/platform/vsp1/vsp1_histo.c +@@ -36,9 +36,8 @@ struct vsp1_histogram_buffer * + vsp1_histogram_buffer_get(struct vsp1_histogram *histo) + { + struct vsp1_histogram_buffer *buf = NULL; +- unsigned long flags; + +- spin_lock_irqsave(&histo->irqlock, flags); ++ spin_lock(&histo->irqlock); + + if (list_empty(&histo->irqqueue)) + goto done; +@@ -49,7 +48,7 @@ vsp1_histogram_buffer_get(struct vsp1_histogram *histo) + histo->readout = true; + + done: +- spin_unlock_irqrestore(&histo->irqlock, flags); ++ spin_unlock(&histo->irqlock); + return buf; + } + +@@ -58,7 +57,6 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo, + size_t size) + { + struct vsp1_pipeline *pipe = histo->entity.pipe; +- unsigned long flags; + + /* + * The pipeline pointer is guaranteed to be valid as this function is +@@ -70,10 +68,10 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo, + vb2_set_plane_payload(&buf->buf.vb2_buf, 0, size); + vb2_buffer_done(&buf->buf.vb2_buf, VB2_BUF_STATE_DONE); + +- spin_lock_irqsave(&histo->irqlock, flags); ++ spin_lock(&histo->irqlock); + histo->readout = false; + wake_up(&histo->wait_queue); +- spin_unlock_irqrestore(&histo->irqlock, flags); ++ spin_unlock(&histo->irqlock); + } + + /* ----------------------------------------------------------------------------- +@@ -124,11 +122,10 @@ static void histo_buffer_queue(struct vb2_buffer *vb) + struct vb2_v4l2_buffer *vbuf = to_vb2_v4l2_buffer(vb); + struct vsp1_histogram *histo = vb2_get_drv_priv(vb->vb2_queue); + struct vsp1_histogram_buffer *buf = to_vsp1_histogram_buffer(vbuf); +- unsigned long flags; + +- spin_lock_irqsave(&histo->irqlock, flags); ++ spin_lock_irq(&histo->irqlock); + list_add_tail(&buf->queue, &histo->irqqueue); +- spin_unlock_irqrestore(&histo->irqlock, flags); ++ spin_unlock_irq(&histo->irqlock); + } + + static int histo_start_streaming(struct vb2_queue *vq, unsigned int count) +@@ -140,9 +137,8 @@ static void histo_stop_streaming(struct vb2_queue *vq) + { + struct vsp1_histogram *histo = vb2_get_drv_priv(vq); + struct vsp1_histogram_buffer *buffer; +- unsigned long flags; + +- spin_lock_irqsave(&histo->irqlock, flags); ++ spin_lock_irq(&histo->irqlock); + + /* Remove all buffers from the IRQ queue. */ + list_for_each_entry(buffer, &histo->irqqueue, queue) +@@ -152,7 +148,7 @@ static void histo_stop_streaming(struct vb2_queue *vq) + /* Wait for the buffer being read out (if any) to complete. */ + wait_event_lock_irq(histo->wait_queue, !histo->readout, histo->irqlock); + +- spin_unlock_irqrestore(&histo->irqlock, flags); ++ spin_unlock_irq(&histo->irqlock); + } + + static const struct vb2_ops histo_video_queue_qops = { +diff --git a/drivers/media/platform/vsp1/vsp1_pipe.h b/drivers/media/platform/vsp1/vsp1_pipe.h +index ae646c9ef33731..15daf35bda2163 100644 +--- a/drivers/media/platform/vsp1/vsp1_pipe.h ++++ b/drivers/media/platform/vsp1/vsp1_pipe.h +@@ -73,7 +73,7 @@ struct vsp1_partition_window { + * @wpf: The WPF partition window configuration + */ + struct vsp1_partition { +- struct vsp1_partition_window rpf; ++ struct vsp1_partition_window rpf[VSP1_MAX_RPF]; + struct vsp1_partition_window uds_sink; + struct vsp1_partition_window uds_source; + struct vsp1_partition_window sru; +diff --git a/drivers/media/platform/vsp1/vsp1_rpf.c b/drivers/media/platform/vsp1/vsp1_rpf.c +index 75083cb234fe35..996a3058d5b76a 100644 +--- a/drivers/media/platform/vsp1/vsp1_rpf.c ++++ b/drivers/media/platform/vsp1/vsp1_rpf.c +@@ -271,8 +271,8 @@ static void rpf_configure_partition(struct vsp1_entity *entity, + * 'width' need to be adjusted. + */ + if (pipe->partitions > 1) { +- crop.width = pipe->partition->rpf.width; +- crop.left += pipe->partition->rpf.left; ++ crop.width = pipe->partition->rpf[rpf->entity.index].width; ++ crop.left += pipe->partition->rpf[rpf->entity.index].left; + } + + if (pipe->interlaced) { +@@ -327,7 +327,9 @@ static void rpf_partition(struct vsp1_entity *entity, + unsigned int partition_idx, + struct vsp1_partition_window *window) + { +- partition->rpf = *window; ++ struct vsp1_rwpf *rpf = to_rwpf(&entity->subdev); ++ ++ partition->rpf[rpf->entity.index] = *window; + } + + static const struct vsp1_entity_operations rpf_entity_ops = { +diff --git a/drivers/media/rc/imon.c b/drivers/media/rc/imon.c +index 4e7c3d889d5ce8..9faf8365afa714 100644 +--- a/drivers/media/rc/imon.c ++++ b/drivers/media/rc/imon.c +@@ -1150,10 +1150,7 @@ static int imon_ir_change_protocol(struct rc_dev *rc, u64 *rc_proto) + + memcpy(ictx->usb_tx_buf, &ir_proto_packet, sizeof(ir_proto_packet)); + +- if (!mutex_is_locked(&ictx->lock)) { +- unlock = true; +- mutex_lock(&ictx->lock); +- } ++ unlock = mutex_trylock(&ictx->lock); + + retval = send_packet(ictx); + if (retval) +diff --git a/drivers/media/rc/lirc_dev.c b/drivers/media/rc/lirc_dev.c +index d73f02b0db8425..54f4a7cd88f434 100644 +--- a/drivers/media/rc/lirc_dev.c ++++ b/drivers/media/rc/lirc_dev.c +@@ -841,8 +841,10 @@ struct rc_dev *rc_dev_get_from_fd(int fd, bool write) + return ERR_PTR(-EINVAL); + } + +- if (write && !(f.file->f_mode & FMODE_WRITE)) ++ if (write && !(f.file->f_mode & FMODE_WRITE)) { ++ fdput(f); + return ERR_PTR(-EPERM); ++ } + + fh = f.file->private_data; + dev = fh->rc; +diff --git a/drivers/media/usb/uvc/uvc_ctrl.c b/drivers/media/usb/uvc/uvc_ctrl.c +index 05335866e6d623..050d3342658282 100644 +--- a/drivers/media/usb/uvc/uvc_ctrl.c ++++ b/drivers/media/usb/uvc/uvc_ctrl.c +@@ -1868,7 +1868,13 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev, + else + ret = uvc_query_ctrl(dev, UVC_GET_INFO, ctrl->entity->id, + dev->intfnum, info->selector, data, 1); +- if (!ret) ++ ++ if (!ret) { ++ info->flags &= ~(UVC_CTRL_FLAG_GET_CUR | ++ UVC_CTRL_FLAG_SET_CUR | ++ UVC_CTRL_FLAG_AUTO_UPDATE | ++ UVC_CTRL_FLAG_ASYNCHRONOUS); ++ + info->flags |= (data[0] & UVC_CONTROL_CAP_GET ? + UVC_CTRL_FLAG_GET_CUR : 0) + | (data[0] & UVC_CONTROL_CAP_SET ? +@@ -1877,6 +1883,7 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev, + UVC_CTRL_FLAG_AUTO_UPDATE : 0) + | (data[0] & UVC_CONTROL_CAP_ASYNCHRONOUS ? + UVC_CTRL_FLAG_ASYNCHRONOUS : 0); ++ } + + kfree(data); + return ret; +diff --git a/drivers/media/usb/uvc/uvc_video.c b/drivers/media/usb/uvc/uvc_video.c +index f477cfbbb905a6..446fe67e07c479 100644 +--- a/drivers/media/usb/uvc/uvc_video.c ++++ b/drivers/media/usb/uvc/uvc_video.c +@@ -210,13 +210,13 @@ static void uvc_fixup_video_ctrl(struct uvc_streaming *stream, + /* Compute a bandwidth estimation by multiplying the frame + * size by the number of video frames per second, divide the + * result by the number of USB frames (or micro-frames for +- * high-speed devices) per second and add the UVC header size +- * (assumed to be 12 bytes long). ++ * high- and super-speed devices) per second and add the UVC ++ * header size (assumed to be 12 bytes long). + */ + bandwidth = frame->wWidth * frame->wHeight / 8 * format->bpp; + bandwidth *= 10000000 / interval + 1; + bandwidth /= 1000; +- if (stream->dev->udev->speed == USB_SPEED_HIGH) ++ if (stream->dev->udev->speed >= USB_SPEED_HIGH) + bandwidth /= 8; + bandwidth += 12; + +@@ -471,6 +471,7 @@ uvc_video_clock_decode(struct uvc_streaming *stream, struct uvc_buffer *buf, + ktime_t time; + u16 host_sof; + u16 dev_sof; ++ u32 dev_stc; + + switch (data[1] & (UVC_STREAM_PTS | UVC_STREAM_SCR)) { + case UVC_STREAM_PTS | UVC_STREAM_SCR: +@@ -515,6 +516,34 @@ uvc_video_clock_decode(struct uvc_streaming *stream, struct uvc_buffer *buf, + if (dev_sof == stream->clock.last_sof) + return; + ++ dev_stc = get_unaligned_le32(&data[header_size - 6]); ++ ++ /* ++ * STC (Source Time Clock) is the clock used by the camera. The UVC 1.5 ++ * standard states that it "must be captured when the first video data ++ * of a video frame is put on the USB bus". This is generally understood ++ * as requiring devices to clear the payload header's SCR bit before ++ * the first packet containing video data. ++ * ++ * Most vendors follow that interpretation, but some (namely SunplusIT ++ * on some devices) always set the `UVC_STREAM_SCR` bit, fill the SCR ++ * field with 0's,and expect that the driver only processes the SCR if ++ * there is data in the packet. ++ * ++ * Ignore all the hardware timestamp information if we haven't received ++ * any data for this frame yet, the packet contains no data, and both ++ * STC and SOF are zero. This heuristics should be safe on compliant ++ * devices. This should be safe with compliant devices, as in the very ++ * unlikely case where a UVC 1.1 device would send timing information ++ * only before the first packet containing data, and both STC and SOF ++ * happen to be zero for a particular frame, we would only miss one ++ * clock sample from many and the clock recovery algorithm wouldn't ++ * suffer from this condition. ++ */ ++ if (buf && buf->bytesused == 0 && len == header_size && ++ dev_stc == 0 && dev_sof == 0) ++ return; ++ + stream->clock.last_sof = dev_sof; + + host_sof = usb_get_current_frame_number(stream->dev->udev); +@@ -552,7 +581,7 @@ uvc_video_clock_decode(struct uvc_streaming *stream, struct uvc_buffer *buf, + spin_lock_irqsave(&stream->clock.lock, flags); + + sample = &stream->clock.samples[stream->clock.head]; +- sample->dev_stc = get_unaligned_le32(&data[header_size - 6]); ++ sample->dev_stc = dev_stc; + sample->dev_sof = dev_sof; + sample->host_sof = host_sof; + sample->host_time = time; +@@ -697,11 +726,11 @@ void uvc_video_clock_update(struct uvc_streaming *stream, + unsigned long flags; + u64 timestamp; + u32 delta_stc; +- u32 y1, y2; ++ u32 y1; + u32 x1, x2; + u32 mean; + u32 sof; +- u64 y; ++ u64 y, y2; + + if (!uvc_hw_timestamps_param) + return; +@@ -741,7 +770,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream, + sof = y; + + uvc_dbg(stream->dev, CLOCK, +- "%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %u SOF offset %u)\n", ++ "%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %llu SOF offset %u)\n", + stream->dev->name, buf->pts, + y >> 16, div_u64((y & 0xffff) * 1000000, 65536), + sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536), +@@ -756,7 +785,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream, + goto done; + + y1 = NSEC_PER_SEC; +- y2 = (u32)ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1; ++ y2 = ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1; + + /* Interpolated and host SOF timestamps can wrap around at slightly + * different times. Handle this by adding or removing 2048 to or from +@@ -776,7 +805,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream, + timestamp = ktime_to_ns(first->host_time) + y - y1; + + uvc_dbg(stream->dev, CLOCK, +- "%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %u)\n", ++ "%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %llu)\n", + stream->dev->name, + sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536), + y, timestamp, vbuf->vb2_buf.timestamp, +diff --git a/drivers/memory/Kconfig b/drivers/memory/Kconfig +index 72c0df129d5c50..5a410a40f914ae 100644 +--- a/drivers/memory/Kconfig ++++ b/drivers/memory/Kconfig +@@ -168,7 +168,7 @@ config FSL_CORENET_CF + represents a coherency violation. + + config FSL_IFC +- bool "Freescale IFC driver" if COMPILE_TEST ++ bool "Freescale IFC driver" + depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST + depends on HAS_IOMEM + +diff --git a/drivers/mfd/Makefile b/drivers/mfd/Makefile +index 2ba6646e874cdd..aa0d4391426913 100644 +--- a/drivers/mfd/Makefile ++++ b/drivers/mfd/Makefile +@@ -274,7 +274,5 @@ obj-$(CONFIG_MFD_INTEL_M10_BMC) += intel-m10-bmc.o + obj-$(CONFIG_MFD_ATC260X) += atc260x-core.o + obj-$(CONFIG_MFD_ATC260X_I2C) += atc260x-i2c.o + +-rsmu-i2c-objs := rsmu_core.o rsmu_i2c.o +-rsmu-spi-objs := rsmu_core.o rsmu_spi.o +-obj-$(CONFIG_MFD_RSMU_I2C) += rsmu-i2c.o +-obj-$(CONFIG_MFD_RSMU_SPI) += rsmu-spi.o ++obj-$(CONFIG_MFD_RSMU_I2C) += rsmu_i2c.o rsmu_core.o ++obj-$(CONFIG_MFD_RSMU_SPI) += rsmu_spi.o rsmu_core.o +diff --git a/drivers/mfd/omap-usb-tll.c b/drivers/mfd/omap-usb-tll.c +index 080d7970a3774e..5971b5cb290a13 100644 +--- a/drivers/mfd/omap-usb-tll.c ++++ b/drivers/mfd/omap-usb-tll.c +@@ -237,8 +237,7 @@ static int usbtll_omap_probe(struct platform_device *pdev) + break; + } + +- tll = devm_kzalloc(dev, sizeof(*tll) + sizeof(tll->ch_clk[nch]), +- GFP_KERNEL); ++ tll = devm_kzalloc(dev, struct_size(tll, ch_clk, nch), GFP_KERNEL); + if (!tll) { + pm_runtime_put_sync(dev); + pm_runtime_disable(dev); +diff --git a/drivers/mfd/rsmu_core.c b/drivers/mfd/rsmu_core.c +index 29437fd0bd5bf6..fd04a6e5dfa31a 100644 +--- a/drivers/mfd/rsmu_core.c ++++ b/drivers/mfd/rsmu_core.c +@@ -78,11 +78,13 @@ int rsmu_core_init(struct rsmu_ddata *rsmu) + + return ret; + } ++EXPORT_SYMBOL_GPL(rsmu_core_init); + + void rsmu_core_exit(struct rsmu_ddata *rsmu) + { + mutex_destroy(&rsmu->lock); + } ++EXPORT_SYMBOL_GPL(rsmu_core_exit); + + MODULE_DESCRIPTION("Renesas SMU core driver"); + MODULE_LICENSE("GPL"); +diff --git a/drivers/mtd/nand/raw/Kconfig b/drivers/mtd/nand/raw/Kconfig +index 67b7cb67c0307b..aa584aaf8ae3fe 100644 +--- a/drivers/mtd/nand/raw/Kconfig ++++ b/drivers/mtd/nand/raw/Kconfig +@@ -254,8 +254,7 @@ config MTD_NAND_FSL_IFC + tristate "Freescale IFC NAND controller" + depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST + depends on HAS_IOMEM +- select FSL_IFC +- select MEMORY ++ depends on FSL_IFC + help + Various Freescale chips e.g P1010, include a NAND Flash machine + with built-in hardware ECC capabilities. +diff --git a/drivers/mtd/tests/Makefile b/drivers/mtd/tests/Makefile +index 5de0378f90dbdc..7dae831ee8b6bf 100644 +--- a/drivers/mtd/tests/Makefile ++++ b/drivers/mtd/tests/Makefile +@@ -1,19 +1,19 @@ + # SPDX-License-Identifier: GPL-2.0 +-obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o +-obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o +-obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o +-obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o +-obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o +-obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o +-obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o +-obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o +-obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o ++obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o mtd_test.o ++obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o mtd_test.o ++obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o mtd_test.o ++obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o mtd_test.o ++obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o mtd_test.o ++obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o mtd_test.o ++obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o mtd_test.o ++obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o mtd_test.o ++obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o mtd_test.o + +-mtd_oobtest-objs := oobtest.o mtd_test.o +-mtd_pagetest-objs := pagetest.o mtd_test.o +-mtd_readtest-objs := readtest.o mtd_test.o +-mtd_speedtest-objs := speedtest.o mtd_test.o +-mtd_stresstest-objs := stresstest.o mtd_test.o +-mtd_subpagetest-objs := subpagetest.o mtd_test.o +-mtd_torturetest-objs := torturetest.o mtd_test.o +-mtd_nandbiterrs-objs := nandbiterrs.o mtd_test.o ++mtd_oobtest-objs := oobtest.o ++mtd_pagetest-objs := pagetest.o ++mtd_readtest-objs := readtest.o ++mtd_speedtest-objs := speedtest.o ++mtd_stresstest-objs := stresstest.o ++mtd_subpagetest-objs := subpagetest.o ++mtd_torturetest-objs := torturetest.o ++mtd_nandbiterrs-objs := nandbiterrs.o +diff --git a/drivers/mtd/tests/mtd_test.c b/drivers/mtd/tests/mtd_test.c +index c84250beffdc91..f391e0300cdc94 100644 +--- a/drivers/mtd/tests/mtd_test.c ++++ b/drivers/mtd/tests/mtd_test.c +@@ -25,6 +25,7 @@ int mtdtest_erase_eraseblock(struct mtd_info *mtd, unsigned int ebnum) + + return 0; + } ++EXPORT_SYMBOL_GPL(mtdtest_erase_eraseblock); + + static int is_block_bad(struct mtd_info *mtd, unsigned int ebnum) + { +@@ -57,6 +58,7 @@ int mtdtest_scan_for_bad_eraseblocks(struct mtd_info *mtd, unsigned char *bbt, + + return 0; + } ++EXPORT_SYMBOL_GPL(mtdtest_scan_for_bad_eraseblocks); + + int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt, + unsigned int eb, int ebcnt) +@@ -75,6 +77,7 @@ int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt, + + return 0; + } ++EXPORT_SYMBOL_GPL(mtdtest_erase_good_eraseblocks); + + int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf) + { +@@ -92,6 +95,7 @@ int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf) + + return err; + } ++EXPORT_SYMBOL_GPL(mtdtest_read); + + int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size, + const void *buf) +@@ -107,3 +111,8 @@ int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size, + + return err; + } ++EXPORT_SYMBOL_GPL(mtdtest_write); ++ ++MODULE_LICENSE("GPL"); ++MODULE_DESCRIPTION("MTD function test helpers"); ++MODULE_AUTHOR("Akinobu Mita"); +diff --git a/drivers/mtd/ubi/eba.c b/drivers/mtd/ubi/eba.c +index 4d05b8d3208307..41e0f098705c8b 100644 +--- a/drivers/mtd/ubi/eba.c ++++ b/drivers/mtd/ubi/eba.c +@@ -1560,6 +1560,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap, + GFP_KERNEL); + if (!fm_eba[i]) { + ret = -ENOMEM; ++ kfree(scan_eba[i]); + goto out_free; + } + +@@ -1595,7 +1596,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap, + } + + out_free: +- for (i = 0; i < num_volumes; i++) { ++ while (--i >= 0) { + if (!ubi->volumes[i]) + continue; + +diff --git a/drivers/net/bonding/bond_main.c b/drivers/net/bonding/bond_main.c +index 9aed194d308d67..6a91229b0e05b5 100644 +--- a/drivers/net/bonding/bond_main.c ++++ b/drivers/net/bonding/bond_main.c +@@ -1087,13 +1087,10 @@ static struct slave *bond_find_best_slave(struct bonding *bond) + return bestslave; + } + ++/* must be called in RCU critical section or with RTNL held */ + static bool bond_should_notify_peers(struct bonding *bond) + { +- struct slave *slave; +- +- rcu_read_lock(); +- slave = rcu_dereference(bond->curr_active_slave); +- rcu_read_unlock(); ++ struct slave *slave = rcu_dereference_rtnl(bond->curr_active_slave); + + if (!slave || !bond->send_peer_notif || + bond->send_peer_notif % +diff --git a/drivers/net/dsa/b53/b53_common.c b/drivers/net/dsa/b53/b53_common.c +index 604f541126654f..e23f184ffdda73 100644 +--- a/drivers/net/dsa/b53/b53_common.c ++++ b/drivers/net/dsa/b53/b53_common.c +@@ -2223,6 +2223,9 @@ static int b53_change_mtu(struct dsa_switch *ds, int port, int mtu) + if (is5325(dev) || is5365(dev)) + return -EOPNOTSUPP; + ++ if (!dsa_is_cpu_port(ds, port)) ++ return 0; ++ + enable_jumbo = (mtu >= JMS_MIN_SIZE); + allow_10_100 = (dev->chip_id == BCM583XX_DEVICE_ID); + +diff --git a/drivers/net/dsa/bcm_sf2.c b/drivers/net/dsa/bcm_sf2.c +index 1fa392aee52de0..f259b0add5b2e1 100644 +--- a/drivers/net/dsa/bcm_sf2.c ++++ b/drivers/net/dsa/bcm_sf2.c +@@ -638,8 +638,10 @@ static int bcm_sf2_mdio_register(struct dsa_switch *ds) + of_remove_property(child, prop); + + phydev = of_phy_find_device(child); +- if (phydev) ++ if (phydev) { + phy_device_remove(phydev); ++ phy_device_free(phydev); ++ } + } + + err = mdiobus_register(priv->slave_mii_bus); +diff --git a/drivers/net/dsa/mv88e6xxx/chip.c b/drivers/net/dsa/mv88e6xxx/chip.c +index 7985a48e083060..2a55ecceab8c60 100644 +--- a/drivers/net/dsa/mv88e6xxx/chip.c ++++ b/drivers/net/dsa/mv88e6xxx/chip.c +@@ -3104,7 +3104,8 @@ static int mv88e6xxx_change_mtu(struct dsa_switch *ds, int port, int new_mtu) + mv88e6xxx_reg_lock(chip); + if (chip->info->ops->port_set_jumbo_size) + ret = chip->info->ops->port_set_jumbo_size(chip, port, new_mtu); +- else if (chip->info->ops->set_max_frame_size) ++ else if (chip->info->ops->set_max_frame_size && ++ dsa_is_cpu_port(ds, port)) + ret = chip->info->ops->set_max_frame_size(chip, new_mtu); + mv88e6xxx_reg_unlock(chip); + +diff --git a/drivers/net/ethernet/brocade/bna/bna_types.h b/drivers/net/ethernet/brocade/bna/bna_types.h +index 666b6922e24db3..ebf54d74c2bbe5 100644 +--- a/drivers/net/ethernet/brocade/bna/bna_types.h ++++ b/drivers/net/ethernet/brocade/bna/bna_types.h +@@ -410,7 +410,7 @@ struct bna_ib { + /* Tx object */ + + /* Tx datapath control structure */ +-#define BNA_Q_NAME_SIZE 16 ++#define BNA_Q_NAME_SIZE (IFNAMSIZ + 6) + struct bna_tcb { + /* Fast path */ + void **sw_qpt; +diff --git a/drivers/net/ethernet/brocade/bna/bnad.c b/drivers/net/ethernet/brocade/bna/bnad.c +index 0347c9d3aff321..a3b6b9af0b057f 100644 +--- a/drivers/net/ethernet/brocade/bna/bnad.c ++++ b/drivers/net/ethernet/brocade/bna/bnad.c +@@ -1535,8 +1535,9 @@ bnad_tx_msix_register(struct bnad *bnad, struct bnad_tx_info *tx_info, + + for (i = 0; i < num_txqs; i++) { + vector_num = tx_info->tcb[i]->intr_vector; +- sprintf(tx_info->tcb[i]->name, "%s TXQ %d", bnad->netdev->name, +- tx_id + tx_info->tcb[i]->id); ++ snprintf(tx_info->tcb[i]->name, BNA_Q_NAME_SIZE, "%s TXQ %d", ++ bnad->netdev->name, ++ tx_id + tx_info->tcb[i]->id); + err = request_irq(bnad->msix_table[vector_num].vector, + (irq_handler_t)bnad_msix_tx, 0, + tx_info->tcb[i]->name, +@@ -1586,9 +1587,9 @@ bnad_rx_msix_register(struct bnad *bnad, struct bnad_rx_info *rx_info, + + for (i = 0; i < num_rxps; i++) { + vector_num = rx_info->rx_ctrl[i].ccb->intr_vector; +- sprintf(rx_info->rx_ctrl[i].ccb->name, "%s CQ %d", +- bnad->netdev->name, +- rx_id + rx_info->rx_ctrl[i].ccb->id); ++ snprintf(rx_info->rx_ctrl[i].ccb->name, BNA_Q_NAME_SIZE, ++ "%s CQ %d", bnad->netdev->name, ++ rx_id + rx_info->rx_ctrl[i].ccb->id); + err = request_irq(bnad->msix_table[vector_num].vector, + (irq_handler_t)bnad_msix_rx, 0, + rx_info->rx_ctrl[i].ccb->name, +diff --git a/drivers/net/ethernet/freescale/fec_main.c b/drivers/net/ethernet/freescale/fec_main.c +index f02376555ed459..0a3cf22dc260b1 100644 +--- a/drivers/net/ethernet/freescale/fec_main.c ++++ b/drivers/net/ethernet/freescale/fec_main.c +@@ -252,8 +252,8 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address"); + #define PKT_MINBUF_SIZE 64 + + /* FEC receive acceleration */ +-#define FEC_RACC_IPDIS (1 << 1) +-#define FEC_RACC_PRODIS (1 << 2) ++#define FEC_RACC_IPDIS BIT(1) ++#define FEC_RACC_PRODIS BIT(2) + #define FEC_RACC_SHIFT16 BIT(7) + #define FEC_RACC_OPTIONS (FEC_RACC_IPDIS | FEC_RACC_PRODIS) + +@@ -285,8 +285,23 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address"); + #define FEC_MMFR_TA (2 << 16) + #define FEC_MMFR_DATA(v) (v & 0xffff) + /* FEC ECR bits definition */ +-#define FEC_ECR_MAGICEN (1 << 2) +-#define FEC_ECR_SLEEP (1 << 3) ++#define FEC_ECR_RESET BIT(0) ++#define FEC_ECR_ETHEREN BIT(1) ++#define FEC_ECR_MAGICEN BIT(2) ++#define FEC_ECR_SLEEP BIT(3) ++#define FEC_ECR_EN1588 BIT(4) ++#define FEC_ECR_BYTESWP BIT(8) ++/* FEC RCR bits definition */ ++#define FEC_RCR_LOOP BIT(0) ++#define FEC_RCR_HALFDPX BIT(1) ++#define FEC_RCR_MII BIT(2) ++#define FEC_RCR_PROMISC BIT(3) ++#define FEC_RCR_BC_REJ BIT(4) ++#define FEC_RCR_FLOWCTL BIT(5) ++#define FEC_RCR_RMII BIT(8) ++#define FEC_RCR_10BASET BIT(9) ++/* TX WMARK bits */ ++#define FEC_TXWMRK_STRFWD BIT(8) + + #define FEC_MII_TIMEOUT 30000 /* us */ + +@@ -981,7 +996,7 @@ fec_restart(struct net_device *ndev) + struct fec_enet_private *fep = netdev_priv(ndev); + u32 temp_mac[2]; + u32 rcntl = OPT_FRAME_SIZE | 0x04; +- u32 ecntl = 0x2; /* ETHEREN */ ++ u32 ecntl = FEC_ECR_ETHEREN; + + /* Whack a reset. We should wait for this. + * For i.MX6SX SOC, enet use AXI bus, we use disable MAC +@@ -1059,18 +1074,18 @@ fec_restart(struct net_device *ndev) + fep->phy_interface == PHY_INTERFACE_MODE_RGMII_TXID) + rcntl |= (1 << 6); + else if (fep->phy_interface == PHY_INTERFACE_MODE_RMII) +- rcntl |= (1 << 8); ++ rcntl |= FEC_RCR_RMII; + else +- rcntl &= ~(1 << 8); ++ rcntl &= ~FEC_RCR_RMII; + + /* 1G, 100M or 10M */ + if (ndev->phydev) { + if (ndev->phydev->speed == SPEED_1000) + ecntl |= (1 << 5); + else if (ndev->phydev->speed == SPEED_100) +- rcntl &= ~(1 << 9); ++ rcntl &= ~FEC_RCR_10BASET; + else +- rcntl |= (1 << 9); ++ rcntl |= FEC_RCR_10BASET; + } + } else { + #ifdef FEC_MIIGSK_ENR +@@ -1129,13 +1144,13 @@ fec_restart(struct net_device *ndev) + + if (fep->quirks & FEC_QUIRK_ENET_MAC) { + /* enable ENET endian swap */ +- ecntl |= (1 << 8); ++ ecntl |= FEC_ECR_BYTESWP; + /* enable ENET store and forward mode */ +- writel(1 << 8, fep->hwp + FEC_X_WMRK); ++ writel(FEC_TXWMRK_STRFWD, fep->hwp + FEC_X_WMRK); + } + + if (fep->bufdesc_ex) +- ecntl |= (1 << 4); ++ ecntl |= FEC_ECR_EN1588; + + if (fep->quirks & FEC_QUIRK_DELAYED_CLKS_SUPPORT && + fep->rgmii_txc_dly) +@@ -1189,7 +1204,7 @@ static void + fec_stop(struct net_device *ndev) + { + struct fec_enet_private *fep = netdev_priv(ndev); +- u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & (1 << 8); ++ u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & FEC_RCR_RMII; + u32 val; + + /* We cannot expect a graceful transmit stop without link !!! */ +@@ -1208,7 +1223,7 @@ fec_stop(struct net_device *ndev) + if (fep->quirks & FEC_QUIRK_HAS_MULTI_QUEUES) { + writel(0, fep->hwp + FEC_ECNTRL); + } else { +- writel(1, fep->hwp + FEC_ECNTRL); ++ writel(FEC_ECR_RESET, fep->hwp + FEC_ECNTRL); + udelay(10); + } + writel(FEC_DEFAULT_IMASK, fep->hwp + FEC_IMASK); +@@ -1224,11 +1239,16 @@ fec_stop(struct net_device *ndev) + /* We have to keep ENET enabled to have MII interrupt stay working */ + if (fep->quirks & FEC_QUIRK_ENET_MAC && + !(fep->wol_flag & FEC_WOL_FLAG_SLEEP_ON)) { +- writel(2, fep->hwp + FEC_ECNTRL); ++ writel(FEC_ECR_ETHEREN, fep->hwp + FEC_ECNTRL); + writel(rmii_mode, fep->hwp + FEC_R_CNTRL); + } +-} + ++ if (fep->bufdesc_ex) { ++ val = readl(fep->hwp + FEC_ECNTRL); ++ val |= FEC_ECR_EN1588; ++ writel(val, fep->hwp + FEC_ECNTRL); ++ } ++} + + static void + fec_timeout(struct net_device *ndev, unsigned int txqueue) +diff --git a/drivers/net/ethernet/freescale/fec_ptp.c b/drivers/net/ethernet/freescale/fec_ptp.c +index 780fbb3e1ed062..84e0855069a848 100644 +--- a/drivers/net/ethernet/freescale/fec_ptp.c ++++ b/drivers/net/ethernet/freescale/fec_ptp.c +@@ -640,6 +640,9 @@ void fec_ptp_stop(struct platform_device *pdev) + struct net_device *ndev = platform_get_drvdata(pdev); + struct fec_enet_private *fep = netdev_priv(ndev); + ++ if (fep->pps_enable) ++ fec_ptp_enable_pps(fep, 0); ++ + cancel_delayed_work_sync(&fep->time_keep); + if (fep->ptp_clock) + ptp_clock_unregister(fep->ptp_clock); +diff --git a/drivers/net/ethernet/google/gve/gve_tx_dqo.c b/drivers/net/ethernet/google/gve/gve_tx_dqo.c +index 94e3b74a10f22f..dfbb524bf7392b 100644 +--- a/drivers/net/ethernet/google/gve/gve_tx_dqo.c ++++ b/drivers/net/ethernet/google/gve/gve_tx_dqo.c +@@ -606,22 +606,42 @@ static bool gve_can_send_tso(const struct sk_buff *skb) + const struct skb_shared_info *shinfo = skb_shinfo(skb); + const int gso_size = shinfo->gso_size; + int cur_seg_num_bufs; ++ int prev_frag_size; + int cur_seg_size; + int i; + + cur_seg_size = skb_headlen(skb) - header_len; ++ prev_frag_size = skb_headlen(skb); + cur_seg_num_bufs = cur_seg_size > 0; + + for (i = 0; i < shinfo->nr_frags; i++) { + if (cur_seg_size >= gso_size) { + cur_seg_size %= gso_size; + cur_seg_num_bufs = cur_seg_size > 0; ++ ++ if (prev_frag_size > GVE_TX_MAX_BUF_SIZE_DQO) { ++ int prev_frag_remain = prev_frag_size % ++ GVE_TX_MAX_BUF_SIZE_DQO; ++ ++ /* If the last descriptor of the previous frag ++ * is less than cur_seg_size, the segment will ++ * span two descriptors in the previous frag. ++ * Since max gso size (9728) is less than ++ * GVE_TX_MAX_BUF_SIZE_DQO, it is impossible ++ * for the segment to span more than two ++ * descriptors. ++ */ ++ if (prev_frag_remain && ++ cur_seg_size > prev_frag_remain) ++ cur_seg_num_bufs++; ++ } + } + + if (unlikely(++cur_seg_num_bufs > max_bufs_per_seg)) + return false; + +- cur_seg_size += skb_frag_size(&shinfo->frags[i]); ++ prev_frag_size = skb_frag_size(&shinfo->frags[i]); ++ cur_seg_size += prev_frag_size; + } + + return true; +diff --git a/drivers/net/ethernet/marvell/mvpp2/mvpp2_main.c b/drivers/net/ethernet/marvell/mvpp2/mvpp2_main.c +index ba44d1d9cfcd42..2a60f949d95323 100644 +--- a/drivers/net/ethernet/marvell/mvpp2/mvpp2_main.c ++++ b/drivers/net/ethernet/marvell/mvpp2/mvpp2_main.c +@@ -953,13 +953,13 @@ static void mvpp2_bm_pool_update_fc(struct mvpp2_port *port, + static void mvpp2_bm_pool_update_priv_fc(struct mvpp2 *priv, bool en) + { + struct mvpp2_port *port; +- int i; ++ int i, j; + + for (i = 0; i < priv->port_count; i++) { + port = priv->port_list[i]; + if (port->priv->percpu_pools) { +- for (i = 0; i < port->nrxqs; i++) +- mvpp2_bm_pool_update_fc(port, &port->priv->bm_pools[i], ++ for (j = 0; j < port->nrxqs; j++) ++ mvpp2_bm_pool_update_fc(port, &port->priv->bm_pools[j], + port->tx_fc & en); + } else { + mvpp2_bm_pool_update_fc(port, port->pool_long, port->tx_fc & en); +diff --git a/drivers/net/ethernet/mellanox/mlx5/core/en_ethtool.c b/drivers/net/ethernet/mellanox/mlx5/core/en_ethtool.c +index 2d3cd237355a63..06f6809b1c2b70 100644 +--- a/drivers/net/ethernet/mellanox/mlx5/core/en_ethtool.c ++++ b/drivers/net/ethernet/mellanox/mlx5/core/en_ethtool.c +@@ -1181,7 +1181,12 @@ int mlx5e_ethtool_set_link_ksettings(struct mlx5e_priv *priv, + if (!an_changes && link_modes == eproto.admin) + goto out; + +- mlx5_port_set_eth_ptys(mdev, an_disable, link_modes, ext); ++ err = mlx5_port_set_eth_ptys(mdev, an_disable, link_modes, ext); ++ if (err) { ++ netdev_err(priv->netdev, "%s: failed to set ptys reg: %d\n", __func__, err); ++ goto out; ++ } ++ + mlx5_toggle_port_link(mdev); + + out: +diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c +index 4b713832fdd559..f5c0a4214c4e56 100644 +--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c ++++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c +@@ -391,7 +391,8 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp, + if (err) + return err; + +- lkey_id = aregion->ops->lkey_id_get(aregion, aentry->enc_key, erp_id); ++ lkey_id = aregion->ops->lkey_id_get(aregion, aentry->ht_key.enc_key, ++ erp_id); + if (IS_ERR(lkey_id)) + return PTR_ERR(lkey_id); + aentry->lkey_id = lkey_id; +@@ -399,7 +400,7 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp, + kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block); + mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_WRITE, + priority, region->tcam_region_info, +- aentry->enc_key, erp_id, ++ aentry->ht_key.enc_key, erp_id, + aentry->delta_info.start, + aentry->delta_info.mask, + aentry->delta_info.value, +@@ -428,7 +429,7 @@ mlxsw_sp_acl_atcam_region_entry_remove(struct mlxsw_sp *mlxsw_sp, + + mlxsw_reg_ptce3_pack(ptce3_pl, false, MLXSW_REG_PTCE3_OP_WRITE_WRITE, 0, + region->tcam_region_info, +- aentry->enc_key, erp_id, ++ aentry->ht_key.enc_key, erp_id, + aentry->delta_info.start, + aentry->delta_info.mask, + aentry->delta_info.value, +@@ -457,7 +458,7 @@ mlxsw_sp_acl_atcam_region_entry_action_replace(struct mlxsw_sp *mlxsw_sp, + kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block); + mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_UPDATE, + priority, region->tcam_region_info, +- aentry->enc_key, erp_id, ++ aentry->ht_key.enc_key, erp_id, + aentry->delta_info.start, + aentry->delta_info.mask, + aentry->delta_info.value, +@@ -480,15 +481,13 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp, + int err; + + mlxsw_afk_encode(afk, region->key_info, &rulei->values, +- aentry->ht_key.full_enc_key, mask); ++ aentry->ht_key.enc_key, mask); + + erp_mask = mlxsw_sp_acl_erp_mask_get(aregion, mask, false); + if (IS_ERR(erp_mask)) + return PTR_ERR(erp_mask); + aentry->erp_mask = erp_mask; + aentry->ht_key.erp_id = mlxsw_sp_acl_erp_mask_erp_id(erp_mask); +- memcpy(aentry->enc_key, aentry->ht_key.full_enc_key, +- sizeof(aentry->enc_key)); + + /* Compute all needed delta information and clear the delta bits + * from the encrypted key. +@@ -497,9 +496,8 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp, + aentry->delta_info.start = mlxsw_sp_acl_erp_delta_start(delta); + aentry->delta_info.mask = mlxsw_sp_acl_erp_delta_mask(delta); + aentry->delta_info.value = +- mlxsw_sp_acl_erp_delta_value(delta, +- aentry->ht_key.full_enc_key); +- mlxsw_sp_acl_erp_delta_clear(delta, aentry->enc_key); ++ mlxsw_sp_acl_erp_delta_value(delta, aentry->ht_key.enc_key); ++ mlxsw_sp_acl_erp_delta_clear(delta, aentry->ht_key.enc_key); + + /* Add rule to the list of A-TCAM rules, assuming this + * rule is intended to A-TCAM. In case this rule does +diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c +index 2e8b17e3b93583..3ab87db83b7fc1 100644 +--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c ++++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c +@@ -116,9 +116,10 @@ static u16 mlxsw_sp_acl_bf_crc(const u8 *buffer, size_t len) + } + + static void +-mlxsw_sp_acl_bf_key_encode(struct mlxsw_sp_acl_atcam_region *aregion, +- struct mlxsw_sp_acl_atcam_entry *aentry, +- char *output, u8 *len) ++__mlxsw_sp_acl_bf_key_encode(struct mlxsw_sp_acl_atcam_region *aregion, ++ struct mlxsw_sp_acl_atcam_entry *aentry, ++ char *output, u8 *len, u8 max_chunks, u8 pad_bytes, ++ u8 key_offset, u8 chunk_key_len, u8 chunk_len) + { + struct mlxsw_afk_key_info *key_info = aregion->region->key_info; + u8 chunk_index, chunk_count, block_count; +@@ -129,17 +130,30 @@ mlxsw_sp_acl_bf_key_encode(struct mlxsw_sp_acl_atcam_region *aregion, + chunk_count = 1 + ((block_count - 1) >> 2); + erp_region_id = cpu_to_be16(aentry->ht_key.erp_id | + (aregion->region->id << 4)); +- for (chunk_index = MLXSW_BLOOM_KEY_CHUNKS - chunk_count; +- chunk_index < MLXSW_BLOOM_KEY_CHUNKS; chunk_index++) { +- memset(chunk, 0, MLXSW_BLOOM_CHUNK_PAD_BYTES); +- memcpy(chunk + MLXSW_BLOOM_CHUNK_PAD_BYTES, &erp_region_id, ++ for (chunk_index = max_chunks - chunk_count; chunk_index < max_chunks; ++ chunk_index++) { ++ memset(chunk, 0, pad_bytes); ++ memcpy(chunk + pad_bytes, &erp_region_id, + sizeof(erp_region_id)); +- memcpy(chunk + MLXSW_BLOOM_CHUNK_KEY_OFFSET, +- &aentry->enc_key[chunk_key_offsets[chunk_index]], +- MLXSW_BLOOM_CHUNK_KEY_BYTES); +- chunk += MLXSW_BLOOM_KEY_CHUNK_BYTES; ++ memcpy(chunk + key_offset, ++ &aentry->ht_key.enc_key[chunk_key_offsets[chunk_index]], ++ chunk_key_len); ++ chunk += chunk_len; + } +- *len = chunk_count * MLXSW_BLOOM_KEY_CHUNK_BYTES; ++ *len = chunk_count * chunk_len; ++} ++ ++static void ++mlxsw_sp_acl_bf_key_encode(struct mlxsw_sp_acl_atcam_region *aregion, ++ struct mlxsw_sp_acl_atcam_entry *aentry, ++ char *output, u8 *len) ++{ ++ __mlxsw_sp_acl_bf_key_encode(aregion, aentry, output, len, ++ MLXSW_BLOOM_KEY_CHUNKS, ++ MLXSW_BLOOM_CHUNK_PAD_BYTES, ++ MLXSW_BLOOM_CHUNK_KEY_OFFSET, ++ MLXSW_BLOOM_CHUNK_KEY_BYTES, ++ MLXSW_BLOOM_KEY_CHUNK_BYTES); + } + + static unsigned int +diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c +index d231f4d2888bee..9eee229303cced 100644 +--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c ++++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c +@@ -1217,18 +1217,6 @@ static bool mlxsw_sp_acl_erp_delta_check(void *priv, const void *parent_obj, + return err ? false : true; + } + +-static int mlxsw_sp_acl_erp_hints_obj_cmp(const void *obj1, const void *obj2) +-{ +- const struct mlxsw_sp_acl_erp_key *key1 = obj1; +- const struct mlxsw_sp_acl_erp_key *key2 = obj2; +- +- /* For hints purposes, two objects are considered equal +- * in case the masks are the same. Does not matter what +- * the "ctcam" value is. +- */ +- return memcmp(key1->mask, key2->mask, sizeof(key1->mask)); +-} +- + static void *mlxsw_sp_acl_erp_delta_create(void *priv, void *parent_obj, + void *obj) + { +@@ -1308,7 +1296,6 @@ static void mlxsw_sp_acl_erp_root_destroy(void *priv, void *root_priv) + static const struct objagg_ops mlxsw_sp_acl_erp_objagg_ops = { + .obj_size = sizeof(struct mlxsw_sp_acl_erp_key), + .delta_check = mlxsw_sp_acl_erp_delta_check, +- .hints_obj_cmp = mlxsw_sp_acl_erp_hints_obj_cmp, + .delta_create = mlxsw_sp_acl_erp_delta_create, + .delta_destroy = mlxsw_sp_acl_erp_delta_destroy, + .root_create = mlxsw_sp_acl_erp_root_create, +diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h +index a41df10ade9bf4..f28c47ae548807 100644 +--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h ++++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h +@@ -171,9 +171,9 @@ struct mlxsw_sp_acl_atcam_region { + }; + + struct mlxsw_sp_acl_atcam_entry_ht_key { +- char full_enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded +- * key. +- */ ++ char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key, minus ++ * delta bits. ++ */ + u8 erp_id; + }; + +@@ -185,9 +185,6 @@ struct mlxsw_sp_acl_atcam_entry { + struct rhash_head ht_node; + struct list_head list; /* Member in entries_list */ + struct mlxsw_sp_acl_atcam_entry_ht_key ht_key; +- char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key, +- * minus delta bits. +- */ + struct { + u16 start; + u8 mask; +diff --git a/drivers/net/ethernet/realtek/r8169_main.c b/drivers/net/ethernet/realtek/r8169_main.c +index 76d820c4e6eef4..49a3cd4ce89c28 100644 +--- a/drivers/net/ethernet/realtek/r8169_main.c ++++ b/drivers/net/ethernet/realtek/r8169_main.c +@@ -4283,7 +4283,8 @@ static netdev_tx_t rtl8169_start_xmit(struct sk_buff *skb, + if (unlikely(!rtl_tx_slots_avail(tp))) { + if (net_ratelimit()) + netdev_err(dev, "BUG! Tx Ring full when queue awake!\n"); +- goto err_stop_0; ++ netif_stop_queue(dev); ++ return NETDEV_TX_BUSY; + } + + opts[1] = rtl8169_tx_vlan_tag(skb); +@@ -4356,11 +4357,6 @@ static netdev_tx_t rtl8169_start_xmit(struct sk_buff *skb, + dev_kfree_skb_any(skb); + dev->stats.tx_dropped++; + return NETDEV_TX_OK; +- +-err_stop_0: +- netif_stop_queue(dev); +- dev->stats.tx_dropped++; +- return NETDEV_TX_BUSY; + } + + static unsigned int rtl_last_frag_len(struct sk_buff *skb) +diff --git a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c +index 026e3645e566ae..e5c5a9c5389c35 100644 +--- a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c ++++ b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c +@@ -972,7 +972,7 @@ static void dwmac4_set_mac_loopback(void __iomem *ioaddr, bool enable) + } + + static void dwmac4_update_vlan_hash(struct mac_device_info *hw, u32 hash, +- __le16 perfect_match, bool is_double) ++ u16 perfect_match, bool is_double) + { + void __iomem *ioaddr = hw->pcsr; + u32 value; +diff --git a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c +index dd73f38ec08d80..813327d04c56fe 100644 +--- a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c ++++ b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c +@@ -582,7 +582,7 @@ static int dwxgmac2_rss_configure(struct mac_device_info *hw, + } + + static void dwxgmac2_update_vlan_hash(struct mac_device_info *hw, u32 hash, +- __le16 perfect_match, bool is_double) ++ u16 perfect_match, bool is_double) + { + void __iomem *ioaddr = hw->pcsr; + +diff --git a/drivers/net/ethernet/stmicro/stmmac/hwif.h b/drivers/net/ethernet/stmicro/stmmac/hwif.h +index 58e5c6c428dc01..414b63d5b9ebef 100644 +--- a/drivers/net/ethernet/stmicro/stmmac/hwif.h ++++ b/drivers/net/ethernet/stmicro/stmmac/hwif.h +@@ -370,7 +370,7 @@ struct stmmac_ops { + struct stmmac_rss *cfg, u32 num_rxq); + /* VLAN */ + void (*update_vlan_hash)(struct mac_device_info *hw, u32 hash, +- __le16 perfect_match, bool is_double); ++ u16 perfect_match, bool is_double); + void (*enable_vlan)(struct mac_device_info *hw, u32 type); + int (*add_hw_vlan_rx_fltr)(struct net_device *dev, + struct mac_device_info *hw, +diff --git a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c +index b0ab8f6986f8b4..cd92b8e03a9a16 100644 +--- a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c ++++ b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c +@@ -1286,6 +1286,8 @@ static int stmmac_phy_setup(struct stmmac_priv *priv) + if (!fwnode) + fwnode = dev_fwnode(priv->device); + ++ priv->phylink_config.mac_managed_pm = true; ++ + phylink = phylink_create(&priv->phylink_config, fwnode, + mode, &stmmac_phylink_mac_ops); + if (IS_ERR(phylink)) +@@ -6237,7 +6239,7 @@ static u32 stmmac_vid_crc32_le(__le16 vid_le) + static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double) + { + u32 crc, hash = 0; +- __le16 pmatch = 0; ++ u16 pmatch = 0; + int count = 0; + u16 vid = 0; + +@@ -6252,7 +6254,7 @@ static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double) + if (count > 2) /* VID = 0 always passes filter */ + return -EOPNOTSUPP; + +- pmatch = cpu_to_le16(vid); ++ pmatch = vid; + hash = 0; + } + +diff --git a/drivers/net/netconsole.c b/drivers/net/netconsole.c +index ccecba908ded61..4292105323f4e4 100644 +--- a/drivers/net/netconsole.c ++++ b/drivers/net/netconsole.c +@@ -716,6 +716,7 @@ static int netconsole_netdev_event(struct notifier_block *this, + /* rtnl_lock already held + * we might sleep in __netpoll_cleanup() + */ ++ nt->enabled = false; + spin_unlock_irqrestore(&target_list_lock, flags); + + __netpoll_cleanup(&nt->np); +@@ -723,7 +724,6 @@ static int netconsole_netdev_event(struct notifier_block *this, + spin_lock_irqsave(&target_list_lock, flags); + dev_put(nt->np.dev); + nt->np.dev = NULL; +- nt->enabled = false; + stopped = true; + netconsole_target_put(nt); + goto restart; +diff --git a/drivers/net/usb/qmi_wwan.c b/drivers/net/usb/qmi_wwan.c +index fb09e95cbc258f..773a54c083f61a 100644 +--- a/drivers/net/usb/qmi_wwan.c ++++ b/drivers/net/usb/qmi_wwan.c +@@ -201,6 +201,7 @@ static int qmimux_rx_fixup(struct usbnet *dev, struct sk_buff *skb) + break; + default: + /* not ip - do not know what to do */ ++ kfree_skb(skbn); + goto skip; + } + +diff --git a/drivers/net/usb/sr9700.c b/drivers/net/usb/sr9700.c +index 1c4a4bd46be64c..3cff3c9d7b89a5 100644 +--- a/drivers/net/usb/sr9700.c ++++ b/drivers/net/usb/sr9700.c +@@ -179,6 +179,7 @@ static int sr_mdio_read(struct net_device *netdev, int phy_id, int loc) + struct usbnet *dev = netdev_priv(netdev); + __le16 res; + int rc = 0; ++ int err; + + if (phy_id) { + netdev_dbg(netdev, "Only internal phy supported\n"); +@@ -189,11 +190,17 @@ static int sr_mdio_read(struct net_device *netdev, int phy_id, int loc) + if (loc == MII_BMSR) { + u8 value; + +- sr_read_reg(dev, SR_NSR, &value); ++ err = sr_read_reg(dev, SR_NSR, &value); ++ if (err < 0) ++ return err; ++ + if (value & NSR_LINKST) + rc = 1; + } +- sr_share_read_word(dev, 1, loc, &res); ++ err = sr_share_read_word(dev, 1, loc, &res); ++ if (err < 0) ++ return err; ++ + if (rc == 1) + res = le16_to_cpu(res) | BMSR_LSTATUS; + else +diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.c b/drivers/net/wireless/ath/ath11k/dp_rx.c +index dfdb2eeaf040a1..6920cce493f690 100644 +--- a/drivers/net/wireless/ath/ath11k/dp_rx.c ++++ b/drivers/net/wireless/ath/ath11k/dp_rx.c +@@ -1861,8 +1861,7 @@ static void ath11k_dp_rx_h_csum_offload(struct ath11k *ar, struct sk_buff *msdu) + CHECKSUM_NONE : CHECKSUM_UNNECESSARY; + } + +-static int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, +- enum hal_encrypt_type enctype) ++int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype) + { + switch (enctype) { + case HAL_ENCRYPT_TYPE_OPEN: +diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.h b/drivers/net/wireless/ath/ath11k/dp_rx.h +index 623da3bf9dc810..c322e30caa9683 100644 +--- a/drivers/net/wireless/ath/ath11k/dp_rx.h ++++ b/drivers/net/wireless/ath/ath11k/dp_rx.h +@@ -1,6 +1,7 @@ + /* SPDX-License-Identifier: BSD-3-Clause-Clear */ + /* + * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved. ++ * Copyright (c) 2024 Qualcomm Innovation Center, Inc. All rights reserved. + */ + #ifndef ATH11K_DP_RX_H + #define ATH11K_DP_RX_H +@@ -95,4 +96,6 @@ int ath11k_peer_rx_frag_setup(struct ath11k *ar, const u8 *peer_mac, int vdev_id + int ath11k_dp_rx_pktlog_start(struct ath11k_base *ab); + int ath11k_dp_rx_pktlog_stop(struct ath11k_base *ab, bool stop_timer); + ++int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype); ++ + #endif /* ATH11K_DP_RX_H */ +diff --git a/drivers/net/wireless/ath/ath11k/mac.c b/drivers/net/wireless/ath/ath11k/mac.c +index c58fd836d4ade6..81a8e1102d72bc 100644 +--- a/drivers/net/wireless/ath/ath11k/mac.c ++++ b/drivers/net/wireless/ath/ath11k/mac.c +@@ -2675,6 +2675,7 @@ static int ath11k_install_key(struct ath11k_vif *arvif, + + switch (key->cipher) { + case WLAN_CIPHER_SUITE_CCMP: ++ case WLAN_CIPHER_SUITE_CCMP_256: + arg.key_cipher = WMI_CIPHER_AES_CCM; + /* TODO: Re-check if flag is valid */ + key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT; +@@ -2684,12 +2685,10 @@ static int ath11k_install_key(struct ath11k_vif *arvif, + arg.key_txmic_len = 8; + arg.key_rxmic_len = 8; + break; +- case WLAN_CIPHER_SUITE_CCMP_256: +- arg.key_cipher = WMI_CIPHER_AES_CCM; +- break; + case WLAN_CIPHER_SUITE_GCMP: + case WLAN_CIPHER_SUITE_GCMP_256: + arg.key_cipher = WMI_CIPHER_AES_GCM; ++ key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT; + break; + default: + ath11k_warn(ar->ab, "cipher %d is not supported\n", key->cipher); +@@ -4204,7 +4203,10 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif, + { + struct ath11k_base *ab = ar->ab; + struct ieee80211_hdr *hdr = (struct ieee80211_hdr *)skb->data; ++ struct ath11k_skb_cb *skb_cb = ATH11K_SKB_CB(skb); + struct ieee80211_tx_info *info; ++ enum hal_encrypt_type enctype; ++ unsigned int mic_len; + dma_addr_t paddr; + int buf_id; + int ret; +@@ -4224,7 +4226,12 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif, + ieee80211_is_deauth(hdr->frame_control) || + ieee80211_is_disassoc(hdr->frame_control)) && + ieee80211_has_protected(hdr->frame_control)) { +- skb_put(skb, IEEE80211_CCMP_MIC_LEN); ++ if (!(skb_cb->flags & ATH11K_SKB_CIPHER_SET)) ++ ath11k_warn(ab, "WMI management tx frame without ATH11K_SKB_CIPHER_SET"); ++ ++ enctype = ath11k_dp_tx_get_encrypt_type(skb_cb->cipher); ++ mic_len = ath11k_dp_rx_crypto_mic_len(ar, enctype); ++ skb_put(skb, mic_len); + } + } + +diff --git a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c +index 7717eb85a1db68..47c0e8e429e544 100644 +--- a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c ++++ b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c +@@ -2567,7 +2567,6 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi, + + struct lcnphy_txgains cal_gains, temp_gains; + u16 hash; +- u8 band_idx; + int j; + u16 ncorr_override[5]; + u16 syst_coeffs[] = { 0x0000, 0x0000, 0x0000, 0x0000, 0x0000, 0x0000, +@@ -2599,6 +2598,9 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi, + u16 *values_to_save; + struct brcms_phy_lcnphy *pi_lcn = pi->u.pi_lcnphy; + ++ if (WARN_ON(CHSPEC_IS5G(pi->radio_chanspec))) ++ return; ++ + values_to_save = kmalloc_array(20, sizeof(u16), GFP_ATOMIC); + if (NULL == values_to_save) + return; +@@ -2662,20 +2664,18 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi, + hash = (target_gains->gm_gain << 8) | + (target_gains->pga_gain << 4) | (target_gains->pad_gain); + +- band_idx = (CHSPEC_IS5G(pi->radio_chanspec) ? 1 : 0); +- + cal_gains = *target_gains; + memset(ncorr_override, 0, sizeof(ncorr_override)); +- for (j = 0; j < iqcal_gainparams_numgains_lcnphy[band_idx]; j++) { +- if (hash == tbl_iqcal_gainparams_lcnphy[band_idx][j][0]) { ++ for (j = 0; j < iqcal_gainparams_numgains_lcnphy[0]; j++) { ++ if (hash == tbl_iqcal_gainparams_lcnphy[0][j][0]) { + cal_gains.gm_gain = +- tbl_iqcal_gainparams_lcnphy[band_idx][j][1]; ++ tbl_iqcal_gainparams_lcnphy[0][j][1]; + cal_gains.pga_gain = +- tbl_iqcal_gainparams_lcnphy[band_idx][j][2]; ++ tbl_iqcal_gainparams_lcnphy[0][j][2]; + cal_gains.pad_gain = +- tbl_iqcal_gainparams_lcnphy[band_idx][j][3]; ++ tbl_iqcal_gainparams_lcnphy[0][j][3]; + memcpy(ncorr_override, +- &tbl_iqcal_gainparams_lcnphy[band_idx][j][3], ++ &tbl_iqcal_gainparams_lcnphy[0][j][3], + sizeof(ncorr_override)); + break; + } +diff --git a/drivers/net/wireless/marvell/mwifiex/cfg80211.c b/drivers/net/wireless/marvell/mwifiex/cfg80211.c +index 017d9e03d652da..4257b4ca7d6e99 100644 +--- a/drivers/net/wireless/marvell/mwifiex/cfg80211.c ++++ b/drivers/net/wireless/marvell/mwifiex/cfg80211.c +@@ -930,6 +930,8 @@ mwifiex_init_new_priv_params(struct mwifiex_private *priv, + return -EOPNOTSUPP; + } + ++ priv->bss_num = mwifiex_get_unused_bss_num(adapter, priv->bss_type); ++ + spin_lock_irqsave(&adapter->main_proc_lock, flags); + adapter->main_locked = false; + spin_unlock_irqrestore(&adapter->main_proc_lock, flags); +diff --git a/drivers/net/wireless/virt_wifi.c b/drivers/net/wireless/virt_wifi.c +index 514f2c1124b618..dd6675436bda6d 100644 +--- a/drivers/net/wireless/virt_wifi.c ++++ b/drivers/net/wireless/virt_wifi.c +@@ -136,6 +136,9 @@ static struct ieee80211_supported_band band_5ghz = { + /* Assigned at module init. Guaranteed locally-administered and unicast. */ + static u8 fake_router_bssid[ETH_ALEN] __ro_after_init = {}; + ++#define VIRT_WIFI_SSID "VirtWifi" ++#define VIRT_WIFI_SSID_LEN 8 ++ + static void virt_wifi_inform_bss(struct wiphy *wiphy) + { + u64 tsf = div_u64(ktime_get_boottime_ns(), 1000); +@@ -146,8 +149,8 @@ static void virt_wifi_inform_bss(struct wiphy *wiphy) + u8 ssid[8]; + } __packed ssid = { + .tag = WLAN_EID_SSID, +- .len = 8, +- .ssid = "VirtWifi", ++ .len = VIRT_WIFI_SSID_LEN, ++ .ssid = VIRT_WIFI_SSID, + }; + + informed_bss = cfg80211_inform_bss(wiphy, &channel_5ghz, +@@ -213,6 +216,8 @@ struct virt_wifi_netdev_priv { + struct net_device *upperdev; + u32 tx_packets; + u32 tx_failed; ++ u32 connect_requested_ssid_len; ++ u8 connect_requested_ssid[IEEE80211_MAX_SSID_LEN]; + u8 connect_requested_bss[ETH_ALEN]; + bool is_up; + bool is_connected; +@@ -229,6 +234,12 @@ static int virt_wifi_connect(struct wiphy *wiphy, struct net_device *netdev, + if (priv->being_deleted || !priv->is_up) + return -EBUSY; + ++ if (!sme->ssid) ++ return -EINVAL; ++ ++ priv->connect_requested_ssid_len = sme->ssid_len; ++ memcpy(priv->connect_requested_ssid, sme->ssid, sme->ssid_len); ++ + could_schedule = schedule_delayed_work(&priv->connect, HZ * 2); + if (!could_schedule) + return -EBUSY; +@@ -252,12 +263,15 @@ static void virt_wifi_connect_complete(struct work_struct *work) + container_of(work, struct virt_wifi_netdev_priv, connect.work); + u8 *requested_bss = priv->connect_requested_bss; + bool right_addr = ether_addr_equal(requested_bss, fake_router_bssid); ++ bool right_ssid = priv->connect_requested_ssid_len == VIRT_WIFI_SSID_LEN && ++ !memcmp(priv->connect_requested_ssid, VIRT_WIFI_SSID, ++ priv->connect_requested_ssid_len); + u16 status = WLAN_STATUS_SUCCESS; + + if (is_zero_ether_addr(requested_bss)) + requested_bss = NULL; + +- if (!priv->is_up || (requested_bss && !right_addr)) ++ if (!priv->is_up || (requested_bss && !right_addr) || !right_ssid) + status = WLAN_STATUS_UNSPECIFIED_FAILURE; + else + priv->is_connected = true; +diff --git a/drivers/nvme/host/pci.c b/drivers/nvme/host/pci.c +index 5a3ba7e3905463..7a363f02625d83 100644 +--- a/drivers/nvme/host/pci.c ++++ b/drivers/nvme/host/pci.c +@@ -479,22 +479,13 @@ static inline void nvme_write_sq_db(struct nvme_queue *nvmeq, bool write_sq) + nvmeq->last_sq_tail = nvmeq->sq_tail; + } + +-/** +- * nvme_submit_cmd() - Copy a command into a queue and ring the doorbell +- * @nvmeq: The queue to use +- * @cmd: The command to send +- * @write_sq: whether to write to the SQ doorbell +- */ +-static void nvme_submit_cmd(struct nvme_queue *nvmeq, struct nvme_command *cmd, +- bool write_sq) ++static inline void nvme_sq_copy_cmd(struct nvme_queue *nvmeq, ++ struct nvme_command *cmd) + { +- spin_lock(&nvmeq->sq_lock); + memcpy(nvmeq->sq_cmds + (nvmeq->sq_tail << nvmeq->sqes), +- cmd, sizeof(*cmd)); ++ absolute_pointer(cmd), sizeof(*cmd)); + if (++nvmeq->sq_tail == nvmeq->q_depth) + nvmeq->sq_tail = 0; +- nvme_write_sq_db(nvmeq, write_sq); +- spin_unlock(&nvmeq->sq_lock); + } + + static void nvme_commit_rqs(struct blk_mq_hw_ctx *hctx) +@@ -895,60 +886,73 @@ static blk_status_t nvme_map_metadata(struct nvme_dev *dev, struct request *req, + return BLK_STS_OK; + } + +-/* +- * NOTE: ns is NULL when called on the admin queue. +- */ +-static blk_status_t nvme_queue_rq(struct blk_mq_hw_ctx *hctx, +- const struct blk_mq_queue_data *bd) ++static blk_status_t nvme_prep_rq(struct nvme_dev *dev, struct request *req) + { +- struct nvme_ns *ns = hctx->queue->queuedata; +- struct nvme_queue *nvmeq = hctx->driver_data; +- struct nvme_dev *dev = nvmeq->dev; +- struct request *req = bd->rq; + struct nvme_iod *iod = blk_mq_rq_to_pdu(req); +- struct nvme_command *cmnd = &iod->cmd; + blk_status_t ret; + + iod->aborted = 0; + iod->npages = -1; + iod->nents = 0; + +- /* +- * We should not need to do this, but we're still using this to +- * ensure we can drain requests on a dying queue. +- */ +- if (unlikely(!test_bit(NVMEQ_ENABLED, &nvmeq->flags))) +- return BLK_STS_IOERR; +- +- if (!nvme_check_ready(&dev->ctrl, req, true)) +- return nvme_fail_nonready_command(&dev->ctrl, req); +- +- ret = nvme_setup_cmd(ns, req); ++ ret = nvme_setup_cmd(req->q->queuedata, req); + if (ret) + return ret; + + if (blk_rq_nr_phys_segments(req)) { +- ret = nvme_map_data(dev, req, cmnd); ++ ret = nvme_map_data(dev, req, &iod->cmd); + if (ret) + goto out_free_cmd; + } + + if (blk_integrity_rq(req)) { +- ret = nvme_map_metadata(dev, req, cmnd); ++ ret = nvme_map_metadata(dev, req, &iod->cmd); + if (ret) + goto out_unmap_data; + } + + blk_mq_start_request(req); +- nvme_submit_cmd(nvmeq, cmnd, bd->last); + return BLK_STS_OK; + out_unmap_data: +- nvme_unmap_data(dev, req); ++ if (blk_rq_nr_phys_segments(req)) ++ nvme_unmap_data(dev, req); + out_free_cmd: + nvme_cleanup_cmd(req); + return ret; + } + ++/* ++ * NOTE: ns is NULL when called on the admin queue. ++ */ ++static blk_status_t nvme_queue_rq(struct blk_mq_hw_ctx *hctx, ++ const struct blk_mq_queue_data *bd) ++{ ++ struct nvme_queue *nvmeq = hctx->driver_data; ++ struct nvme_dev *dev = nvmeq->dev; ++ struct request *req = bd->rq; ++ struct nvme_iod *iod = blk_mq_rq_to_pdu(req); ++ blk_status_t ret; ++ ++ /* ++ * We should not need to do this, but we're still using this to ++ * ensure we can drain requests on a dying queue. ++ */ ++ if (unlikely(!test_bit(NVMEQ_ENABLED, &nvmeq->flags))) ++ return BLK_STS_IOERR; ++ ++ if (unlikely(!nvme_check_ready(&dev->ctrl, req, true))) ++ return nvme_fail_nonready_command(&dev->ctrl, req); ++ ++ ret = nvme_prep_rq(dev, req); ++ if (unlikely(ret)) ++ return ret; ++ spin_lock(&nvmeq->sq_lock); ++ nvme_sq_copy_cmd(nvmeq, &iod->cmd); ++ nvme_write_sq_db(nvmeq, bd->last); ++ spin_unlock(&nvmeq->sq_lock); ++ return BLK_STS_OK; ++} ++ + static void nvme_pci_complete_rq(struct request *req) + { + struct nvme_queue *nvmeq = req->mq_hctx->driver_data; +@@ -1109,7 +1113,11 @@ static void nvme_pci_submit_async_event(struct nvme_ctrl *ctrl) + + c.common.opcode = nvme_admin_async_event; + c.common.command_id = NVME_AQ_BLK_MQ_DEPTH; +- nvme_submit_cmd(nvmeq, &c, true); ++ ++ spin_lock(&nvmeq->sq_lock); ++ nvme_sq_copy_cmd(nvmeq, &c); ++ nvme_write_sq_db(nvmeq, true); ++ spin_unlock(&nvmeq->sq_lock); + } + + static int adapter_delete_queue(struct nvme_dev *dev, u8 opcode, u16 id) +@@ -2968,6 +2976,13 @@ static unsigned long check_vendor_combination_bug(struct pci_dev *pdev) + return NVME_QUIRK_FORCE_NO_SIMPLE_SUSPEND; + } + ++ /* ++ * NVMe SSD drops off the PCIe bus after system idle ++ * for 10 hours on a Lenovo N60z board. ++ */ ++ if (dmi_match(DMI_BOARD_NAME, "LXKT-ZXEG-N6")) ++ return NVME_QUIRK_NO_APST; ++ + return 0; + } + +diff --git a/drivers/parport/procfs.c b/drivers/parport/procfs.c +index d740eba3c0999e..8400a379186ea0 100644 +--- a/drivers/parport/procfs.c ++++ b/drivers/parport/procfs.c +@@ -51,12 +51,12 @@ static int do_active_device(struct ctl_table *table, int write, + + for (dev = port->devices; dev ; dev = dev->next) { + if(dev == port->cad) { +- len += sprintf(buffer, "%s\n", dev->name); ++ len += snprintf(buffer, sizeof(buffer), "%s\n", dev->name); + } + } + + if(!len) { +- len += sprintf(buffer, "%s\n", "none"); ++ len += snprintf(buffer, sizeof(buffer), "%s\n", "none"); + } + + if (len > *lenp) +@@ -87,19 +87,19 @@ static int do_autoprobe(struct ctl_table *table, int write, + } + + if ((str = info->class_name) != NULL) +- len += sprintf (buffer + len, "CLASS:%s;\n", str); ++ len += snprintf (buffer + len, sizeof(buffer) - len, "CLASS:%s;\n", str); + + if ((str = info->model) != NULL) +- len += sprintf (buffer + len, "MODEL:%s;\n", str); ++ len += snprintf (buffer + len, sizeof(buffer) - len, "MODEL:%s;\n", str); + + if ((str = info->mfr) != NULL) +- len += sprintf (buffer + len, "MANUFACTURER:%s;\n", str); ++ len += snprintf (buffer + len, sizeof(buffer) - len, "MANUFACTURER:%s;\n", str); + + if ((str = info->description) != NULL) +- len += sprintf (buffer + len, "DESCRIPTION:%s;\n", str); ++ len += snprintf (buffer + len, sizeof(buffer) - len, "DESCRIPTION:%s;\n", str); + + if ((str = info->cmdset) != NULL) +- len += sprintf (buffer + len, "COMMAND SET:%s;\n", str); ++ len += snprintf (buffer + len, sizeof(buffer) - len, "COMMAND SET:%s;\n", str); + + if (len > *lenp) + len = *lenp; +@@ -117,7 +117,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write, + void *result, size_t *lenp, loff_t *ppos) + { + struct parport *port = (struct parport *)table->extra1; +- char buffer[20]; ++ char buffer[64]; + int len = 0; + + if (*ppos) { +@@ -128,7 +128,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write, + if (write) /* permissions prevent this anyway */ + return -EACCES; + +- len += sprintf (buffer, "%lu\t%lu\n", port->base, port->base_hi); ++ len += snprintf (buffer, sizeof(buffer), "%lu\t%lu\n", port->base, port->base_hi); + + if (len > *lenp) + len = *lenp; +@@ -155,7 +155,7 @@ static int do_hardware_irq(struct ctl_table *table, int write, + if (write) /* permissions prevent this anyway */ + return -EACCES; + +- len += sprintf (buffer, "%d\n", port->irq); ++ len += snprintf (buffer, sizeof(buffer), "%d\n", port->irq); + + if (len > *lenp) + len = *lenp; +@@ -182,7 +182,7 @@ static int do_hardware_dma(struct ctl_table *table, int write, + if (write) /* permissions prevent this anyway */ + return -EACCES; + +- len += sprintf (buffer, "%d\n", port->dma); ++ len += snprintf (buffer, sizeof(buffer), "%d\n", port->dma); + + if (len > *lenp) + len = *lenp; +@@ -213,7 +213,7 @@ static int do_hardware_modes(struct ctl_table *table, int write, + #define printmode(x) \ + do { \ + if (port->modes & PARPORT_MODE_##x) \ +- len += sprintf(buffer + len, "%s%s", f++ ? "," : "", #x); \ ++ len += snprintf(buffer + len, sizeof(buffer) - len, "%s%s", f++ ? "," : "", #x); \ + } while (0) + int f = 0; + printmode(PCSPP); +diff --git a/drivers/pci/controller/dwc/pcie-designware-host.c b/drivers/pci/controller/dwc/pcie-designware-host.c +index f561e87cd5f6e4..962e700f90f596 100644 +--- a/drivers/pci/controller/dwc/pcie-designware-host.c ++++ b/drivers/pci/controller/dwc/pcie-designware-host.c +@@ -352,6 +352,12 @@ int dw_pcie_host_init(struct pcie_port *pp) + if (ret < 0) + return ret; + } else if (pp->has_msi_ctrl) { ++ u32 ctrl, num_ctrls; ++ ++ num_ctrls = pp->num_vectors / MAX_MSI_IRQS_PER_CTRL; ++ for (ctrl = 0; ctrl < num_ctrls; ctrl++) ++ pp->irq_mask[ctrl] = ~0; ++ + if (!pp->msi_irq) { + pp->msi_irq = platform_get_irq_byname_optional(pdev, "msi"); + if (pp->msi_irq < 0) { +@@ -550,7 +556,6 @@ void dw_pcie_setup_rc(struct pcie_port *pp) + + /* Initialize IRQ Status array */ + for (ctrl = 0; ctrl < num_ctrls; ctrl++) { +- pp->irq_mask[ctrl] = ~0; + dw_pcie_writel_dbi(pci, PCIE_MSI_INTR0_MASK + + (ctrl * MSI_REG_CTRL_BLOCK_SIZE), + pp->irq_mask[ctrl]); +diff --git a/drivers/pci/controller/dwc/pcie-dw-rockchip.c b/drivers/pci/controller/dwc/pcie-dw-rockchip.c +index c9b341e55cbb7a..b7f848eb2d761d 100644 +--- a/drivers/pci/controller/dwc/pcie-dw-rockchip.c ++++ b/drivers/pci/controller/dwc/pcie-dw-rockchip.c +@@ -148,7 +148,7 @@ static int rockchip_pcie_resource_get(struct platform_device *pdev, + return PTR_ERR(rockchip->apb_base); + + rockchip->rst_gpio = devm_gpiod_get_optional(&pdev->dev, "reset", +- GPIOD_OUT_HIGH); ++ GPIOD_OUT_LOW); + if (IS_ERR(rockchip->rst_gpio)) + return PTR_ERR(rockchip->rst_gpio); + +diff --git a/drivers/pci/controller/pci-hyperv.c b/drivers/pci/controller/pci-hyperv.c +index 9b15c0130bbbd8..4325b98993a4b6 100644 +--- a/drivers/pci/controller/pci-hyperv.c ++++ b/drivers/pci/controller/pci-hyperv.c +@@ -707,8 +707,8 @@ static void _hv_pcifront_read_config(struct hv_pci_dev *hpdev, int where, + PCI_CAPABILITY_LIST) { + /* ROM BARs are unimplemented */ + *val = 0; +- } else if (where >= PCI_INTERRUPT_LINE && where + size <= +- PCI_INTERRUPT_PIN) { ++ } else if ((where >= PCI_INTERRUPT_LINE && where + size <= PCI_INTERRUPT_PIN) || ++ (where >= PCI_INTERRUPT_PIN && where + size <= PCI_MIN_GNT)) { + /* + * Interrupt Line and Interrupt PIN are hard-wired to zero + * because this front-end only supports message-signaled +diff --git a/drivers/pci/controller/pcie-rockchip.c b/drivers/pci/controller/pcie-rockchip.c +index 1aa84035a8bc77..bdce1ba7c1bc08 100644 +--- a/drivers/pci/controller/pcie-rockchip.c ++++ b/drivers/pci/controller/pcie-rockchip.c +@@ -120,7 +120,7 @@ int rockchip_pcie_parse_dt(struct rockchip_pcie *rockchip) + + if (rockchip->is_rc) { + rockchip->ep_gpio = devm_gpiod_get_optional(dev, "ep", +- GPIOD_OUT_HIGH); ++ GPIOD_OUT_LOW); + if (IS_ERR(rockchip->ep_gpio)) + return dev_err_probe(dev, PTR_ERR(rockchip->ep_gpio), + "failed to get ep GPIO\n"); +diff --git a/drivers/pci/endpoint/functions/pci-epf-vntb.c b/drivers/pci/endpoint/functions/pci-epf-vntb.c +index d4cd4bd4a08811..fb926b300c9511 100644 +--- a/drivers/pci/endpoint/functions/pci-epf-vntb.c ++++ b/drivers/pci/endpoint/functions/pci-epf-vntb.c +@@ -993,8 +993,10 @@ static int vpci_scan_bus(void *sysdata) + struct epf_ntb *ndev = sysdata; + + vpci_bus = pci_scan_bus(ndev->vbus_number, &vpci_ops, sysdata); +- if (vpci_bus) +- pr_err("create pci bus\n"); ++ if (!vpci_bus) { ++ pr_err("create pci bus failed\n"); ++ return -EINVAL; ++ } + + pci_bus_add_devices(vpci_bus); + +@@ -1313,10 +1315,14 @@ static int epf_ntb_bind(struct pci_epf *epf) + goto err_bar_alloc; + } + +- vpci_scan_bus(ntb); ++ ret = vpci_scan_bus(ntb); ++ if (ret) ++ goto err_unregister; + + return 0; + ++err_unregister: ++ pci_unregister_driver(&vntb_pci_driver); + err_bar_alloc: + epf_ntb_config_spad_bar_free(ntb); + +diff --git a/drivers/pci/pci.c b/drivers/pci/pci.c +index 67216f4ea2151a..a88909f2ae6533 100644 +--- a/drivers/pci/pci.c ++++ b/drivers/pci/pci.c +@@ -4916,7 +4916,7 @@ int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type, + int timeout) + { + struct pci_dev *child; +- int delay; ++ int delay, ret = 0; + + if (pci_dev_is_disconnected(dev)) + return 0; +@@ -4944,8 +4944,8 @@ int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type, + return 0; + } + +- child = list_first_entry(&dev->subordinate->devices, struct pci_dev, +- bus_list); ++ child = pci_dev_get(list_first_entry(&dev->subordinate->devices, ++ struct pci_dev, bus_list)); + up_read(&pci_bus_sem); + + /* +@@ -4955,7 +4955,7 @@ int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type, + if (!pci_is_pcie(dev)) { + pci_dbg(dev, "waiting %d ms for secondary bus\n", 1000 + delay); + msleep(1000 + delay); +- return 0; ++ goto put_child; + } + + /* +@@ -4976,7 +4976,7 @@ int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type, + * until the timeout expires. + */ + if (!pcie_downstream_port(dev)) +- return 0; ++ goto put_child; + + if (pcie_get_speed_cap(dev) <= PCIE_SPEED_5_0GT) { + pci_dbg(dev, "waiting %d ms for downstream link\n", delay); +@@ -4987,11 +4987,16 @@ int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type, + if (!pcie_wait_for_link_delay(dev, true, delay)) { + /* Did not train, no need to wait any further */ + pci_info(dev, "Data Link Layer Link Active not set in 1000 msec\n"); +- return -ENOTTY; ++ ret = -ENOTTY; ++ goto put_child; + } + } + +- return pci_dev_wait(child, reset_type, timeout - delay); ++ ret = pci_dev_wait(child, reset_type, timeout - delay); ++ ++put_child: ++ pci_dev_put(child); ++ return ret; + } + + void pci_reset_secondary_bus(struct pci_dev *dev) +diff --git a/drivers/pci/setup-bus.c b/drivers/pci/setup-bus.c +index 16d291e10627b0..a159bfdfa2512e 100644 +--- a/drivers/pci/setup-bus.c ++++ b/drivers/pci/setup-bus.c +@@ -824,11 +824,9 @@ static resource_size_t calculate_memsize(resource_size_t size, + size = min_size; + if (old_size == 1) + old_size = 0; +- if (size < old_size) +- size = old_size; + +- size = ALIGN(max(size, add_size) + children_add_size, align); +- return size; ++ size = max(size, add_size) + children_add_size; ++ return ALIGN(max(size, old_size), align); + } + + resource_size_t __weak pcibios_window_alignment(struct pci_bus *bus, +diff --git a/drivers/phy/cadence/phy-cadence-torrent.c b/drivers/phy/cadence/phy-cadence-torrent.c +index 415ace64adc5c2..8f23146d62bf0e 100644 +--- a/drivers/phy/cadence/phy-cadence-torrent.c ++++ b/drivers/phy/cadence/phy-cadence-torrent.c +@@ -1056,6 +1056,9 @@ static int cdns_torrent_dp_set_power_state(struct cdns_torrent_phy *cdns_phy, + ret = regmap_read_poll_timeout(regmap, PHY_PMA_XCVR_POWER_STATE_ACK, + read_val, (read_val & mask) == value, 0, + POLL_TIMEOUT_US); ++ if (ret) ++ return ret; ++ + cdns_torrent_dp_write(regmap, PHY_PMA_XCVR_POWER_STATE_REQ, 0x00000000); + ndelay(100); + +diff --git a/drivers/pinctrl/core.c b/drivers/pinctrl/core.c +index f567805cbde8e4..8f4cc52b2a066f 100644 +--- a/drivers/pinctrl/core.c ++++ b/drivers/pinctrl/core.c +@@ -2062,6 +2062,14 @@ pinctrl_init_controller(struct pinctrl_desc *pctldesc, struct device *dev, + return ERR_PTR(ret); + } + ++static void pinctrl_uninit_controller(struct pinctrl_dev *pctldev, struct pinctrl_desc *pctldesc) ++{ ++ pinctrl_free_pindescs(pctldev, pctldesc->pins, ++ pctldesc->npins); ++ mutex_destroy(&pctldev->mutex); ++ kfree(pctldev); ++} ++ + static int pinctrl_claim_hogs(struct pinctrl_dev *pctldev) + { + pctldev->p = create_pinctrl(pctldev->dev, pctldev); +@@ -2142,8 +2150,10 @@ struct pinctrl_dev *pinctrl_register(struct pinctrl_desc *pctldesc, + return pctldev; + + error = pinctrl_enable(pctldev); +- if (error) ++ if (error) { ++ pinctrl_uninit_controller(pctldev, pctldesc); + return ERR_PTR(error); ++ } + + return pctldev; + } +diff --git a/drivers/pinctrl/freescale/pinctrl-mxs.c b/drivers/pinctrl/freescale/pinctrl-mxs.c +index 735cedd0958a2b..5b0fcf15f28049 100644 +--- a/drivers/pinctrl/freescale/pinctrl-mxs.c ++++ b/drivers/pinctrl/freescale/pinctrl-mxs.c +@@ -405,8 +405,8 @@ static int mxs_pinctrl_probe_dt(struct platform_device *pdev, + int ret; + u32 val; + +- child = of_get_next_child(np, NULL); +- if (!child) { ++ val = of_get_child_count(np); ++ if (val == 0) { + dev_err(&pdev->dev, "no group is defined\n"); + return -ENOENT; + } +diff --git a/drivers/pinctrl/pinctrl-rockchip.c b/drivers/pinctrl/pinctrl-rockchip.c +index 4ff70527755a38..790467dcde4f59 100644 +--- a/drivers/pinctrl/pinctrl-rockchip.c ++++ b/drivers/pinctrl/pinctrl-rockchip.c +@@ -748,9 +748,8 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = { + RK_MUXROUTE_SAME(0, RK_PC3, 1, 0x314, BIT(16 + 0) | BIT(0)), /* rtc_clk */ + RK_MUXROUTE_SAME(1, RK_PC6, 2, 0x314, BIT(16 + 2) | BIT(16 + 3)), /* uart2_rxm0 */ + RK_MUXROUTE_SAME(4, RK_PD2, 2, 0x314, BIT(16 + 2) | BIT(16 + 3) | BIT(2)), /* uart2_rxm1 */ +- RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x608, BIT(16 + 8) | BIT(16 + 9)), /* i2c3_sdam0 */ +- RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(8)), /* i2c3_sdam1 */ +- RK_MUXROUTE_SAME(2, RK_PA0, 3, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(9)), /* i2c3_sdam2 */ ++ RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x314, BIT(16 + 4)), /* i2c3_sdam0 */ ++ RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x314, BIT(16 + 4) | BIT(4)), /* i2c3_sdam1 */ + RK_MUXROUTE_SAME(1, RK_PA3, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclktxm0 */ + RK_MUXROUTE_SAME(1, RK_PA4, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclkrxm0 */ + RK_MUXROUTE_SAME(1, RK_PB5, 2, 0x308, BIT(16 + 3) | BIT(3)), /* i2s-8ch-1-sclktxm1 */ +@@ -759,18 +758,6 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = { + RK_MUXROUTE_SAME(1, RK_PB6, 4, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* pdm-clkm1 */ + RK_MUXROUTE_SAME(2, RK_PA6, 2, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* pdm-clkm2 */ + RK_MUXROUTE_SAME(2, RK_PA4, 3, 0x600, BIT(16 + 2) | BIT(2)), /* pdm-clkm-m2 */ +- RK_MUXROUTE_SAME(3, RK_PB2, 3, 0x314, BIT(16 + 9)), /* spi1_miso */ +- RK_MUXROUTE_SAME(2, RK_PA4, 2, 0x314, BIT(16 + 9) | BIT(9)), /* spi1_miso_m1 */ +- RK_MUXROUTE_SAME(0, RK_PB3, 3, 0x314, BIT(16 + 10) | BIT(16 + 11)), /* owire_m0 */ +- RK_MUXROUTE_SAME(1, RK_PC6, 7, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(10)), /* owire_m1 */ +- RK_MUXROUTE_SAME(2, RK_PA2, 5, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(11)), /* owire_m2 */ +- RK_MUXROUTE_SAME(0, RK_PB3, 2, 0x314, BIT(16 + 12) | BIT(16 + 13)), /* can_rxd_m0 */ +- RK_MUXROUTE_SAME(1, RK_PC6, 5, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* can_rxd_m1 */ +- RK_MUXROUTE_SAME(2, RK_PA2, 4, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* can_rxd_m2 */ +- RK_MUXROUTE_SAME(1, RK_PC4, 3, 0x314, BIT(16 + 14)), /* mac_rxd0_m0 */ +- RK_MUXROUTE_SAME(4, RK_PA2, 2, 0x314, BIT(16 + 14) | BIT(14)), /* mac_rxd0_m1 */ +- RK_MUXROUTE_SAME(3, RK_PB4, 4, 0x314, BIT(16 + 15)), /* uart3_rx */ +- RK_MUXROUTE_SAME(0, RK_PC1, 3, 0x314, BIT(16 + 15) | BIT(15)), /* uart3_rx_m1 */ + }; + + static struct rockchip_mux_route_data rk3328_mux_route_data[] = { +diff --git a/drivers/pinctrl/pinctrl-single.c b/drivers/pinctrl/pinctrl-single.c +index 9ad8f702061421..cd23479f352a2b 100644 +--- a/drivers/pinctrl/pinctrl-single.c ++++ b/drivers/pinctrl/pinctrl-single.c +@@ -1328,7 +1328,6 @@ static void pcs_irq_free(struct pcs_device *pcs) + static void pcs_free_resources(struct pcs_device *pcs) + { + pcs_irq_free(pcs); +- pinctrl_unregister(pcs->pctl); + + #if IS_BUILTIN(CONFIG_PINCTRL_SINGLE) + if (pcs->missing_nr_pinctrl_cells) +@@ -1885,7 +1884,7 @@ static int pcs_probe(struct platform_device *pdev) + if (ret < 0) + goto free; + +- ret = pinctrl_register_and_init(&pcs->desc, pcs->dev, pcs, &pcs->pctl); ++ ret = devm_pinctrl_register_and_init(pcs->dev, &pcs->desc, pcs, &pcs->pctl); + if (ret) { + dev_err(pcs->dev, "could not register single pinctrl driver\n"); + goto free; +@@ -1918,8 +1917,10 @@ static int pcs_probe(struct platform_device *pdev) + + dev_info(pcs->dev, "%i pins, size %u\n", pcs->desc.npins, pcs->size); + +- return pinctrl_enable(pcs->pctl); ++ if (pinctrl_enable(pcs->pctl)) ++ goto free; + ++ return 0; + free: + pcs_free_resources(pcs); + +diff --git a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c +index 4e2382778d38f5..f3411e3eaf2ea1 100644 +--- a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c ++++ b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c +@@ -883,7 +883,7 @@ static int ti_iodelay_probe(struct platform_device *pdev) + iod->desc.name = dev_name(dev); + iod->desc.owner = THIS_MODULE; + +- ret = pinctrl_register_and_init(&iod->desc, dev, iod, &iod->pctl); ++ ret = devm_pinctrl_register_and_init(dev, &iod->desc, iod, &iod->pctl); + if (ret) { + dev_err(dev, "Failed to register pinctrl\n"); + goto exit_out; +@@ -891,7 +891,11 @@ static int ti_iodelay_probe(struct platform_device *pdev) + + platform_set_drvdata(pdev, iod); + +- return pinctrl_enable(iod->pctl); ++ ret = pinctrl_enable(iod->pctl); ++ if (ret) ++ goto exit_out; ++ ++ return 0; + + exit_out: + of_node_put(np); +@@ -908,12 +912,6 @@ static int ti_iodelay_remove(struct platform_device *pdev) + { + struct ti_iodelay_device *iod = platform_get_drvdata(pdev); + +- if (!iod) +- return 0; +- +- if (iod->pctl) +- pinctrl_unregister(iod->pctl); +- + ti_iodelay_pinconf_deinit_dev(iod); + + /* Expect other allocations to be freed by devm */ +diff --git a/drivers/platform/chrome/cros_ec_debugfs.c b/drivers/platform/chrome/cros_ec_debugfs.c +index 0dbceee87a4b1a..2928c3cb378545 100644 +--- a/drivers/platform/chrome/cros_ec_debugfs.c ++++ b/drivers/platform/chrome/cros_ec_debugfs.c +@@ -326,6 +326,7 @@ static int ec_read_version_supported(struct cros_ec_dev *ec) + if (!msg) + return 0; + ++ msg->version = 1; + msg->command = EC_CMD_GET_CMD_VERSIONS + ec->cmd_offset; + msg->outsize = sizeof(*params); + msg->insize = sizeof(*response); +diff --git a/drivers/platform/chrome/cros_ec_proto.c b/drivers/platform/chrome/cros_ec_proto.c +index 9d1f431bdc2443..818a02c84f76d5 100644 +--- a/drivers/platform/chrome/cros_ec_proto.c ++++ b/drivers/platform/chrome/cros_ec_proto.c +@@ -780,9 +780,11 @@ int cros_ec_get_next_event(struct cros_ec_device *ec_dev, + if (ret == -ENOPROTOOPT) { + dev_dbg(ec_dev->dev, + "GET_NEXT_EVENT returned invalid version error.\n"); ++ mutex_lock(&ec_dev->lock); + ret = cros_ec_get_host_command_version_mask(ec_dev, + EC_CMD_GET_NEXT_EVENT, + &ver_mask); ++ mutex_unlock(&ec_dev->lock); + if (ret < 0 || ver_mask == 0) + /* + * Do not change the MKBP supported version if we can't +diff --git a/drivers/platform/mips/cpu_hwmon.c b/drivers/platform/mips/cpu_hwmon.c +index d8c5f9195f85f5..2ac2f31090f96f 100644 +--- a/drivers/platform/mips/cpu_hwmon.c ++++ b/drivers/platform/mips/cpu_hwmon.c +@@ -139,6 +139,9 @@ static int __init loongson_hwmon_init(void) + csr_temp_enable = csr_readl(LOONGSON_CSR_FEATURES) & + LOONGSON_CSRF_TEMP; + ++ if (!csr_temp_enable && !loongson_chiptemp[0]) ++ return -ENODEV; ++ + nr_packages = loongson_sysconf.nr_cpus / + loongson_sysconf.cores_per_package; + +diff --git a/drivers/power/supply/axp288_charger.c b/drivers/power/supply/axp288_charger.c +index 22378dad4d9fc5..012c8574ece21c 100644 +--- a/drivers/power/supply/axp288_charger.c ++++ b/drivers/power/supply/axp288_charger.c +@@ -168,18 +168,18 @@ static inline int axp288_charger_set_cv(struct axp288_chrg_info *info, int cv) + u8 reg_val; + int ret; + +- if (cv <= CV_4100MV) { +- reg_val = CHRG_CCCV_CV_4100MV; +- cv = CV_4100MV; +- } else if (cv <= CV_4150MV) { +- reg_val = CHRG_CCCV_CV_4150MV; +- cv = CV_4150MV; +- } else if (cv <= CV_4200MV) { ++ if (cv >= CV_4350MV) { ++ reg_val = CHRG_CCCV_CV_4350MV; ++ cv = CV_4350MV; ++ } else if (cv >= CV_4200MV) { + reg_val = CHRG_CCCV_CV_4200MV; + cv = CV_4200MV; ++ } else if (cv >= CV_4150MV) { ++ reg_val = CHRG_CCCV_CV_4150MV; ++ cv = CV_4150MV; + } else { +- reg_val = CHRG_CCCV_CV_4350MV; +- cv = CV_4350MV; ++ reg_val = CHRG_CCCV_CV_4100MV; ++ cv = CV_4100MV; + } + + reg_val = reg_val << CHRG_CCCV_CV_BIT_POS; +@@ -371,8 +371,8 @@ static int axp288_charger_usb_set_property(struct power_supply *psy, + dev_warn(&info->pdev->dev, "set charge current failed\n"); + break; + case POWER_SUPPLY_PROP_CONSTANT_CHARGE_VOLTAGE: +- scaled_val = min(val->intval, info->max_cv); +- scaled_val = DIV_ROUND_CLOSEST(scaled_val, 1000); ++ scaled_val = DIV_ROUND_CLOSEST(val->intval, 1000); ++ scaled_val = min(scaled_val, info->max_cv); + ret = axp288_charger_set_cv(info, scaled_val); + if (ret < 0) + dev_warn(&info->pdev->dev, "set charge voltage failed\n"); +diff --git a/drivers/power/supply/bq24190_charger.c b/drivers/power/supply/bq24190_charger.c +index 90ac5e59a5d6f3..8a4729ee1ab194 100644 +--- a/drivers/power/supply/bq24190_charger.c ++++ b/drivers/power/supply/bq24190_charger.c +@@ -1727,7 +1727,7 @@ static int bq24190_probe(struct i2c_client *client, + + bdi->client = client; + bdi->dev = dev; +- strncpy(bdi->model_name, id->name, I2C_NAME_SIZE); ++ strscpy(bdi->model_name, id->name, sizeof(bdi->model_name)); + mutex_init(&bdi->f_reg_lock); + bdi->f_reg = 0; + bdi->ss_reg = BQ24190_REG_SS_VBUS_STAT_MASK; /* impossible state */ +diff --git a/drivers/pwm/pwm-stm32.c b/drivers/pwm/pwm-stm32.c +index c40a6548ce7d4d..2070d107c63287 100644 +--- a/drivers/pwm/pwm-stm32.c ++++ b/drivers/pwm/pwm-stm32.c +@@ -452,8 +452,9 @@ static int stm32_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm, + + enabled = pwm->state.enabled; + +- if (enabled && !state->enabled) { +- stm32_pwm_disable(priv, pwm->hwpwm); ++ if (!state->enabled) { ++ if (enabled) ++ stm32_pwm_disable(priv, pwm->hwpwm); + return 0; + } + +diff --git a/drivers/remoteproc/imx_rproc.c b/drivers/remoteproc/imx_rproc.c +index c4e1ad813e0970..d5ce97e75f0272 100644 +--- a/drivers/remoteproc/imx_rproc.c ++++ b/drivers/remoteproc/imx_rproc.c +@@ -588,31 +588,37 @@ static int imx_rproc_addr_init(struct imx_rproc *priv, + struct resource res; + + node = of_parse_phandle(np, "memory-region", a); ++ if (!node) ++ continue; + /* Not map vdevbuffer, vdevring region */ + if (!strncmp(node->name, "vdev", strlen("vdev"))) { + of_node_put(node); + continue; + } + err = of_address_to_resource(node, 0, &res); +- of_node_put(node); + if (err) { + dev_err(dev, "unable to resolve memory region\n"); ++ of_node_put(node); + return err; + } + +- if (b >= IMX_RPROC_MEM_MAX) ++ if (b >= IMX_RPROC_MEM_MAX) { ++ of_node_put(node); + break; ++ } + + /* Not use resource version, because we might share region */ + priv->mem[b].cpu_addr = devm_ioremap(&pdev->dev, res.start, resource_size(&res)); + if (!priv->mem[b].cpu_addr) { + dev_err(dev, "failed to remap %pr\n", &res); ++ of_node_put(node); + return -ENOMEM; + } + priv->mem[b].sys_addr = res.start; + priv->mem[b].size = resource_size(&res); + if (!strcmp(node->name, "rsc-table")) + priv->rsc_table = priv->mem[b].cpu_addr; ++ of_node_put(node); + b++; + } + +diff --git a/drivers/remoteproc/stm32_rproc.c b/drivers/remoteproc/stm32_rproc.c +index 9a29285246f4bf..5f26d4728438ce 100644 +--- a/drivers/remoteproc/stm32_rproc.c ++++ b/drivers/remoteproc/stm32_rproc.c +@@ -293,7 +293,7 @@ static void stm32_rproc_mb_vq_work(struct work_struct *work) + + mutex_lock(&rproc->lock); + +- if (rproc->state != RPROC_RUNNING) ++ if (rproc->state != RPROC_RUNNING && rproc->state != RPROC_ATTACHED) + goto unlock_mutex; + + if (rproc_vq_interrupt(rproc, mb->vq_id) == IRQ_NONE) +diff --git a/drivers/rtc/interface.c b/drivers/rtc/interface.c +index f49ab45455d7c9..29c12947e73fc4 100644 +--- a/drivers/rtc/interface.c ++++ b/drivers/rtc/interface.c +@@ -274,10 +274,9 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm) + return err; + + /* full-function RTCs won't have such missing fields */ +- if (rtc_valid_tm(&alarm->time) == 0) { +- rtc_add_offset(rtc, &alarm->time); +- return 0; +- } ++ err = rtc_valid_tm(&alarm->time); ++ if (!err) ++ goto done; + + /* get the "after" timestamp, to detect wrapped fields */ + err = rtc_read_time(rtc, &now); +@@ -379,6 +378,8 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm) + if (err) + dev_warn(&rtc->dev, "invalid alarm value: %ptR\n", + &alarm->time); ++ else ++ rtc_add_offset(rtc, &alarm->time); + + return err; + } +diff --git a/drivers/rtc/rtc-cmos.c b/drivers/rtc/rtc-cmos.c +index 178ee5563224e6..9f776c048a839b 100644 +--- a/drivers/rtc/rtc-cmos.c ++++ b/drivers/rtc/rtc-cmos.c +@@ -643,11 +643,10 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val, + size_t count) + { + unsigned char *buf = val; +- int retval; + + off += NVRAM_OFFSET; + spin_lock_irq(&rtc_lock); +- for (retval = 0; count; count--, off++, retval++) { ++ for (; count; count--, off++) { + if (off < 128) + *buf++ = CMOS_READ(off); + else if (can_bank2) +@@ -657,7 +656,7 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val, + } + spin_unlock_irq(&rtc_lock); + +- return retval; ++ return count ? -EIO : 0; + } + + static int cmos_nvram_write(void *priv, unsigned int off, void *val, +@@ -665,7 +664,6 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val, + { + struct cmos_rtc *cmos = priv; + unsigned char *buf = val; +- int retval; + + /* NOTE: on at least PCs and Ataris, the boot firmware uses a + * checksum on part of the NVRAM data. That's currently ignored +@@ -674,7 +672,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val, + */ + off += NVRAM_OFFSET; + spin_lock_irq(&rtc_lock); +- for (retval = 0; count; count--, off++, retval++) { ++ for (; count; count--, off++) { + /* don't trash RTC registers */ + if (off == cmos->day_alrm + || off == cmos->mon_alrm +@@ -689,7 +687,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val, + } + spin_unlock_irq(&rtc_lock); + +- return retval; ++ return count ? -EIO : 0; + } + + /*----------------------------------------------------------------*/ +diff --git a/drivers/rtc/rtc-isl1208.c b/drivers/rtc/rtc-isl1208.c +index 182dfa60551557..56043479b30bfa 100644 +--- a/drivers/rtc/rtc-isl1208.c ++++ b/drivers/rtc/rtc-isl1208.c +@@ -743,14 +743,13 @@ static int isl1208_nvmem_read(void *priv, unsigned int off, void *buf, + { + struct isl1208_state *isl1208 = priv; + struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent); +- int ret; + + /* nvmem sanitizes offset/count for us, but count==0 is possible */ + if (!count) + return count; +- ret = isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf, ++ ++ return isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf, + count); +- return ret == 0 ? count : ret; + } + + static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf, +@@ -758,15 +757,13 @@ static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf, + { + struct isl1208_state *isl1208 = priv; + struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent); +- int ret; + + /* nvmem sanitizes off/count for us, but count==0 is possible */ + if (!count) + return count; +- ret = isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf, +- count); + +- return ret == 0 ? count : ret; ++ return isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf, ++ count); + } + + static const struct nvmem_config isl1208_nvmem_config = { +diff --git a/drivers/s390/char/sclp_sd.c b/drivers/s390/char/sclp_sd.c +index 1e244f78f1929c..64581433c33491 100644 +--- a/drivers/s390/char/sclp_sd.c ++++ b/drivers/s390/char/sclp_sd.c +@@ -319,8 +319,14 @@ static int sclp_sd_store_data(struct sclp_sd_data *result, u8 di) + &esize); + if (rc) { + /* Cancel running request if interrupted */ +- if (rc == -ERESTARTSYS) +- sclp_sd_sync(page, SD_EQ_HALT, di, 0, 0, NULL, NULL); ++ if (rc == -ERESTARTSYS) { ++ if (sclp_sd_sync(page, SD_EQ_HALT, di, 0, 0, NULL, NULL)) { ++ pr_warn("Could not stop Store Data request - leaking at least %zu bytes\n", ++ (size_t)dsize * PAGE_SIZE); ++ data = NULL; ++ asce = 0; ++ } ++ } + vfree(data); + goto out; + } +diff --git a/drivers/scsi/mpi3mr/mpi3mr_os.c b/drivers/scsi/mpi3mr/mpi3mr_os.c +index 859e2c1e38e129..8f88e6e202a071 100644 +--- a/drivers/scsi/mpi3mr/mpi3mr_os.c ++++ b/drivers/scsi/mpi3mr/mpi3mr_os.c +@@ -2411,6 +2411,17 @@ static int mpi3mr_prepare_sg_scmd(struct mpi3mr_ioc *mrioc, + scmd->sc_data_direction); + priv->meta_sg_valid = 1; /* To unmap meta sg DMA */ + } else { ++ /* ++ * Some firmware versions byte-swap the REPORT ZONES command ++ * reply from ATA-ZAC devices by directly accessing in the host ++ * buffer. This does not respect the default command DMA ++ * direction and causes IOMMU page faults on some architectures ++ * with an IOMMU enforcing write mappings (e.g. AMD hosts). ++ * Avoid such issue by making the REPORT ZONES buffer mapping ++ * bi-directional. ++ */ ++ if (scmd->cmnd[0] == ZBC_IN && scmd->cmnd[1] == ZI_REPORT_ZONES) ++ scmd->sc_data_direction = DMA_BIDIRECTIONAL; + sg_scmd = scsi_sglist(scmd); + sges_left = scsi_dma_map(scmd); + } +diff --git a/drivers/scsi/mpt3sas/mpt3sas_base.c b/drivers/scsi/mpt3sas/mpt3sas_base.c +index 8428411ee95930..0fc2c355fc3790 100644 +--- a/drivers/scsi/mpt3sas/mpt3sas_base.c ++++ b/drivers/scsi/mpt3sas/mpt3sas_base.c +@@ -2672,6 +2672,22 @@ _base_build_zero_len_sge_ieee(struct MPT3SAS_ADAPTER *ioc, void *paddr) + _base_add_sg_single_ieee(paddr, sgl_flags, 0, 0, -1); + } + ++static inline int _base_scsi_dma_map(struct scsi_cmnd *cmd) ++{ ++ /* ++ * Some firmware versions byte-swap the REPORT ZONES command reply from ++ * ATA-ZAC devices by directly accessing in the host buffer. This does ++ * not respect the default command DMA direction and causes IOMMU page ++ * faults on some architectures with an IOMMU enforcing write mappings ++ * (e.g. AMD hosts). Avoid such issue by making the report zones buffer ++ * mapping bi-directional. ++ */ ++ if (cmd->cmnd[0] == ZBC_IN && cmd->cmnd[1] == ZI_REPORT_ZONES) ++ cmd->sc_data_direction = DMA_BIDIRECTIONAL; ++ ++ return scsi_dma_map(cmd); ++} ++ + /** + * _base_build_sg_scmd - main sg creation routine + * pcie_device is unused here! +@@ -2718,7 +2734,7 @@ _base_build_sg_scmd(struct MPT3SAS_ADAPTER *ioc, + sgl_flags = sgl_flags << MPI2_SGE_FLAGS_SHIFT; + + sg_scmd = scsi_sglist(scmd); +- sges_left = scsi_dma_map(scmd); ++ sges_left = _base_scsi_dma_map(scmd); + if (sges_left < 0) + return -ENOMEM; + +@@ -2862,7 +2878,7 @@ _base_build_sg_scmd_ieee(struct MPT3SAS_ADAPTER *ioc, + } + + sg_scmd = scsi_sglist(scmd); +- sges_left = scsi_dma_map(scmd); ++ sges_left = _base_scsi_dma_map(scmd); + if (sges_left < 0) + return -ENOMEM; + +diff --git a/drivers/scsi/qla2xxx/qla_bsg.c b/drivers/scsi/qla2xxx/qla_bsg.c +index 5db43b6b76c52a..0d922022a15bff 100644 +--- a/drivers/scsi/qla2xxx/qla_bsg.c ++++ b/drivers/scsi/qla2xxx/qla_bsg.c +@@ -324,7 +324,7 @@ qla2x00_process_els(struct bsg_job *bsg_job) + "request_sg_cnt=%x reply_sg_cnt=%x.\n", + bsg_job->request_payload.sg_cnt, + bsg_job->reply_payload.sg_cnt); +- rval = -EPERM; ++ rval = -ENOBUFS; + goto done; + } + +@@ -2966,17 +2966,61 @@ qla24xx_bsg_request(struct bsg_job *bsg_job) + return ret; + } + +-int +-qla24xx_bsg_timeout(struct bsg_job *bsg_job) ++static bool qla_bsg_found(struct qla_qpair *qpair, struct bsg_job *bsg_job) + { ++ bool found = false; + struct fc_bsg_reply *bsg_reply = bsg_job->reply; + scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job)); + struct qla_hw_data *ha = vha->hw; +- srb_t *sp; +- int cnt, que; ++ srb_t *sp = NULL; ++ int cnt; + unsigned long flags; + struct req_que *req; + ++ spin_lock_irqsave(qpair->qp_lock_ptr, flags); ++ req = qpair->req; ++ ++ for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) { ++ sp = req->outstanding_cmds[cnt]; ++ if (sp && ++ (sp->type == SRB_CT_CMD || ++ sp->type == SRB_ELS_CMD_HST || ++ sp->type == SRB_ELS_CMD_HST_NOLOGIN) && ++ sp->u.bsg_job == bsg_job) { ++ req->outstanding_cmds[cnt] = NULL; ++ spin_unlock_irqrestore(qpair->qp_lock_ptr, flags); ++ ++ if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) { ++ ql_log(ql_log_warn, vha, 0x7089, ++ "mbx abort_command failed.\n"); ++ bsg_reply->result = -EIO; ++ } else { ++ ql_dbg(ql_dbg_user, vha, 0x708a, ++ "mbx abort_command success.\n"); ++ bsg_reply->result = 0; ++ } ++ /* ref: INIT */ ++ kref_put(&sp->cmd_kref, qla2x00_sp_release); ++ ++ found = true; ++ goto done; ++ } ++ } ++ spin_unlock_irqrestore(qpair->qp_lock_ptr, flags); ++ ++done: ++ return found; ++} ++ ++int ++qla24xx_bsg_timeout(struct bsg_job *bsg_job) ++{ ++ struct fc_bsg_reply *bsg_reply = bsg_job->reply; ++ scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job)); ++ struct qla_hw_data *ha = vha->hw; ++ int i; ++ struct qla_qpair *qpair; ++ + ql_log(ql_log_info, vha, 0x708b, "%s CMD timeout. bsg ptr %p.\n", + __func__, bsg_job); + +@@ -2986,47 +3030,21 @@ qla24xx_bsg_timeout(struct bsg_job *bsg_job) + qla_pci_set_eeh_busy(vha); + } + ++ if (qla_bsg_found(ha->base_qpair, bsg_job)) ++ goto done; ++ + /* find the bsg job from the active list of commands */ +- spin_lock_irqsave(&ha->hardware_lock, flags); +- for (que = 0; que < ha->max_req_queues; que++) { +- req = ha->req_q_map[que]; +- if (!req) ++ for (i = 0; i < ha->max_qpairs; i++) { ++ qpair = vha->hw->queue_pair_map[i]; ++ if (!qpair) + continue; +- +- for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) { +- sp = req->outstanding_cmds[cnt]; +- if (sp && +- (sp->type == SRB_CT_CMD || +- sp->type == SRB_ELS_CMD_HST || +- sp->type == SRB_ELS_CMD_HST_NOLOGIN || +- sp->type == SRB_FXIOCB_BCMD) && +- sp->u.bsg_job == bsg_job) { +- req->outstanding_cmds[cnt] = NULL; +- spin_unlock_irqrestore(&ha->hardware_lock, flags); +- +- if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) { +- ql_log(ql_log_warn, vha, 0x7089, +- "mbx abort_command failed.\n"); +- bsg_reply->result = -EIO; +- } else { +- ql_dbg(ql_dbg_user, vha, 0x708a, +- "mbx abort_command success.\n"); +- bsg_reply->result = 0; +- } +- spin_lock_irqsave(&ha->hardware_lock, flags); +- goto done; +- +- } +- } ++ if (qla_bsg_found(qpair, bsg_job)) ++ goto done; + } +- spin_unlock_irqrestore(&ha->hardware_lock, flags); ++ + ql_log(ql_log_info, vha, 0x708b, "SRB not found to abort.\n"); + bsg_reply->result = -ENXIO; +- return 0; + + done: +- spin_unlock_irqrestore(&ha->hardware_lock, flags); +- /* ref: INIT */ +- kref_put(&sp->cmd_kref, qla2x00_sp_release); + return 0; + } +diff --git a/drivers/scsi/qla2xxx/qla_def.h b/drivers/scsi/qla2xxx/qla_def.h +index 87ada9b4471706..9cec49e6602cbb 100644 +--- a/drivers/scsi/qla2xxx/qla_def.h ++++ b/drivers/scsi/qla2xxx/qla_def.h +@@ -3264,6 +3264,8 @@ struct fab_scan_rp { + struct fab_scan { + struct fab_scan_rp *l; + u32 size; ++ u32 rscn_gen_start; ++ u32 rscn_gen_end; + u16 scan_retry; + #define MAX_SCAN_RETRIES 5 + enum scan_flags_t scan_flags; +@@ -4971,6 +4973,7 @@ typedef struct scsi_qla_host { + + /* Counter to detect races between ELS and RSCN events */ + atomic_t generation_tick; ++ atomic_t rscn_gen; + /* Time when global fcport update has been scheduled */ + int total_fcport_update_gen; + /* List of pending LOGOs, protected by tgt_mutex */ +diff --git a/drivers/scsi/qla2xxx/qla_gs.c b/drivers/scsi/qla2xxx/qla_gs.c +index b0f3bf42c34051..d0c3710b5cdf64 100644 +--- a/drivers/scsi/qla2xxx/qla_gs.c ++++ b/drivers/scsi/qla2xxx/qla_gs.c +@@ -1709,7 +1709,7 @@ qla2x00_hba_attributes(scsi_qla_host_t *vha, void *entries, + eiter->type = cpu_to_be16(FDMI_HBA_OPTION_ROM_VERSION); + alen = scnprintf( + eiter->a.orom_version, sizeof(eiter->a.orom_version), +- "%d.%02d", ha->bios_revision[1], ha->bios_revision[0]); ++ "%d.%02d", ha->efi_revision[1], ha->efi_revision[0]); + alen += FDMI_ATTR_ALIGNMENT(alen); + alen += FDMI_ATTR_TYPELEN(eiter); + eiter->len = cpu_to_be16(alen); +@@ -3464,6 +3464,29 @@ static int qla2x00_is_a_vp(scsi_qla_host_t *vha, u64 wwn) + return rc; + } + ++static bool qla_ok_to_clear_rscn(scsi_qla_host_t *vha, fc_port_t *fcport) ++{ ++ u32 rscn_gen; ++ ++ rscn_gen = atomic_read(&vha->rscn_gen); ++ ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2017, ++ "%s %d %8phC rscn_gen %x start %x end %x current %x\n", ++ __func__, __LINE__, fcport->port_name, fcport->rscn_gen, ++ vha->scan.rscn_gen_start, vha->scan.rscn_gen_end, rscn_gen); ++ ++ if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_start, ++ vha->scan.rscn_gen_end)) ++ /* rscn came in before fabric scan */ ++ return true; ++ ++ if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_end, rscn_gen)) ++ /* rscn came in after fabric scan */ ++ return false; ++ ++ /* rare: fcport's scan_needed + rscn_gen must be stale */ ++ return true; ++} ++ + void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp) + { + fc_port_t *fcport; +@@ -3577,10 +3600,10 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp) + (fcport->scan_needed && + fcport->port_type != FCT_INITIATOR && + fcport->port_type != FCT_NVME_INITIATOR)) { ++ fcport->scan_needed = 0; + qlt_schedule_sess_for_deletion(fcport); + } + fcport->d_id.b24 = rp->id.b24; +- fcport->scan_needed = 0; + break; + } + +@@ -3621,7 +3644,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp) + do_delete = true; + } + +- fcport->scan_needed = 0; ++ if (qla_ok_to_clear_rscn(vha, fcport)) ++ fcport->scan_needed = 0; ++ + if (((qla_dual_mode_enabled(vha) || + qla_ini_mode_enabled(vha)) && + atomic_read(&fcport->state) == FCS_ONLINE) || +@@ -3651,7 +3676,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp) + fcport->port_name, fcport->loop_id, + fcport->login_retry); + } +- fcport->scan_needed = 0; ++ ++ if (qla_ok_to_clear_rscn(vha, fcport)) ++ fcport->scan_needed = 0; + qla24xx_fcport_handle_login(vha, fcport); + } + } +diff --git a/drivers/scsi/qla2xxx/qla_init.c b/drivers/scsi/qla2xxx/qla_init.c +index 531e0ea87202ed..214861459b413e 100644 +--- a/drivers/scsi/qla2xxx/qla_init.c ++++ b/drivers/scsi/qla2xxx/qla_init.c +@@ -1845,10 +1845,18 @@ int qla24xx_post_newsess_work(struct scsi_qla_host *vha, port_id_t *id, + return qla2x00_post_work(vha, e); + } + ++static void qla_rscn_gen_tick(scsi_qla_host_t *vha, u32 *ret_rscn_gen) ++{ ++ *ret_rscn_gen = atomic_inc_return(&vha->rscn_gen); ++ /* memory barrier */ ++ wmb(); ++} ++ + void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea) + { + fc_port_t *fcport; + unsigned long flags; ++ u32 rscn_gen; + + switch (ea->id.b.rsvd_1) { + case RSCN_PORT_ADDR: +@@ -1877,15 +1885,16 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea) + * Otherwise we're already in the middle of a relogin + */ + fcport->scan_needed = 1; +- fcport->rscn_gen++; ++ qla_rscn_gen_tick(vha, &fcport->rscn_gen); + } + } else { + fcport->scan_needed = 1; +- fcport->rscn_gen++; ++ qla_rscn_gen_tick(vha, &fcport->rscn_gen); + } + } + break; + case RSCN_AREA_ADDR: ++ qla_rscn_gen_tick(vha, &rscn_gen); + list_for_each_entry(fcport, &vha->vp_fcports, list) { + if (fcport->flags & FCF_FCP2_DEVICE && + atomic_read(&fcport->state) == FCS_ONLINE) +@@ -1893,11 +1902,12 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea) + + if ((ea->id.b24 & 0xffff00) == (fcport->d_id.b24 & 0xffff00)) { + fcport->scan_needed = 1; +- fcport->rscn_gen++; ++ fcport->rscn_gen = rscn_gen; + } + } + break; + case RSCN_DOM_ADDR: ++ qla_rscn_gen_tick(vha, &rscn_gen); + list_for_each_entry(fcport, &vha->vp_fcports, list) { + if (fcport->flags & FCF_FCP2_DEVICE && + atomic_read(&fcport->state) == FCS_ONLINE) +@@ -1905,19 +1915,20 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea) + + if ((ea->id.b24 & 0xff0000) == (fcport->d_id.b24 & 0xff0000)) { + fcport->scan_needed = 1; +- fcport->rscn_gen++; ++ fcport->rscn_gen = rscn_gen; + } + } + break; + case RSCN_FAB_ADDR: + default: ++ qla_rscn_gen_tick(vha, &rscn_gen); + list_for_each_entry(fcport, &vha->vp_fcports, list) { + if (fcport->flags & FCF_FCP2_DEVICE && + atomic_read(&fcport->state) == FCS_ONLINE) + continue; + + fcport->scan_needed = 1; +- fcport->rscn_gen++; ++ fcport->rscn_gen = rscn_gen; + } + break; + } +@@ -1926,6 +1937,7 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea) + if (vha->scan.scan_flags == 0) { + ql_dbg(ql_dbg_disc, vha, 0xffff, "%s: schedule\n", __func__); + vha->scan.scan_flags |= SF_QUEUED; ++ vha->scan.rscn_gen_start = atomic_read(&vha->rscn_gen); + schedule_delayed_work(&vha->scan.scan_work, 5); + } + spin_unlock_irqrestore(&vha->work_lock, flags); +@@ -6423,6 +6435,8 @@ qla2x00_configure_fabric(scsi_qla_host_t *vha) + qlt_do_generation_tick(vha, &discovery_gen); + + if (USE_ASYNC_SCAN(ha)) { ++ /* start of scan begins here */ ++ vha->scan.rscn_gen_end = atomic_read(&vha->rscn_gen); + rval = qla24xx_async_gpnft(vha, FC4_TYPE_FCP_SCSI, + NULL); + if (rval) +@@ -8282,15 +8296,21 @@ qla28xx_get_aux_images( + struct qla27xx_image_status pri_aux_image_status, sec_aux_image_status; + bool valid_pri_image = false, valid_sec_image = false; + bool active_pri_image = false, active_sec_image = false; ++ int rc; + + if (!ha->flt_region_aux_img_status_pri) { + ql_dbg(ql_dbg_init, vha, 0x018a, "Primary aux image not addressed\n"); + goto check_sec_image; + } + +- qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status, ++ rc = qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status, + ha->flt_region_aux_img_status_pri, + sizeof(pri_aux_image_status) >> 2); ++ if (rc) { ++ ql_log(ql_log_info, vha, 0x01a1, ++ "Unable to read Primary aux image(%x).\n", rc); ++ goto check_sec_image; ++ } + qla27xx_print_image(vha, "Primary aux image", &pri_aux_image_status); + + if (qla28xx_check_aux_image_status_signature(&pri_aux_image_status)) { +@@ -8321,9 +8341,15 @@ qla28xx_get_aux_images( + goto check_valid_image; + } + +- qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status, ++ rc = qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status, + ha->flt_region_aux_img_status_sec, + sizeof(sec_aux_image_status) >> 2); ++ if (rc) { ++ ql_log(ql_log_info, vha, 0x01a2, ++ "Unable to read Secondary aux image(%x).\n", rc); ++ goto check_valid_image; ++ } ++ + qla27xx_print_image(vha, "Secondary aux image", &sec_aux_image_status); + + if (qla28xx_check_aux_image_status_signature(&sec_aux_image_status)) { +@@ -8380,6 +8406,7 @@ qla27xx_get_active_image(struct scsi_qla_host *vha, + struct qla27xx_image_status pri_image_status, sec_image_status; + bool valid_pri_image = false, valid_sec_image = false; + bool active_pri_image = false, active_sec_image = false; ++ int rc; + + if (!ha->flt_region_img_status_pri) { + ql_dbg(ql_dbg_init, vha, 0x018a, "Primary image not addressed\n"); +@@ -8421,8 +8448,14 @@ qla27xx_get_active_image(struct scsi_qla_host *vha, + goto check_valid_image; + } + +- qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status), ++ rc = qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status), + ha->flt_region_img_status_sec, sizeof(sec_image_status) >> 2); ++ if (rc) { ++ ql_log(ql_log_info, vha, 0x01a3, ++ "Unable to read Secondary image status(%x).\n", rc); ++ goto check_valid_image; ++ } ++ + qla27xx_print_image(vha, "Secondary image", &sec_image_status); + + if (qla27xx_check_image_status_signature(&sec_image_status)) { +@@ -8494,11 +8527,10 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr, + "FW: Loading firmware from flash (%x).\n", faddr); + + dcode = (uint32_t *)req->ring; +- qla24xx_read_flash_data(vha, dcode, faddr, 8); +- if (qla24xx_risc_firmware_invalid(dcode)) { ++ rval = qla24xx_read_flash_data(vha, dcode, faddr, 8); ++ if (rval || qla24xx_risc_firmware_invalid(dcode)) { + ql_log(ql_log_fatal, vha, 0x008c, +- "Unable to verify the integrity of flash firmware " +- "image.\n"); ++ "Unable to verify the integrity of flash firmware image (rval %x).\n", rval); + ql_log(ql_log_fatal, vha, 0x008d, + "Firmware data: %08x %08x %08x %08x.\n", + dcode[0], dcode[1], dcode[2], dcode[3]); +@@ -8512,7 +8544,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr, + for (j = 0; j < segments; j++) { + ql_dbg(ql_dbg_init, vha, 0x008d, + "-> Loading segment %u...\n", j); +- qla24xx_read_flash_data(vha, dcode, faddr, 10); ++ rval = qla24xx_read_flash_data(vha, dcode, faddr, 10); ++ if (rval) { ++ ql_log(ql_log_fatal, vha, 0x016a, ++ "-> Unable to read segment addr + size .\n"); ++ return QLA_FUNCTION_FAILED; ++ } + risc_addr = be32_to_cpu((__force __be32)dcode[2]); + risc_size = be32_to_cpu((__force __be32)dcode[3]); + if (!*srisc_addr) { +@@ -8528,7 +8565,13 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr, + ql_dbg(ql_dbg_init, vha, 0x008e, + "-> Loading fragment %u: %#x <- %#x (%#lx dwords)...\n", + fragment, risc_addr, faddr, dlen); +- qla24xx_read_flash_data(vha, dcode, faddr, dlen); ++ rval = qla24xx_read_flash_data(vha, dcode, faddr, dlen); ++ if (rval) { ++ ql_log(ql_log_fatal, vha, 0x016b, ++ "-> Unable to read fragment(faddr %#x dlen %#lx).\n", ++ faddr, dlen); ++ return QLA_FUNCTION_FAILED; ++ } + for (i = 0; i < dlen; i++) + dcode[i] = swab32(dcode[i]); + +@@ -8557,7 +8600,14 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr, + fwdt->length = 0; + + dcode = (uint32_t *)req->ring; +- qla24xx_read_flash_data(vha, dcode, faddr, 7); ++ ++ rval = qla24xx_read_flash_data(vha, dcode, faddr, 7); ++ if (rval) { ++ ql_log(ql_log_fatal, vha, 0x016c, ++ "-> Unable to read template size.\n"); ++ goto failed; ++ } ++ + risc_size = be32_to_cpu((__force __be32)dcode[2]); + ql_dbg(ql_dbg_init, vha, 0x0161, + "-> fwdt%u template array at %#x (%#x dwords)\n", +@@ -8583,11 +8633,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr, + } + + dcode = fwdt->template; +- qla24xx_read_flash_data(vha, dcode, faddr, risc_size); ++ rval = qla24xx_read_flash_data(vha, dcode, faddr, risc_size); + +- if (!qla27xx_fwdt_template_valid(dcode)) { ++ if (rval || !qla27xx_fwdt_template_valid(dcode)) { + ql_log(ql_log_warn, vha, 0x0165, +- "-> fwdt%u failed template validate\n", j); ++ "-> fwdt%u failed template validate (rval %x)\n", ++ j, rval); + goto failed; + } + +diff --git a/drivers/scsi/qla2xxx/qla_inline.h b/drivers/scsi/qla2xxx/qla_inline.h +index a4a56ab0ba7473..ef4b3cc1cd77e1 100644 +--- a/drivers/scsi/qla2xxx/qla_inline.h ++++ b/drivers/scsi/qla2xxx/qla_inline.h +@@ -631,3 +631,11 @@ static inline int qla_mapq_alloc_qp_cpu_map(struct qla_hw_data *ha) + } + return 0; + } ++ ++static inline bool val_is_in_range(u32 val, u32 start, u32 end) ++{ ++ if (val >= start && val <= end) ++ return true; ++ else ++ return false; ++} +diff --git a/drivers/scsi/qla2xxx/qla_mid.c b/drivers/scsi/qla2xxx/qla_mid.c +index eb43a5f1b3992a..aa6aaf7f6b6ace 100644 +--- a/drivers/scsi/qla2xxx/qla_mid.c ++++ b/drivers/scsi/qla2xxx/qla_mid.c +@@ -180,7 +180,7 @@ qla24xx_disable_vp(scsi_qla_host_t *vha) + atomic_set(&vha->loop_state, LOOP_DOWN); + atomic_set(&vha->loop_down_timer, LOOP_DOWN_TIME); + list_for_each_entry(fcport, &vha->vp_fcports, list) +- fcport->logout_on_delete = 0; ++ fcport->logout_on_delete = 1; + + if (!vha->hw->flags.edif_enabled) + qla2x00_wait_for_sess_deletion(vha); +diff --git a/drivers/scsi/qla2xxx/qla_nvme.c b/drivers/scsi/qla2xxx/qla_nvme.c +index 088e84042efc72..9746f6debdcb4f 100644 +--- a/drivers/scsi/qla2xxx/qla_nvme.c ++++ b/drivers/scsi/qla2xxx/qla_nvme.c +@@ -27,7 +27,10 @@ int qla_nvme_register_remote(struct scsi_qla_host *vha, struct fc_port *fcport) + return 0; + } + +- if (!vha->nvme_local_port && qla_nvme_register_hba(vha)) ++ if (qla_nvme_register_hba(vha)) ++ return 0; ++ ++ if (!vha->nvme_local_port) + return 0; + + if (!(fcport->nvme_prli_service_param & +diff --git a/drivers/scsi/qla2xxx/qla_os.c b/drivers/scsi/qla2xxx/qla_os.c +index f418d43ee84119..24714acfc28479 100644 +--- a/drivers/scsi/qla2xxx/qla_os.c ++++ b/drivers/scsi/qla2xxx/qla_os.c +@@ -1861,14 +1861,9 @@ __qla2x00_abort_all_cmds(struct qla_qpair *qp, int res) + for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) { + sp = req->outstanding_cmds[cnt]; + if (sp) { +- /* +- * perform lockless completion during driver unload +- */ + if (qla2x00_chip_is_down(vha)) { + req->outstanding_cmds[cnt] = NULL; +- spin_unlock_irqrestore(qp->qp_lock_ptr, flags); + sp->done(sp, res); +- spin_lock_irqsave(qp->qp_lock_ptr, flags); + continue; + } + +@@ -4634,7 +4629,7 @@ static void + qla2x00_number_of_exch(scsi_qla_host_t *vha, u32 *ret_cnt, u16 max_cnt) + { + u32 temp; +- struct init_cb_81xx *icb = (struct init_cb_81xx *)&vha->hw->init_cb; ++ struct init_cb_81xx *icb = (struct init_cb_81xx *)vha->hw->init_cb; + *ret_cnt = FW_DEF_EXCHANGES_CNT; + + if (max_cnt > vha->hw->max_exchg) +diff --git a/drivers/scsi/qla2xxx/qla_sup.c b/drivers/scsi/qla2xxx/qla_sup.c +index c092a6b1ced4fe..6d16546e172926 100644 +--- a/drivers/scsi/qla2xxx/qla_sup.c ++++ b/drivers/scsi/qla2xxx/qla_sup.c +@@ -555,6 +555,7 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start) + struct qla_flt_location *fltl = (void *)req->ring; + uint32_t *dcode = (uint32_t *)req->ring; + uint8_t *buf = (void *)req->ring, *bcode, last_image; ++ int rc; + + /* + * FLT-location structure resides after the last PCI region. +@@ -584,14 +585,24 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start) + pcihdr = 0; + do { + /* Verify PCI expansion ROM header. */ +- qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20); ++ rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20); ++ if (rc) { ++ ql_log(ql_log_info, vha, 0x016d, ++ "Unable to read PCI Expansion Rom Header (%x).\n", rc); ++ return QLA_FUNCTION_FAILED; ++ } + bcode = buf + (pcihdr % 4); + if (bcode[0x0] != 0x55 || bcode[0x1] != 0xaa) + goto end; + + /* Locate PCI data structure. */ + pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]); +- qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20); ++ rc = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20); ++ if (rc) { ++ ql_log(ql_log_info, vha, 0x0179, ++ "Unable to read PCI Data Structure (%x).\n", rc); ++ return QLA_FUNCTION_FAILED; ++ } + bcode = buf + (pcihdr % 4); + + /* Validate signature of PCI data structure. */ +@@ -606,7 +617,12 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start) + } while (!last_image); + + /* Now verify FLT-location structure. */ +- qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2); ++ rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2); ++ if (rc) { ++ ql_log(ql_log_info, vha, 0x017a, ++ "Unable to read FLT (%x).\n", rc); ++ return QLA_FUNCTION_FAILED; ++ } + if (memcmp(fltl->sig, "QFLT", 4)) + goto end; + +@@ -2605,13 +2621,18 @@ qla24xx_read_optrom_data(struct scsi_qla_host *vha, void *buf, + uint32_t offset, uint32_t length) + { + struct qla_hw_data *ha = vha->hw; ++ int rc; + + /* Suspend HBA. */ + scsi_block_requests(vha->host); + set_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags); + + /* Go with read. */ +- qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2); ++ rc = qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2); ++ if (rc) { ++ ql_log(ql_log_info, vha, 0x01a0, ++ "Unable to perform optrom read(%x).\n", rc); ++ } + + /* Resume HBA. */ + clear_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags); +@@ -3412,7 +3433,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf) + struct active_regions active_regions = { }; + + if (IS_P3P_TYPE(ha)) +- return ret; ++ return QLA_SUCCESS; + + if (!mbuf) + return QLA_FUNCTION_FAILED; +@@ -3432,20 +3453,31 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf) + + do { + /* Verify PCI expansion ROM header. */ +- qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20); ++ ret = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20); ++ if (ret) { ++ ql_log(ql_log_info, vha, 0x017d, ++ "Unable to read PCI EXP Rom Header(%x).\n", ret); ++ return QLA_FUNCTION_FAILED; ++ } ++ + bcode = mbuf + (pcihdr % 4); + if (memcmp(bcode, "\x55\xaa", 2)) { + /* No signature */ + ql_log(ql_log_fatal, vha, 0x0059, + "No matching ROM signature.\n"); +- ret = QLA_FUNCTION_FAILED; +- break; ++ return QLA_FUNCTION_FAILED; + } + + /* Locate PCI data structure. */ + pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]); + +- qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20); ++ ret = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20); ++ if (ret) { ++ ql_log(ql_log_info, vha, 0x018e, ++ "Unable to read PCI Data Structure (%x).\n", ret); ++ return QLA_FUNCTION_FAILED; ++ } ++ + bcode = mbuf + (pcihdr % 4); + + /* Validate signature of PCI data structure. */ +@@ -3454,8 +3486,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf) + ql_log(ql_log_fatal, vha, 0x005a, + "PCI data struct not found pcir_adr=%x.\n", pcids); + ql_dump_buffer(ql_dbg_init, vha, 0x0059, dcode, 32); +- ret = QLA_FUNCTION_FAILED; +- break; ++ return QLA_FUNCTION_FAILED; + } + + /* Read version */ +@@ -3507,20 +3538,26 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf) + faddr = ha->flt_region_fw_sec; + } + +- qla24xx_read_flash_data(vha, dcode, faddr, 8); +- if (qla24xx_risc_firmware_invalid(dcode)) { +- ql_log(ql_log_warn, vha, 0x005f, +- "Unrecognized fw revision at %x.\n", +- ha->flt_region_fw * 4); +- ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32); ++ ret = qla24xx_read_flash_data(vha, dcode, faddr, 8); ++ if (ret) { ++ ql_log(ql_log_info, vha, 0x019e, ++ "Unable to read FW version (%x).\n", ret); ++ return ret; + } else { +- for (i = 0; i < 4; i++) +- ha->fw_revision[i] = ++ if (qla24xx_risc_firmware_invalid(dcode)) { ++ ql_log(ql_log_warn, vha, 0x005f, ++ "Unrecognized fw revision at %x.\n", ++ ha->flt_region_fw * 4); ++ ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32); ++ } else { ++ for (i = 0; i < 4; i++) ++ ha->fw_revision[i] = + be32_to_cpu((__force __be32)dcode[4+i]); +- ql_dbg(ql_dbg_init, vha, 0x0060, +- "Firmware revision (flash) %u.%u.%u (%x).\n", +- ha->fw_revision[0], ha->fw_revision[1], +- ha->fw_revision[2], ha->fw_revision[3]); ++ ql_dbg(ql_dbg_init, vha, 0x0060, ++ "Firmware revision (flash) %u.%u.%u (%x).\n", ++ ha->fw_revision[0], ha->fw_revision[1], ++ ha->fw_revision[2], ha->fw_revision[3]); ++ } + } + + /* Check for golden firmware and get version if available */ +@@ -3531,18 +3568,23 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf) + + memset(ha->gold_fw_version, 0, sizeof(ha->gold_fw_version)); + faddr = ha->flt_region_gold_fw; +- qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8); +- if (qla24xx_risc_firmware_invalid(dcode)) { +- ql_log(ql_log_warn, vha, 0x0056, +- "Unrecognized golden fw at %#x.\n", faddr); +- ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32); ++ ret = qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8); ++ if (ret) { ++ ql_log(ql_log_info, vha, 0x019f, ++ "Unable to read Gold FW version (%x).\n", ret); + return ret; +- } +- +- for (i = 0; i < 4; i++) +- ha->gold_fw_version[i] = +- be32_to_cpu((__force __be32)dcode[4+i]); ++ } else { ++ if (qla24xx_risc_firmware_invalid(dcode)) { ++ ql_log(ql_log_warn, vha, 0x0056, ++ "Unrecognized golden fw at %#x.\n", faddr); ++ ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32); ++ return QLA_FUNCTION_FAILED; ++ } + ++ for (i = 0; i < 4; i++) ++ ha->gold_fw_version[i] = ++ be32_to_cpu((__force __be32)dcode[4+i]); ++ } + return ret; + } + +diff --git a/drivers/scsi/ufs/ufshcd.c b/drivers/scsi/ufs/ufshcd.c +index b7abf1f6410c88..e199abc4e6176b 100644 +--- a/drivers/scsi/ufs/ufshcd.c ++++ b/drivers/scsi/ufs/ufshcd.c +@@ -3795,11 +3795,16 @@ static inline void ufshcd_add_delay_before_dme_cmd(struct ufs_hba *hba) + min_sleep_time_us = + MIN_DELAY_BEFORE_DME_CMDS_US - delta; + else +- return; /* no more delay required */ ++ min_sleep_time_us = 0; /* no more delay required */ + } + +- /* allow sleep for extra 50us if needed */ +- usleep_range(min_sleep_time_us, min_sleep_time_us + 50); ++ if (min_sleep_time_us > 0) { ++ /* allow sleep for extra 50us if needed */ ++ usleep_range(min_sleep_time_us, min_sleep_time_us + 50); ++ } ++ ++ /* update the last_dme_cmd_tstamp */ ++ hba->last_dme_cmd_tstamp = ktime_get(); + } + + /** +diff --git a/drivers/soc/qcom/pdr_interface.c b/drivers/soc/qcom/pdr_interface.c +index 915d5bc3d46e67..e20d97d7fb658d 100644 +--- a/drivers/soc/qcom/pdr_interface.c ++++ b/drivers/soc/qcom/pdr_interface.c +@@ -76,12 +76,12 @@ static int pdr_locator_new_server(struct qmi_handle *qmi, + locator_hdl); + struct pdr_service *pds; + ++ mutex_lock(&pdr->lock); + /* Create a local client port for QMI communication */ + pdr->locator_addr.sq_family = AF_QIPCRTR; + pdr->locator_addr.sq_node = svc->node; + pdr->locator_addr.sq_port = svc->port; + +- mutex_lock(&pdr->lock); + pdr->locator_init_complete = true; + mutex_unlock(&pdr->lock); + +@@ -104,10 +104,10 @@ static void pdr_locator_del_server(struct qmi_handle *qmi, + + mutex_lock(&pdr->lock); + pdr->locator_init_complete = false; +- mutex_unlock(&pdr->lock); + + pdr->locator_addr.sq_node = 0; + pdr->locator_addr.sq_port = 0; ++ mutex_unlock(&pdr->lock); + } + + static const struct qmi_ops pdr_locator_ops = { +@@ -366,12 +366,14 @@ static int pdr_get_domain_list(struct servreg_get_domain_list_req *req, + if (ret < 0) + return ret; + ++ mutex_lock(&pdr->lock); + ret = qmi_send_request(&pdr->locator_hdl, + &pdr->locator_addr, + &txn, SERVREG_GET_DOMAIN_LIST_REQ, + SERVREG_GET_DOMAIN_LIST_REQ_MAX_LEN, + servreg_get_domain_list_req_ei, + req); ++ mutex_unlock(&pdr->lock); + if (ret < 0) { + qmi_txn_cancel(&txn); + return ret; +@@ -416,7 +418,7 @@ static int pdr_locate_service(struct pdr_handle *pdr, struct pdr_service *pds) + if (ret < 0) + goto out; + +- for (i = domains_read; i < resp->domain_list_len; i++) { ++ for (i = 0; i < resp->domain_list_len; i++) { + entry = &resp->domain_list[i]; + + if (strnlen(entry->name, sizeof(entry->name)) == sizeof(entry->name)) +diff --git a/drivers/soc/qcom/rpmh-rsc.c b/drivers/soc/qcom/rpmh-rsc.c +index b722e28d9ed62a..4c9400cf6686b8 100644 +--- a/drivers/soc/qcom/rpmh-rsc.c ++++ b/drivers/soc/qcom/rpmh-rsc.c +@@ -608,13 +608,14 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg) + { + struct tcs_group *tcs; + int tcs_id; +- unsigned long flags; ++ ++ might_sleep(); + + tcs = get_tcs_for_msg(drv, msg); + if (IS_ERR(tcs)) + return PTR_ERR(tcs); + +- spin_lock_irqsave(&drv->lock, flags); ++ spin_lock_irq(&drv->lock); + + /* Wait forever for a free tcs. It better be there eventually! */ + wait_event_lock_irq(drv->tcs_wait, +@@ -632,7 +633,7 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg) + write_tcs_reg_sync(drv, RSC_DRV_CMD_ENABLE, tcs_id, 0); + enable_tcs_irq(drv, tcs_id, true); + } +- spin_unlock_irqrestore(&drv->lock, flags); ++ spin_unlock_irq(&drv->lock); + + /* + * These two can be done after the lock is released because: +diff --git a/drivers/soc/qcom/rpmh.c b/drivers/soc/qcom/rpmh.c +index 01765ee9cdfb8d..c6df7ac0afebc9 100644 +--- a/drivers/soc/qcom/rpmh.c ++++ b/drivers/soc/qcom/rpmh.c +@@ -189,7 +189,6 @@ static int __rpmh_write(const struct device *dev, enum rpmh_state state, + } + + if (state == RPMH_ACTIVE_ONLY_STATE) { +- WARN_ON(irqs_disabled()); + ret = rpmh_rsc_send_data(ctrlr_to_drv(ctrlr), &rpm_msg->msg); + } else { + /* Clean up our call by spoofing tx_done */ +diff --git a/drivers/soc/xilinx/zynqmp_pm_domains.c b/drivers/soc/xilinx/zynqmp_pm_domains.c +index 226d343f0a6a5b..81e8e10f10929b 100644 +--- a/drivers/soc/xilinx/zynqmp_pm_domains.c ++++ b/drivers/soc/xilinx/zynqmp_pm_domains.c +@@ -152,11 +152,17 @@ static int zynqmp_gpd_power_off(struct generic_pm_domain *domain) + static int zynqmp_gpd_attach_dev(struct generic_pm_domain *domain, + struct device *dev) + { ++ struct device_link *link; + int ret; + struct zynqmp_pm_domain *pd; + + pd = container_of(domain, struct zynqmp_pm_domain, gpd); + ++ link = device_link_add(dev, &domain->dev, DL_FLAG_SYNC_STATE_ONLY); ++ if (!link) ++ dev_dbg(&domain->dev, "failed to create device link for %s\n", ++ dev_name(dev)); ++ + /* If this is not the first device to attach there is nothing to do */ + if (domain->device_count) + return 0; +@@ -299,9 +305,19 @@ static int zynqmp_gpd_remove(struct platform_device *pdev) + return 0; + } + ++static void zynqmp_gpd_sync_state(struct device *dev) ++{ ++ int ret; ++ ++ ret = zynqmp_pm_init_finalize(); ++ if (ret) ++ dev_warn(dev, "failed to release power management to firmware\n"); ++} ++ + static struct platform_driver zynqmp_power_domain_driver = { + .driver = { + .name = "zynqmp_power_controller", ++ .sync_state = zynqmp_gpd_sync_state, + }, + .probe = zynqmp_gpd_probe, + .remove = zynqmp_gpd_remove, +diff --git a/drivers/soc/xilinx/zynqmp_power.c b/drivers/soc/xilinx/zynqmp_power.c +index c556623dae0248..2653d29ba829b0 100644 +--- a/drivers/soc/xilinx/zynqmp_power.c ++++ b/drivers/soc/xilinx/zynqmp_power.c +@@ -178,8 +178,9 @@ static int zynqmp_pm_probe(struct platform_device *pdev) + u32 pm_api_version; + struct mbox_client *client; + +- zynqmp_pm_init_finalize(); +- zynqmp_pm_get_api_version(&pm_api_version); ++ ret = zynqmp_pm_get_api_version(&pm_api_version); ++ if (ret) ++ return ret; + + /* Check PM API version number */ + if (pm_api_version < ZYNQMP_PM_VERSION) +diff --git a/drivers/spi/spi-fsl-lpspi.c b/drivers/spi/spi-fsl-lpspi.c +index c5ff6e8c45be0d..c21d7959dcd237 100644 +--- a/drivers/spi/spi-fsl-lpspi.c ++++ b/drivers/spi/spi-fsl-lpspi.c +@@ -297,7 +297,7 @@ static void fsl_lpspi_set_watermark(struct fsl_lpspi_data *fsl_lpspi) + static int fsl_lpspi_set_bitrate(struct fsl_lpspi_data *fsl_lpspi) + { + struct lpspi_config config = fsl_lpspi->config; +- unsigned int perclk_rate, scldiv; ++ unsigned int perclk_rate, scldiv, div; + u8 prescale; + + perclk_rate = clk_get_rate(fsl_lpspi->clk_per); +@@ -308,8 +308,10 @@ static int fsl_lpspi_set_bitrate(struct fsl_lpspi_data *fsl_lpspi) + return -EINVAL; + } + ++ div = DIV_ROUND_UP(perclk_rate, config.speed_hz); ++ + for (prescale = 0; prescale < 8; prescale++) { +- scldiv = perclk_rate / config.speed_hz / (1 << prescale) - 2; ++ scldiv = div / (1 << prescale) - 2; + if (scldiv < 256) { + fsl_lpspi->config.prescale = prescale; + break; +diff --git a/drivers/spi/spidev.c b/drivers/spi/spidev.c +index 922d778df06414..0b97e5b97a0186 100644 +--- a/drivers/spi/spidev.c ++++ b/drivers/spi/spidev.c +@@ -8,19 +8,18 @@ + */ + + #include <linux/init.h> +-#include <linux/module.h> + #include <linux/ioctl.h> + #include <linux/fs.h> + #include <linux/device.h> + #include <linux/err.h> + #include <linux/list.h> + #include <linux/errno.h> ++#include <linux/mod_devicetable.h> ++#include <linux/module.h> + #include <linux/mutex.h> ++#include <linux/property.h> + #include <linux/slab.h> + #include <linux/compat.h> +-#include <linux/of.h> +-#include <linux/of_device.h> +-#include <linux/acpi.h> + + #include <linux/spi/spi.h> + #include <linux/spi/spidev.h> +@@ -683,6 +682,7 @@ static const struct file_operations spidev_fops = { + static struct class *spidev_class; + + static const struct spi_device_id spidev_spi_ids[] = { ++ { .name = "bh2228fv" }, + { .name = "dh2228fv" }, + { .name = "ltc2488" }, + { .name = "sx1301" }, +@@ -691,29 +691,45 @@ static const struct spi_device_id spidev_spi_ids[] = { + { .name = "m53cpld" }, + { .name = "spi-petra" }, + { .name = "spi-authenta" }, ++ { .name = "em3581" }, + {}, + }; + MODULE_DEVICE_TABLE(spi, spidev_spi_ids); + +-#ifdef CONFIG_OF ++/* ++ * spidev should never be referenced in DT without a specific compatible string, ++ * it is a Linux implementation thing rather than a description of the hardware. ++ */ ++static int spidev_of_check(struct device *dev) ++{ ++ if (device_property_match_string(dev, "compatible", "spidev") < 0) ++ return 0; ++ ++ dev_err(dev, "spidev listed directly in DT is not supported\n"); ++ return -EINVAL; ++} ++ + static const struct of_device_id spidev_dt_ids[] = { +- { .compatible = "rohm,dh2228fv" }, +- { .compatible = "lineartechnology,ltc2488" }, +- { .compatible = "semtech,sx1301" }, +- { .compatible = "lwn,bk4" }, +- { .compatible = "dh,dhcom-board" }, +- { .compatible = "menlo,m53cpld" }, +- { .compatible = "cisco,spi-petra" }, +- { .compatible = "micron,spi-authenta" }, ++ { .compatible = "cisco,spi-petra", .data = &spidev_of_check }, ++ { .compatible = "dh,dhcom-board", .data = &spidev_of_check }, ++ { .compatible = "lineartechnology,ltc2488", .data = &spidev_of_check }, ++ { .compatible = "lwn,bk4", .data = &spidev_of_check }, ++ { .compatible = "menlo,m53cpld", .data = &spidev_of_check }, ++ { .compatible = "micron,spi-authenta", .data = &spidev_of_check }, ++ { .compatible = "rohm,bh2228fv", .data = &spidev_of_check }, ++ { .compatible = "rohm,dh2228fv", .data = &spidev_of_check }, ++ { .compatible = "semtech,sx1301", .data = &spidev_of_check }, ++ { .compatible = "silabs,em3581", .data = &spidev_of_check }, + {}, + }; + MODULE_DEVICE_TABLE(of, spidev_dt_ids); +-#endif +- +-#ifdef CONFIG_ACPI + + /* Dummy SPI devices not to be used in production systems */ +-#define SPIDEV_ACPI_DUMMY 1 ++static int spidev_acpi_check(struct device *dev) ++{ ++ dev_warn(dev, "do not use this driver in production systems!\n"); ++ return 0; ++} + + static const struct acpi_device_id spidev_acpi_ids[] = { + /* +@@ -722,49 +738,28 @@ static const struct acpi_device_id spidev_acpi_ids[] = { + * description of the connected peripheral and they should also use + * a proper driver instead of poking directly to the SPI bus. + */ +- { "SPT0001", SPIDEV_ACPI_DUMMY }, +- { "SPT0002", SPIDEV_ACPI_DUMMY }, +- { "SPT0003", SPIDEV_ACPI_DUMMY }, ++ { "SPT0001", (kernel_ulong_t)&spidev_acpi_check }, ++ { "SPT0002", (kernel_ulong_t)&spidev_acpi_check }, ++ { "SPT0003", (kernel_ulong_t)&spidev_acpi_check }, + {}, + }; + MODULE_DEVICE_TABLE(acpi, spidev_acpi_ids); + +-static void spidev_probe_acpi(struct spi_device *spi) +-{ +- const struct acpi_device_id *id; +- +- if (!has_acpi_companion(&spi->dev)) +- return; +- +- id = acpi_match_device(spidev_acpi_ids, &spi->dev); +- if (WARN_ON(!id)) +- return; +- +- if (id->driver_data == SPIDEV_ACPI_DUMMY) +- dev_warn(&spi->dev, "do not use this driver in production systems!\n"); +-} +-#else +-static inline void spidev_probe_acpi(struct spi_device *spi) {} +-#endif +- + /*-------------------------------------------------------------------------*/ + + static int spidev_probe(struct spi_device *spi) + { ++ int (*match)(struct device *dev); + struct spidev_data *spidev; + int status; + unsigned long minor; + +- /* +- * spidev should never be referenced in DT without a specific +- * compatible string, it is a Linux implementation thing +- * rather than a description of the hardware. +- */ +- WARN(spi->dev.of_node && +- of_device_is_compatible(spi->dev.of_node, "spidev"), +- "%pOF: buggy DT: spidev listed directly in DT\n", spi->dev.of_node); +- +- spidev_probe_acpi(spi); ++ match = device_get_match_data(&spi->dev); ++ if (match) { ++ status = match(&spi->dev); ++ if (status) ++ return status; ++ } + + /* Allocate driver data */ + spidev = kzalloc(sizeof(*spidev), GFP_KERNEL); +@@ -835,8 +830,8 @@ static int spidev_remove(struct spi_device *spi) + static struct spi_driver spidev_spi_driver = { + .driver = { + .name = "spidev", +- .of_match_table = of_match_ptr(spidev_dt_ids), +- .acpi_match_table = ACPI_PTR(spidev_acpi_ids), ++ .of_match_table = spidev_dt_ids, ++ .acpi_match_table = spidev_acpi_ids, + }, + .probe = spidev_probe, + .remove = spidev_remove, +diff --git a/drivers/tty/serial/serial_core.c b/drivers/tty/serial/serial_core.c +index b638b2fd2d3d24..7cd12ea88c0b00 100644 +--- a/drivers/tty/serial/serial_core.c ++++ b/drivers/tty/serial/serial_core.c +@@ -836,6 +836,14 @@ static int uart_set_info(struct tty_struct *tty, struct tty_port *port, + new_flags = (__force upf_t)new_info->flags; + old_custom_divisor = uport->custom_divisor; + ++ if (!(uport->flags & UPF_FIXED_PORT)) { ++ unsigned int uartclk = new_info->baud_base * 16; ++ /* check needs to be done here before other settings made */ ++ if (uartclk == 0) { ++ retval = -EINVAL; ++ goto exit; ++ } ++ } + if (!capable(CAP_SYS_ADMIN)) { + retval = -EPERM; + if (change_irq || change_port || +diff --git a/drivers/usb/gadget/function/u_audio.c b/drivers/usb/gadget/function/u_audio.c +index 5e34a7ff1b63dc..6bd908c7bfe637 100644 +--- a/drivers/usb/gadget/function/u_audio.c ++++ b/drivers/usb/gadget/function/u_audio.c +@@ -474,15 +474,24 @@ int u_audio_start_capture(struct g_audio *audio_dev) + struct usb_ep *ep, *ep_fback; + struct uac_rtd_params *prm; + struct uac_params *params = &audio_dev->params; +- int req_len, i; ++ int req_len, i, ret; + + ep = audio_dev->out_ep; + prm = &uac->c_prm; +- config_ep_by_speed(gadget, &audio_dev->func, ep); ++ ret = config_ep_by_speed(gadget, &audio_dev->func, ep); ++ if (ret < 0) { ++ dev_err(dev, "config_ep_by_speed for out_ep failed (%d)\n", ret); ++ return ret; ++ } ++ + req_len = ep->maxpacket; + + prm->ep_enabled = true; +- usb_ep_enable(ep); ++ ret = usb_ep_enable(ep); ++ if (ret < 0) { ++ dev_err(dev, "usb_ep_enable failed for out_ep (%d)\n", ret); ++ return ret; ++ } + + for (i = 0; i < params->req_number; i++) { + if (!prm->reqs[i]) { +@@ -508,9 +517,18 @@ int u_audio_start_capture(struct g_audio *audio_dev) + return 0; + + /* Setup feedback endpoint */ +- config_ep_by_speed(gadget, &audio_dev->func, ep_fback); ++ ret = config_ep_by_speed(gadget, &audio_dev->func, ep_fback); ++ if (ret < 0) { ++ dev_err(dev, "config_ep_by_speed in_ep_fback failed (%d)\n", ret); ++ return ret; // TODO: Clean up out_ep ++ } ++ + prm->fb_ep_enabled = true; +- usb_ep_enable(ep_fback); ++ ret = usb_ep_enable(ep_fback); ++ if (ret < 0) { ++ dev_err(dev, "usb_ep_enable failed for in_ep_fback (%d)\n", ret); ++ return ret; // TODO: Clean up out_ep ++ } + req_len = ep_fback->maxpacket; + + req_fback = usb_ep_alloc_request(ep_fback, GFP_ATOMIC); +@@ -565,11 +583,15 @@ int u_audio_start_playback(struct g_audio *audio_dev) + struct uac_params *params = &audio_dev->params; + unsigned int factor; + const struct usb_endpoint_descriptor *ep_desc; +- int req_len, i; ++ int req_len, i, ret; + + ep = audio_dev->in_ep; + prm = &uac->p_prm; +- config_ep_by_speed(gadget, &audio_dev->func, ep); ++ ret = config_ep_by_speed(gadget, &audio_dev->func, ep); ++ if (ret < 0) { ++ dev_err(dev, "config_ep_by_speed for in_ep failed (%d)\n", ret); ++ return ret; ++ } + + ep_desc = ep->desc; + +@@ -598,7 +620,11 @@ int u_audio_start_playback(struct g_audio *audio_dev) + uac->p_residue = 0; + + prm->ep_enabled = true; +- usb_ep_enable(ep); ++ ret = usb_ep_enable(ep); ++ if (ret < 0) { ++ dev_err(dev, "usb_ep_enable failed for in_ep (%d)\n", ret); ++ return ret; ++ } + + for (i = 0; i < params->req_number; i++) { + if (!prm->reqs[i]) { +diff --git a/drivers/usb/gadget/function/u_serial.c b/drivers/usb/gadget/function/u_serial.c +index f975dc03a19049..5111fcc0cac395 100644 +--- a/drivers/usb/gadget/function/u_serial.c ++++ b/drivers/usb/gadget/function/u_serial.c +@@ -1436,6 +1436,7 @@ void gserial_suspend(struct gserial *gser) + spin_lock(&port->port_lock); + spin_unlock(&serial_port_lock); + port->suspended = true; ++ port->start_delayed = true; + spin_unlock_irqrestore(&port->port_lock, flags); + } + EXPORT_SYMBOL_GPL(gserial_suspend); +diff --git a/drivers/usb/gadget/udc/core.c b/drivers/usb/gadget/udc/core.c +index 808a8d062e6a52..d865c4677ad7c0 100644 +--- a/drivers/usb/gadget/udc/core.c ++++ b/drivers/usb/gadget/udc/core.c +@@ -101,12 +101,10 @@ int usb_ep_enable(struct usb_ep *ep) + goto out; + + /* UDC drivers can't handle endpoints with maxpacket size 0 */ +- if (usb_endpoint_maxp(ep->desc) == 0) { +- /* +- * We should log an error message here, but we can't call +- * dev_err() because there's no way to find the gadget +- * given only ep. +- */ ++ if (!ep->desc || usb_endpoint_maxp(ep->desc) == 0) { ++ WARN_ONCE(1, "%s: ep%d (%s) has %s\n", __func__, ep->address, ep->name, ++ (!ep->desc) ? "NULL descriptor" : "maxpacket 0"); ++ + ret = -EINVAL; + goto out; + } +diff --git a/drivers/usb/serial/usb_debug.c b/drivers/usb/serial/usb_debug.c +index aaf4813e4971ee..406cb326e8124a 100644 +--- a/drivers/usb/serial/usb_debug.c ++++ b/drivers/usb/serial/usb_debug.c +@@ -69,6 +69,11 @@ static void usb_debug_process_read_urb(struct urb *urb) + usb_serial_generic_process_read_urb(urb); + } + ++static void usb_debug_init_termios(struct tty_struct *tty) ++{ ++ tty->termios.c_lflag &= ~(ECHO | ECHONL); ++} ++ + static struct usb_serial_driver debug_device = { + .driver = { + .owner = THIS_MODULE, +@@ -78,6 +83,7 @@ static struct usb_serial_driver debug_device = { + .num_ports = 1, + .bulk_out_size = USB_DEBUG_MAX_PACKET_SIZE, + .break_ctl = usb_debug_break_ctl, ++ .init_termios = usb_debug_init_termios, + .process_read_urb = usb_debug_process_read_urb, + }; + +@@ -89,6 +95,7 @@ static struct usb_serial_driver dbc_device = { + .id_table = dbc_id_table, + .num_ports = 1, + .break_ctl = usb_debug_break_ctl, ++ .init_termios = usb_debug_init_termios, + .process_read_urb = usb_debug_process_read_urb, + }; + +diff --git a/drivers/usb/usbip/vhci_hcd.c b/drivers/usb/usbip/vhci_hcd.c +index 233265550fc63e..6b98f5ab6dfed5 100644 +--- a/drivers/usb/usbip/vhci_hcd.c ++++ b/drivers/usb/usbip/vhci_hcd.c +@@ -745,6 +745,7 @@ static int vhci_urb_enqueue(struct usb_hcd *hcd, struct urb *urb, gfp_t mem_flag + * + */ + if (usb_pipedevice(urb->pipe) == 0) { ++ struct usb_device *old; + __u8 type = usb_pipetype(urb->pipe); + struct usb_ctrlrequest *ctrlreq = + (struct usb_ctrlrequest *) urb->setup_packet; +@@ -755,14 +756,15 @@ static int vhci_urb_enqueue(struct usb_hcd *hcd, struct urb *urb, gfp_t mem_flag + goto no_need_xmit; + } + ++ old = vdev->udev; + switch (ctrlreq->bRequest) { + case USB_REQ_SET_ADDRESS: + /* set_address may come when a device is reset */ + dev_info(dev, "SetAddress Request (%d) to port %d\n", + ctrlreq->wValue, vdev->rhport); + +- usb_put_dev(vdev->udev); + vdev->udev = usb_get_dev(urb->dev); ++ usb_put_dev(old); + + spin_lock(&vdev->ud.lock); + vdev->ud.status = VDEV_ST_USED; +@@ -781,8 +783,8 @@ static int vhci_urb_enqueue(struct usb_hcd *hcd, struct urb *urb, gfp_t mem_flag + usbip_dbg_vhci_hc( + "Not yet?:Get_Descriptor to device 0 (get max pipe size)\n"); + +- usb_put_dev(vdev->udev); + vdev->udev = usb_get_dev(urb->dev); ++ usb_put_dev(old); + goto out; + + default: +@@ -1067,6 +1069,7 @@ static void vhci_shutdown_connection(struct usbip_device *ud) + static void vhci_device_reset(struct usbip_device *ud) + { + struct vhci_device *vdev = container_of(ud, struct vhci_device, ud); ++ struct usb_device *old = vdev->udev; + unsigned long flags; + + spin_lock_irqsave(&ud->lock, flags); +@@ -1074,8 +1077,8 @@ static void vhci_device_reset(struct usbip_device *ud) + vdev->speed = 0; + vdev->devid = 0; + +- usb_put_dev(vdev->udev); + vdev->udev = NULL; ++ usb_put_dev(old); + + if (ud->tcp_socket) { + sockfd_put(ud->tcp_socket); +diff --git a/drivers/vhost/vdpa.c b/drivers/vhost/vdpa.c +index 9ca8b92d92ae43..019e8c9bedffbf 100644 +--- a/drivers/vhost/vdpa.c ++++ b/drivers/vhost/vdpa.c +@@ -1059,13 +1059,7 @@ static vm_fault_t vhost_vdpa_fault(struct vm_fault *vmf) + + notify = ops->get_vq_notification(vdpa, index); + +- vma->vm_page_prot = pgprot_noncached(vma->vm_page_prot); +- if (remap_pfn_range(vma, vmf->address & PAGE_MASK, +- PFN_DOWN(notify.addr), PAGE_SIZE, +- vma->vm_page_prot)) +- return VM_FAULT_SIGBUS; +- +- return VM_FAULT_NOPAGE; ++ return vmf_insert_pfn(vma, vmf->address & PAGE_MASK, PFN_DOWN(notify.addr)); + } + + static const struct vm_operations_struct vhost_vdpa_vm_ops = { +diff --git a/drivers/vhost/vsock.c b/drivers/vhost/vsock.c +index 74ac0c28fe43ad..531e3e139c0d0e 100644 +--- a/drivers/vhost/vsock.c ++++ b/drivers/vhost/vsock.c +@@ -684,6 +684,7 @@ static int vhost_vsock_dev_open(struct inode *inode, struct file *file) + } + + vsock->guest_cid = 0; /* no CID assigned yet */ ++ vsock->seqpacket_allow = false; + + atomic_set(&vsock->queued_replies, 0); + +@@ -842,8 +843,7 @@ static int vhost_vsock_set_features(struct vhost_vsock *vsock, u64 features) + goto err; + } + +- if (features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET)) +- vsock->seqpacket_allow = true; ++ vsock->seqpacket_allow = features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET); + + for (i = 0; i < ARRAY_SIZE(vsock->vqs); i++) { + vq = &vsock->vqs[i]; +diff --git a/fs/binfmt_flat.c b/fs/binfmt_flat.c +index 7ca3e0db06ffa4..250651cdce0a61 100644 +--- a/fs/binfmt_flat.c ++++ b/fs/binfmt_flat.c +@@ -76,8 +76,10 @@ + + #ifdef CONFIG_BINFMT_FLAT_NO_DATA_START_OFFSET + #define DATA_START_OFFSET_WORDS (0) ++#define MAX_SHARED_LIBS_UPDATE (0) + #else + #define DATA_START_OFFSET_WORDS (MAX_SHARED_LIBS) ++#define MAX_SHARED_LIBS_UPDATE (MAX_SHARED_LIBS) + #endif + + struct lib_info { +@@ -991,7 +993,7 @@ static int load_flat_binary(struct linux_binprm *bprm) + return res; + + /* Update data segment pointers for all libraries */ +- for (i = 0; i < MAX_SHARED_LIBS; i++) { ++ for (i = 0; i < MAX_SHARED_LIBS_UPDATE; i++) { + if (!libinfo.lib_list[i].loaded) + continue; + for (j = 0; j < MAX_SHARED_LIBS; j++) { +diff --git a/fs/btrfs/ctree.h b/fs/btrfs/ctree.h +index 17ebcf19b4446c..f19c6aa3ea4b52 100644 +--- a/fs/btrfs/ctree.h ++++ b/fs/btrfs/ctree.h +@@ -1383,6 +1383,7 @@ struct btrfs_drop_extents_args { + struct btrfs_file_private { + void *filldir_buf; + u64 last_index; ++ bool fsync_skip_inode_lock; + }; + + +diff --git a/fs/btrfs/file.c b/fs/btrfs/file.c +index eae622ef4c6d55..c44dfb4370d756 100644 +--- a/fs/btrfs/file.c ++++ b/fs/btrfs/file.c +@@ -1983,22 +1983,38 @@ static ssize_t btrfs_direct_write(struct kiocb *iocb, struct iov_iter *from) + * So here we disable page faults in the iov_iter and then retry if we + * got -EFAULT, faulting in the pages before the retry. + */ ++again: + from->nofault = true; + dio = __iomap_dio_rw(iocb, from, &btrfs_dio_iomap_ops, &btrfs_dio_ops, + IOMAP_DIO_PARTIAL, written); + from->nofault = false; + +- /* +- * iomap_dio_complete() will call btrfs_sync_file() if we have a dsync +- * iocb, and that needs to lock the inode. So unlock it before calling +- * iomap_dio_complete() to avoid a deadlock. +- */ +- btrfs_inode_unlock(inode, ilock_flags); +- +- if (IS_ERR_OR_NULL(dio)) ++ if (IS_ERR_OR_NULL(dio)) { + err = PTR_ERR_OR_ZERO(dio); +- else ++ } else { ++ struct btrfs_file_private stack_private = { 0 }; ++ struct btrfs_file_private *private; ++ const bool have_private = (file->private_data != NULL); ++ ++ if (!have_private) ++ file->private_data = &stack_private; ++ ++ /* ++ * If we have a synchoronous write, we must make sure the fsync ++ * triggered by the iomap_dio_complete() call below doesn't ++ * deadlock on the inode lock - we are already holding it and we ++ * can't call it after unlocking because we may need to complete ++ * partial writes due to the input buffer (or parts of it) not ++ * being already faulted in. ++ */ ++ private = file->private_data; ++ private->fsync_skip_inode_lock = true; + err = iomap_dio_complete(dio); ++ private->fsync_skip_inode_lock = false; ++ ++ if (!have_private) ++ file->private_data = NULL; ++ } + + /* No increment (+=) because iomap returns a cumulative value. */ + if (err > 0) +@@ -2025,10 +2041,12 @@ static ssize_t btrfs_direct_write(struct kiocb *iocb, struct iov_iter *from) + } else { + fault_in_iov_iter_readable(from, left); + prev_left = left; +- goto relock; ++ goto again; + } + } + ++ btrfs_inode_unlock(inode, ilock_flags); ++ + /* If 'err' is -ENOTBLK then it means we must fallback to buffered IO. */ + if ((err < 0 && err != -ENOTBLK) || !iov_iter_count(from)) + goto out; +@@ -2177,6 +2195,7 @@ static inline bool skip_inode_logging(const struct btrfs_log_ctx *ctx) + */ + int btrfs_sync_file(struct file *file, loff_t start, loff_t end, int datasync) + { ++ struct btrfs_file_private *private = file->private_data; + struct dentry *dentry = file_dentry(file); + struct inode *inode = d_inode(dentry); + struct btrfs_fs_info *fs_info = btrfs_sb(inode->i_sb); +@@ -2186,6 +2205,7 @@ int btrfs_sync_file(struct file *file, loff_t start, loff_t end, int datasync) + int ret = 0, err; + u64 len; + bool full_sync; ++ const bool skip_ilock = (private ? private->fsync_skip_inode_lock : false); + + trace_btrfs_sync_file(file, datasync); + +@@ -2213,7 +2233,10 @@ int btrfs_sync_file(struct file *file, loff_t start, loff_t end, int datasync) + if (ret) + goto out; + +- btrfs_inode_lock(inode, BTRFS_ILOCK_MMAP); ++ if (skip_ilock) ++ down_write(&BTRFS_I(inode)->i_mmap_lock); ++ else ++ btrfs_inode_lock(inode, BTRFS_ILOCK_MMAP); + + atomic_inc(&root->log_batch); + +@@ -2245,7 +2268,10 @@ int btrfs_sync_file(struct file *file, loff_t start, loff_t end, int datasync) + */ + ret = start_ordered_ops(inode, start, end); + if (ret) { +- btrfs_inode_unlock(inode, BTRFS_ILOCK_MMAP); ++ if (skip_ilock) ++ up_write(&BTRFS_I(inode)->i_mmap_lock); ++ else ++ btrfs_inode_unlock(inode, BTRFS_ILOCK_MMAP); + goto out; + } + +@@ -2337,7 +2363,10 @@ int btrfs_sync_file(struct file *file, loff_t start, loff_t end, int datasync) + * file again, but that will end up using the synchronization + * inside btrfs_sync_log to keep things safe. + */ +- btrfs_inode_unlock(inode, BTRFS_ILOCK_MMAP); ++ if (skip_ilock) ++ up_write(&BTRFS_I(inode)->i_mmap_lock); ++ else ++ btrfs_inode_unlock(inode, BTRFS_ILOCK_MMAP); + + if (ret == BTRFS_NO_LOG_SYNC) { + ret = btrfs_end_transaction(trans); +@@ -2404,7 +2433,10 @@ int btrfs_sync_file(struct file *file, loff_t start, loff_t end, int datasync) + + out_release_extents: + btrfs_release_log_ctx_extents(&ctx); +- btrfs_inode_unlock(inode, BTRFS_ILOCK_MMAP); ++ if (skip_ilock) ++ up_write(&BTRFS_I(inode)->i_mmap_lock); ++ else ++ btrfs_inode_unlock(inode, BTRFS_ILOCK_MMAP); + goto out; + } + +diff --git a/fs/btrfs/free-space-cache.c b/fs/btrfs/free-space-cache.c +index 9161bc4f40649c..0004488eeb0601 100644 +--- a/fs/btrfs/free-space-cache.c ++++ b/fs/btrfs/free-space-cache.c +@@ -829,6 +829,7 @@ static int __load_free_space_cache(struct btrfs_root *root, struct inode *inode, + spin_unlock(&ctl->tree_lock); + btrfs_err(fs_info, + "Duplicate entries in free space cache, dumping"); ++ kmem_cache_free(btrfs_free_space_bitmap_cachep, e->bitmap); + kmem_cache_free(btrfs_free_space_cachep, e); + goto free_cache; + } +diff --git a/fs/ceph/super.c b/fs/ceph/super.c +index 1723ec21cd4703..b5ed6d9a19f4a2 100644 +--- a/fs/ceph/super.c ++++ b/fs/ceph/super.c +@@ -783,7 +783,8 @@ static int __init init_caches(void) + if (!ceph_mds_request_cachep) + goto bad_mds_req; + +- ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10, CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT); ++ ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10, ++ (CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT) * sizeof(struct page *)); + if (!ceph_wb_pagevec_pool) + goto bad_pagevec_pool; + +diff --git a/fs/exec.c b/fs/exec.c +index 03516b704d8a4a..05c47a168b7b8c 100644 +--- a/fs/exec.c ++++ b/fs/exec.c +@@ -1603,6 +1603,7 @@ static void bprm_fill_uid(struct linux_binprm *bprm, struct file *file) + unsigned int mode; + kuid_t uid; + kgid_t gid; ++ int err; + + if (!mnt_may_suid(file->f_path.mnt)) + return; +@@ -1620,12 +1621,17 @@ static void bprm_fill_uid(struct linux_binprm *bprm, struct file *file) + /* Be careful if suid/sgid is set */ + inode_lock(inode); + +- /* reload atomically mode/uid/gid now that lock held */ ++ /* Atomically reload and check mode/uid/gid now that lock held. */ + mode = inode->i_mode; + uid = i_uid_into_mnt(mnt_userns, inode); + gid = i_gid_into_mnt(mnt_userns, inode); ++ err = inode_permission(mnt_userns, inode, MAY_EXEC); + inode_unlock(inode); + ++ /* Did the exec bit vanish out from under us? Give up. */ ++ if (err) ++ return; ++ + /* We ignore suid/sgid if there are no mappings for them in the ns */ + if (!kuid_has_mapping(bprm->cred->user_ns, uid) || + !kgid_has_mapping(bprm->cred->user_ns, gid)) +diff --git a/fs/ext2/balloc.c b/fs/ext2/balloc.c +index c17ccc19b938e2..9bf086821eb3ac 100644 +--- a/fs/ext2/balloc.c ++++ b/fs/ext2/balloc.c +@@ -79,26 +79,33 @@ static int ext2_valid_block_bitmap(struct super_block *sb, + ext2_grpblk_t next_zero_bit; + ext2_fsblk_t bitmap_blk; + ext2_fsblk_t group_first_block; ++ ext2_grpblk_t max_bit; + + group_first_block = ext2_group_first_block_no(sb, block_group); ++ max_bit = ext2_group_last_block_no(sb, block_group) - group_first_block; + + /* check whether block bitmap block number is set */ + bitmap_blk = le32_to_cpu(desc->bg_block_bitmap); + offset = bitmap_blk - group_first_block; +- if (!ext2_test_bit(offset, bh->b_data)) ++ if (offset < 0 || offset > max_bit || ++ !ext2_test_bit(offset, bh->b_data)) + /* bad block bitmap */ + goto err_out; + + /* check whether the inode bitmap block number is set */ + bitmap_blk = le32_to_cpu(desc->bg_inode_bitmap); + offset = bitmap_blk - group_first_block; +- if (!ext2_test_bit(offset, bh->b_data)) ++ if (offset < 0 || offset > max_bit || ++ !ext2_test_bit(offset, bh->b_data)) + /* bad block bitmap */ + goto err_out; + + /* check whether the inode table block number is set */ + bitmap_blk = le32_to_cpu(desc->bg_inode_table); + offset = bitmap_blk - group_first_block; ++ if (offset < 0 || offset > max_bit || ++ offset + EXT2_SB(sb)->s_itb_per_group - 1 > max_bit) ++ goto err_out; + next_zero_bit = ext2_find_next_zero_bit(bh->b_data, + offset + EXT2_SB(sb)->s_itb_per_group, + offset); +diff --git a/fs/ext4/extents.c b/fs/ext4/extents.c +index cece004b32d5c9..6c41bf322315ce 100644 +--- a/fs/ext4/extents.c ++++ b/fs/ext4/extents.c +@@ -3112,8 +3112,9 @@ static int ext4_zeroout_es(struct inode *inode, struct ext4_extent *ex) + if (ee_len == 0) + return 0; + +- return ext4_es_insert_extent(inode, ee_block, ee_len, ee_pblock, +- EXTENT_STATUS_WRITTEN); ++ ext4_es_insert_extent(inode, ee_block, ee_len, ee_pblock, ++ EXTENT_STATUS_WRITTEN); ++ return 0; + } + + /* FIXME!! we need to try to merge to left or right after zero-out */ +diff --git a/fs/ext4/extents_status.c b/fs/ext4/extents_status.c +index cccbdfd49a86b6..be3b3ccbf70b61 100644 +--- a/fs/ext4/extents_status.c ++++ b/fs/ext4/extents_status.c +@@ -312,6 +312,8 @@ void ext4_es_find_extent_range(struct inode *inode, + ext4_lblk_t lblk, ext4_lblk_t end, + struct extent_status *es) + { ++ es->es_lblk = es->es_len = es->es_pblk = 0; ++ + if (EXT4_SB(inode->i_sb)->s_mount_state & EXT4_FC_REPLAY) + return; + +@@ -846,12 +848,10 @@ static int __es_insert_extent(struct inode *inode, struct extent_status *newes, + /* + * ext4_es_insert_extent() adds information to an inode's extent + * status tree. +- * +- * Return 0 on success, error code on failure. + */ +-int ext4_es_insert_extent(struct inode *inode, ext4_lblk_t lblk, +- ext4_lblk_t len, ext4_fsblk_t pblk, +- unsigned int status) ++void ext4_es_insert_extent(struct inode *inode, ext4_lblk_t lblk, ++ ext4_lblk_t len, ext4_fsblk_t pblk, ++ unsigned int status) + { + struct extent_status newes; + ext4_lblk_t end = lblk + len - 1; +@@ -863,13 +863,13 @@ int ext4_es_insert_extent(struct inode *inode, ext4_lblk_t lblk, + bool revise_pending = false; + + if (EXT4_SB(inode->i_sb)->s_mount_state & EXT4_FC_REPLAY) +- return 0; ++ return; + + es_debug("add [%u/%u) %llu %x to extent status tree of inode %lu\n", + lblk, len, pblk, status, inode->i_ino); + + if (!len) +- return 0; ++ return; + + BUG_ON(end < lblk); + +@@ -938,7 +938,7 @@ int ext4_es_insert_extent(struct inode *inode, ext4_lblk_t lblk, + goto retry; + + ext4_es_print_tree(inode); +- return 0; ++ return; + } + + /* +diff --git a/fs/ext4/extents_status.h b/fs/ext4/extents_status.h +index 4ec30a79826050..481ec4381bee6e 100644 +--- a/fs/ext4/extents_status.h ++++ b/fs/ext4/extents_status.h +@@ -127,9 +127,9 @@ extern int __init ext4_init_es(void); + extern void ext4_exit_es(void); + extern void ext4_es_init_tree(struct ext4_es_tree *tree); + +-extern int ext4_es_insert_extent(struct inode *inode, ext4_lblk_t lblk, +- ext4_lblk_t len, ext4_fsblk_t pblk, +- unsigned int status); ++extern void ext4_es_insert_extent(struct inode *inode, ext4_lblk_t lblk, ++ ext4_lblk_t len, ext4_fsblk_t pblk, ++ unsigned int status); + extern void ext4_es_cache_extent(struct inode *inode, ext4_lblk_t lblk, + ext4_lblk_t len, ext4_fsblk_t pblk, + unsigned int status); +diff --git a/fs/ext4/fast_commit.c b/fs/ext4/fast_commit.c +index 2660c34c770e39..e81b886d9c6730 100644 +--- a/fs/ext4/fast_commit.c ++++ b/fs/ext4/fast_commit.c +@@ -353,13 +353,6 @@ static int ext4_fc_track_template( + tid_t tid = 0; + int ret; + +- if (!test_opt2(inode->i_sb, JOURNAL_FAST_COMMIT) || +- (sbi->s_mount_state & EXT4_FC_REPLAY)) +- return -EOPNOTSUPP; +- +- if (ext4_test_mount_flag(inode->i_sb, EXT4_MF_FC_INELIGIBLE)) +- return -EINVAL; +- + tid = handle->h_transaction->t_tid; + mutex_lock(&ei->i_fc_lock); + if (tid == ei->i_sync_tid) { +@@ -468,7 +461,17 @@ void __ext4_fc_track_unlink(handle_t *handle, + + void ext4_fc_track_unlink(handle_t *handle, struct dentry *dentry) + { +- __ext4_fc_track_unlink(handle, d_inode(dentry), dentry); ++ struct inode *inode = d_inode(dentry); ++ struct ext4_sb_info *sbi = EXT4_SB(inode->i_sb); ++ ++ if (!test_opt2(inode->i_sb, JOURNAL_FAST_COMMIT) || ++ (sbi->s_mount_state & EXT4_FC_REPLAY)) ++ return; ++ ++ if (ext4_test_mount_flag(inode->i_sb, EXT4_MF_FC_INELIGIBLE)) ++ return; ++ ++ __ext4_fc_track_unlink(handle, inode, dentry); + } + + void __ext4_fc_track_link(handle_t *handle, +@@ -487,7 +490,17 @@ void __ext4_fc_track_link(handle_t *handle, + + void ext4_fc_track_link(handle_t *handle, struct dentry *dentry) + { +- __ext4_fc_track_link(handle, d_inode(dentry), dentry); ++ struct inode *inode = d_inode(dentry); ++ struct ext4_sb_info *sbi = EXT4_SB(inode->i_sb); ++ ++ if (!test_opt2(inode->i_sb, JOURNAL_FAST_COMMIT) || ++ (sbi->s_mount_state & EXT4_FC_REPLAY)) ++ return; ++ ++ if (ext4_test_mount_flag(inode->i_sb, EXT4_MF_FC_INELIGIBLE)) ++ return; ++ ++ __ext4_fc_track_link(handle, inode, dentry); + } + + void __ext4_fc_track_create(handle_t *handle, struct inode *inode, +@@ -506,7 +519,17 @@ void __ext4_fc_track_create(handle_t *handle, struct inode *inode, + + void ext4_fc_track_create(handle_t *handle, struct dentry *dentry) + { +- __ext4_fc_track_create(handle, d_inode(dentry), dentry); ++ struct inode *inode = d_inode(dentry); ++ struct ext4_sb_info *sbi = EXT4_SB(inode->i_sb); ++ ++ if (!test_opt2(inode->i_sb, JOURNAL_FAST_COMMIT) || ++ (sbi->s_mount_state & EXT4_FC_REPLAY)) ++ return; ++ ++ if (ext4_test_mount_flag(inode->i_sb, EXT4_MF_FC_INELIGIBLE)) ++ return; ++ ++ __ext4_fc_track_create(handle, inode, dentry); + } + + /* __track_fn for inode tracking */ +@@ -522,6 +545,7 @@ static int __track_inode(struct inode *inode, void *arg, bool update) + + void ext4_fc_track_inode(handle_t *handle, struct inode *inode) + { ++ struct ext4_sb_info *sbi = EXT4_SB(inode->i_sb); + int ret; + + if (S_ISDIR(inode->i_mode)) +@@ -533,6 +557,13 @@ void ext4_fc_track_inode(handle_t *handle, struct inode *inode) + return; + } + ++ if (!test_opt2(inode->i_sb, JOURNAL_FAST_COMMIT) || ++ (sbi->s_mount_state & EXT4_FC_REPLAY)) ++ return; ++ ++ if (ext4_test_mount_flag(inode->i_sb, EXT4_MF_FC_INELIGIBLE)) ++ return; ++ + ret = ext4_fc_track_template(handle, inode, __track_inode, NULL, 1); + trace_ext4_fc_track_inode(inode, ret); + } +@@ -572,12 +603,26 @@ static int __track_range(struct inode *inode, void *arg, bool update) + void ext4_fc_track_range(handle_t *handle, struct inode *inode, ext4_lblk_t start, + ext4_lblk_t end) + { ++ struct ext4_sb_info *sbi = EXT4_SB(inode->i_sb); + struct __track_range_args args; + int ret; + + if (S_ISDIR(inode->i_mode)) + return; + ++ if (!test_opt2(inode->i_sb, JOURNAL_FAST_COMMIT) || ++ (sbi->s_mount_state & EXT4_FC_REPLAY)) ++ return; ++ ++ if (ext4_test_mount_flag(inode->i_sb, EXT4_MF_FC_INELIGIBLE)) ++ return; ++ ++ if (ext4_has_inline_data(inode)) { ++ ext4_fc_mark_ineligible(inode->i_sb, EXT4_FC_REASON_XATTR, ++ handle); ++ return; ++ } ++ + args.start = start; + args.end = end; + +diff --git a/fs/ext4/inline.c b/fs/ext4/inline.c +index 6fe665de1b2038..bc7f6417888dc7 100644 +--- a/fs/ext4/inline.c ++++ b/fs/ext4/inline.c +@@ -1446,7 +1446,11 @@ int ext4_inlinedir_to_tree(struct file *dir_file, + hinfo->hash = EXT4_DIRENT_HASH(de); + hinfo->minor_hash = EXT4_DIRENT_MINOR_HASH(de); + } else { +- ext4fs_dirhash(dir, de->name, de->name_len, hinfo); ++ err = ext4fs_dirhash(dir, de->name, de->name_len, hinfo); ++ if (err) { ++ ret = err; ++ goto out; ++ } + } + if ((hinfo->hash < start_hash) || + ((hinfo->hash == start_hash) && +diff --git a/fs/ext4/inode.c b/fs/ext4/inode.c +index 64a783f221052a..e765c0d05fea21 100644 +--- a/fs/ext4/inode.c ++++ b/fs/ext4/inode.c +@@ -484,6 +484,35 @@ static void ext4_map_blocks_es_recheck(handle_t *handle, + } + #endif /* ES_AGGRESSIVE_TEST */ + ++static int ext4_map_query_blocks(handle_t *handle, struct inode *inode, ++ struct ext4_map_blocks *map) ++{ ++ unsigned int status; ++ int retval; ++ ++ if (ext4_test_inode_flag(inode, EXT4_INODE_EXTENTS)) ++ retval = ext4_ext_map_blocks(handle, inode, map, 0); ++ else ++ retval = ext4_ind_map_blocks(handle, inode, map, 0); ++ ++ if (retval <= 0) ++ return retval; ++ ++ if (unlikely(retval != map->m_len)) { ++ ext4_warning(inode->i_sb, ++ "ES len assertion failed for inode " ++ "%lu: retval %d != map->m_len %d", ++ inode->i_ino, retval, map->m_len); ++ WARN_ON(1); ++ } ++ ++ status = map->m_flags & EXT4_MAP_UNWRITTEN ? ++ EXTENT_STATUS_UNWRITTEN : EXTENT_STATUS_WRITTEN; ++ ext4_es_insert_extent(inode, map->m_lblk, map->m_len, ++ map->m_pblk, status); ++ return retval; ++} ++ + /* + * The ext4_map_blocks() function tries to look up the requested blocks, + * and returns if the blocks are already mapped. +@@ -589,10 +618,8 @@ int ext4_map_blocks(handle_t *handle, struct inode *inode, + ext4_es_scan_range(inode, &ext4_es_is_delayed, map->m_lblk, + map->m_lblk + map->m_len - 1)) + status |= EXTENT_STATUS_DELAYED; +- ret = ext4_es_insert_extent(inode, map->m_lblk, +- map->m_len, map->m_pblk, status); +- if (ret < 0) +- retval = ret; ++ ext4_es_insert_extent(inode, map->m_lblk, map->m_len, ++ map->m_pblk, status); + } + up_read((&EXT4_I(inode)->i_data_sem)); + +@@ -701,12 +728,8 @@ int ext4_map_blocks(handle_t *handle, struct inode *inode, + ext4_es_scan_range(inode, &ext4_es_is_delayed, map->m_lblk, + map->m_lblk + map->m_len - 1)) + status |= EXTENT_STATUS_DELAYED; +- ret = ext4_es_insert_extent(inode, map->m_lblk, map->m_len, +- map->m_pblk, status); +- if (ret < 0) { +- retval = ret; +- goto out_sem; +- } ++ ext4_es_insert_extent(inode, map->m_lblk, map->m_len, ++ map->m_pblk, status); + } + + out_sem: +@@ -1718,12 +1741,10 @@ static int ext4_da_map_blocks(struct inode *inode, sector_t iblock, + + /* Lookup extent status tree firstly */ + if (ext4_es_lookup_extent(inode, iblock, NULL, &es)) { +- if (ext4_es_is_hole(&es)) { +- retval = 0; +- down_read(&EXT4_I(inode)->i_data_sem); ++ if (ext4_es_is_hole(&es)) + goto add_delayed; +- } + ++found: + /* + * Delayed extent could be allocated by fallocate. + * So we need to check it. +@@ -1760,52 +1781,42 @@ static int ext4_da_map_blocks(struct inode *inode, sector_t iblock, + down_read(&EXT4_I(inode)->i_data_sem); + if (ext4_has_inline_data(inode)) + retval = 0; +- else if (ext4_test_inode_flag(inode, EXT4_INODE_EXTENTS)) +- retval = ext4_ext_map_blocks(NULL, inode, map, 0); + else +- retval = ext4_ind_map_blocks(NULL, inode, map, 0); ++ retval = ext4_map_query_blocks(NULL, inode, map); ++ up_read(&EXT4_I(inode)->i_data_sem); ++ if (retval) ++ return retval; + + add_delayed: +- if (retval == 0) { +- int ret; +- +- /* +- * XXX: __block_prepare_write() unmaps passed block, +- * is it OK? +- */ +- +- ret = ext4_insert_delayed_block(inode, map->m_lblk); +- if (ret != 0) { +- retval = ret; +- goto out_unlock; ++ down_write(&EXT4_I(inode)->i_data_sem); ++ /* ++ * Page fault path (ext4_page_mkwrite does not take i_rwsem) ++ * and fallocate path (no folio lock) can race. Make sure we ++ * lookup the extent status tree here again while i_data_sem ++ * is held in write mode, before inserting a new da entry in ++ * the extent status tree. ++ */ ++ if (ext4_es_lookup_extent(inode, iblock, NULL, &es)) { ++ if (!ext4_es_is_hole(&es)) { ++ up_write(&EXT4_I(inode)->i_data_sem); ++ goto found; + } +- +- map_bh(bh, inode->i_sb, invalid_block); +- set_buffer_new(bh); +- set_buffer_delay(bh); +- } else if (retval > 0) { +- int ret; +- unsigned int status; +- +- if (unlikely(retval != map->m_len)) { +- ext4_warning(inode->i_sb, +- "ES len assertion failed for inode " +- "%lu: retval %d != map->m_len %d", +- inode->i_ino, retval, map->m_len); +- WARN_ON(1); ++ } else if (!ext4_has_inline_data(inode)) { ++ retval = ext4_map_query_blocks(NULL, inode, map); ++ if (retval) { ++ up_write(&EXT4_I(inode)->i_data_sem); ++ return retval; + } +- +- status = map->m_flags & EXT4_MAP_UNWRITTEN ? +- EXTENT_STATUS_UNWRITTEN : EXTENT_STATUS_WRITTEN; +- ret = ext4_es_insert_extent(inode, map->m_lblk, map->m_len, +- map->m_pblk, status); +- if (ret != 0) +- retval = ret; + } + +-out_unlock: +- up_read((&EXT4_I(inode)->i_data_sem)); ++ retval = ext4_insert_delayed_block(inode, map->m_lblk); ++ up_write(&EXT4_I(inode)->i_data_sem); ++ if (retval) ++ return retval; + ++ map_bh(bh, inode->i_sb, invalid_block); ++ set_buffer_new(bh); ++ set_buffer_delay(bh); + return retval; + } + +diff --git a/fs/ext4/mballoc.c b/fs/ext4/mballoc.c +index 1145664a0bb716..630a5e5a380e2a 100644 +--- a/fs/ext4/mballoc.c ++++ b/fs/ext4/mballoc.c +@@ -2270,8 +2270,7 @@ int ext4_mb_find_by_goal(struct ext4_allocation_context *ac, + if (max >= ac->ac_g_ex.fe_len && ac->ac_g_ex.fe_len == sbi->s_stripe) { + ext4_fsblk_t start; + +- start = ext4_group_first_block_no(ac->ac_sb, e4b->bd_group) + +- ex.fe_start; ++ start = ext4_grp_offs_to_block(ac->ac_sb, &ex); + /* use do_div to get remainder (would be 64-bit modulo) */ + if (do_div(start, sbi->s_stripe) == 0) { + ac->ac_found++; +diff --git a/fs/ext4/namei.c b/fs/ext4/namei.c +index e9501fb28477bb..a80f2cdab37443 100644 +--- a/fs/ext4/namei.c ++++ b/fs/ext4/namei.c +@@ -151,10 +151,11 @@ static struct buffer_head *__ext4_read_dirblock(struct inode *inode, + + return bh; + } +- if (!bh && (type == INDEX || type == DIRENT_HTREE)) { ++ /* The first directory block must not be a hole. */ ++ if (!bh && (type == INDEX || type == DIRENT_HTREE || block == 0)) { + ext4_error_inode(inode, func, line, block, +- "Directory hole found for htree %s block", +- (type == INDEX) ? "index" : "leaf"); ++ "Directory hole found for htree %s block %u", ++ (type == INDEX) ? "index" : "leaf", block); + return ERR_PTR(-EFSCORRUPTED); + } + if (!bh) +@@ -2218,6 +2219,52 @@ static int add_dirent_to_buf(handle_t *handle, struct ext4_filename *fname, + return err ? err : err2; + } + ++static bool ext4_check_dx_root(struct inode *dir, struct dx_root *root) ++{ ++ struct fake_dirent *fde; ++ const char *error_msg; ++ unsigned int rlen; ++ unsigned int blocksize = dir->i_sb->s_blocksize; ++ char *blockend = (char *)root + dir->i_sb->s_blocksize; ++ ++ fde = &root->dot; ++ if (unlikely(fde->name_len != 1)) { ++ error_msg = "invalid name_len for '.'"; ++ goto corrupted; ++ } ++ if (unlikely(strncmp(root->dot_name, ".", fde->name_len))) { ++ error_msg = "invalid name for '.'"; ++ goto corrupted; ++ } ++ rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize); ++ if (unlikely((char *)fde + rlen >= blockend)) { ++ error_msg = "invalid rec_len for '.'"; ++ goto corrupted; ++ } ++ ++ fde = &root->dotdot; ++ if (unlikely(fde->name_len != 2)) { ++ error_msg = "invalid name_len for '..'"; ++ goto corrupted; ++ } ++ if (unlikely(strncmp(root->dotdot_name, "..", fde->name_len))) { ++ error_msg = "invalid name for '..'"; ++ goto corrupted; ++ } ++ rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize); ++ if (unlikely((char *)fde + rlen >= blockend)) { ++ error_msg = "invalid rec_len for '..'"; ++ goto corrupted; ++ } ++ ++ return true; ++ ++corrupted: ++ EXT4_ERROR_INODE(dir, "Corrupt dir, %s, running e2fsck is recommended", ++ error_msg); ++ return false; ++} ++ + /* + * This converts a one block unindexed directory to a 3 block indexed + * directory, and adds the dentry to the indexed directory. +@@ -2252,17 +2299,17 @@ static int make_indexed_dir(handle_t *handle, struct ext4_filename *fname, + brelse(bh); + return retval; + } ++ + root = (struct dx_root *) bh->b_data; ++ if (!ext4_check_dx_root(dir, root)) { ++ brelse(bh); ++ return -EFSCORRUPTED; ++ } + + /* The 0th block becomes the root, move the dirents out */ + fde = &root->dotdot; + de = (struct ext4_dir_entry_2 *)((char *)fde + + ext4_rec_len_from_disk(fde->rec_len, blocksize)); +- if ((char *) de >= (((char *) root) + blocksize)) { +- EXT4_ERROR_INODE(dir, "invalid rec_len for '..'"); +- brelse(bh); +- return -EFSCORRUPTED; +- } + len = ((char *) root) + (blocksize - csum_size) - (char *) de; + + /* Allocate new block for the 0th block's dirents */ +@@ -3087,10 +3134,7 @@ bool ext4_empty_dir(struct inode *inode) + EXT4_ERROR_INODE(inode, "invalid size"); + return false; + } +- /* The first directory block must not be a hole, +- * so treat it as DIRENT_HTREE +- */ +- bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE); ++ bh = ext4_read_dirblock(inode, 0, EITHER); + if (IS_ERR(bh)) + return false; + +@@ -3548,10 +3592,7 @@ static struct buffer_head *ext4_get_first_dir_block(handle_t *handle, + struct ext4_dir_entry_2 *de; + unsigned int offset; + +- /* The first directory block must not be a hole, so +- * treat it as DIRENT_HTREE +- */ +- bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE); ++ bh = ext4_read_dirblock(inode, 0, EITHER); + if (IS_ERR(bh)) { + *retval = PTR_ERR(bh); + return NULL; +@@ -4011,12 +4052,19 @@ static int ext4_rename(struct user_namespace *mnt_userns, struct inode *old_dir, + ext4_fc_mark_ineligible(old.inode->i_sb, + EXT4_FC_REASON_RENAME_DIR, handle); + } else { ++ struct super_block *sb = old.inode->i_sb; ++ + if (new.inode) + ext4_fc_track_unlink(handle, new.dentry); +- __ext4_fc_track_link(handle, old.inode, new.dentry); +- __ext4_fc_track_unlink(handle, old.inode, old.dentry); +- if (whiteout) +- __ext4_fc_track_create(handle, whiteout, old.dentry); ++ if (test_opt2(sb, JOURNAL_FAST_COMMIT) && ++ !(EXT4_SB(sb)->s_mount_state & EXT4_FC_REPLAY) && ++ !(ext4_test_mount_flag(sb, EXT4_MF_FC_INELIGIBLE))) { ++ __ext4_fc_track_link(handle, old.inode, new.dentry); ++ __ext4_fc_track_unlink(handle, old.inode, old.dentry); ++ if (whiteout) ++ __ext4_fc_track_create(handle, whiteout, ++ old.dentry); ++ } + } + + if (new.inode) { +diff --git a/fs/ext4/xattr.c b/fs/ext4/xattr.c +index 37f3c2ebe6f82f..e788f291ae86d7 100644 +--- a/fs/ext4/xattr.c ++++ b/fs/ext4/xattr.c +@@ -1384,6 +1384,12 @@ static int ext4_xattr_inode_write(handle_t *handle, struct inode *ea_inode, + goto out; + + memcpy(bh->b_data, buf, csize); ++ /* ++ * Zero out block tail to avoid writing uninitialized memory ++ * to disk. ++ */ ++ if (csize < blocksize) ++ memset(bh->b_data + csize, 0, blocksize - csize); + set_buffer_uptodate(bh); + ext4_handle_dirty_metadata(handle, ea_inode, bh); + +diff --git a/fs/f2fs/inline.c b/fs/f2fs/inline.c +index e4fc169a07f55f..6246ea2e1c6214 100644 +--- a/fs/f2fs/inline.c ++++ b/fs/f2fs/inline.c +@@ -203,8 +203,10 @@ int f2fs_convert_inline_inode(struct inode *inode) + struct page *ipage, *page; + int err = 0; + +- if (!f2fs_has_inline_data(inode) || +- f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb)) ++ if (f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb)) ++ return -EROFS; ++ ++ if (!f2fs_has_inline_data(inode)) + return 0; + + err = f2fs_dquot_initialize(inode); +diff --git a/fs/f2fs/inode.c b/fs/f2fs/inode.c +index ddb297409f41b3..27bd8d1bae4d3d 100644 +--- a/fs/f2fs/inode.c ++++ b/fs/f2fs/inode.c +@@ -27,6 +27,9 @@ void f2fs_mark_inode_dirty_sync(struct inode *inode, bool sync) + if (is_inode_flag_set(inode, FI_NEW_INODE)) + return; + ++ if (f2fs_readonly(F2FS_I_SB(inode)->sb)) ++ return; ++ + if (f2fs_inode_dirtied(inode, sync)) + return; + +diff --git a/fs/file.c b/fs/file.c +index b46a4a725a0ef7..0669cc0f1809fe 100644 +--- a/fs/file.c ++++ b/fs/file.c +@@ -1148,6 +1148,7 @@ __releases(&files->file_lock) + * tables and this condition does not arise without those. + */ + fdt = files_fdtable(files); ++ fd = array_index_nospec(fd, fdt->max_fds); + tofree = fdt->fd[fd]; + if (!tofree && fd_is_open(fd, fdt)) + goto Ebusy; +diff --git a/fs/fuse/inode.c b/fs/fuse/inode.c +index 62b4143ccf26c9..396866f9d72c33 100644 +--- a/fs/fuse/inode.c ++++ b/fs/fuse/inode.c +@@ -686,6 +686,8 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param) + struct fs_parse_result result; + struct fuse_fs_context *ctx = fsc->fs_private; + int opt; ++ kuid_t kuid; ++ kgid_t kgid; + + if (fsc->purpose == FS_CONTEXT_FOR_RECONFIGURE) { + /* +@@ -730,16 +732,30 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param) + break; + + case OPT_USER_ID: +- ctx->user_id = make_kuid(fsc->user_ns, result.uint_32); +- if (!uid_valid(ctx->user_id)) ++ kuid = make_kuid(fsc->user_ns, result.uint_32); ++ if (!uid_valid(kuid)) + return invalfc(fsc, "Invalid user_id"); ++ /* ++ * The requested uid must be representable in the ++ * filesystem's idmapping. ++ */ ++ if (!kuid_has_mapping(fsc->user_ns, kuid)) ++ return invalfc(fsc, "Invalid user_id"); ++ ctx->user_id = kuid; + ctx->user_id_present = true; + break; + + case OPT_GROUP_ID: +- ctx->group_id = make_kgid(fsc->user_ns, result.uint_32); +- if (!gid_valid(ctx->group_id)) ++ kgid = make_kgid(fsc->user_ns, result.uint_32);; ++ if (!gid_valid(kgid)) ++ return invalfc(fsc, "Invalid group_id"); ++ /* ++ * The requested gid must be representable in the ++ * filesystem's idmapping. ++ */ ++ if (!kgid_has_mapping(fsc->user_ns, kgid)) + return invalfc(fsc, "Invalid group_id"); ++ ctx->group_id = kgid; + ctx->group_id_present = true; + break; + +diff --git a/fs/hfs/inode.c b/fs/hfs/inode.c +index 7c9c6d0b38fd62..9730ad3622d450 100644 +--- a/fs/hfs/inode.c ++++ b/fs/hfs/inode.c +@@ -202,6 +202,7 @@ struct inode *hfs_new_inode(struct inode *dir, const struct qstr *name, umode_t + HFS_I(inode)->flags = 0; + HFS_I(inode)->rsrc_inode = NULL; + HFS_I(inode)->fs_blocks = 0; ++ HFS_I(inode)->tz_secondswest = sys_tz.tz_minuteswest * 60; + if (S_ISDIR(mode)) { + inode->i_size = 2; + HFS_SB(sb)->folder_count++; +@@ -277,6 +278,8 @@ void hfs_inode_read_fork(struct inode *inode, struct hfs_extent *ext, + for (count = 0, i = 0; i < 3; i++) + count += be16_to_cpu(ext[i].count); + HFS_I(inode)->first_blocks = count; ++ HFS_I(inode)->cached_start = 0; ++ HFS_I(inode)->cached_blocks = 0; + + inode->i_size = HFS_I(inode)->phys_size = log_size; + HFS_I(inode)->fs_blocks = (log_size + sb->s_blocksize - 1) >> sb->s_blocksize_bits; +diff --git a/fs/hfsplus/bfind.c b/fs/hfsplus/bfind.c +index ca2ba8c9f82ef2..901e83d65d2021 100644 +--- a/fs/hfsplus/bfind.c ++++ b/fs/hfsplus/bfind.c +@@ -25,19 +25,8 @@ int hfs_find_init(struct hfs_btree *tree, struct hfs_find_data *fd) + fd->key = ptr + tree->max_key_len + 2; + hfs_dbg(BNODE_REFS, "find_init: %d (%p)\n", + tree->cnid, __builtin_return_address(0)); +- switch (tree->cnid) { +- case HFSPLUS_CAT_CNID: +- mutex_lock_nested(&tree->tree_lock, CATALOG_BTREE_MUTEX); +- break; +- case HFSPLUS_EXT_CNID: +- mutex_lock_nested(&tree->tree_lock, EXTENTS_BTREE_MUTEX); +- break; +- case HFSPLUS_ATTR_CNID: +- mutex_lock_nested(&tree->tree_lock, ATTR_BTREE_MUTEX); +- break; +- default: +- BUG(); +- } ++ mutex_lock_nested(&tree->tree_lock, ++ hfsplus_btree_lock_class(tree)); + return 0; + } + +diff --git a/fs/hfsplus/extents.c b/fs/hfsplus/extents.c +index 7054a542689f9c..c95a2f0ed4a74e 100644 +--- a/fs/hfsplus/extents.c ++++ b/fs/hfsplus/extents.c +@@ -430,7 +430,8 @@ int hfsplus_free_fork(struct super_block *sb, u32 cnid, + hfsplus_free_extents(sb, ext_entry, total_blocks - start, + total_blocks); + total_blocks = start; +- mutex_lock(&fd.tree->tree_lock); ++ mutex_lock_nested(&fd.tree->tree_lock, ++ hfsplus_btree_lock_class(fd.tree)); + } while (total_blocks > blocks); + hfs_find_exit(&fd); + +@@ -592,7 +593,8 @@ void hfsplus_file_truncate(struct inode *inode) + alloc_cnt, alloc_cnt - blk_cnt); + hfsplus_dump_extent(hip->first_extents); + hip->first_blocks = blk_cnt; +- mutex_lock(&fd.tree->tree_lock); ++ mutex_lock_nested(&fd.tree->tree_lock, ++ hfsplus_btree_lock_class(fd.tree)); + break; + } + res = __hfsplus_ext_cache_extent(&fd, inode, alloc_cnt); +@@ -606,7 +608,8 @@ void hfsplus_file_truncate(struct inode *inode) + hfsplus_free_extents(sb, hip->cached_extents, + alloc_cnt - start, alloc_cnt - blk_cnt); + hfsplus_dump_extent(hip->cached_extents); +- mutex_lock(&fd.tree->tree_lock); ++ mutex_lock_nested(&fd.tree->tree_lock, ++ hfsplus_btree_lock_class(fd.tree)); + if (blk_cnt > start) { + hip->extent_state |= HFSPLUS_EXT_DIRTY; + break; +diff --git a/fs/hfsplus/hfsplus_fs.h b/fs/hfsplus/hfsplus_fs.h +index ebc0d5c678d0c4..decb671db91b46 100644 +--- a/fs/hfsplus/hfsplus_fs.h ++++ b/fs/hfsplus/hfsplus_fs.h +@@ -550,6 +550,27 @@ static inline __be32 __hfsp_ut2mt(time64_t ut) + return cpu_to_be32(lower_32_bits(ut) + HFSPLUS_UTC_OFFSET); + } + ++static inline enum hfsplus_btree_mutex_classes ++hfsplus_btree_lock_class(struct hfs_btree *tree) ++{ ++ enum hfsplus_btree_mutex_classes class; ++ ++ switch (tree->cnid) { ++ case HFSPLUS_CAT_CNID: ++ class = CATALOG_BTREE_MUTEX; ++ break; ++ case HFSPLUS_EXT_CNID: ++ class = EXTENTS_BTREE_MUTEX; ++ break; ++ case HFSPLUS_ATTR_CNID: ++ class = ATTR_BTREE_MUTEX; ++ break; ++ default: ++ BUG(); ++ } ++ return class; ++} ++ + /* compatibility */ + #define hfsp_mt2ut(t) (struct timespec64){ .tv_sec = __hfsp_mt2ut(t) } + #define hfsp_ut2mt(t) __hfsp_ut2mt((t).tv_sec) +diff --git a/fs/jbd2/commit.c b/fs/jbd2/commit.c +index f858d1152368a2..540a3ccb32875b 100644 +--- a/fs/jbd2/commit.c ++++ b/fs/jbd2/commit.c +@@ -800,7 +800,7 @@ void jbd2_journal_commit_transaction(journal_t *journal) + if (first_block < journal->j_tail) + freed += journal->j_last - journal->j_first; + /* Update tail only if we free significant amount of space */ +- if (freed < jbd2_journal_get_max_txn_bufs(journal)) ++ if (freed < journal->j_max_transaction_buffers) + update_tail = 0; + } + J_ASSERT(commit_transaction->t_state == T_COMMIT); +diff --git a/fs/jbd2/journal.c b/fs/jbd2/journal.c +index b7af1727a01600..b10c144c608469 100644 +--- a/fs/jbd2/journal.c ++++ b/fs/jbd2/journal.c +@@ -412,6 +412,7 @@ int jbd2_journal_write_metadata_buffer(transaction_t *transaction, + tmp = jbd2_alloc(bh_in->b_size, GFP_NOFS); + if (!tmp) { + brelse(new_bh); ++ free_buffer_head(new_bh); + return -ENOMEM; + } + spin_lock(&jh_in->b_state_lock); +@@ -1529,6 +1530,11 @@ static void journal_fail_superblock(journal_t *journal) + journal->j_sb_buffer = NULL; + } + ++static int jbd2_journal_get_max_txn_bufs(journal_t *journal) ++{ ++ return (journal->j_total_len - journal->j_fc_wbufsize) / 4; ++} ++ + /* + * Given a journal_t structure, initialise the various fields for + * startup of a new journaling session. We use this both when creating +diff --git a/fs/jfs/jfs_imap.c b/fs/jfs/jfs_imap.c +index ac42f8ee553fc3..ba6f28521360b3 100644 +--- a/fs/jfs/jfs_imap.c ++++ b/fs/jfs/jfs_imap.c +@@ -290,7 +290,7 @@ int diSync(struct inode *ipimap) + int diRead(struct inode *ip) + { + struct jfs_sb_info *sbi = JFS_SBI(ip->i_sb); +- int iagno, ino, extno, rc; ++ int iagno, ino, extno, rc, agno; + struct inode *ipimap; + struct dinode *dp; + struct iag *iagp; +@@ -339,8 +339,11 @@ int diRead(struct inode *ip) + + /* get the ag for the iag */ + agstart = le64_to_cpu(iagp->agstart); ++ agno = BLKTOAG(agstart, JFS_SBI(ip->i_sb)); + + release_metapage(mp); ++ if (agno >= MAXAG || agno < 0) ++ return -EIO; + + rel_inode = (ino & (INOSPERPAGE - 1)); + pageno = blkno >> sbi->l2nbperpage; +diff --git a/fs/nfs/nfs4client.c b/fs/nfs/nfs4client.c +index cba8b4c1fb4a3c..8557b2218aa196 100644 +--- a/fs/nfs/nfs4client.c ++++ b/fs/nfs/nfs4client.c +@@ -230,9 +230,8 @@ struct nfs_client *nfs4_alloc_client(const struct nfs_client_initdata *cl_init) + __set_bit(NFS_CS_INFINITE_SLOTS, &clp->cl_flags); + __set_bit(NFS_CS_DISCRTRY, &clp->cl_flags); + __set_bit(NFS_CS_NO_RETRANS_TIMEOUT, &clp->cl_flags); +- +- if (test_bit(NFS_CS_DS, &cl_init->init_flags)) +- __set_bit(NFS_CS_DS, &clp->cl_flags); ++ if (test_bit(NFS_CS_PNFS, &cl_init->init_flags)) ++ __set_bit(NFS_CS_PNFS, &clp->cl_flags); + /* + * Set up the connection to the server before we add add to the + * global list. +@@ -997,7 +996,6 @@ struct nfs_client *nfs4_set_ds_client(struct nfs_server *mds_srv, + if (mds_srv->flags & NFS_MOUNT_NORESVPORT) + __set_bit(NFS_CS_NORESVPORT, &cl_init.init_flags); + +- __set_bit(NFS_CS_DS, &cl_init.init_flags); + __set_bit(NFS_CS_PNFS, &cl_init.init_flags); + cl_init.max_connect = NFS_MAX_TRANSPORTS; + /* +diff --git a/fs/nfs/nfs4proc.c b/fs/nfs/nfs4proc.c +index 167f2cc3c3798d..770fa1cb112d81 100644 +--- a/fs/nfs/nfs4proc.c ++++ b/fs/nfs/nfs4proc.c +@@ -8718,7 +8718,7 @@ nfs4_run_exchange_id(struct nfs_client *clp, const struct cred *cred, + #ifdef CONFIG_NFS_V4_1_MIGRATION + calldata->args.flags |= EXCHGID4_FLAG_SUPP_MOVED_MIGR; + #endif +- if (test_bit(NFS_CS_DS, &clp->cl_flags)) ++ if (test_bit(NFS_CS_PNFS, &clp->cl_flags)) + calldata->args.flags |= EXCHGID4_FLAG_USE_PNFS_DS; + msg.rpc_argp = &calldata->args; + msg.rpc_resp = &calldata->res; +diff --git a/fs/nilfs2/btnode.c b/fs/nilfs2/btnode.c +index 1776121677e28b..28a726553318b0 100644 +--- a/fs/nilfs2/btnode.c ++++ b/fs/nilfs2/btnode.c +@@ -51,12 +51,21 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr) + + bh = nilfs_grab_buffer(inode, btnc, blocknr, BIT(BH_NILFS_Node)); + if (unlikely(!bh)) +- return NULL; ++ return ERR_PTR(-ENOMEM); + + if (unlikely(buffer_mapped(bh) || buffer_uptodate(bh) || + buffer_dirty(bh))) { +- brelse(bh); +- BUG(); ++ /* ++ * The block buffer at the specified new address was already ++ * in use. This can happen if it is a virtual block number ++ * and has been reallocated due to corruption of the bitmap ++ * used to manage its allocation state (if not, the buffer ++ * clearing of an abandoned b-tree node is missing somewhere). ++ */ ++ nilfs_error(inode->i_sb, ++ "state inconsistency probably due to duplicate use of b-tree node block address %llu (ino=%lu)", ++ (unsigned long long)blocknr, inode->i_ino); ++ goto failed; + } + memset(bh->b_data, 0, i_blocksize(inode)); + bh->b_bdev = inode->i_sb->s_bdev; +@@ -67,6 +76,12 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr) + unlock_page(bh->b_page); + put_page(bh->b_page); + return bh; ++ ++failed: ++ unlock_page(bh->b_page); ++ put_page(bh->b_page); ++ brelse(bh); ++ return ERR_PTR(-EIO); + } + + int nilfs_btnode_submit_block(struct address_space *btnc, __u64 blocknr, +@@ -217,8 +232,8 @@ int nilfs_btnode_prepare_change_key(struct address_space *btnc, + } + + nbh = nilfs_btnode_create_block(btnc, newkey); +- if (!nbh) +- return -ENOMEM; ++ if (IS_ERR(nbh)) ++ return PTR_ERR(nbh); + + BUG_ON(nbh == obh); + ctxt->newbh = nbh; +diff --git a/fs/nilfs2/btree.c b/fs/nilfs2/btree.c +index 385ec71fcdef21..8e3d343b9a7937 100644 +--- a/fs/nilfs2/btree.c ++++ b/fs/nilfs2/btree.c +@@ -63,8 +63,8 @@ static int nilfs_btree_get_new_block(const struct nilfs_bmap *btree, + struct buffer_head *bh; + + bh = nilfs_btnode_create_block(btnc, ptr); +- if (!bh) +- return -ENOMEM; ++ if (IS_ERR(bh)) ++ return PTR_ERR(bh); + + set_buffer_nilfs_volatile(bh); + *bhp = bh; +diff --git a/fs/nilfs2/segment.c b/fs/nilfs2/segment.c +index 440e628f9d4fc4..c90435e8e74890 100644 +--- a/fs/nilfs2/segment.c ++++ b/fs/nilfs2/segment.c +@@ -136,7 +136,7 @@ static void nilfs_dispose_list(struct the_nilfs *, struct list_head *, int); + + #define nilfs_cnt32_ge(a, b) \ + (typecheck(__u32, a) && typecheck(__u32, b) && \ +- ((__s32)(a) - (__s32)(b) >= 0)) ++ ((__s32)((a) - (b)) >= 0)) + + static int nilfs_prepare_segment_lock(struct super_block *sb, + struct nilfs_transaction_info *ti) +diff --git a/fs/ntfs3/attrib.c b/fs/ntfs3/attrib.c +index 64a6d255c4686f..83c15c70f59453 100644 +--- a/fs/ntfs3/attrib.c ++++ b/fs/ntfs3/attrib.c +@@ -242,7 +242,7 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr, + struct ntfs_sb_info *sbi; + struct ATTRIB *attr_s; + struct MFT_REC *rec; +- u32 used, asize, rsize, aoff, align; ++ u32 used, asize, rsize, aoff; + bool is_data; + CLST len, alen; + char *next; +@@ -263,10 +263,13 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr, + rsize = le32_to_cpu(attr->res.data_size); + is_data = attr->type == ATTR_DATA && !attr->name_len; + +- align = sbi->cluster_size; +- if (is_attr_compressed(attr)) +- align <<= COMPRESSION_UNIT; +- len = (rsize + align - 1) >> sbi->cluster_bits; ++ /* len - how many clusters required to store 'rsize' bytes */ ++ if (is_attr_compressed(attr)) { ++ u8 shift = sbi->cluster_bits + NTFS_LZNT_CUNIT; ++ len = ((rsize + (1u << shift) - 1) >> shift) << NTFS_LZNT_CUNIT; ++ } else { ++ len = bytes_to_cluster(sbi, rsize); ++ } + + run_init(run); + +@@ -1562,6 +1565,7 @@ int attr_allocate_frame(struct ntfs_inode *ni, CLST frame, size_t compr_size, + + attr_b->nres.total_size = cpu_to_le64(total_size); + inode_set_bytes(&ni->vfs_inode, total_size); ++ ni->ni_flags |= NI_FLAG_UPDATE_PARENT; + + mi_b->dirty = true; + mark_inode_dirty(&ni->vfs_inode); +diff --git a/fs/ntfs3/bitmap.c b/fs/ntfs3/bitmap.c +index 21536b72aa5e57..95589a496f0ff8 100644 +--- a/fs/ntfs3/bitmap.c ++++ b/fs/ntfs3/bitmap.c +@@ -1363,7 +1363,7 @@ int wnd_extend(struct wnd_bitmap *wnd, size_t new_bits) + + err = ntfs_vbo_to_lbo(sbi, &wnd->run, vbo, &lbo, &bytes); + if (err) +- break; ++ return err; + + bh = ntfs_bread(sb, lbo >> sb->s_blocksize_bits); + if (!bh) +diff --git a/fs/ntfs3/dir.c b/fs/ntfs3/dir.c +index 98f57d0c702eba..dcd689ed4baae1 100644 +--- a/fs/ntfs3/dir.c ++++ b/fs/ntfs3/dir.c +@@ -326,7 +326,8 @@ static inline int ntfs_filldir(struct ntfs_sb_info *sbi, struct ntfs_inode *ni, + * It does additional locks/reads just to get the type of name. + * Should we use additional mount option to enable branch below? + */ +- if ((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) && ++ if (((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) || ++ fname->dup.ea_size) && + ino != ni->mi.rno) { + struct inode *inode = ntfs_iget5(sbi->sb, &e->ref, NULL); + if (!IS_ERR_OR_NULL(inode)) { +diff --git a/fs/ntfs3/file.c b/fs/ntfs3/file.c +index 6d4f3431bc75ac..af7e138064624f 100644 +--- a/fs/ntfs3/file.c ++++ b/fs/ntfs3/file.c +@@ -398,10 +398,7 @@ static int ntfs_file_mmap(struct file *file, struct vm_area_struct *vma) + } + + if (ni->i_valid < to) { +- if (!inode_trylock(inode)) { +- err = -EAGAIN; +- goto out; +- } ++ inode_lock(inode); + err = ntfs_extend_initialized_size(file, ni, + ni->i_valid, to); + inode_unlock(inode); +diff --git a/fs/ntfs3/frecord.c b/fs/ntfs3/frecord.c +index b02778cbb1d34e..da21a044d3f869 100644 +--- a/fs/ntfs3/frecord.c ++++ b/fs/ntfs3/frecord.c +@@ -1453,7 +1453,7 @@ int ni_insert_nonresident(struct ntfs_inode *ni, enum ATTR_TYPE type, + + if (is_ext) { + if (flags & ATTR_FLAG_COMPRESSED) +- attr->nres.c_unit = COMPRESSION_UNIT; ++ attr->nres.c_unit = NTFS_LZNT_CUNIT; + attr->nres.total_size = attr->nres.alloc_size; + } + +diff --git a/fs/ntfs3/fslog.c b/fs/ntfs3/fslog.c +index 8ac677e3b250c9..ba4dc7385b4467 100644 +--- a/fs/ntfs3/fslog.c ++++ b/fs/ntfs3/fslog.c +@@ -2999,7 +2999,7 @@ static struct ATTRIB *attr_create_nonres_log(struct ntfs_sb_info *sbi, + if (is_ext) { + attr->name_off = SIZEOF_NONRESIDENT_EX_LE; + if (is_attr_compressed(attr)) +- attr->nres.c_unit = COMPRESSION_UNIT; ++ attr->nres.c_unit = NTFS_LZNT_CUNIT; + + attr->nres.run_off = + cpu_to_le16(SIZEOF_NONRESIDENT_EX + name_size); +@@ -3935,6 +3935,9 @@ int log_replay(struct ntfs_inode *ni, bool *initialized) + goto out; + } + ++ log->page_mask = log->page_size - 1; ++ log->page_bits = blksize_bits(log->page_size); ++ + /* If the file size has shrunk then we won't mount it. */ + if (l_size < le64_to_cpu(ra2->l_size)) { + err = -EINVAL; +diff --git a/fs/ntfs3/fsntfs.c b/fs/ntfs3/fsntfs.c +index 1b082b7a67ee24..4bd3e6718ee65e 100644 +--- a/fs/ntfs3/fsntfs.c ++++ b/fs/ntfs3/fsntfs.c +@@ -475,7 +475,7 @@ static int ntfs_extend_mft(struct ntfs_sb_info *sbi) + struct ATTRIB *attr; + struct wnd_bitmap *wnd = &sbi->mft.bitmap; + +- new_mft_total = (wnd->nbits + MFT_INCREASE_CHUNK + 127) & (CLST)~127; ++ new_mft_total = ALIGN(wnd->nbits + NTFS_MFT_INCREASE_STEP, 128); + new_mft_bytes = (u64)new_mft_total << sbi->record_bits; + + /* Step 1: Resize $MFT::DATA. */ +diff --git a/fs/ntfs3/index.c b/fs/ntfs3/index.c +index a069ae7a748efc..13f492d0d971fb 100644 +--- a/fs/ntfs3/index.c ++++ b/fs/ntfs3/index.c +@@ -979,7 +979,7 @@ static struct indx_node *indx_new(struct ntfs_index *indx, + hdr->used = + cpu_to_le32(eo + sizeof(struct NTFS_DE) + sizeof(u64)); + de_set_vbn_le(e, *sub_vbn); +- hdr->flags = 1; ++ hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES; + } else { + e->size = cpu_to_le16(sizeof(struct NTFS_DE)); + hdr->used = cpu_to_le32(eo + sizeof(struct NTFS_DE)); +@@ -1684,7 +1684,7 @@ static int indx_insert_into_root(struct ntfs_index *indx, struct ntfs_inode *ni, + e->size = cpu_to_le16(sizeof(struct NTFS_DE) + sizeof(u64)); + e->flags = NTFS_IE_HAS_SUBNODES | NTFS_IE_LAST; + +- hdr->flags = 1; ++ hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES; + hdr->used = hdr->total = + cpu_to_le32(new_root_size - offsetof(struct INDEX_ROOT, ihdr)); + +diff --git a/fs/ntfs3/inode.c b/fs/ntfs3/inode.c +index ff45ad967fb823..7adfa19a2f0672 100644 +--- a/fs/ntfs3/inode.c ++++ b/fs/ntfs3/inode.c +@@ -1465,7 +1465,7 @@ struct inode *ntfs_create_inode(struct user_namespace *mnt_userns, + attr->size = cpu_to_le32(SIZEOF_NONRESIDENT_EX + 8); + attr->name_off = SIZEOF_NONRESIDENT_EX_LE; + attr->flags = ATTR_FLAG_COMPRESSED; +- attr->nres.c_unit = COMPRESSION_UNIT; ++ attr->nres.c_unit = NTFS_LZNT_CUNIT; + asize = SIZEOF_NONRESIDENT_EX + 8; + } else { + attr->size = cpu_to_le32(SIZEOF_NONRESIDENT + 8); +diff --git a/fs/ntfs3/ntfs.h b/fs/ntfs3/ntfs.h +index 324c0b036fdc1c..625f2b52bd5860 100644 +--- a/fs/ntfs3/ntfs.h ++++ b/fs/ntfs3/ntfs.h +@@ -82,10 +82,6 @@ typedef u32 CLST; + #define RESIDENT_LCN ((CLST)-2) + #define COMPRESSED_LCN ((CLST)-3) + +-#define COMPRESSION_UNIT 4 +-#define COMPRESS_MAX_CLUSTER 0x1000 +-#define MFT_INCREASE_CHUNK 1024 +- + enum RECORD_NUM { + MFT_REC_MFT = 0, + MFT_REC_MIRR = 1, +@@ -690,14 +686,15 @@ static inline bool de_has_vcn_ex(const struct NTFS_DE *e) + offsetof(struct ATTR_FILE_NAME, name) + \ + NTFS_NAME_LEN * sizeof(short), 8) + ++#define NTFS_INDEX_HDR_HAS_SUBNODES cpu_to_le32(1) ++ + struct INDEX_HDR { + __le32 de_off; // 0x00: The offset from the start of this structure + // to the first NTFS_DE. + __le32 used; // 0x04: The size of this structure plus all + // entries (quad-word aligned). + __le32 total; // 0x08: The allocated size of for this structure plus all entries. +- u8 flags; // 0x0C: 0x00 = Small directory, 0x01 = Large directory. +- u8 res[3]; ++ __le32 flags; // 0x0C: 0x00 = Small directory, 0x01 = Large directory. + + // + // de_off + used <= total +@@ -744,7 +741,7 @@ static inline struct NTFS_DE *hdr_next_de(const struct INDEX_HDR *hdr, + + static inline bool hdr_has_subnode(const struct INDEX_HDR *hdr) + { +- return hdr->flags & 1; ++ return hdr->flags & NTFS_INDEX_HDR_HAS_SUBNODES; + } + + struct INDEX_BUFFER { +@@ -764,7 +761,7 @@ static inline bool ib_is_empty(const struct INDEX_BUFFER *ib) + + static inline bool ib_is_leaf(const struct INDEX_BUFFER *ib) + { +- return !(ib->ihdr.flags & 1); ++ return !(ib->ihdr.flags & NTFS_INDEX_HDR_HAS_SUBNODES); + } + + /* Index root structure ( 0x90 ). */ +diff --git a/fs/ntfs3/ntfs_fs.h b/fs/ntfs3/ntfs_fs.h +index 12a3b41d351c91..e67bef4018079d 100644 +--- a/fs/ntfs3/ntfs_fs.h ++++ b/fs/ntfs3/ntfs_fs.h +@@ -198,6 +198,8 @@ struct ntfs_index { + + /* Minimum MFT zone. */ + #define NTFS_MIN_MFT_ZONE 100 ++/* Step to increase the MFT. */ ++#define NTFS_MFT_INCREASE_STEP 1024 + + /* Ntfs file system in-core superblock data. */ + struct ntfs_sb_info { +diff --git a/fs/proc/proc_sysctl.c b/fs/proc/proc_sysctl.c +index 4192fe6ec3da29..213ea008fe2db6 100644 +--- a/fs/proc/proc_sysctl.c ++++ b/fs/proc/proc_sysctl.c +@@ -466,12 +466,10 @@ static struct inode *proc_sys_make_inode(struct super_block *sb, + make_empty_dir_inode(inode); + } + ++ inode->i_uid = GLOBAL_ROOT_UID; ++ inode->i_gid = GLOBAL_ROOT_GID; + if (root->set_ownership) + root->set_ownership(head, table, &inode->i_uid, &inode->i_gid); +- else { +- inode->i_uid = GLOBAL_ROOT_UID; +- inode->i_gid = GLOBAL_ROOT_GID; +- } + + return inode; + } +diff --git a/fs/proc/task_mmu.c b/fs/proc/task_mmu.c +index 705a41f4d6b362..b255e3dfded14f 100644 +--- a/fs/proc/task_mmu.c ++++ b/fs/proc/task_mmu.c +@@ -1471,6 +1471,8 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end, + } + #endif + ++ if (page && !PageAnon(page)) ++ flags |= PM_FILE; + if (page && !migration && page_mapcount(page) == 1) + flags |= PM_MMAP_EXCLUSIVE; + +diff --git a/fs/super.c b/fs/super.c +index 048576b19af633..39d866f7d7c6be 100644 +--- a/fs/super.c ++++ b/fs/super.c +@@ -528,6 +528,17 @@ struct super_block *sget_fc(struct fs_context *fc, + struct user_namespace *user_ns = fc->global ? &init_user_ns : fc->user_ns; + int err; + ++ /* ++ * Never allow s_user_ns != &init_user_ns when FS_USERNS_MOUNT is ++ * not set, as the filesystem is likely unprepared to handle it. ++ * This can happen when fsconfig() is called from init_user_ns with ++ * an fs_fd opened in another user namespace. ++ */ ++ if (user_ns != &init_user_ns && !(fc->fs_type->fs_flags & FS_USERNS_MOUNT)) { ++ errorfc(fc, "VFS: Mounting from non-initial user namespace is not allowed"); ++ return ERR_PTR(-EPERM); ++ } ++ + retry: + spin_lock(&sb_lock); + if (test) { +diff --git a/fs/udf/balloc.c b/fs/udf/balloc.c +index f416b7fe092fcc..aa73ab1b50a529 100644 +--- a/fs/udf/balloc.c ++++ b/fs/udf/balloc.c +@@ -22,6 +22,7 @@ + #include "udfdecl.h" + + #include <linux/bitops.h> ++#include <linux/overflow.h> + + #include "udf_i.h" + #include "udf_sb.h" +@@ -68,8 +69,12 @@ static int read_block_bitmap(struct super_block *sb, + } + + for (i = 0; i < count; i++) +- if (udf_test_bit(i + off, bh->b_data)) ++ if (udf_test_bit(i + off, bh->b_data)) { ++ bitmap->s_block_bitmap[bitmap_nr] = ++ ERR_PTR(-EFSCORRUPTED); ++ brelse(bh); + return -EFSCORRUPTED; ++ } + return 0; + } + +@@ -85,8 +90,15 @@ static int __load_block_bitmap(struct super_block *sb, + block_group, nr_groups); + } + +- if (bitmap->s_block_bitmap[block_group]) ++ if (bitmap->s_block_bitmap[block_group]) { ++ /* ++ * The bitmap failed verification in the past. No point in ++ * trying again. ++ */ ++ if (IS_ERR(bitmap->s_block_bitmap[block_group])) ++ return PTR_ERR(bitmap->s_block_bitmap[block_group]); + return block_group; ++ } + + retval = read_block_bitmap(sb, bitmap, block_group, block_group); + if (retval < 0) +@@ -133,7 +145,6 @@ static void udf_bitmap_free_blocks(struct super_block *sb, + { + struct udf_sb_info *sbi = UDF_SB(sb); + struct buffer_head *bh = NULL; +- struct udf_part_map *partmap; + unsigned long block; + unsigned long block_group; + unsigned long bit; +@@ -142,19 +153,9 @@ static void udf_bitmap_free_blocks(struct super_block *sb, + unsigned long overflow; + + mutex_lock(&sbi->s_alloc_mutex); +- partmap = &sbi->s_partmaps[bloc->partitionReferenceNum]; +- if (bloc->logicalBlockNum + count < count || +- (bloc->logicalBlockNum + count) > partmap->s_partition_len) { +- udf_debug("%u < %d || %u + %u > %u\n", +- bloc->logicalBlockNum, 0, +- bloc->logicalBlockNum, count, +- partmap->s_partition_len); +- goto error_return; +- } +- ++ /* We make sure this cannot overflow when mounting the filesystem */ + block = bloc->logicalBlockNum + offset + + (sizeof(struct spaceBitmapDesc) << 3); +- + do { + overflow = 0; + block_group = block >> (sb->s_blocksize_bits + 3); +@@ -384,7 +385,6 @@ static void udf_table_free_blocks(struct super_block *sb, + uint32_t count) + { + struct udf_sb_info *sbi = UDF_SB(sb); +- struct udf_part_map *partmap; + uint32_t start, end; + uint32_t elen; + struct kernel_lb_addr eloc; +@@ -393,16 +393,6 @@ static void udf_table_free_blocks(struct super_block *sb, + struct udf_inode_info *iinfo; + + mutex_lock(&sbi->s_alloc_mutex); +- partmap = &sbi->s_partmaps[bloc->partitionReferenceNum]; +- if (bloc->logicalBlockNum + count < count || +- (bloc->logicalBlockNum + count) > partmap->s_partition_len) { +- udf_debug("%u < %d || %u + %u > %u\n", +- bloc->logicalBlockNum, 0, +- bloc->logicalBlockNum, count, +- partmap->s_partition_len); +- goto error_return; +- } +- + iinfo = UDF_I(table); + udf_add_free_space(sb, sbi->s_partition, count); + +@@ -677,6 +667,17 @@ void udf_free_blocks(struct super_block *sb, struct inode *inode, + { + uint16_t partition = bloc->partitionReferenceNum; + struct udf_part_map *map = &UDF_SB(sb)->s_partmaps[partition]; ++ uint32_t blk; ++ ++ if (check_add_overflow(bloc->logicalBlockNum, offset, &blk) || ++ check_add_overflow(blk, count, &blk) || ++ bloc->logicalBlockNum + count > map->s_partition_len) { ++ udf_debug("Invalid request to free blocks: (%d, %u), off %u, " ++ "len %u, partition len %u\n", ++ partition, bloc->logicalBlockNum, offset, count, ++ map->s_partition_len); ++ return; ++ } + + if (map->s_partition_flags & UDF_PART_FLAG_UNALLOC_BITMAP) { + udf_bitmap_free_blocks(sb, map->s_uspace.s_bitmap, +diff --git a/fs/udf/super.c b/fs/udf/super.c +index 6b85c66722d3ab..e2f3d2b6c245d0 100644 +--- a/fs/udf/super.c ++++ b/fs/udf/super.c +@@ -266,7 +266,8 @@ static void udf_sb_free_bitmap(struct udf_bitmap *bitmap) + int nr_groups = bitmap->s_nr_groups; + + for (i = 0; i < nr_groups; i++) +- brelse(bitmap->s_block_bitmap[i]); ++ if (!IS_ERR_OR_NULL(bitmap->s_block_bitmap[i])) ++ brelse(bitmap->s_block_bitmap[i]); + + kvfree(bitmap); + } +diff --git a/fs/xfs/xfs_log_recover.c b/fs/xfs/xfs_log_recover.c +index 3d844a250b710b..705cd5a60fbc93 100644 +--- a/fs/xfs/xfs_log_recover.c ++++ b/fs/xfs/xfs_log_recover.c +@@ -2972,7 +2972,7 @@ xlog_do_recovery_pass( + int error = 0, h_size, h_len; + int error2 = 0; + int bblks, split_bblks; +- int hblks, split_hblks, wrapped_hblks; ++ int hblks = 1, split_hblks, wrapped_hblks; + int i; + struct hlist_head rhash[XLOG_RHASH_SIZE]; + LIST_HEAD (buffer_list); +@@ -3028,14 +3028,22 @@ xlog_do_recovery_pass( + if (error) + goto bread_err1; + +- hblks = xlog_logrec_hblks(log, rhead); +- if (hblks != 1) { +- kmem_free(hbp); +- hbp = xlog_alloc_buffer(log, hblks); ++ /* ++ * This open codes xlog_logrec_hblks so that we can reuse the ++ * fixed up h_size value calculated above. Without that we'd ++ * still allocate the buffer based on the incorrect on-disk ++ * size. ++ */ ++ if (h_size > XLOG_HEADER_CYCLE_SIZE && ++ (rhead->h_version & cpu_to_be32(XLOG_VERSION_2))) { ++ hblks = DIV_ROUND_UP(h_size, XLOG_HEADER_CYCLE_SIZE); ++ if (hblks > 1) { ++ kmem_free(hbp); ++ hbp = xlog_alloc_buffer(log, hblks); ++ } + } + } else { + ASSERT(log->l_sectBBsize == 1); +- hblks = 1; + hbp = xlog_alloc_buffer(log, 1); + h_size = XLOG_BIG_RECORD_BSIZE; + } +diff --git a/include/asm-generic/vmlinux.lds.h b/include/asm-generic/vmlinux.lds.h +index dd9ea351bc02ef..4132a76a3e2e40 100644 +--- a/include/asm-generic/vmlinux.lds.h ++++ b/include/asm-generic/vmlinux.lds.h +@@ -101,7 +101,7 @@ + #define DATA_MAIN .data .data.[0-9a-zA-Z_]* .data..L* .data..compoundliteral* .data.$__unnamed_* .data.$L* + #define SDATA_MAIN .sdata .sdata.[0-9a-zA-Z_]* + #define RODATA_MAIN .rodata .rodata.[0-9a-zA-Z_]* .rodata..L* +-#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..compoundliteral* ++#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..L* .bss..compoundliteral* + #define SBSS_MAIN .sbss .sbss.[0-9a-zA-Z_]* + #else + #define TEXT_MAIN .text +diff --git a/include/linux/clocksource.h b/include/linux/clocksource.h +index 1d42d4b1732717..0ad8b550bb4b46 100644 +--- a/include/linux/clocksource.h ++++ b/include/linux/clocksource.h +@@ -291,7 +291,19 @@ static inline void timer_probe(void) {} + #define TIMER_ACPI_DECLARE(name, table_id, fn) \ + ACPI_DECLARE_PROBE_ENTRY(timer, name, table_id, 0, NULL, 0, fn) + +-extern ulong max_cswd_read_retries; ++static inline unsigned int clocksource_get_max_watchdog_retry(void) ++{ ++ /* ++ * When system is in the boot phase or under heavy workload, there ++ * can be random big latencies during the clocksource/watchdog ++ * read, so allow retries to filter the noise latency. As the ++ * latency's frequency and maximum value goes up with the number of ++ * CPUs, scale the number of retries with the number of online ++ * CPUs. ++ */ ++ return (ilog2(num_online_cpus()) / 2) + 1; ++} ++ + void clocksource_verify_percpu(struct clocksource *cs); + + #endif /* _LINUX_CLOCKSOURCE_H */ +diff --git a/include/linux/hugetlb.h b/include/linux/hugetlb.h +index 4ede8df5818e1d..f96f10957a986e 100644 +--- a/include/linux/hugetlb.h ++++ b/include/linux/hugetlb.h +@@ -600,6 +600,7 @@ HPAGEFLAG(VmemmapOptimized, vmemmap_optimized) + /* Defines one hugetlb page size */ + struct hstate { + struct mutex resize_lock; ++ struct lock_class_key resize_key; + int next_nid_to_alloc; + int next_nid_to_free; + unsigned int order; +diff --git a/include/linux/irq.h b/include/linux/irq.h +index f9e6449fbbbaec..4fd8d900a1b867 100644 +--- a/include/linux/irq.h ++++ b/include/linux/irq.h +@@ -709,10 +709,11 @@ extern struct irq_chip no_irq_chip; + extern struct irq_chip dummy_irq_chip; + + extern void +-irq_set_chip_and_handler_name(unsigned int irq, struct irq_chip *chip, ++irq_set_chip_and_handler_name(unsigned int irq, const struct irq_chip *chip, + irq_flow_handler_t handle, const char *name); + +-static inline void irq_set_chip_and_handler(unsigned int irq, struct irq_chip *chip, ++static inline void irq_set_chip_and_handler(unsigned int irq, ++ const struct irq_chip *chip, + irq_flow_handler_t handle) + { + irq_set_chip_and_handler_name(irq, chip, handle, NULL); +@@ -802,7 +803,7 @@ static inline void irq_set_percpu_devid_flags(unsigned int irq) + } + + /* Set/get chip/data for an IRQ: */ +-extern int irq_set_chip(unsigned int irq, struct irq_chip *chip); ++extern int irq_set_chip(unsigned int irq, const struct irq_chip *chip); + extern int irq_set_handler_data(unsigned int irq, void *data); + extern int irq_set_chip_data(unsigned int irq, void *data); + extern int irq_set_irq_type(unsigned int irq, unsigned int type); +diff --git a/include/linux/irqdomain.h b/include/linux/irqdomain.h +index 9ee238ad29ce91..a7c80bd4b45b60 100644 +--- a/include/linux/irqdomain.h ++++ b/include/linux/irqdomain.h +@@ -147,6 +147,8 @@ struct irq_domain_chip_generic; + * @gc: Pointer to a list of generic chips. There is a helper function for + * setting up one or more generic chips for interrupt controllers + * drivers using the generic chip library which uses this pointer. ++ * @dev: Pointer to a device that the domain represent, and that will be ++ * used for power management purposes. + * @parent: Pointer to parent irq_domain to support hierarchy irq_domains + * + * Revmap data, used internally by irq_domain +@@ -167,6 +169,7 @@ struct irq_domain { + struct fwnode_handle *fwnode; + enum irq_domain_bus_token bus_token; + struct irq_domain_chip_generic *gc; ++ struct device *dev; + #ifdef CONFIG_IRQ_DOMAIN_HIERARCHY + struct irq_domain *parent; + #endif +@@ -222,6 +225,13 @@ static inline struct device_node *irq_domain_get_of_node(struct irq_domain *d) + return to_of_node(d->fwnode); + } + ++static inline void irq_domain_set_pm_device(struct irq_domain *d, ++ struct device *dev) ++{ ++ if (d) ++ d->dev = dev; ++} ++ + #ifdef CONFIG_IRQ_DOMAIN + struct fwnode_handle *__irq_domain_alloc_fwnode(unsigned int type, int id, + const char *name, phys_addr_t *pa); +diff --git a/include/linux/jbd2.h b/include/linux/jbd2.h +index d19f527ade3bbb..5377df8c854534 100644 +--- a/include/linux/jbd2.h ++++ b/include/linux/jbd2.h +@@ -1669,11 +1669,6 @@ int jbd2_wait_inode_data(journal_t *journal, struct jbd2_inode *jinode); + int jbd2_fc_wait_bufs(journal_t *journal, int num_blks); + int jbd2_fc_release_bufs(journal_t *journal); + +-static inline int jbd2_journal_get_max_txn_bufs(journal_t *journal) +-{ +- return (journal->j_total_len - journal->j_fc_wbufsize) / 4; +-} +- + /* + * is_journal_abort + * +diff --git a/include/linux/leds.h b/include/linux/leds.h +index a0b730be40ad2f..79ab2dfd3c72f1 100644 +--- a/include/linux/leds.h ++++ b/include/linux/leds.h +@@ -356,11 +356,14 @@ struct led_trigger { + int (*activate)(struct led_classdev *led_cdev); + void (*deactivate)(struct led_classdev *led_cdev); + ++ /* Brightness set by led_trigger_event */ ++ enum led_brightness brightness; ++ + /* LED-private triggers have this set */ + struct led_hw_trigger_type *trigger_type; + + /* LEDs under control by this trigger (for simple triggers) */ +- rwlock_t leddev_list_lock; ++ spinlock_t leddev_list_lock; + struct list_head led_cdevs; + + /* Link to next registered trigger */ +@@ -409,22 +412,11 @@ static inline void *led_get_trigger_data(struct led_classdev *led_cdev) + return led_cdev->trigger_data; + } + +-/** +- * led_trigger_rename_static - rename a trigger +- * @name: the new trigger name +- * @trig: the LED trigger to rename +- * +- * Change a LED trigger name by copying the string passed in +- * name into current trigger name, which MUST be large +- * enough for the new string. +- * +- * Note that name must NOT point to the same string used +- * during LED registration, as that could lead to races. +- * +- * This is meant to be used on triggers with statically +- * allocated name. +- */ +-void led_trigger_rename_static(const char *name, struct led_trigger *trig); ++static inline enum led_brightness ++led_trigger_get_brightness(const struct led_trigger *trigger) ++{ ++ return trigger ? trigger->brightness : LED_OFF; ++} + + #define module_led_trigger(__led_trigger) \ + module_driver(__led_trigger, led_trigger_register, \ +@@ -462,6 +454,12 @@ static inline void *led_get_trigger_data(struct led_classdev *led_cdev) + return NULL; + } + ++static inline enum led_brightness ++led_trigger_get_brightness(const struct led_trigger *trigger) ++{ ++ return LED_OFF; ++} ++ + #endif /* CONFIG_LEDS_TRIGGERS */ + + /* Trigger specific functions */ +diff --git a/include/linux/objagg.h b/include/linux/objagg.h +index 78021777df4626..6df5b887dc547c 100644 +--- a/include/linux/objagg.h ++++ b/include/linux/objagg.h +@@ -8,7 +8,6 @@ struct objagg_ops { + size_t obj_size; + bool (*delta_check)(void *priv, const void *parent_obj, + const void *obj); +- int (*hints_obj_cmp)(const void *obj1, const void *obj2); + void * (*delta_create)(void *priv, void *parent_obj, void *obj); + void (*delta_destroy)(void *priv, void *delta_priv); + void * (*root_create)(void *priv, void *obj, unsigned int root_id); +diff --git a/include/linux/pci_ids.h b/include/linux/pci_ids.h +index 2590ccda29ab99..66e95df2e6867b 100644 +--- a/include/linux/pci_ids.h ++++ b/include/linux/pci_ids.h +@@ -2113,6 +2113,8 @@ + + #define PCI_VENDOR_ID_CHELSIO 0x1425 + ++#define PCI_VENDOR_ID_EDIMAX 0x1432 ++ + #define PCI_VENDOR_ID_ADLINK 0x144a + + #define PCI_VENDOR_ID_SAMSUNG 0x144d +diff --git a/include/linux/perf_event.h b/include/linux/perf_event.h +index 200995c5210eab..7cc581e0ee69df 100644 +--- a/include/linux/perf_event.h ++++ b/include/linux/perf_event.h +@@ -732,6 +732,7 @@ struct perf_event { + struct irq_work pending_irq; + struct callback_head pending_task; + unsigned int pending_work; ++ struct rcuwait pending_work_wait; + + atomic_t event_limit; + +diff --git a/include/linux/profile.h b/include/linux/profile.h +index fd18ca96f55740..c5cb3155597e03 100644 +--- a/include/linux/profile.h ++++ b/include/linux/profile.h +@@ -11,7 +11,6 @@ + + #define CPU_PROFILING 1 + #define SCHED_PROFILING 2 +-#define SLEEP_PROFILING 3 + #define KVM_PROFILING 4 + + struct proc_dir_entry; +diff --git a/include/linux/sched/signal.h b/include/linux/sched/signal.h +index 9743f7d173a0bc..13c95782c063f7 100644 +--- a/include/linux/sched/signal.h ++++ b/include/linux/sched/signal.h +@@ -347,6 +347,12 @@ extern void sigqueue_free(struct sigqueue *); + extern int send_sigqueue(struct sigqueue *, struct pid *, enum pid_type); + extern int do_sigaction(int, struct k_sigaction *, struct k_sigaction *); + ++static inline void clear_notify_signal(void) ++{ ++ clear_thread_flag(TIF_NOTIFY_SIGNAL); ++ smp_mb__after_atomic(); ++} ++ + static inline int restart_syscall(void) + { + set_tsk_thread_flag(current, TIF_SIGPENDING); +diff --git a/include/linux/task_work.h b/include/linux/task_work.h +index 5b8a93f288bb4d..ad943231362709 100644 +--- a/include/linux/task_work.h ++++ b/include/linux/task_work.h +@@ -24,7 +24,8 @@ int task_work_add(struct task_struct *task, struct callback_head *twork, + + struct callback_head *task_work_cancel_match(struct task_struct *task, + bool (*match)(struct callback_head *, void *data), void *data); +-struct callback_head *task_work_cancel(struct task_struct *, task_work_func_t); ++struct callback_head *task_work_cancel_func(struct task_struct *, task_work_func_t); ++bool task_work_cancel(struct task_struct *task, struct callback_head *cb); + void task_work_run(void); + + static inline void exit_task_work(struct task_struct *task) +diff --git a/include/linux/trace_events.h b/include/linux/trace_events.h +index 511c43ce94213d..d5618d96ade677 100644 +--- a/include/linux/trace_events.h ++++ b/include/linux/trace_events.h +@@ -828,7 +828,6 @@ do { \ + struct perf_event; + + DECLARE_PER_CPU(struct pt_regs, perf_trace_regs); +-DECLARE_PER_CPU(int, bpf_kprobe_override); + + extern int perf_trace_init(struct perf_event *event); + extern void perf_trace_destroy(struct perf_event *event); +diff --git a/include/linux/virtio_net.h b/include/linux/virtio_net.h +index 6047058d67037b..29b19d0a324c79 100644 +--- a/include/linux/virtio_net.h ++++ b/include/linux/virtio_net.h +@@ -51,6 +51,7 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb, + unsigned int thlen = 0; + unsigned int p_off = 0; + unsigned int ip_proto; ++ u64 ret, remainder, gso_size; + + if (hdr->gso_type != VIRTIO_NET_HDR_GSO_NONE) { + switch (hdr->gso_type & ~VIRTIO_NET_HDR_GSO_ECN) { +@@ -87,6 +88,16 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb, + u32 off = __virtio16_to_cpu(little_endian, hdr->csum_offset); + u32 needed = start + max_t(u32, thlen, off + sizeof(__sum16)); + ++ if (hdr->gso_size) { ++ gso_size = __virtio16_to_cpu(little_endian, hdr->gso_size); ++ ret = div64_u64_rem(skb->len, gso_size, &remainder); ++ if (!(ret && (hdr->gso_size > needed) && ++ ((remainder > needed) || (remainder == 0)))) { ++ return -EINVAL; ++ } ++ skb_shinfo(skb)->tx_flags |= SKBFL_SHARED_FRAG; ++ } ++ + if (!pskb_may_pull(skb, needed)) + return -EINVAL; + +diff --git a/include/net/netfilter/nf_tables.h b/include/net/netfilter/nf_tables.h +index 3ff6b3362800be..3e92331d8c9a02 100644 +--- a/include/net/netfilter/nf_tables.h ++++ b/include/net/netfilter/nf_tables.h +@@ -374,7 +374,7 @@ static inline void *nft_expr_priv(const struct nft_expr *expr) + return (void *)expr->data; + } + +-int nft_expr_clone(struct nft_expr *dst, struct nft_expr *src); ++int nft_expr_clone(struct nft_expr *dst, struct nft_expr *src, gfp_t gfp); + void nft_expr_destroy(const struct nft_ctx *ctx, struct nft_expr *expr); + int nft_expr_dump(struct sk_buff *skb, unsigned int attr, + const struct nft_expr *expr); +@@ -772,10 +772,16 @@ static inline struct nft_set_elem_expr *nft_set_ext_expr(const struct nft_set_ex + return nft_set_ext(ext, NFT_SET_EXT_EXPRESSIONS); + } + +-static inline bool nft_set_elem_expired(const struct nft_set_ext *ext) ++static inline bool __nft_set_elem_expired(const struct nft_set_ext *ext, ++ u64 tstamp) + { + return nft_set_ext_exists(ext, NFT_SET_EXT_EXPIRATION) && +- time_is_before_eq_jiffies64(*nft_set_ext_expiration(ext)); ++ time_after_eq64(tstamp, *nft_set_ext_expiration(ext)); ++} ++ ++static inline bool nft_set_elem_expired(const struct nft_set_ext *ext) ++{ ++ return __nft_set_elem_expired(ext, get_jiffies_64()); + } + + static inline struct nft_set_ext *nft_set_elem_ext(const struct nft_set *set, +@@ -866,7 +872,7 @@ struct nft_expr_ops { + struct nft_regs *regs, + const struct nft_pktinfo *pkt); + int (*clone)(struct nft_expr *dst, +- const struct nft_expr *src); ++ const struct nft_expr *src, gfp_t gfp); + unsigned int size; + + int (*init)(const struct nft_ctx *ctx, +@@ -1679,6 +1685,7 @@ struct nftables_pernet { + struct list_head notify_list; + struct mutex commit_mutex; + u64 table_handle; ++ u64 tstamp; + unsigned int base_seq; + u8 validate_state; + unsigned int gc_seq; +@@ -1691,4 +1698,9 @@ static inline struct nftables_pernet *nft_pernet(const struct net *net) + return net_generic(net, nf_tables_net_id); + } + ++static inline u64 nft_net_tstamp(const struct net *net) ++{ ++ return nft_pernet(net)->tstamp; ++} ++ + #endif /* _NET_NF_TABLES_H */ +diff --git a/include/net/sctp/sctp.h b/include/net/sctp/sctp.h +index 3ae61ce2eabd01..bf3716fe83e07a 100644 +--- a/include/net/sctp/sctp.h ++++ b/include/net/sctp/sctp.h +@@ -509,8 +509,8 @@ static inline int sctp_ep_hashfn(struct net *net, __u16 lport) + return (net_hash_mix(net) + lport) & (sctp_ep_hashsize - 1); + } + +-#define sctp_for_each_hentry(epb, head) \ +- hlist_for_each_entry(epb, head, node) ++#define sctp_for_each_hentry(ep, head) \ ++ hlist_for_each_entry(ep, head, node) + + /* Is a socket of this style? */ + #define sctp_style(sk, style) __sctp_style((sk), (SCTP_SOCKET_##style)) +diff --git a/include/net/sctp/structs.h b/include/net/sctp/structs.h +index 790252c1478b0d..821b20a0f88295 100644 +--- a/include/net/sctp/structs.h ++++ b/include/net/sctp/structs.h +@@ -1244,10 +1244,6 @@ enum sctp_endpoint_type { + */ + + struct sctp_ep_common { +- /* Fields to help us manage our entries in the hash tables. */ +- struct hlist_node node; +- int hashent; +- + /* Runtime type information. What kind of endpoint is this? */ + enum sctp_endpoint_type type; + +@@ -1299,6 +1295,10 @@ struct sctp_endpoint { + /* Common substructure for endpoint and association. */ + struct sctp_ep_common base; + ++ /* Fields to help us manage our entries in the hash tables. */ ++ struct hlist_node node; ++ int hashent; ++ + /* Associations: A list of current associations and mappings + * to the data consumers for each association. This + * may be in the form of a hash table or other +diff --git a/include/net/tcp.h b/include/net/tcp.h +index 30f8111f750b5b..061e15a1ac87da 100644 +--- a/include/net/tcp.h ++++ b/include/net/tcp.h +@@ -612,6 +612,7 @@ void tcp_skb_collapse_tstamp(struct sk_buff *skb, + /* tcp_input.c */ + void tcp_rearm_rto(struct sock *sk); + void tcp_synack_rtt_meas(struct sock *sk, struct request_sock *req); ++void tcp_done_with_error(struct sock *sk, int err); + void tcp_reset(struct sock *sk, struct sk_buff *skb); + void tcp_skb_mark_lost_uncond_verify(struct tcp_sock *tp, struct sk_buff *skb); + void tcp_fin(struct sock *sk); +diff --git a/include/trace/events/mptcp.h b/include/trace/events/mptcp.h +index 6bf43176f14c14..df26c1dd3d8dc8 100644 +--- a/include/trace/events/mptcp.h ++++ b/include/trace/events/mptcp.h +@@ -34,7 +34,7 @@ TRACE_EVENT(mptcp_subflow_get_send, + struct sock *ssk; + + __entry->active = mptcp_subflow_active(subflow); +- __entry->backup = subflow->backup; ++ __entry->backup = subflow->backup || subflow->request_bkup; + + if (subflow->tcp_sock && sk_fullsock(subflow->tcp_sock)) + __entry->free = sk_stream_memory_free(subflow->tcp_sock); +diff --git a/include/trace/events/rpcgss.h b/include/trace/events/rpcgss.h +index 6959255ccfa98a..3e4f767fbfc12e 100644 +--- a/include/trace/events/rpcgss.h ++++ b/include/trace/events/rpcgss.h +@@ -54,7 +54,7 @@ TRACE_DEFINE_ENUM(GSS_S_UNSEQ_TOKEN); + TRACE_DEFINE_ENUM(GSS_S_GAP_TOKEN); + + #define show_gss_status(x) \ +- __print_flags(x, "|", \ ++ __print_symbolic(x, \ + { GSS_S_BAD_MECH, "GSS_S_BAD_MECH" }, \ + { GSS_S_BAD_NAME, "GSS_S_BAD_NAME" }, \ + { GSS_S_BAD_NAMETYPE, "GSS_S_BAD_NAMETYPE" }, \ +diff --git a/include/uapi/linux/netfilter/nf_tables.h b/include/uapi/linux/netfilter/nf_tables.h +index 62cc780a168a86..c0edc1a2c8e653 100644 +--- a/include/uapi/linux/netfilter/nf_tables.h ++++ b/include/uapi/linux/netfilter/nf_tables.h +@@ -1320,7 +1320,7 @@ enum nft_secmark_attributes { + #define NFTA_SECMARK_MAX (__NFTA_SECMARK_MAX - 1) + + /* Max security context length */ +-#define NFT_SECMARK_CTX_MAXLEN 256 ++#define NFT_SECMARK_CTX_MAXLEN 4096 + + /** + * enum nft_reject_types - nf_tables reject expression reject types +diff --git a/include/uapi/linux/zorro_ids.h b/include/uapi/linux/zorro_ids.h +index 6e574d7b7d79cd..393f2ee9c04228 100644 +--- a/include/uapi/linux/zorro_ids.h ++++ b/include/uapi/linux/zorro_ids.h +@@ -449,6 +449,9 @@ + #define ZORRO_PROD_VMC_ISDN_BLASTER_Z2 ZORRO_ID(VMC, 0x01, 0) + #define ZORRO_PROD_VMC_HYPERCOM_4 ZORRO_ID(VMC, 0x02, 0) + ++#define ZORRO_MANUF_CSLAB 0x1400 ++#define ZORRO_PROD_CSLAB_WARP_1260 ZORRO_ID(CSLAB, 0x65, 0) ++ + #define ZORRO_MANUF_INFORMATION 0x157C + #define ZORRO_PROD_INFORMATION_ISDN_ENGINE_I ZORRO_ID(INFORMATION, 0x64, 0) + +diff --git a/io_uring/io-wq.c b/io_uring/io-wq.c +index fe8594a0396cae..c5d249f5d21409 100644 +--- a/io_uring/io-wq.c ++++ b/io_uring/io-wq.c +@@ -19,6 +19,7 @@ + #include "io-wq.h" + + #define WORKER_IDLE_TIMEOUT (5 * HZ) ++#define WORKER_INIT_LIMIT 3 + + enum { + IO_WORKER_F_UP = 1, /* up and active */ +@@ -54,6 +55,7 @@ struct io_worker { + unsigned long create_state; + struct callback_head create_work; + int create_index; ++ int init_retries; + + union { + struct rcu_head rcu; +@@ -732,7 +734,7 @@ static bool io_wq_work_match_all(struct io_wq_work *work, void *data) + return true; + } + +-static inline bool io_should_retry_thread(long err) ++static inline bool io_should_retry_thread(struct io_worker *worker, long err) + { + /* + * Prevent perpetual task_work retry, if the task (or its group) is +@@ -740,6 +742,8 @@ static inline bool io_should_retry_thread(long err) + */ + if (fatal_signal_pending(current)) + return false; ++ if (worker->init_retries++ >= WORKER_INIT_LIMIT) ++ return false; + + switch (err) { + case -EAGAIN: +@@ -766,7 +770,7 @@ static void create_worker_cont(struct callback_head *cb) + io_init_new_worker(wqe, worker, tsk); + io_worker_release(worker); + return; +- } else if (!io_should_retry_thread(PTR_ERR(tsk))) { ++ } else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) { + struct io_wqe_acct *acct = io_wqe_get_acct(worker); + + atomic_dec(&acct->nr_running); +@@ -831,7 +835,7 @@ static bool create_io_worker(struct io_wq *wq, struct io_wqe *wqe, int index) + tsk = create_io_thread(io_wqe_worker, worker, wqe->node); + if (!IS_ERR(tsk)) { + io_init_new_worker(wqe, worker, tsk); +- } else if (!io_should_retry_thread(PTR_ERR(tsk))) { ++ } else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) { + kfree(worker); + goto fail; + } else { +diff --git a/io_uring/io_uring.c b/io_uring/io_uring.c +index ea005700c8ce12..8ed2c65529714f 100644 +--- a/io_uring/io_uring.c ++++ b/io_uring/io_uring.c +@@ -9856,8 +9856,11 @@ static void io_uring_cancel_generic(bool cancel_all, struct io_sq_data *sqd) + atomic_inc(&tctx->in_idle); + do { + io_uring_drop_tctx_refs(current); ++ if (!tctx_inflight(tctx, !cancel_all)) ++ break; ++ + /* read completions before cancelations */ +- inflight = tctx_inflight(tctx, !cancel_all); ++ inflight = tctx_inflight(tctx, false); + if (!inflight) + break; + +diff --git a/kernel/bpf/btf.c b/kernel/bpf/btf.c +index a0c7e13e0ab4dc..d3eb75bfd97184 100644 +--- a/kernel/bpf/btf.c ++++ b/kernel/bpf/btf.c +@@ -349,7 +349,7 @@ const char *btf_type_str(const struct btf_type *t) + struct btf_show { + u64 flags; + void *target; /* target of show operation (seq file, buffer) */ +- void (*showfn)(struct btf_show *show, const char *fmt, va_list args); ++ __printf(2, 0) void (*showfn)(struct btf_show *show, const char *fmt, va_list args); + const struct btf *btf; + /* below are used during iteration */ + struct { +@@ -5808,8 +5808,8 @@ static void btf_type_show(const struct btf *btf, u32 type_id, void *obj, + btf_type_ops(t)->show(btf, t, type_id, obj, 0, show); + } + +-static void btf_seq_show(struct btf_show *show, const char *fmt, +- va_list args) ++__printf(2, 0) static void btf_seq_show(struct btf_show *show, const char *fmt, ++ va_list args) + { + seq_vprintf((struct seq_file *)show->target, fmt, args); + } +@@ -5842,8 +5842,8 @@ struct btf_show_snprintf { + int len; /* length we would have written */ + }; + +-static void btf_snprintf_show(struct btf_show *show, const char *fmt, +- va_list args) ++__printf(2, 0) static void btf_snprintf_show(struct btf_show *show, const char *fmt, ++ va_list args) + { + struct btf_show_snprintf *ssnprintf = (struct btf_show_snprintf *)show; + int len; +diff --git a/kernel/debug/kdb/kdb_io.c b/kernel/debug/kdb/kdb_io.c +index a3b4b55d2e2e1b..b28b8a5ef6381b 100644 +--- a/kernel/debug/kdb/kdb_io.c ++++ b/kernel/debug/kdb/kdb_io.c +@@ -194,7 +194,7 @@ char kdb_getchar(void) + */ + static void kdb_position_cursor(char *prompt, char *buffer, char *cp) + { +- kdb_printf("\r%s", kdb_prompt_str); ++ kdb_printf("\r%s", prompt); + if (cp > buffer) + kdb_printf("%.*s", (int)(cp - buffer), buffer); + } +@@ -358,7 +358,7 @@ static char *kdb_read(char *buffer, size_t bufsize) + if (i >= dtab_count) + kdb_printf("..."); + kdb_printf("\n"); +- kdb_printf(kdb_prompt_str); ++ kdb_printf("%s", kdb_prompt_str); + kdb_printf("%s", buffer); + if (cp != lastchar) + kdb_position_cursor(kdb_prompt_str, buffer, cp); +@@ -450,7 +450,7 @@ char *kdb_getstr(char *buffer, size_t bufsize, const char *prompt) + { + if (prompt && kdb_prompt_str != prompt) + strscpy(kdb_prompt_str, prompt, CMD_BUFLEN); +- kdb_printf(kdb_prompt_str); ++ kdb_printf("%s", kdb_prompt_str); + kdb_nextline = 1; /* Prompt and input resets line number */ + return kdb_read(buffer, bufsize); + } +diff --git a/kernel/dma/mapping.c b/kernel/dma/mapping.c +index c9dbc8f5812b83..9e1a724ae7e7da 100644 +--- a/kernel/dma/mapping.c ++++ b/kernel/dma/mapping.c +@@ -62,8 +62,8 @@ void dmam_free_coherent(struct device *dev, size_t size, void *vaddr, + { + struct dma_devres match_data = { size, vaddr, dma_handle }; + +- dma_free_coherent(dev, size, vaddr, dma_handle); + WARN_ON(devres_destroy(dev, dmam_release, dmam_match, &match_data)); ++ dma_free_coherent(dev, size, vaddr, dma_handle); + } + EXPORT_SYMBOL(dmam_free_coherent); + +diff --git a/kernel/events/core.c b/kernel/events/core.c +index 80d9c8fcc30a61..9f3da1e05e4654 100644 +--- a/kernel/events/core.c ++++ b/kernel/events/core.c +@@ -2395,18 +2395,14 @@ event_sched_out(struct perf_event *event, + } + + if (event->pending_sigtrap) { +- bool dec = true; +- + event->pending_sigtrap = 0; + if (state != PERF_EVENT_STATE_OFF && +- !event->pending_work) { ++ !event->pending_work && ++ !task_work_add(current, &event->pending_task, TWA_RESUME)) { + event->pending_work = 1; +- dec = false; +- WARN_ON_ONCE(!atomic_long_inc_not_zero(&event->refcount)); +- task_work_add(current, &event->pending_task, TWA_RESUME); +- } +- if (dec) ++ } else { + local_dec(&event->ctx->nr_pending); ++ } + } + + perf_event_set_state(event, state); +@@ -5101,9 +5097,35 @@ static bool exclusive_event_installable(struct perf_event *event, + static void perf_addr_filters_splice(struct perf_event *event, + struct list_head *head); + ++static void perf_pending_task_sync(struct perf_event *event) ++{ ++ struct callback_head *head = &event->pending_task; ++ ++ if (!event->pending_work) ++ return; ++ /* ++ * If the task is queued to the current task's queue, we ++ * obviously can't wait for it to complete. Simply cancel it. ++ */ ++ if (task_work_cancel(current, head)) { ++ event->pending_work = 0; ++ local_dec(&event->ctx->nr_pending); ++ return; ++ } ++ ++ /* ++ * All accesses related to the event are within the same ++ * non-preemptible section in perf_pending_task(). The RCU ++ * grace period before the event is freed will make sure all ++ * those accesses are complete by then. ++ */ ++ rcuwait_wait_event(&event->pending_work_wait, !event->pending_work, TASK_UNINTERRUPTIBLE); ++} ++ + static void _free_event(struct perf_event *event) + { + irq_work_sync(&event->pending_irq); ++ perf_pending_task_sync(event); + + unaccount_event(event); + +@@ -6401,6 +6423,8 @@ static int perf_mmap(struct file *file, struct vm_area_struct *vma) + return -EINVAL; + + nr_pages = vma_size / PAGE_SIZE; ++ if (nr_pages > INT_MAX) ++ return -ENOMEM; + + mutex_lock(&event->mmap_mutex); + ret = -EINVAL; +@@ -6731,24 +6755,28 @@ static void perf_pending_task(struct callback_head *head) + struct perf_event *event = container_of(head, struct perf_event, pending_task); + int rctx; + ++ /* ++ * All accesses to the event must belong to the same implicit RCU read-side ++ * critical section as the ->pending_work reset. See comment in ++ * perf_pending_task_sync(). ++ */ ++ preempt_disable_notrace(); + /* + * If we 'fail' here, that's OK, it means recursion is already disabled + * and we won't recurse 'further'. + */ +- preempt_disable_notrace(); + rctx = perf_swevent_get_recursion_context(); + + if (event->pending_work) { + event->pending_work = 0; + perf_sigtrap(event); + local_dec(&event->ctx->nr_pending); ++ rcuwait_wake_up(&event->pending_work_wait); + } + + if (rctx >= 0) + perf_swevent_put_recursion_context(rctx); + preempt_enable_notrace(); +- +- put_event(event); + } + + /* +@@ -9166,21 +9194,19 @@ static void perf_event_bpf_emit_ksymbols(struct bpf_prog *prog, + bool unregister = type == PERF_BPF_EVENT_PROG_UNLOAD; + int i; + +- if (prog->aux->func_cnt == 0) { +- perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF, +- (u64)(unsigned long)prog->bpf_func, +- prog->jited_len, unregister, +- prog->aux->ksym.name); +- } else { +- for (i = 0; i < prog->aux->func_cnt; i++) { +- struct bpf_prog *subprog = prog->aux->func[i]; +- +- perf_event_ksymbol( +- PERF_RECORD_KSYMBOL_TYPE_BPF, +- (u64)(unsigned long)subprog->bpf_func, +- subprog->jited_len, unregister, +- subprog->aux->ksym.name); +- } ++ perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF, ++ (u64)(unsigned long)prog->bpf_func, ++ prog->jited_len, unregister, ++ prog->aux->ksym.name); ++ ++ for (i = 1; i < prog->aux->func_cnt; i++) { ++ struct bpf_prog *subprog = prog->aux->func[i]; ++ ++ perf_event_ksymbol( ++ PERF_RECORD_KSYMBOL_TYPE_BPF, ++ (u64)(unsigned long)subprog->bpf_func, ++ subprog->jited_len, unregister, ++ subprog->aux->ksym.name); + } + } + +@@ -11786,6 +11812,7 @@ perf_event_alloc(struct perf_event_attr *attr, int cpu, + init_waitqueue_head(&event->waitq); + init_irq_work(&event->pending_irq, perf_pending_irq); + init_task_work(&event->pending_task, perf_pending_task); ++ rcuwait_init(&event->pending_work_wait); + + mutex_init(&event->mmap_mutex); + raw_spin_lock_init(&event->addr_filters.lock); +diff --git a/kernel/events/internal.h b/kernel/events/internal.h +index 5150d5f84c033e..386d21c7edfa03 100644 +--- a/kernel/events/internal.h ++++ b/kernel/events/internal.h +@@ -128,7 +128,7 @@ static inline unsigned long perf_data_size(struct perf_buffer *rb) + + static inline unsigned long perf_aux_size(struct perf_buffer *rb) + { +- return rb->aux_nr_pages << PAGE_SHIFT; ++ return (unsigned long)rb->aux_nr_pages << PAGE_SHIFT; + } + + #define __DEFINE_OUTPUT_COPY_BODY(advance_buf, memcpy_func, ...) \ +diff --git a/kernel/events/ring_buffer.c b/kernel/events/ring_buffer.c +index 45965f13757e44..f3a3c294ff2b34 100644 +--- a/kernel/events/ring_buffer.c ++++ b/kernel/events/ring_buffer.c +@@ -683,7 +683,9 @@ int rb_alloc_aux(struct perf_buffer *rb, struct perf_event *event, + * max_order, to aid PMU drivers in double buffering. + */ + if (!watermark) +- watermark = nr_pages << (PAGE_SHIFT - 1); ++ watermark = min_t(unsigned long, ++ U32_MAX, ++ (unsigned long)nr_pages << (PAGE_SHIFT - 1)); + + /* + * Use aux_watermark as the basis for chunking to +diff --git a/kernel/irq/chip.c b/kernel/irq/chip.c +index f3920374f71cec..0a893df1b80992 100644 +--- a/kernel/irq/chip.c ++++ b/kernel/irq/chip.c +@@ -38,7 +38,7 @@ struct irqaction chained_action = { + * @irq: irq number + * @chip: pointer to irq chip description structure + */ +-int irq_set_chip(unsigned int irq, struct irq_chip *chip) ++int irq_set_chip(unsigned int irq, const struct irq_chip *chip) + { + unsigned long flags; + struct irq_desc *desc = irq_get_desc_lock(irq, &flags, 0); +@@ -46,10 +46,7 @@ int irq_set_chip(unsigned int irq, struct irq_chip *chip) + if (!desc) + return -EINVAL; + +- if (!chip) +- chip = &no_irq_chip; +- +- desc->irq_data.chip = chip; ++ desc->irq_data.chip = (struct irq_chip *)(chip ?: &no_irq_chip); + irq_put_desc_unlock(desc, flags); + /* + * For !CONFIG_SPARSE_IRQ make the irq show up in +@@ -1075,7 +1072,7 @@ irq_set_chained_handler_and_data(unsigned int irq, irq_flow_handler_t handle, + EXPORT_SYMBOL_GPL(irq_set_chained_handler_and_data); + + void +-irq_set_chip_and_handler_name(unsigned int irq, struct irq_chip *chip, ++irq_set_chip_and_handler_name(unsigned int irq, const struct irq_chip *chip, + irq_flow_handler_t handle, const char *name) + { + irq_set_chip(irq, chip); +@@ -1559,6 +1556,17 @@ int irq_chip_compose_msi_msg(struct irq_data *data, struct msi_msg *msg) + return 0; + } + ++static struct device *irq_get_parent_device(struct irq_data *data) ++{ ++ if (data->chip->parent_device) ++ return data->chip->parent_device; ++ ++ if (data->domain) ++ return data->domain->dev; ++ ++ return NULL; ++} ++ + /** + * irq_chip_pm_get - Enable power for an IRQ chip + * @data: Pointer to interrupt specific data +@@ -1568,12 +1576,13 @@ int irq_chip_compose_msi_msg(struct irq_data *data, struct msi_msg *msg) + */ + int irq_chip_pm_get(struct irq_data *data) + { ++ struct device *dev = irq_get_parent_device(data); + int retval; + +- if (IS_ENABLED(CONFIG_PM) && data->chip->parent_device) { +- retval = pm_runtime_get_sync(data->chip->parent_device); ++ if (IS_ENABLED(CONFIG_PM) && dev) { ++ retval = pm_runtime_get_sync(dev); + if (retval < 0) { +- pm_runtime_put_noidle(data->chip->parent_device); ++ pm_runtime_put_noidle(dev); + return retval; + } + } +@@ -1591,10 +1600,11 @@ int irq_chip_pm_get(struct irq_data *data) + */ + int irq_chip_pm_put(struct irq_data *data) + { ++ struct device *dev = irq_get_parent_device(data); + int retval = 0; + +- if (IS_ENABLED(CONFIG_PM) && data->chip->parent_device) +- retval = pm_runtime_put(data->chip->parent_device); ++ if (IS_ENABLED(CONFIG_PM) && dev) ++ retval = pm_runtime_put(dev); + + return (retval < 0) ? retval : 0; + } +diff --git a/kernel/irq/irqdesc.c b/kernel/irq/irqdesc.c +index 7a45fd59324542..d5010a24ed16e4 100644 +--- a/kernel/irq/irqdesc.c ++++ b/kernel/irq/irqdesc.c +@@ -493,6 +493,7 @@ static int alloc_descs(unsigned int start, unsigned int cnt, int node, + flags = IRQD_AFFINITY_MANAGED | + IRQD_MANAGED_SHUTDOWN; + } ++ flags |= IRQD_AFFINITY_SET; + mask = &affinity->mask; + node = cpu_to_node(cpumask_first(mask)); + affinity++; +diff --git a/kernel/irq/irqdomain.c b/kernel/irq/irqdomain.c +index e0b67784ac1e02..4ac1c01346d4e3 100644 +--- a/kernel/irq/irqdomain.c ++++ b/kernel/irq/irqdomain.c +@@ -153,7 +153,6 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode, + switch (fwid->type) { + case IRQCHIP_FWNODE_NAMED: + case IRQCHIP_FWNODE_NAMED_ID: +- domain->fwnode = fwnode; + domain->name = kstrdup(fwid->name, GFP_KERNEL); + if (!domain->name) { + kfree(domain); +@@ -162,7 +161,6 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode, + domain->flags |= IRQ_DOMAIN_NAME_ALLOCATED; + break; + default: +- domain->fwnode = fwnode; + domain->name = fwid->name; + break; + } +@@ -184,7 +182,6 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode, + strreplace(name, '/', ':'); + + domain->name = name; +- domain->fwnode = fwnode; + domain->flags |= IRQ_DOMAIN_NAME_ALLOCATED; + } + +@@ -200,8 +197,8 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode, + domain->flags |= IRQ_DOMAIN_NAME_ALLOCATED; + } + +- fwnode_handle_get(fwnode); +- fwnode_dev_initialized(fwnode, true); ++ domain->fwnode = fwnode_handle_get(fwnode); ++ fwnode_dev_initialized(domain->fwnode, true); + + /* Fill structure */ + INIT_RADIX_TREE(&domain->revmap_tree, GFP_KERNEL); +diff --git a/kernel/irq/manage.c b/kernel/irq/manage.c +index 9862372e0f0110..b46fbfbb929f1a 100644 +--- a/kernel/irq/manage.c ++++ b/kernel/irq/manage.c +@@ -1330,7 +1330,7 @@ static int irq_thread(void *data) + * synchronize_hardirq(). So neither IRQTF_RUNTHREAD nor the + * oneshot mask bit can be set. + */ +- task_work_cancel(current, irq_thread_dtor); ++ task_work_cancel_func(current, irq_thread_dtor); + return 0; + } + +diff --git a/kernel/kcov.c b/kernel/kcov.c +index 793486e00dd6f2..9e89b34321f789 100644 +--- a/kernel/kcov.c ++++ b/kernel/kcov.c +@@ -151,6 +151,15 @@ static void kcov_remote_area_put(struct kcov_remote_area *area, + list_add(&area->list, &kcov_remote_areas); + } + ++/* ++ * Unlike in_serving_softirq(), this function returns false when called during ++ * a hardirq or an NMI that happened in the softirq context. ++ */ ++static inline bool in_softirq_really(void) ++{ ++ return in_serving_softirq() && !in_hardirq() && !in_nmi(); ++} ++ + static notrace bool check_kcov_mode(enum kcov_mode needed_mode, struct task_struct *t) + { + unsigned int mode; +@@ -160,7 +169,7 @@ static notrace bool check_kcov_mode(enum kcov_mode needed_mode, struct task_stru + * so we ignore code executed in interrupts, unless we are in a remote + * coverage collection section in a softirq. + */ +- if (!in_task() && !(in_serving_softirq() && t->kcov_softirq)) ++ if (!in_task() && !(in_softirq_really() && t->kcov_softirq)) + return false; + mode = READ_ONCE(t->kcov_mode); + /* +@@ -822,7 +831,7 @@ void kcov_remote_start(u64 handle) + + if (WARN_ON(!kcov_check_handle(handle, true, true, true))) + return; +- if (!in_task() && !in_serving_softirq()) ++ if (!in_task() && !in_softirq_really()) + return; + + local_irq_save(flags); +@@ -963,7 +972,7 @@ void kcov_remote_stop(void) + int sequence; + unsigned long flags; + +- if (!in_task() && !in_serving_softirq()) ++ if (!in_task() && !in_softirq_really()) + return; + + local_irq_save(flags); +diff --git a/kernel/kprobes.c b/kernel/kprobes.c +index 258d425b2c4a59..0d463859ad3292 100644 +--- a/kernel/kprobes.c ++++ b/kernel/kprobes.c +@@ -1545,8 +1545,8 @@ static bool is_cfi_preamble_symbol(unsigned long addr) + if (lookup_symbol_name(addr, symbuf)) + return false; + +- return str_has_prefix("__cfi_", symbuf) || +- str_has_prefix("__pfx_", symbuf); ++ return str_has_prefix(symbuf, "__cfi_") || ++ str_has_prefix(symbuf, "__pfx_"); + } + + static int check_kprobe_address_safe(struct kprobe *p, +diff --git a/kernel/locking/rwsem.c b/kernel/locking/rwsem.c +index 4a38d32b89fa33..eca42c14ec09ae 100644 +--- a/kernel/locking/rwsem.c ++++ b/kernel/locking/rwsem.c +@@ -1286,7 +1286,7 @@ static inline int __down_read_trylock(struct rw_semaphore *sem) + /* + * lock for writing + */ +-static inline int __down_write_common(struct rw_semaphore *sem, int state) ++static __always_inline int __down_write_common(struct rw_semaphore *sem, int state) + { + if (unlikely(!rwsem_write_trylock(sem))) { + if (IS_ERR(rwsem_down_write_slowpath(sem, state))) +@@ -1296,12 +1296,12 @@ static inline int __down_write_common(struct rw_semaphore *sem, int state) + return 0; + } + +-static inline void __down_write(struct rw_semaphore *sem) ++static __always_inline void __down_write(struct rw_semaphore *sem) + { + __down_write_common(sem, TASK_UNINTERRUPTIBLE); + } + +-static inline int __down_write_killable(struct rw_semaphore *sem) ++static __always_inline int __down_write_killable(struct rw_semaphore *sem) + { + return __down_write_common(sem, TASK_KILLABLE); + } +diff --git a/kernel/padata.c b/kernel/padata.c +index 809978bb249c24..7c52f9de5d4ec1 100644 +--- a/kernel/padata.c ++++ b/kernel/padata.c +@@ -508,6 +508,13 @@ void __init padata_do_multithreaded(struct padata_mt_job *job) + ps.chunk_size = max(ps.chunk_size, job->min_chunk); + ps.chunk_size = roundup(ps.chunk_size, job->align); + ++ /* ++ * chunk_size can be 0 if the caller sets min_chunk to 0. So force it ++ * to at least 1 to prevent divide-by-0 panic in padata_mt_helper().` ++ */ ++ if (!ps.chunk_size) ++ ps.chunk_size = 1U; ++ + list_for_each_entry(pw, &works, pw_list) + queue_work(system_unbound_wq, &pw->pw_work); + +diff --git a/kernel/profile.c b/kernel/profile.c +index 0db1122855c0d5..e9a1efe18caf1f 100644 +--- a/kernel/profile.c ++++ b/kernel/profile.c +@@ -57,24 +57,10 @@ static DEFINE_MUTEX(profile_flip_mutex); + int profile_setup(char *str) + { + static const char schedstr[] = "schedule"; +- static const char sleepstr[] = "sleep"; + static const char kvmstr[] = "kvm"; + int par; + +- if (!strncmp(str, sleepstr, strlen(sleepstr))) { +-#ifdef CONFIG_SCHEDSTATS +- force_schedstat_enabled(); +- prof_on = SLEEP_PROFILING; +- if (str[strlen(sleepstr)] == ',') +- str += strlen(sleepstr) + 1; +- if (get_option(&str, &par)) +- prof_shift = clamp(par, 0, BITS_PER_LONG - 1); +- pr_info("kernel sleep profiling enabled (shift: %u)\n", +- prof_shift); +-#else +- pr_warn("kernel sleep profiling requires CONFIG_SCHEDSTATS\n"); +-#endif /* CONFIG_SCHEDSTATS */ +- } else if (!strncmp(str, schedstr, strlen(schedstr))) { ++ if (!strncmp(str, schedstr, strlen(schedstr))) { + prof_on = SCHED_PROFILING; + if (str[strlen(schedstr)] == ',') + str += strlen(schedstr) + 1; +diff --git a/kernel/rcu/rcutorture.c b/kernel/rcu/rcutorture.c +index 9d8d1f233d7bda..a3bab6af4028f8 100644 +--- a/kernel/rcu/rcutorture.c ++++ b/kernel/rcu/rcutorture.c +@@ -2186,7 +2186,7 @@ static void rcu_torture_fwd_cb_cr(struct rcu_head *rhp) + spin_lock_irqsave(&rfp->rcu_fwd_lock, flags); + rfcpp = rfp->rcu_fwd_cb_tail; + rfp->rcu_fwd_cb_tail = &rfcp->rfc_next; +- WRITE_ONCE(*rfcpp, rfcp); ++ smp_store_release(rfcpp, rfcp); + WRITE_ONCE(rfp->n_launders_cb, rfp->n_launders_cb + 1); + i = ((jiffies - rfp->rcu_fwd_startat) / (HZ / FWD_CBS_HIST_DIV)); + if (i >= ARRAY_SIZE(rfp->n_launders_hist)) +diff --git a/kernel/sched/core.c b/kernel/sched/core.c +index b43da6201b9aaf..21b4f96d80a1b2 100644 +--- a/kernel/sched/core.c ++++ b/kernel/sched/core.c +@@ -1203,27 +1203,24 @@ int tg_nop(struct task_group *tg, void *data) + static void set_load_weight(struct task_struct *p, bool update_load) + { + int prio = p->static_prio - MAX_RT_PRIO; +- struct load_weight *load = &p->se.load; ++ struct load_weight lw; + +- /* +- * SCHED_IDLE tasks get minimal weight: +- */ + if (task_has_idle_policy(p)) { +- load->weight = scale_load(WEIGHT_IDLEPRIO); +- load->inv_weight = WMULT_IDLEPRIO; +- return; ++ lw.weight = scale_load(WEIGHT_IDLEPRIO); ++ lw.inv_weight = WMULT_IDLEPRIO; ++ } else { ++ lw.weight = scale_load(sched_prio_to_weight[prio]); ++ lw.inv_weight = sched_prio_to_wmult[prio]; + } + + /* + * SCHED_OTHER tasks have to update their load when changing their + * weight + */ +- if (update_load && p->sched_class == &fair_sched_class) { +- reweight_task(p, prio); +- } else { +- load->weight = scale_load(sched_prio_to_weight[prio]); +- load->inv_weight = sched_prio_to_wmult[prio]; +- } ++ if (update_load && p->sched_class == &fair_sched_class) ++ reweight_task(p, &lw); ++ else ++ p->se.load = lw; + } + + #ifdef CONFIG_UCLAMP_TASK +@@ -9104,6 +9101,22 @@ static int cpuset_cpu_inactive(unsigned int cpu) + return 0; + } + ++static inline void sched_smt_present_inc(int cpu) ++{ ++#ifdef CONFIG_SCHED_SMT ++ if (cpumask_weight(cpu_smt_mask(cpu)) == 2) ++ static_branch_inc_cpuslocked(&sched_smt_present); ++#endif ++} ++ ++static inline void sched_smt_present_dec(int cpu) ++{ ++#ifdef CONFIG_SCHED_SMT ++ if (cpumask_weight(cpu_smt_mask(cpu)) == 2) ++ static_branch_dec_cpuslocked(&sched_smt_present); ++#endif ++} ++ + int sched_cpu_activate(unsigned int cpu) + { + struct rq *rq = cpu_rq(cpu); +@@ -9115,13 +9128,10 @@ int sched_cpu_activate(unsigned int cpu) + */ + balance_push_set(cpu, false); + +-#ifdef CONFIG_SCHED_SMT + /* + * When going up, increment the number of cores with SMT present. + */ +- if (cpumask_weight(cpu_smt_mask(cpu)) == 2) +- static_branch_inc_cpuslocked(&sched_smt_present); +-#endif ++ sched_smt_present_inc(cpu); + set_cpu_active(cpu, true); + + if (sched_smp_initialized) { +@@ -9190,13 +9200,12 @@ int sched_cpu_deactivate(unsigned int cpu) + } + rq_unlock_irqrestore(rq, &rf); + +-#ifdef CONFIG_SCHED_SMT + /* + * When going down, decrement the number of cores with SMT present. + */ +- if (cpumask_weight(cpu_smt_mask(cpu)) == 2) +- static_branch_dec_cpuslocked(&sched_smt_present); ++ sched_smt_present_dec(cpu); + ++#ifdef CONFIG_SCHED_SMT + sched_core_cpu_deactivate(cpu); + #endif + +@@ -9205,6 +9214,7 @@ int sched_cpu_deactivate(unsigned int cpu) + + ret = cpuset_cpu_inactive(cpu); + if (ret) { ++ sched_smt_present_inc(cpu); + balance_push_set(cpu, false); + set_cpu_active(cpu, true); + return ret; +diff --git a/kernel/sched/cputime.c b/kernel/sched/cputime.c +index 042a6dbce8f32f..e3022598f7b02b 100644 +--- a/kernel/sched/cputime.c ++++ b/kernel/sched/cputime.c +@@ -577,6 +577,12 @@ void cputime_adjust(struct task_cputime *curr, struct prev_cputime *prev, + } + + stime = mul_u64_u64_div_u64(stime, rtime, stime + utime); ++ /* ++ * Because mul_u64_u64_div_u64() can approximate on some ++ * achitectures; enforce the constraint that: a*b/(b+c) <= a. ++ */ ++ if (unlikely(stime > rtime)) ++ stime = rtime; + + update: + /* +diff --git a/kernel/sched/fair.c b/kernel/sched/fair.c +index 94fcd585eb7f02..68793b50adad7d 100644 +--- a/kernel/sched/fair.c ++++ b/kernel/sched/fair.c +@@ -988,16 +988,6 @@ update_stats_enqueue_sleeper(struct cfs_rq *cfs_rq, struct sched_entity *se) + + trace_sched_stat_blocked(tsk, delta); + +- /* +- * Blocking time is in units of nanosecs, so shift by +- * 20 to get a milliseconds-range estimation of the +- * amount of time that the task spent sleeping: +- */ +- if (unlikely(prof_on == SLEEP_PROFILING)) { +- profile_hits(SLEEP_PROFILING, +- (void *)get_wchan(tsk), +- delta >> 20); +- } + account_scheduler_latency(tsk, delta >> 10, 0); + } + } +@@ -3121,15 +3111,14 @@ static void reweight_entity(struct cfs_rq *cfs_rq, struct sched_entity *se, + + } + +-void reweight_task(struct task_struct *p, int prio) ++void reweight_task(struct task_struct *p, const struct load_weight *lw) + { + struct sched_entity *se = &p->se; + struct cfs_rq *cfs_rq = cfs_rq_of(se); + struct load_weight *load = &se->load; +- unsigned long weight = scale_load(sched_prio_to_weight[prio]); + +- reweight_entity(cfs_rq, se, weight); +- load->inv_weight = sched_prio_to_wmult[prio]; ++ reweight_entity(cfs_rq, se, lw->weight); ++ load->inv_weight = lw->inv_weight; + } + + #ifdef CONFIG_FAIR_GROUP_SCHED +@@ -8242,7 +8231,7 @@ static int detach_tasks(struct lb_env *env) + case migrate_util: + util = task_util_est(p); + +- if (util > env->imbalance) ++ if (shr_bound(util, env->sd->nr_balance_failed) > env->imbalance) + goto next; + + env->imbalance -= util; +diff --git a/kernel/sched/sched.h b/kernel/sched/sched.h +index 5061093d9baae5..48bcc1876df831 100644 +--- a/kernel/sched/sched.h ++++ b/kernel/sched/sched.h +@@ -2322,7 +2322,7 @@ extern void init_sched_dl_class(void); + extern void init_sched_rt_class(void); + extern void init_sched_fair_class(void); + +-extern void reweight_task(struct task_struct *p, int prio); ++extern void reweight_task(struct task_struct *p, const struct load_weight *lw); + + extern void resched_curr(struct rq *rq); + extern void resched_cpu(int cpu); +diff --git a/kernel/signal.c b/kernel/signal.c +index c7dbb19219b9a5..08bccdbb1b4639 100644 +--- a/kernel/signal.c ++++ b/kernel/signal.c +@@ -2579,6 +2579,14 @@ static void do_freezer_trap(void) + spin_unlock_irq(¤t->sighand->siglock); + cgroup_enter_frozen(); + freezable_schedule(); ++ ++ /* ++ * We could've been woken by task_work, run it to clear ++ * TIF_NOTIFY_SIGNAL. The caller will retry if necessary. ++ */ ++ clear_notify_signal(); ++ if (unlikely(READ_ONCE(current->task_works))) ++ task_work_run(); + } + + static int ptrace_signal(int signr, kernel_siginfo_t *info) +diff --git a/kernel/task_work.c b/kernel/task_work.c +index 1698fbe6f0e134..b8515291f74203 100644 +--- a/kernel/task_work.c ++++ b/kernel/task_work.c +@@ -104,9 +104,9 @@ static bool task_work_func_match(struct callback_head *cb, void *data) + } + + /** +- * task_work_cancel - cancel a pending work added by task_work_add() +- * @task: the task which should execute the work +- * @func: identifies the work to remove ++ * task_work_cancel_func - cancel a pending work matching a function added by task_work_add() ++ * @task: the task which should execute the func's work ++ * @func: identifies the func to match with a work to remove + * + * Find the last queued pending work with ->func == @func and remove + * it from queue. +@@ -115,11 +115,35 @@ static bool task_work_func_match(struct callback_head *cb, void *data) + * The found work or NULL if not found. + */ + struct callback_head * +-task_work_cancel(struct task_struct *task, task_work_func_t func) ++task_work_cancel_func(struct task_struct *task, task_work_func_t func) + { + return task_work_cancel_match(task, task_work_func_match, func); + } + ++static bool task_work_match(struct callback_head *cb, void *data) ++{ ++ return cb == data; ++} ++ ++/** ++ * task_work_cancel - cancel a pending work added by task_work_add() ++ * @task: the task which should execute the work ++ * @cb: the callback to remove if queued ++ * ++ * Remove a callback from a task's queue if queued. ++ * ++ * RETURNS: ++ * True if the callback was queued and got cancelled, false otherwise. ++ */ ++bool task_work_cancel(struct task_struct *task, struct callback_head *cb) ++{ ++ struct callback_head *ret; ++ ++ ret = task_work_cancel_match(task, task_work_match, cb); ++ ++ return ret == cb; ++} ++ + /** + * task_work_run - execute the works added by task_work_add() + * +@@ -152,7 +176,7 @@ void task_work_run(void) + if (!work) + break; + /* +- * Synchronize with task_work_cancel(). It can not remove ++ * Synchronize with task_work_cancel_match(). It can not remove + * the first entry == work, cmpxchg(task_works) must fail. + * But it can remove another entry from the ->next list. + */ +diff --git a/kernel/time/clocksource-wdtest.c b/kernel/time/clocksource-wdtest.c +index df922f49d171ba..d06185e054ea21 100644 +--- a/kernel/time/clocksource-wdtest.c ++++ b/kernel/time/clocksource-wdtest.c +@@ -104,8 +104,8 @@ static void wdtest_ktime_clocksource_reset(void) + static int wdtest_func(void *arg) + { + unsigned long j1, j2; ++ int i, max_retries; + char *s; +- int i; + + schedule_timeout_uninterruptible(holdoff * HZ); + +@@ -139,18 +139,19 @@ static int wdtest_func(void *arg) + WARN_ON_ONCE(time_before(j2, j1 + NSEC_PER_USEC)); + + /* Verify tsc-like stability with various numbers of errors injected. */ +- for (i = 0; i <= max_cswd_read_retries + 1; i++) { +- if (i <= 1 && i < max_cswd_read_retries) ++ max_retries = clocksource_get_max_watchdog_retry(); ++ for (i = 0; i <= max_retries + 1; i++) { ++ if (i <= 1 && i < max_retries) + s = ""; +- else if (i <= max_cswd_read_retries) ++ else if (i <= max_retries) + s = ", expect message"; + else + s = ", expect clock skew"; +- pr_info("--- Watchdog with %dx error injection, %lu retries%s.\n", i, max_cswd_read_retries, s); ++ pr_info("--- Watchdog with %dx error injection, %d retries%s.\n", i, max_retries, s); + WRITE_ONCE(wdtest_ktime_read_ndelays, i); + schedule_timeout_uninterruptible(2 * HZ); + WARN_ON_ONCE(READ_ONCE(wdtest_ktime_read_ndelays)); +- WARN_ON_ONCE((i <= max_cswd_read_retries) != ++ WARN_ON_ONCE((i <= max_retries) != + !(clocksource_wdtest_ktime.flags & CLOCK_SOURCE_UNSTABLE)); + wdtest_ktime_clocksource_reset(); + } +diff --git a/kernel/time/clocksource.c b/kernel/time/clocksource.c +index 7d6d87a22ad55c..3ccb383741d081 100644 +--- a/kernel/time/clocksource.c ++++ b/kernel/time/clocksource.c +@@ -201,9 +201,6 @@ void clocksource_mark_unstable(struct clocksource *cs) + spin_unlock_irqrestore(&watchdog_lock, flags); + } + +-ulong max_cswd_read_retries = 3; +-module_param(max_cswd_read_retries, ulong, 0644); +-EXPORT_SYMBOL_GPL(max_cswd_read_retries); + static int verify_n_cpus = 8; + module_param(verify_n_cpus, int, 0644); + +@@ -215,11 +212,12 @@ enum wd_read_status { + + static enum wd_read_status cs_watchdog_read(struct clocksource *cs, u64 *csnow, u64 *wdnow) + { +- unsigned int nretries; ++ unsigned int nretries, max_retries; + u64 wd_end, wd_end2, wd_delta; + int64_t wd_delay, wd_seq_delay; + +- for (nretries = 0; nretries <= max_cswd_read_retries; nretries++) { ++ max_retries = clocksource_get_max_watchdog_retry(); ++ for (nretries = 0; nretries <= max_retries; nretries++) { + local_irq_disable(); + *wdnow = watchdog->read(watchdog); + *csnow = cs->read(cs); +@@ -231,7 +229,7 @@ static enum wd_read_status cs_watchdog_read(struct clocksource *cs, u64 *csnow, + wd_delay = clocksource_cyc2ns(wd_delta, watchdog->mult, + watchdog->shift); + if (wd_delay <= WATCHDOG_MAX_SKEW) { +- if (nretries > 1 || nretries >= max_cswd_read_retries) { ++ if (nretries > 1 && nretries >= max_retries) { + pr_warn("timekeeping watchdog on CPU%d: %s retried %d times before success\n", + smp_processor_id(), watchdog->name, nretries); + } +diff --git a/kernel/time/ntp.c b/kernel/time/ntp.c +index 406dccb79c2b6b..8d2dd214ec6822 100644 +--- a/kernel/time/ntp.c ++++ b/kernel/time/ntp.c +@@ -727,17 +727,16 @@ static inline void process_adjtimex_modes(const struct __kernel_timex *txc, + } + + if (txc->modes & ADJ_MAXERROR) +- time_maxerror = txc->maxerror; ++ time_maxerror = clamp(txc->maxerror, 0, NTP_PHASE_LIMIT); + + if (txc->modes & ADJ_ESTERROR) +- time_esterror = txc->esterror; ++ time_esterror = clamp(txc->esterror, 0, NTP_PHASE_LIMIT); + + if (txc->modes & ADJ_TIMECONST) { +- time_constant = txc->constant; ++ time_constant = clamp(txc->constant, 0, MAXTC); + if (!(time_status & STA_NANO)) + time_constant += 4; +- time_constant = min(time_constant, (long)MAXTC); +- time_constant = max(time_constant, 0l); ++ time_constant = clamp(time_constant, 0, MAXTC); + } + + if (txc->modes & ADJ_TAI && +diff --git a/kernel/time/tick-broadcast.c b/kernel/time/tick-broadcast.c +index 0916cc9adb8289..13a71a894cc16c 100644 +--- a/kernel/time/tick-broadcast.c ++++ b/kernel/time/tick-broadcast.c +@@ -1144,6 +1144,30 @@ void hotplug_cpu__broadcast_tick_pull(int deadcpu) + bc = tick_broadcast_device.evtdev; + + if (bc && broadcast_needs_cpu(bc, deadcpu)) { ++ /* ++ * If the broadcast force bit of the current CPU is set, ++ * then the current CPU has not yet reprogrammed the local ++ * timer device to avoid a ping-pong race. See ++ * ___tick_broadcast_oneshot_control(). ++ * ++ * If the broadcast device is hrtimer based then ++ * programming the broadcast event below does not have any ++ * effect because the local clockevent device is not ++ * running and not programmed because the broadcast event ++ * is not earlier than the pending event of the local clock ++ * event device. As a consequence all CPUs waiting for a ++ * broadcast event are stuck forever. ++ * ++ * Detect this condition and reprogram the cpu local timer ++ * device to avoid the starvation. ++ */ ++ if (tick_check_broadcast_expired()) { ++ struct tick_device *td = this_cpu_ptr(&tick_cpu_device); ++ ++ cpumask_clear_cpu(smp_processor_id(), tick_broadcast_force_mask); ++ tick_program_event(td->evtdev->next_event, 1); ++ } ++ + /* This moves the broadcast assignment to this CPU: */ + clockevents_program_event(bc, bc->next_event, 1); + } +diff --git a/kernel/time/timekeeping.c b/kernel/time/timekeeping.c +index dfa6649c490ded..ce3d1377cbc7ac 100644 +--- a/kernel/time/timekeeping.c ++++ b/kernel/time/timekeeping.c +@@ -2459,7 +2459,7 @@ int do_adjtimex(struct __kernel_timex *txc) + clock_set |= timekeeping_advance(TK_ADV_FREQ); + + if (clock_set) +- clock_was_set(CLOCK_REALTIME); ++ clock_was_set(CLOCK_SET_WALL); + + ntp_notify_cmos_timer(); + +diff --git a/kernel/trace/tracing_map.c b/kernel/trace/tracing_map.c +index 3edf5e51581343..7efb74220920b5 100644 +--- a/kernel/trace/tracing_map.c ++++ b/kernel/trace/tracing_map.c +@@ -454,7 +454,7 @@ static struct tracing_map_elt *get_free_elt(struct tracing_map *map) + struct tracing_map_elt *elt = NULL; + int idx; + +- idx = atomic_inc_return(&map->next_elt); ++ idx = atomic_fetch_add_unless(&map->next_elt, 1, map->max_elts); + if (idx < map->max_elts) { + elt = *(TRACING_MAP_ELT(map->elts, idx)); + if (map->ops && map->ops->elt_init) +@@ -699,7 +699,7 @@ void tracing_map_clear(struct tracing_map *map) + { + unsigned int i; + +- atomic_set(&map->next_elt, -1); ++ atomic_set(&map->next_elt, 0); + atomic64_set(&map->hits, 0); + atomic64_set(&map->drops, 0); + +@@ -783,7 +783,7 @@ struct tracing_map *tracing_map_create(unsigned int map_bits, + + map->map_bits = map_bits; + map->max_elts = (1 << map_bits); +- atomic_set(&map->next_elt, -1); ++ atomic_set(&map->next_elt, 0); + + map->map_size = (1 << (map_bits + 1)); + map->ops = ops; +diff --git a/kernel/watchdog_hld.c b/kernel/watchdog_hld.c +index 1e8a49dc956e2a..8ba4b269ab89c8 100644 +--- a/kernel/watchdog_hld.c ++++ b/kernel/watchdog_hld.c +@@ -91,11 +91,15 @@ static bool watchdog_check_timestamp(void) + __this_cpu_write(last_timestamp, now); + return true; + } +-#else +-static inline bool watchdog_check_timestamp(void) ++ ++static void watchdog_init_timestamp(void) + { +- return true; ++ __this_cpu_write(nmi_rearmed, 0); ++ __this_cpu_write(last_timestamp, ktime_get_mono_fast_ns()); + } ++#else ++static inline bool watchdog_check_timestamp(void) { return true; } ++static inline void watchdog_init_timestamp(void) { } + #endif + + static struct perf_event_attr wd_hw_attr = { +@@ -196,6 +200,7 @@ void hardlockup_detector_perf_enable(void) + if (!atomic_fetch_inc(&watchdog_cpus)) + pr_info("Enabled. Permanently consumes one hw-PMU counter.\n"); + ++ watchdog_init_timestamp(); + perf_event_enable(this_cpu_read(watchdog_ev)); + } + +diff --git a/lib/decompress_bunzip2.c b/lib/decompress_bunzip2.c +index 3518e7394eca8e..ca736166f10009 100644 +--- a/lib/decompress_bunzip2.c ++++ b/lib/decompress_bunzip2.c +@@ -232,7 +232,8 @@ static int INIT get_next_block(struct bunzip_data *bd) + RUNB) */ + symCount = symTotal+2; + for (j = 0; j < groupCount; j++) { +- unsigned char length[MAX_SYMBOLS], temp[MAX_HUFCODE_BITS+1]; ++ unsigned char length[MAX_SYMBOLS]; ++ unsigned short temp[MAX_HUFCODE_BITS+1]; + int minLen, maxLen, pp; + /* Read Huffman code lengths for each symbol. They're + stored in a way similar to mtf; record a starting +diff --git a/lib/kobject_uevent.c b/lib/kobject_uevent.c +index c87d5b6a8a55a3..38716b2eb671d7 100644 +--- a/lib/kobject_uevent.c ++++ b/lib/kobject_uevent.c +@@ -432,8 +432,23 @@ static void zap_modalias_env(struct kobj_uevent_env *env) + len = strlen(env->envp[i]) + 1; + + if (i != env->envp_idx - 1) { ++ /* @env->envp[] contains pointers to @env->buf[] ++ * with @env->buflen chars, and we are removing ++ * variable MODALIAS here pointed by @env->envp[i] ++ * with length @len as shown below: ++ * ++ * 0 @env->buf[] @env->buflen ++ * --------------------------------------------- ++ * ^ ^ ^ ^ ++ * | |-> @len <-| target block | ++ * @env->envp[0] @env->envp[i] @env->envp[i + 1] ++ * ++ * so the "target block" indicated above is moved ++ * backward by @len, and its right size is ++ * @env->buflen - (@env->envp[i + 1] - @env->envp[0]). ++ */ + memmove(env->envp[i], env->envp[i + 1], +- env->buflen - len); ++ env->buflen - (env->envp[i + 1] - env->envp[0])); + + for (j = i; j < env->envp_idx - 1; j++) + env->envp[j] = env->envp[j + 1] - len; +diff --git a/lib/objagg.c b/lib/objagg.c +index 5e1676ccdaddd0..57bde522f2493c 100644 +--- a/lib/objagg.c ++++ b/lib/objagg.c +@@ -167,6 +167,9 @@ static int objagg_obj_parent_assign(struct objagg *objagg, + { + void *delta_priv; + ++ if (WARN_ON(!objagg_obj_is_root(parent))) ++ return -EINVAL; ++ + delta_priv = objagg->ops->delta_create(objagg->priv, parent->obj, + objagg_obj->obj); + if (IS_ERR(delta_priv)) +@@ -906,20 +909,6 @@ static const struct objagg_opt_algo *objagg_opt_algos[] = { + [OBJAGG_OPT_ALGO_SIMPLE_GREEDY] = &objagg_opt_simple_greedy, + }; + +-static int objagg_hints_obj_cmp(struct rhashtable_compare_arg *arg, +- const void *obj) +-{ +- struct rhashtable *ht = arg->ht; +- struct objagg_hints *objagg_hints = +- container_of(ht, struct objagg_hints, node_ht); +- const struct objagg_ops *ops = objagg_hints->ops; +- const char *ptr = obj; +- +- ptr += ht->p.key_offset; +- return ops->hints_obj_cmp ? ops->hints_obj_cmp(ptr, arg->key) : +- memcmp(ptr, arg->key, ht->p.key_len); +-} +- + /** + * objagg_hints_get - obtains hints instance + * @objagg: objagg instance +@@ -958,7 +947,6 @@ struct objagg_hints *objagg_hints_get(struct objagg *objagg, + offsetof(struct objagg_hints_node, obj); + objagg_hints->ht_params.head_offset = + offsetof(struct objagg_hints_node, ht_node); +- objagg_hints->ht_params.obj_cmpfn = objagg_hints_obj_cmp; + + err = rhashtable_init(&objagg_hints->node_ht, &objagg_hints->ht_params); + if (err) +diff --git a/mm/hugetlb.c b/mm/hugetlb.c +index 2f5c1b2456ef2b..01a685963a9919 100644 +--- a/mm/hugetlb.c ++++ b/mm/hugetlb.c +@@ -3717,7 +3717,7 @@ void __init hugetlb_add_hstate(unsigned int order) + BUG_ON(hugetlb_max_hstate >= HUGE_MAX_HSTATE); + BUG_ON(order == 0); + h = &hstates[hugetlb_max_hstate++]; +- mutex_init(&h->resize_lock); ++ __mutex_init(&h->resize_lock, "resize mutex", &h->resize_key); + h->order = order; + h->mask = ~(huge_page_size(h) - 1); + for (i = 0; i < MAX_NUMNODES; ++i) +diff --git a/mm/mempolicy.c b/mm/mempolicy.c +index 818753635e427d..f089de8564cadb 100644 +--- a/mm/mempolicy.c ++++ b/mm/mempolicy.c +@@ -2921,8 +2921,9 @@ int mpol_parse_str(char *str, struct mempolicy **mpol) + * @pol: pointer to mempolicy to be formatted + * + * Convert @pol into a string. If @buffer is too short, truncate the string. +- * Recommend a @maxlen of at least 32 for the longest mode, "interleave", the +- * longest flag, "relative", and to display at least a few node ids. ++ * Recommend a @maxlen of at least 51 for the longest mode, "weighted ++ * interleave", plus the longest flag flags, "relative|balancing", and to ++ * display at least a few node ids. + */ + void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol) + { +@@ -2931,7 +2932,10 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol) + unsigned short mode = MPOL_DEFAULT; + unsigned short flags = 0; + +- if (pol && pol != &default_policy && !(pol->flags & MPOL_F_MORON)) { ++ if (pol && ++ pol != &default_policy && ++ !(pol >= &preferred_node_policy[0] && ++ pol <= &preferred_node_policy[ARRAY_SIZE(preferred_node_policy) - 1])) { + mode = pol->mode; + flags = pol->flags; + } +@@ -2958,12 +2962,18 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol) + p += snprintf(p, buffer + maxlen - p, "="); + + /* +- * Currently, the only defined flags are mutually exclusive ++ * Static and relative are mutually exclusive. + */ + if (flags & MPOL_F_STATIC_NODES) + p += snprintf(p, buffer + maxlen - p, "static"); + else if (flags & MPOL_F_RELATIVE_NODES) + p += snprintf(p, buffer + maxlen - p, "relative"); ++ ++ if (flags & MPOL_F_NUMA_BALANCING) { ++ if (!is_power_of_2(flags & MPOL_MODE_FLAGS)) ++ p += snprintf(p, buffer + maxlen - p, "|"); ++ p += snprintf(p, buffer + maxlen - p, "balancing"); ++ } + } + + if (!nodes_empty(nodes)) +diff --git a/mm/mmap_lock.c b/mm/mmap_lock.c +index 1854850b4b897f..368b840e75082c 100644 +--- a/mm/mmap_lock.c ++++ b/mm/mmap_lock.c +@@ -19,14 +19,7 @@ EXPORT_TRACEPOINT_SYMBOL(mmap_lock_released); + + #ifdef CONFIG_MEMCG + +-/* +- * Our various events all share the same buffer (because we don't want or need +- * to allocate a set of buffers *per event type*), so we need to protect against +- * concurrent _reg() and _unreg() calls, and count how many _reg() calls have +- * been made. +- */ +-static DEFINE_MUTEX(reg_lock); +-static int reg_refcount; /* Protected by reg_lock. */ ++static atomic_t reg_refcount; + + /* + * Size of the buffer for memcg path names. Ignoring stack trace support, +@@ -34,136 +27,22 @@ static int reg_refcount; /* Protected by reg_lock. */ + */ + #define MEMCG_PATH_BUF_SIZE MAX_FILTER_STR_VAL + +-/* +- * How many contexts our trace events might be called in: normal, softirq, irq, +- * and NMI. +- */ +-#define CONTEXT_COUNT 4 +- +-struct memcg_path { +- local_lock_t lock; +- char __rcu *buf; +- local_t buf_idx; +-}; +-static DEFINE_PER_CPU(struct memcg_path, memcg_paths) = { +- .lock = INIT_LOCAL_LOCK(lock), +- .buf_idx = LOCAL_INIT(0), +-}; +- +-static char **tmp_bufs; +- +-/* Called with reg_lock held. */ +-static void free_memcg_path_bufs(void) +-{ +- struct memcg_path *memcg_path; +- int cpu; +- char **old = tmp_bufs; +- +- for_each_possible_cpu(cpu) { +- memcg_path = per_cpu_ptr(&memcg_paths, cpu); +- *(old++) = rcu_dereference_protected(memcg_path->buf, +- lockdep_is_held(®_lock)); +- rcu_assign_pointer(memcg_path->buf, NULL); +- } +- +- /* Wait for inflight memcg_path_buf users to finish. */ +- synchronize_rcu(); +- +- old = tmp_bufs; +- for_each_possible_cpu(cpu) { +- kfree(*(old++)); +- } +- +- kfree(tmp_bufs); +- tmp_bufs = NULL; +-} +- + int trace_mmap_lock_reg(void) + { +- int cpu; +- char *new; +- +- mutex_lock(®_lock); +- +- /* If the refcount is going 0->1, proceed with allocating buffers. */ +- if (reg_refcount++) +- goto out; +- +- tmp_bufs = kmalloc_array(num_possible_cpus(), sizeof(*tmp_bufs), +- GFP_KERNEL); +- if (tmp_bufs == NULL) +- goto out_fail; +- +- for_each_possible_cpu(cpu) { +- new = kmalloc(MEMCG_PATH_BUF_SIZE * CONTEXT_COUNT, GFP_KERNEL); +- if (new == NULL) +- goto out_fail_free; +- rcu_assign_pointer(per_cpu_ptr(&memcg_paths, cpu)->buf, new); +- /* Don't need to wait for inflights, they'd have gotten NULL. */ +- } +- +-out: +- mutex_unlock(®_lock); ++ atomic_inc(®_refcount); + return 0; +- +-out_fail_free: +- free_memcg_path_bufs(); +-out_fail: +- /* Since we failed, undo the earlier ref increment. */ +- --reg_refcount; +- +- mutex_unlock(®_lock); +- return -ENOMEM; + } + + void trace_mmap_lock_unreg(void) + { +- mutex_lock(®_lock); +- +- /* If the refcount is going 1->0, proceed with freeing buffers. */ +- if (--reg_refcount) +- goto out; +- +- free_memcg_path_bufs(); +- +-out: +- mutex_unlock(®_lock); +-} +- +-static inline char *get_memcg_path_buf(void) +-{ +- struct memcg_path *memcg_path = this_cpu_ptr(&memcg_paths); +- char *buf; +- int idx; +- +- rcu_read_lock(); +- buf = rcu_dereference(memcg_path->buf); +- if (buf == NULL) { +- rcu_read_unlock(); +- return NULL; +- } +- idx = local_add_return(MEMCG_PATH_BUF_SIZE, &memcg_path->buf_idx) - +- MEMCG_PATH_BUF_SIZE; +- return &buf[idx]; ++ atomic_dec(®_refcount); + } + +-static inline void put_memcg_path_buf(void) +-{ +- local_sub(MEMCG_PATH_BUF_SIZE, &this_cpu_ptr(&memcg_paths)->buf_idx); +- rcu_read_unlock(); +-} +- +-#define TRACE_MMAP_LOCK_EVENT(type, mm, ...) \ +- do { \ +- const char *memcg_path; \ +- local_lock(&memcg_paths.lock); \ +- memcg_path = get_mm_memcg_path(mm); \ +- trace_mmap_lock_##type(mm, \ +- memcg_path != NULL ? memcg_path : "", \ +- ##__VA_ARGS__); \ +- if (likely(memcg_path != NULL)) \ +- put_memcg_path_buf(); \ +- local_unlock(&memcg_paths.lock); \ ++#define TRACE_MMAP_LOCK_EVENT(type, mm, ...) \ ++ do { \ ++ char buf[MEMCG_PATH_BUF_SIZE]; \ ++ get_mm_memcg_path(mm, buf, sizeof(buf)); \ ++ trace_mmap_lock_##type(mm, buf, ##__VA_ARGS__); \ + } while (0) + + #else /* !CONFIG_MEMCG */ +@@ -185,37 +64,23 @@ void trace_mmap_lock_unreg(void) + #ifdef CONFIG_TRACING + #ifdef CONFIG_MEMCG + /* +- * Write the given mm_struct's memcg path to a percpu buffer, and return a +- * pointer to it. If the path cannot be determined, or no buffer was available +- * (because the trace event is being unregistered), NULL is returned. +- * +- * Note: buffers are allocated per-cpu to avoid locking, so preemption must be +- * disabled by the caller before calling us, and re-enabled only after the +- * caller is done with the pointer. +- * +- * The caller must call put_memcg_path_buf() once the buffer is no longer +- * needed. This must be done while preemption is still disabled. ++ * Write the given mm_struct's memcg path to a buffer. If the path cannot be ++ * determined or the trace event is being unregistered, empty string is written. + */ +-static const char *get_mm_memcg_path(struct mm_struct *mm) ++static void get_mm_memcg_path(struct mm_struct *mm, char *buf, size_t buflen) + { +- char *buf = NULL; +- struct mem_cgroup *memcg = get_mem_cgroup_from_mm(mm); ++ struct mem_cgroup *memcg; + ++ buf[0] = '\0'; ++ /* No need to get path if no trace event is registered. */ ++ if (!atomic_read(®_refcount)) ++ return; ++ memcg = get_mem_cgroup_from_mm(mm); + if (memcg == NULL) +- goto out; +- if (unlikely(memcg->css.cgroup == NULL)) +- goto out_put; +- +- buf = get_memcg_path_buf(); +- if (buf == NULL) +- goto out_put; +- +- cgroup_path(memcg->css.cgroup, buf, MEMCG_PATH_BUF_SIZE); +- +-out_put: ++ return; ++ if (memcg->css.cgroup) ++ cgroup_path(memcg->css.cgroup, buf, buflen); + css_put(&memcg->css); +-out: +- return buf; + } + + #endif /* CONFIG_MEMCG */ +diff --git a/net/bluetooth/l2cap_core.c b/net/bluetooth/l2cap_core.c +index 43a21a90619d98..4d5dd82f261443 100644 +--- a/net/bluetooth/l2cap_core.c ++++ b/net/bluetooth/l2cap_core.c +@@ -7767,6 +7767,7 @@ static void l2cap_conless_channel(struct l2cap_conn *conn, __le16 psm, + bt_cb(skb)->l2cap.psm = psm; + + if (!chan->ops->recv(chan, skb)) { ++ l2cap_chan_unlock(chan); + l2cap_chan_put(chan); + return; + } +diff --git a/net/bridge/br_multicast.c b/net/bridge/br_multicast.c +index 9765f9f9bf7ff0..3cd2b648408d67 100644 +--- a/net/bridge/br_multicast.c ++++ b/net/bridge/br_multicast.c +@@ -1890,16 +1890,14 @@ void br_multicast_del_port(struct net_bridge_port *port) + { + struct net_bridge *br = port->br; + struct net_bridge_port_group *pg; +- HLIST_HEAD(deleted_head); + struct hlist_node *n; + + /* Take care of the remaining groups, only perm ones should be left */ + spin_lock_bh(&br->multicast_lock); + hlist_for_each_entry_safe(pg, n, &port->mglist, mglist) + br_multicast_find_del_pg(br, pg); +- hlist_move_list(&br->mcast_gc_list, &deleted_head); + spin_unlock_bh(&br->multicast_lock); +- br_multicast_gc(&deleted_head); ++ flush_work(&br->mcast_gc_work); + br_multicast_port_ctx_deinit(&port->multicast_ctx); + free_percpu(port->mcast_stats); + } +diff --git a/net/core/filter.c b/net/core/filter.c +index a873c8fd51b677..a92a35c0f1e72e 100644 +--- a/net/core/filter.c ++++ b/net/core/filter.c +@@ -3507,13 +3507,20 @@ static int bpf_skb_net_grow(struct sk_buff *skb, u32 off, u32 len_diff, + if (skb_is_gso(skb)) { + struct skb_shared_info *shinfo = skb_shinfo(skb); + +- /* Due to header grow, MSS needs to be downgraded. */ +- if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO)) +- skb_decrease_gso_size(shinfo, len_diff); +- + /* Header must be checked, and gso_segs recomputed. */ + shinfo->gso_type |= gso_type; + shinfo->gso_segs = 0; ++ ++ /* Due to header growth, MSS needs to be downgraded. ++ * There is a BUG_ON() when segmenting the frag_list with ++ * head_frag true, so linearize the skb after downgrading ++ * the MSS. ++ */ ++ if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO)) { ++ skb_decrease_gso_size(shinfo, len_diff); ++ if (shinfo->frag_list) ++ return skb_linearize(skb); ++ } + } + + return 0; +diff --git a/net/core/link_watch.c b/net/core/link_watch.c +index 9599afd0862dab..010b39f4a189b2 100644 +--- a/net/core/link_watch.c ++++ b/net/core/link_watch.c +@@ -138,9 +138,9 @@ static void linkwatch_schedule_work(int urgent) + * override the existing timer. + */ + if (test_bit(LW_URGENT, &linkwatch_flags)) +- mod_delayed_work(system_wq, &linkwatch_work, 0); ++ mod_delayed_work(system_unbound_wq, &linkwatch_work, 0); + else +- schedule_delayed_work(&linkwatch_work, delay); ++ queue_delayed_work(system_unbound_wq, &linkwatch_work, delay); + } + + +diff --git a/net/core/rtnetlink.c b/net/core/rtnetlink.c +index d25632fbfa892d..eca7f6f4a52f5a 100644 +--- a/net/core/rtnetlink.c ++++ b/net/core/rtnetlink.c +@@ -2617,17 +2617,23 @@ static int do_set_proto_down(struct net_device *dev, + static int do_setlink(const struct sk_buff *skb, + struct net_device *dev, struct ifinfomsg *ifm, + struct netlink_ext_ack *extack, +- struct nlattr **tb, char *ifname, int status) ++ struct nlattr **tb, int status) + { + const struct net_device_ops *ops = dev->netdev_ops; ++ char ifname[IFNAMSIZ]; + int err; + + err = validate_linkmsg(dev, tb, extack); + if (err < 0) + return err; + ++ if (tb[IFLA_IFNAME]) ++ nla_strscpy(ifname, tb[IFLA_IFNAME], IFNAMSIZ); ++ else ++ ifname[0] = '\0'; ++ + if (tb[IFLA_NET_NS_PID] || tb[IFLA_NET_NS_FD] || tb[IFLA_TARGET_NETNSID]) { +- const char *pat = ifname && ifname[0] ? ifname : NULL; ++ const char *pat = ifname[0] ? ifname : NULL; + struct net *net; + int new_ifindex; + +@@ -2974,21 +2980,16 @@ static int do_setlink(const struct sk_buff *skb, + } + + static struct net_device *rtnl_dev_get(struct net *net, +- struct nlattr *ifname_attr, +- struct nlattr *altifname_attr, +- char *ifname) +-{ +- char buffer[ALTIFNAMSIZ]; +- +- if (!ifname) { +- ifname = buffer; +- if (ifname_attr) +- nla_strscpy(ifname, ifname_attr, IFNAMSIZ); +- else if (altifname_attr) +- nla_strscpy(ifname, altifname_attr, ALTIFNAMSIZ); +- else +- return NULL; +- } ++ struct nlattr *tb[]) ++{ ++ char ifname[ALTIFNAMSIZ]; ++ ++ if (tb[IFLA_IFNAME]) ++ nla_strscpy(ifname, tb[IFLA_IFNAME], IFNAMSIZ); ++ else if (tb[IFLA_ALT_IFNAME]) ++ nla_strscpy(ifname, tb[IFLA_ALT_IFNAME], ALTIFNAMSIZ); ++ else ++ return NULL; + + return __dev_get_by_name(net, ifname); + } +@@ -3001,7 +3002,6 @@ static int rtnl_setlink(struct sk_buff *skb, struct nlmsghdr *nlh, + struct net_device *dev; + int err; + struct nlattr *tb[IFLA_MAX+1]; +- char ifname[IFNAMSIZ]; + + err = nlmsg_parse_deprecated(nlh, sizeof(*ifm), tb, IFLA_MAX, + ifla_policy, extack); +@@ -3012,17 +3012,12 @@ static int rtnl_setlink(struct sk_buff *skb, struct nlmsghdr *nlh, + if (err < 0) + goto errout; + +- if (tb[IFLA_IFNAME]) +- nla_strscpy(ifname, tb[IFLA_IFNAME], IFNAMSIZ); +- else +- ifname[0] = '\0'; +- + err = -EINVAL; + ifm = nlmsg_data(nlh); + if (ifm->ifi_index > 0) + dev = __dev_get_by_index(net, ifm->ifi_index); + else if (tb[IFLA_IFNAME] || tb[IFLA_ALT_IFNAME]) +- dev = rtnl_dev_get(net, NULL, tb[IFLA_ALT_IFNAME], ifname); ++ dev = rtnl_dev_get(net, tb); + else + goto errout; + +@@ -3031,7 +3026,7 @@ static int rtnl_setlink(struct sk_buff *skb, struct nlmsghdr *nlh, + goto errout; + } + +- err = do_setlink(skb, dev, ifm, extack, tb, ifname, 0); ++ err = do_setlink(skb, dev, ifm, extack, tb, 0); + errout: + return err; + } +@@ -3120,8 +3115,7 @@ static int rtnl_dellink(struct sk_buff *skb, struct nlmsghdr *nlh, + if (ifm->ifi_index > 0) + dev = __dev_get_by_index(tgt_net, ifm->ifi_index); + else if (tb[IFLA_IFNAME] || tb[IFLA_ALT_IFNAME]) +- dev = rtnl_dev_get(net, tb[IFLA_IFNAME], +- tb[IFLA_ALT_IFNAME], NULL); ++ dev = rtnl_dev_get(tgt_net, tb); + else if (tb[IFLA_GROUP]) + err = rtnl_group_dellink(tgt_net, nla_get_u32(tb[IFLA_GROUP])); + else +@@ -3267,7 +3261,7 @@ static int rtnl_group_changelink(const struct sk_buff *skb, + + for_each_netdev_safe(net, dev, aux) { + if (dev->group == group) { +- err = do_setlink(skb, dev, ifm, extack, tb, NULL, 0); ++ err = do_setlink(skb, dev, ifm, extack, tb, 0); + if (err < 0) + return err; + } +@@ -3309,11 +3303,6 @@ static int __rtnl_newlink(struct sk_buff *skb, struct nlmsghdr *nlh, + if (err < 0) + return err; + +- if (tb[IFLA_IFNAME]) +- nla_strscpy(ifname, tb[IFLA_IFNAME], IFNAMSIZ); +- else +- ifname[0] = '\0'; +- + ifm = nlmsg_data(nlh); + if (ifm->ifi_index > 0) { + link_specified = true; +@@ -3323,7 +3312,7 @@ static int __rtnl_newlink(struct sk_buff *skb, struct nlmsghdr *nlh, + return -EINVAL; + } else if (tb[IFLA_IFNAME] || tb[IFLA_ALT_IFNAME]) { + link_specified = true; +- dev = rtnl_dev_get(net, NULL, tb[IFLA_ALT_IFNAME], ifname); ++ dev = rtnl_dev_get(net, tb); + } else { + link_specified = false; + dev = NULL; +@@ -3426,7 +3415,7 @@ static int __rtnl_newlink(struct sk_buff *skb, struct nlmsghdr *nlh, + status |= DO_SETLINK_NOTIFY; + } + +- return do_setlink(skb, dev, ifm, extack, tb, ifname, status); ++ return do_setlink(skb, dev, ifm, extack, tb, status); + } + + if (!(nlh->nlmsg_flags & NLM_F_CREATE)) { +@@ -3463,7 +3452,9 @@ static int __rtnl_newlink(struct sk_buff *skb, struct nlmsghdr *nlh, + if (!ops->alloc && !ops->setup) + return -EOPNOTSUPP; + +- if (!ifname[0]) { ++ if (tb[IFLA_IFNAME]) { ++ nla_strscpy(ifname, tb[IFLA_IFNAME], IFNAMSIZ); ++ } else { + snprintf(ifname, IFNAMSIZ, "%s%%d", ops->kind); + name_assign_type = NET_NAME_ENUM; + } +@@ -3635,8 +3626,7 @@ static int rtnl_getlink(struct sk_buff *skb, struct nlmsghdr *nlh, + if (ifm->ifi_index > 0) + dev = __dev_get_by_index(tgt_net, ifm->ifi_index); + else if (tb[IFLA_IFNAME] || tb[IFLA_ALT_IFNAME]) +- dev = rtnl_dev_get(tgt_net, tb[IFLA_IFNAME], +- tb[IFLA_ALT_IFNAME], NULL); ++ dev = rtnl_dev_get(tgt_net, tb); + else + goto out; + +@@ -3731,8 +3721,7 @@ static int rtnl_linkprop(int cmd, struct sk_buff *skb, struct nlmsghdr *nlh, + if (ifm->ifi_index > 0) + dev = __dev_get_by_index(net, ifm->ifi_index); + else if (tb[IFLA_IFNAME] || tb[IFLA_ALT_IFNAME]) +- dev = rtnl_dev_get(net, tb[IFLA_IFNAME], +- tb[IFLA_ALT_IFNAME], NULL); ++ dev = rtnl_dev_get(net, tb); + else + return -EINVAL; + +diff --git a/net/core/xdp.c b/net/core/xdp.c +index e9a9694c4fdcc3..4a9c2f4eceda8b 100644 +--- a/net/core/xdp.c ++++ b/net/core/xdp.c +@@ -124,10 +124,8 @@ void xdp_unreg_mem_model(struct xdp_mem_info *mem) + return; + + if (type == MEM_TYPE_PAGE_POOL) { +- rcu_read_lock(); +- xa = rhashtable_lookup(mem_id_ht, &id, mem_id_rht_params); ++ xa = rhashtable_lookup_fast(mem_id_ht, &id, mem_id_rht_params); + page_pool_destroy(xa->page_pool); +- rcu_read_unlock(); + } + } + EXPORT_SYMBOL_GPL(xdp_unreg_mem_model); +diff --git a/net/ipv4/esp4.c b/net/ipv4/esp4.c +index ca0cd94eb22d1b..e578d065d9046e 100644 +--- a/net/ipv4/esp4.c ++++ b/net/ipv4/esp4.c +@@ -237,8 +237,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb) + #else + static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb) + { +- kfree_skb(skb); +- ++ WARN_ON(1); + return -EOPNOTSUPP; + } + #endif +diff --git a/net/ipv4/netfilter/iptable_nat.c b/net/ipv4/netfilter/iptable_nat.c +index 45d7e072e6a549..226000a7408602 100644 +--- a/net/ipv4/netfilter/iptable_nat.c ++++ b/net/ipv4/netfilter/iptable_nat.c +@@ -152,25 +152,27 @@ static struct pernet_operations iptable_nat_net_ops = { + + static int __init iptable_nat_init(void) + { +- int ret = xt_register_template(&nf_nat_ipv4_table, +- iptable_nat_table_init); ++ int ret; + ++ /* net->gen->ptr[iptable_nat_net_id] must be allocated ++ * before calling iptable_nat_table_init(). ++ */ ++ ret = register_pernet_subsys(&iptable_nat_net_ops); + if (ret < 0) + return ret; + +- ret = register_pernet_subsys(&iptable_nat_net_ops); +- if (ret < 0) { +- xt_unregister_template(&nf_nat_ipv4_table); +- return ret; +- } ++ ret = xt_register_template(&nf_nat_ipv4_table, ++ iptable_nat_table_init); ++ if (ret < 0) ++ unregister_pernet_subsys(&iptable_nat_net_ops); + + return ret; + } + + static void __exit iptable_nat_exit(void) + { +- unregister_pernet_subsys(&iptable_nat_net_ops); + xt_unregister_template(&nf_nat_ipv4_table); ++ unregister_pernet_subsys(&iptable_nat_net_ops); + } + + module_init(iptable_nat_init); +diff --git a/net/ipv4/nexthop.c b/net/ipv4/nexthop.c +index c140a36bd1e65e..633eab6ff55dd7 100644 +--- a/net/ipv4/nexthop.c ++++ b/net/ipv4/nexthop.c +@@ -675,9 +675,10 @@ static int nla_put_nh_group(struct sk_buff *skb, struct nh_group *nhg) + + p = nla_data(nla); + for (i = 0; i < nhg->num_nh; ++i) { +- p->id = nhg->nh_entries[i].nh->id; +- p->weight = nhg->nh_entries[i].weight - 1; +- p += 1; ++ *p++ = (struct nexthop_grp) { ++ .id = nhg->nh_entries[i].nh->id, ++ .weight = nhg->nh_entries[i].weight - 1, ++ }; + } + + if (nhg->resilient && nla_put_nh_group_res(skb, nhg)) +diff --git a/net/ipv4/route.c b/net/ipv4/route.c +index e7130a9f0e1a98..60fc35defdf8b0 100644 +--- a/net/ipv4/route.c ++++ b/net/ipv4/route.c +@@ -1282,7 +1282,7 @@ void ip_rt_get_source(u8 *addr, struct sk_buff *skb, struct rtable *rt) + struct flowi4 fl4 = { + .daddr = iph->daddr, + .saddr = iph->saddr, +- .flowi4_tos = RT_TOS(iph->tos), ++ .flowi4_tos = iph->tos & IPTOS_RT_MASK, + .flowi4_oif = rt->dst.dev->ifindex, + .flowi4_iif = skb->dev->ifindex, + .flowi4_mark = skb->mark, +diff --git a/net/ipv4/tcp.c b/net/ipv4/tcp.c +index c1602b36dee42c..3c85ecab144571 100644 +--- a/net/ipv4/tcp.c ++++ b/net/ipv4/tcp.c +@@ -592,9 +592,10 @@ __poll_t tcp_poll(struct file *file, struct socket *sock, poll_table *wait) + */ + mask |= EPOLLOUT | EPOLLWRNORM; + } +- /* This barrier is coupled with smp_wmb() in tcp_reset() */ ++ /* This barrier is coupled with smp_wmb() in tcp_done_with_error() */ + smp_rmb(); +- if (sk->sk_err || !skb_queue_empty_lockless(&sk->sk_error_queue)) ++ if (READ_ONCE(sk->sk_err) || ++ !skb_queue_empty_lockless(&sk->sk_error_queue)) + mask |= EPOLLERR; + + return mask; +@@ -2995,7 +2996,7 @@ int tcp_disconnect(struct sock *sk, int flags) + if (old_state == TCP_LISTEN) { + inet_csk_listen_stop(sk); + } else if (unlikely(tp->repair)) { +- sk->sk_err = ECONNABORTED; ++ WRITE_ONCE(sk->sk_err, ECONNABORTED); + } else if (tcp_need_reset(old_state) || + (tp->snd_nxt != tp->write_seq && + (1 << old_state) & (TCPF_CLOSING | TCPF_LAST_ACK))) { +@@ -3003,9 +3004,9 @@ int tcp_disconnect(struct sock *sk, int flags) + * states + */ + tcp_send_active_reset(sk, gfp_any()); +- sk->sk_err = ECONNRESET; ++ WRITE_ONCE(sk->sk_err, ECONNRESET); + } else if (old_state == TCP_SYN_SENT) +- sk->sk_err = ECONNRESET; ++ WRITE_ONCE(sk->sk_err, ECONNRESET); + + tcp_clear_xmit_timers(sk); + __skb_queue_purge(&sk->sk_receive_queue); +@@ -4513,7 +4514,7 @@ int tcp_abort(struct sock *sk, int err) + bh_lock_sock(sk); + + if (!sock_flag(sk, SOCK_DEAD)) { +- sk->sk_err = err; ++ WRITE_ONCE(sk->sk_err, err); + /* This barrier is coupled with smp_rmb() in tcp_poll() */ + smp_wmb(); + sk_error_report(sk); +diff --git a/net/ipv4/tcp_input.c b/net/ipv4/tcp_input.c +index 48d45022dedaf5..c51ad6b353eef4 100644 +--- a/net/ipv4/tcp_input.c ++++ b/net/ipv4/tcp_input.c +@@ -3915,7 +3915,7 @@ static int tcp_ack(struct sock *sk, const struct sk_buff *skb, int flag) + /* We passed data and got it acked, remove any soft error + * log. Something worked... + */ +- sk->sk_err_soft = 0; ++ WRITE_ONCE(sk->sk_err_soft, 0); + icsk->icsk_probes_out = 0; + tp->rcv_tstamp = tcp_jiffies32; + if (!prior_packets) +@@ -4348,9 +4348,26 @@ static inline bool tcp_sequence(const struct tcp_sock *tp, u32 seq, u32 end_seq) + !after(seq, tp->rcv_nxt + tcp_receive_window(tp)); + } + ++ ++void tcp_done_with_error(struct sock *sk, int err) ++{ ++ /* This barrier is coupled with smp_rmb() in tcp_poll() */ ++ WRITE_ONCE(sk->sk_err, err); ++ smp_wmb(); ++ ++ tcp_write_queue_purge(sk); ++ tcp_done(sk); ++ ++ if (!sock_flag(sk, SOCK_DEAD)) ++ sk_error_report(sk); ++} ++EXPORT_SYMBOL(tcp_done_with_error); ++ + /* When we get a reset we do this. */ + void tcp_reset(struct sock *sk, struct sk_buff *skb) + { ++ int err; ++ + trace_tcp_receive_reset(sk); + + /* mptcp can't tell us to ignore reset pkts, +@@ -4362,24 +4379,17 @@ void tcp_reset(struct sock *sk, struct sk_buff *skb) + /* We want the right error as BSD sees it (and indeed as we do). */ + switch (sk->sk_state) { + case TCP_SYN_SENT: +- sk->sk_err = ECONNREFUSED; ++ err = ECONNREFUSED; + break; + case TCP_CLOSE_WAIT: +- sk->sk_err = EPIPE; ++ err = EPIPE; + break; + case TCP_CLOSE: + return; + default: +- sk->sk_err = ECONNRESET; ++ err = ECONNRESET; + } +- /* This barrier is coupled with smp_rmb() in tcp_poll() */ +- smp_wmb(); +- +- tcp_write_queue_purge(sk); +- tcp_done(sk); +- +- if (!sock_flag(sk, SOCK_DEAD)) +- sk_error_report(sk); ++ tcp_done_with_error(sk, err); + } + + /* +diff --git a/net/ipv4/tcp_ipv4.c b/net/ipv4/tcp_ipv4.c +index e9b1dcf2d463af..44a9fa957301b5 100644 +--- a/net/ipv4/tcp_ipv4.c ++++ b/net/ipv4/tcp_ipv4.c +@@ -361,7 +361,7 @@ void tcp_v4_mtu_reduced(struct sock *sk) + * for the case, if this connection will not able to recover. + */ + if (mtu < dst_mtu(dst) && ip_dont_fragment(sk, dst)) +- sk->sk_err_soft = EMSGSIZE; ++ WRITE_ONCE(sk->sk_err_soft, EMSGSIZE); + + mtu = dst_mtu(dst); + +@@ -592,15 +592,10 @@ int tcp_v4_err(struct sk_buff *skb, u32 info) + + ip_icmp_error(sk, skb, err, th->dest, info, (u8 *)th); + +- if (!sock_owned_by_user(sk)) { +- sk->sk_err = err; +- +- sk_error_report(sk); +- +- tcp_done(sk); +- } else { +- sk->sk_err_soft = err; +- } ++ if (!sock_owned_by_user(sk)) ++ tcp_done_with_error(sk, err); ++ else ++ WRITE_ONCE(sk->sk_err_soft, err); + goto out; + } + +@@ -622,10 +617,10 @@ int tcp_v4_err(struct sk_buff *skb, u32 info) + + inet = inet_sk(sk); + if (!sock_owned_by_user(sk) && inet->recverr) { +- sk->sk_err = err; ++ WRITE_ONCE(sk->sk_err, err); + sk_error_report(sk); + } else { /* Only an error on timeout */ +- sk->sk_err_soft = err; ++ WRITE_ONCE(sk->sk_err_soft, err); + } + + out: +diff --git a/net/ipv4/tcp_output.c b/net/ipv4/tcp_output.c +index 0fb84e57a2d490..2c9670c8320204 100644 +--- a/net/ipv4/tcp_output.c ++++ b/net/ipv4/tcp_output.c +@@ -3724,7 +3724,7 @@ static void tcp_connect_init(struct sock *sk) + tp->rx_opt.rcv_wscale = rcv_wscale; + tp->rcv_ssthresh = tp->rcv_wnd; + +- sk->sk_err = 0; ++ WRITE_ONCE(sk->sk_err, 0); + sock_reset_flag(sk, SOCK_DONE); + tp->snd_wnd = 0; + tcp_init_wl(tp, 0); +diff --git a/net/ipv4/tcp_timer.c b/net/ipv4/tcp_timer.c +index 11569900b729fe..1a3a84992b9be5 100644 +--- a/net/ipv4/tcp_timer.c ++++ b/net/ipv4/tcp_timer.c +@@ -67,11 +67,7 @@ u32 tcp_clamp_probe0_to_user_timeout(const struct sock *sk, u32 when) + + static void tcp_write_err(struct sock *sk) + { +- sk->sk_err = sk->sk_err_soft ? : ETIMEDOUT; +- sk_error_report(sk); +- +- tcp_write_queue_purge(sk); +- tcp_done(sk); ++ tcp_done_with_error(sk, READ_ONCE(sk->sk_err_soft) ? : ETIMEDOUT); + __NET_INC_STATS(sock_net(sk), LINUX_MIB_TCPABORTONTIMEOUT); + } + +@@ -110,7 +106,7 @@ static int tcp_out_of_resources(struct sock *sk, bool do_reset) + shift++; + + /* If some dubious ICMP arrived, penalize even more. */ +- if (sk->sk_err_soft) ++ if (READ_ONCE(sk->sk_err_soft)) + shift++; + + if (tcp_check_oom(sk, shift)) { +@@ -146,7 +142,7 @@ static int tcp_orphan_retries(struct sock *sk, bool alive) + int retries = READ_ONCE(sock_net(sk)->ipv4.sysctl_tcp_orphan_retries); /* May be zero. */ + + /* We know from an ICMP that something is wrong. */ +- if (sk->sk_err_soft && !alive) ++ if (READ_ONCE(sk->sk_err_soft) && !alive) + retries = 0; + + /* However, if socket sent something recently, select some safe +diff --git a/net/ipv6/addrconf.c b/net/ipv6/addrconf.c +index ba22470b74768e..932a10f64adcb1 100644 +--- a/net/ipv6/addrconf.c ++++ b/net/ipv6/addrconf.c +@@ -1831,7 +1831,8 @@ int ipv6_dev_get_saddr(struct net *net, const struct net_device *dst_dev, + master, &dst, + scores, hiscore_idx); + +- if (scores[hiscore_idx].ifa) ++ if (scores[hiscore_idx].ifa && ++ scores[hiscore_idx].scopedist >= 0) + goto out; + } + +diff --git a/net/ipv6/esp6.c b/net/ipv6/esp6.c +index 26d476494676e2..a4b8c70ae52754 100644 +--- a/net/ipv6/esp6.c ++++ b/net/ipv6/esp6.c +@@ -255,8 +255,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb) + #else + static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb) + { +- kfree_skb(skb); +- ++ WARN_ON(1); + return -EOPNOTSUPP; + } + #endif +diff --git a/net/ipv6/ndisc.c b/net/ipv6/ndisc.c +index 856edbe81e11ab..d56e80741c5ba2 100644 +--- a/net/ipv6/ndisc.c ++++ b/net/ipv6/ndisc.c +@@ -226,6 +226,7 @@ struct ndisc_options *ndisc_parse_options(const struct net_device *dev, + return NULL; + memset(ndopts, 0, sizeof(*ndopts)); + while (opt_len) { ++ bool unknown = false; + int l; + if (opt_len < sizeof(struct nd_opt_hdr)) + return NULL; +@@ -261,22 +262,23 @@ struct ndisc_options *ndisc_parse_options(const struct net_device *dev, + break; + #endif + default: +- if (ndisc_is_useropt(dev, nd_opt)) { +- ndopts->nd_useropts_end = nd_opt; +- if (!ndopts->nd_useropts) +- ndopts->nd_useropts = nd_opt; +- } else { +- /* +- * Unknown options must be silently ignored, +- * to accommodate future extension to the +- * protocol. +- */ +- ND_PRINTK(2, notice, +- "%s: ignored unsupported option; type=%d, len=%d\n", +- __func__, +- nd_opt->nd_opt_type, +- nd_opt->nd_opt_len); +- } ++ unknown = true; ++ } ++ if (ndisc_is_useropt(dev, nd_opt)) { ++ ndopts->nd_useropts_end = nd_opt; ++ if (!ndopts->nd_useropts) ++ ndopts->nd_useropts = nd_opt; ++ } else if (unknown) { ++ /* ++ * Unknown options must be silently ignored, ++ * to accommodate future extension to the ++ * protocol. ++ */ ++ ND_PRINTK(2, notice, ++ "%s: ignored unsupported option; type=%d, len=%d\n", ++ __func__, ++ nd_opt->nd_opt_type, ++ nd_opt->nd_opt_len); + } + next_opt: + opt_len -= l; +diff --git a/net/ipv6/netfilter/ip6table_nat.c b/net/ipv6/netfilter/ip6table_nat.c +index 921c1723a01e4a..229a81cf1a7291 100644 +--- a/net/ipv6/netfilter/ip6table_nat.c ++++ b/net/ipv6/netfilter/ip6table_nat.c +@@ -154,23 +154,27 @@ static struct pernet_operations ip6table_nat_net_ops = { + + static int __init ip6table_nat_init(void) + { +- int ret = xt_register_template(&nf_nat_ipv6_table, +- ip6table_nat_table_init); ++ int ret; + ++ /* net->gen->ptr[ip6table_nat_net_id] must be allocated ++ * before calling ip6t_nat_register_lookups(). ++ */ ++ ret = register_pernet_subsys(&ip6table_nat_net_ops); + if (ret < 0) + return ret; + +- ret = register_pernet_subsys(&ip6table_nat_net_ops); ++ ret = xt_register_template(&nf_nat_ipv6_table, ++ ip6table_nat_table_init); + if (ret) +- xt_unregister_template(&nf_nat_ipv6_table); ++ unregister_pernet_subsys(&ip6table_nat_net_ops); + + return ret; + } + + static void __exit ip6table_nat_exit(void) + { +- unregister_pernet_subsys(&ip6table_nat_net_ops); + xt_unregister_template(&nf_nat_ipv6_table); ++ unregister_pernet_subsys(&ip6table_nat_net_ops); + } + + module_init(ip6table_nat_init); +diff --git a/net/ipv6/tcp_ipv6.c b/net/ipv6/tcp_ipv6.c +index 78c7b0fb6ffe73..fedbce7ed853e9 100644 +--- a/net/ipv6/tcp_ipv6.c ++++ b/net/ipv6/tcp_ipv6.c +@@ -485,13 +485,10 @@ static int tcp_v6_err(struct sk_buff *skb, struct inet6_skb_parm *opt, + + ipv6_icmp_error(sk, skb, err, th->dest, ntohl(info), (u8 *)th); + +- if (!sock_owned_by_user(sk)) { +- sk->sk_err = err; +- sk_error_report(sk); /* Wake people up to see the error (see connect in sock.c) */ +- +- tcp_done(sk); +- } else +- sk->sk_err_soft = err; ++ if (!sock_owned_by_user(sk)) ++ tcp_done_with_error(sk, err); ++ else ++ WRITE_ONCE(sk->sk_err_soft, err); + goto out; + case TCP_LISTEN: + break; +@@ -505,11 +502,11 @@ static int tcp_v6_err(struct sk_buff *skb, struct inet6_skb_parm *opt, + } + + if (!sock_owned_by_user(sk) && np->recverr) { +- sk->sk_err = err; ++ WRITE_ONCE(sk->sk_err, err); + sk_error_report(sk); +- } else +- sk->sk_err_soft = err; +- ++ } else { ++ WRITE_ONCE(sk->sk_err_soft, err); ++ } + out: + bh_unlock_sock(sk); + sock_put(sk); +diff --git a/net/iucv/af_iucv.c b/net/iucv/af_iucv.c +index 18316ee3c69214..e6cb3e1cbbf9b8 100644 +--- a/net/iucv/af_iucv.c ++++ b/net/iucv/af_iucv.c +@@ -336,8 +336,8 @@ static void iucv_sever_path(struct sock *sk, int with_user_data) + struct iucv_sock *iucv = iucv_sk(sk); + struct iucv_path *path = iucv->path; + +- if (iucv->path) { +- iucv->path = NULL; ++ /* Whoever resets the path pointer, must sever and free it. */ ++ if (xchg(&iucv->path, NULL)) { + if (with_user_data) { + low_nmcpy(user_data, iucv->src_name); + high_nmcpy(user_data, iucv->dst_name); +diff --git a/net/l2tp/l2tp_core.c b/net/l2tp/l2tp_core.c +index a2b13e213e06ff..acd5b67858ddce 100644 +--- a/net/l2tp/l2tp_core.c ++++ b/net/l2tp/l2tp_core.c +@@ -88,6 +88,11 @@ + /* Default trace flags */ + #define L2TP_DEFAULT_DEBUG_FLAGS 0 + ++#define L2TP_DEPTH_NESTING 2 ++#if L2TP_DEPTH_NESTING == SINGLE_DEPTH_NESTING ++#error "L2TP requires its own lockdep subclass" ++#endif ++ + /* Private data stored for received packets in the skb. + */ + struct l2tp_skb_cb { +@@ -1041,7 +1046,13 @@ static int l2tp_xmit_core(struct l2tp_session *session, struct sk_buff *skb, uns + IPCB(skb)->flags &= ~(IPSKB_XFRM_TUNNEL_SIZE | IPSKB_XFRM_TRANSFORMED | IPSKB_REROUTED); + nf_reset_ct(skb); + +- bh_lock_sock_nested(sk); ++ /* L2TP uses its own lockdep subclass to avoid lockdep splats caused by ++ * nested socket calls on the same lockdep socket class. This can ++ * happen when data from a user socket is routed over l2tp, which uses ++ * another userspace socket. ++ */ ++ spin_lock_nested(&sk->sk_lock.slock, L2TP_DEPTH_NESTING); ++ + if (sock_owned_by_user(sk)) { + kfree_skb(skb); + ret = NET_XMIT_DROP; +@@ -1093,7 +1104,7 @@ static int l2tp_xmit_core(struct l2tp_session *session, struct sk_buff *skb, uns + ret = l2tp_xmit_queue(tunnel, skb, &inet->cork.fl); + + out_unlock: +- bh_unlock_sock(sk); ++ spin_unlock(&sk->sk_lock.slock); + + return ret; + } +diff --git a/net/mac80211/cfg.c b/net/mac80211/cfg.c +index f277ce839ddb2e..f652982a106bae 100644 +--- a/net/mac80211/cfg.c ++++ b/net/mac80211/cfg.c +@@ -2339,6 +2339,17 @@ static int ieee80211_change_bss(struct wiphy *wiphy, + if (!sband) + return -EINVAL; + ++ if (params->basic_rates) { ++ if (!ieee80211_parse_bitrates(&sdata->vif.bss_conf.chandef, ++ wiphy->bands[sband->band], ++ params->basic_rates, ++ params->basic_rates_len, ++ &sdata->vif.bss_conf.basic_rates)) ++ return -EINVAL; ++ changed |= BSS_CHANGED_BASIC_RATES; ++ ieee80211_check_rate_mask(sdata); ++ } ++ + if (params->use_cts_prot >= 0) { + sdata->vif.bss_conf.use_cts_prot = params->use_cts_prot; + changed |= BSS_CHANGED_ERP_CTS_PROT; +@@ -2362,16 +2373,6 @@ static int ieee80211_change_bss(struct wiphy *wiphy, + changed |= BSS_CHANGED_ERP_SLOT; + } + +- if (params->basic_rates) { +- ieee80211_parse_bitrates(&sdata->vif.bss_conf.chandef, +- wiphy->bands[sband->band], +- params->basic_rates, +- params->basic_rates_len, +- &sdata->vif.bss_conf.basic_rates); +- changed |= BSS_CHANGED_BASIC_RATES; +- ieee80211_check_rate_mask(sdata); +- } +- + if (params->ap_isolate >= 0) { + if (params->ap_isolate) + sdata->flags |= IEEE80211_SDATA_DONT_BRIDGE_PACKETS; +diff --git a/net/mptcp/mib.c b/net/mptcp/mib.c +index 8d1c67b9359115..c2fadfcfd6d6a4 100644 +--- a/net/mptcp/mib.c ++++ b/net/mptcp/mib.c +@@ -19,7 +19,9 @@ static const struct snmp_mib mptcp_snmp_list[] = { + SNMP_MIB_ITEM("MPTCPRetrans", MPTCP_MIB_RETRANSSEGS), + SNMP_MIB_ITEM("MPJoinNoTokenFound", MPTCP_MIB_JOINNOTOKEN), + SNMP_MIB_ITEM("MPJoinSynRx", MPTCP_MIB_JOINSYNRX), ++ SNMP_MIB_ITEM("MPJoinSynBackupRx", MPTCP_MIB_JOINSYNBACKUPRX), + SNMP_MIB_ITEM("MPJoinSynAckRx", MPTCP_MIB_JOINSYNACKRX), ++ SNMP_MIB_ITEM("MPJoinSynAckBackupRx", MPTCP_MIB_JOINSYNACKBACKUPRX), + SNMP_MIB_ITEM("MPJoinSynAckHMacFailure", MPTCP_MIB_JOINSYNACKMAC), + SNMP_MIB_ITEM("MPJoinAckRx", MPTCP_MIB_JOINACKRX), + SNMP_MIB_ITEM("MPJoinAckHMacFailure", MPTCP_MIB_JOINACKMAC), +diff --git a/net/mptcp/mib.h b/net/mptcp/mib.h +index 2966fcb6548bac..90025acdcf7245 100644 +--- a/net/mptcp/mib.h ++++ b/net/mptcp/mib.h +@@ -12,7 +12,9 @@ enum linux_mptcp_mib_field { + MPTCP_MIB_RETRANSSEGS, /* Segments retransmitted at the MPTCP-level */ + MPTCP_MIB_JOINNOTOKEN, /* Received MP_JOIN but the token was not found */ + MPTCP_MIB_JOINSYNRX, /* Received a SYN + MP_JOIN */ ++ MPTCP_MIB_JOINSYNBACKUPRX, /* Received a SYN + MP_JOIN + backup flag */ + MPTCP_MIB_JOINSYNACKRX, /* Received a SYN/ACK + MP_JOIN */ ++ MPTCP_MIB_JOINSYNACKBACKUPRX, /* Received a SYN/ACK + MP_JOIN + backup flag */ + MPTCP_MIB_JOINSYNACKMAC, /* HMAC was wrong on SYN/ACK + MP_JOIN */ + MPTCP_MIB_JOINACKRX, /* Received an ACK + MP_JOIN */ + MPTCP_MIB_JOINACKMAC, /* HMAC was wrong on ACK + MP_JOIN */ +diff --git a/net/mptcp/options.c b/net/mptcp/options.c +index 3b4ce8a06f9995..2baed0c01922fa 100644 +--- a/net/mptcp/options.c ++++ b/net/mptcp/options.c +@@ -877,7 +877,7 @@ bool mptcp_synack_options(const struct request_sock *req, unsigned int *size, + return true; + } else if (subflow_req->mp_join) { + opts->suboptions = OPTION_MPTCP_MPJ_SYNACK; +- opts->backup = subflow_req->backup; ++ opts->backup = subflow_req->request_bkup; + opts->join_id = subflow_req->local_id; + opts->thmac = subflow_req->thmac; + opts->nonce = subflow_req->local_nonce; +@@ -923,7 +923,8 @@ static bool check_fully_established(struct mptcp_sock *msk, struct sock *ssk, + } + + if (((mp_opt->suboptions & OPTION_MPTCP_DSS) && mp_opt->use_ack) || +- ((mp_opt->suboptions & OPTION_MPTCP_ADD_ADDR) && !mp_opt->echo)) { ++ ((mp_opt->suboptions & OPTION_MPTCP_ADD_ADDR) && ++ (!mp_opt->echo || subflow->mp_join))) { + /* subflows are fully established as soon as we get any + * additional ack, including ADD_ADDR. + */ +diff --git a/net/mptcp/pm.c b/net/mptcp/pm.c +index d9790d6fbce9c4..55e8407bcc2500 100644 +--- a/net/mptcp/pm.c ++++ b/net/mptcp/pm.c +@@ -341,6 +341,15 @@ int mptcp_pm_get_local_id(struct mptcp_sock *msk, struct sock_common *skc) + return mptcp_pm_nl_get_local_id(msk, skc); + } + ++bool mptcp_pm_is_backup(struct mptcp_sock *msk, struct sock_common *skc) ++{ ++ struct mptcp_addr_info skc_local; ++ ++ mptcp_local_address((struct sock_common *)skc, &skc_local); ++ ++ return mptcp_pm_nl_is_backup(msk, &skc_local); ++} ++ + void mptcp_pm_subflow_chk_stale(const struct mptcp_sock *msk, struct sock *ssk) + { + struct mptcp_subflow_context *subflow = mptcp_subflow_ctx(ssk); +diff --git a/net/mptcp/pm_netlink.c b/net/mptcp/pm_netlink.c +index 7b312aa03e6b5b..1ae164711783f1 100644 +--- a/net/mptcp/pm_netlink.c ++++ b/net/mptcp/pm_netlink.c +@@ -97,8 +97,7 @@ static bool address_zero(const struct mptcp_addr_info *addr) + return addresses_equal(addr, &zero, true); + } + +-static void local_address(const struct sock_common *skc, +- struct mptcp_addr_info *addr) ++void mptcp_local_address(const struct sock_common *skc, struct mptcp_addr_info *addr) + { + addr->family = skc->skc_family; + addr->port = htons(skc->skc_num); +@@ -133,7 +132,7 @@ static bool lookup_subflow_by_saddr(const struct list_head *list, + list_for_each_entry(subflow, list, node) { + skc = (struct sock_common *)mptcp_subflow_tcp_sock(subflow); + +- local_address(skc, &cur); ++ mptcp_local_address(skc, &cur); + if (addresses_equal(&cur, saddr, saddr->port)) + return true; + } +@@ -286,7 +285,7 @@ bool mptcp_pm_sport_in_anno_list(struct mptcp_sock *msk, const struct sock *sk) + struct mptcp_addr_info saddr; + bool ret = false; + +- local_address((struct sock_common *)sk, &saddr); ++ mptcp_local_address((struct sock_common *)sk, &saddr); + + spin_lock_bh(&msk->pm.lock); + list_for_each_entry(entry, &msk->pm.anno_list, list) { +@@ -693,13 +692,12 @@ int mptcp_pm_nl_mp_prio_send_ack(struct mptcp_sock *msk, + struct sock *sk = (struct sock *)msk; + struct mptcp_addr_info local; + +- local_address((struct sock_common *)ssk, &local); ++ mptcp_local_address((struct sock_common *)ssk, &local); + if (!addresses_equal(&local, addr, addr->port)) + continue; + + if (subflow->backup != bkup) + msk->last_snd = NULL; +- subflow->backup = bkup; + subflow->send_mp_prio = 1; + subflow->request_bkup = bkup; + __MPTCP_INC_STATS(sock_net(sk), MPTCP_MIB_MPPRIOTX); +@@ -977,8 +975,8 @@ int mptcp_pm_nl_get_local_id(struct mptcp_sock *msk, struct sock_common *skc) + /* The 0 ID mapping is defined by the first subflow, copied into the msk + * addr + */ +- local_address((struct sock_common *)msk, &msk_local); +- local_address((struct sock_common *)skc, &skc_local); ++ mptcp_local_address((struct sock_common *)msk, &msk_local); ++ mptcp_local_address((struct sock_common *)skc, &skc_local); + if (addresses_equal(&msk_local, &skc_local, false)) + return 0; + +@@ -1016,6 +1014,26 @@ int mptcp_pm_nl_get_local_id(struct mptcp_sock *msk, struct sock_common *skc) + return ret; + } + ++bool mptcp_pm_nl_is_backup(struct mptcp_sock *msk, struct mptcp_addr_info *skc) ++{ ++ struct mptcp_pm_addr_entry *entry; ++ struct pm_nl_pernet *pernet; ++ bool backup = false; ++ ++ pernet = net_generic(sock_net((struct sock *)msk), pm_nl_pernet_id); ++ ++ rcu_read_lock(); ++ list_for_each_entry_rcu(entry, &pernet->local_addr_list, list) { ++ if (addresses_equal(&entry->addr, skc, entry->addr.port)) { ++ backup = !!(entry->flags & MPTCP_PM_ADDR_FLAG_BACKUP); ++ break; ++ } ++ } ++ rcu_read_unlock(); ++ ++ return backup; ++} ++ + void mptcp_pm_nl_data_init(struct mptcp_sock *msk) + { + struct mptcp_pm_data *pm = &msk->pm; +@@ -1323,6 +1341,7 @@ static bool mptcp_pm_remove_anno_addr(struct mptcp_sock *msk, + ret = remove_anno_list_by_saddr(msk, addr); + if (ret || force) { + spin_lock_bh(&msk->pm.lock); ++ msk->pm.add_addr_signaled -= ret; + mptcp_pm_remove_addr(msk, &list); + spin_unlock_bh(&msk->pm.lock); + } +@@ -1388,7 +1407,7 @@ static int mptcp_nl_remove_id_zero_address(struct net *net, + if (list_empty(&msk->conn_list)) + goto next; + +- local_address((struct sock_common *)msk, &msk_local); ++ mptcp_local_address((struct sock_common *)msk, &msk_local); + if (!addresses_equal(&msk_local, addr, addr->port)) + goto next; + +@@ -1462,19 +1481,20 @@ static void mptcp_pm_remove_addrs_and_subflows(struct mptcp_sock *msk, + struct mptcp_pm_addr_entry *entry; + + list_for_each_entry(entry, rm_list, list) { +- if (lookup_subflow_by_saddr(&msk->conn_list, &entry->addr) && +- alist.nr < MPTCP_RM_IDS_MAX && +- slist.nr < MPTCP_RM_IDS_MAX) { ++ if (alist.nr < MPTCP_RM_IDS_MAX && ++ slist.nr < MPTCP_RM_IDS_MAX && ++ lookup_subflow_by_saddr(&msk->conn_list, &entry->addr)) { + alist.ids[alist.nr++] = entry->addr.id; + slist.ids[slist.nr++] = entry->addr.id; +- } else if (remove_anno_list_by_saddr(msk, &entry->addr) && +- alist.nr < MPTCP_RM_IDS_MAX) { ++ } else if (alist.nr < MPTCP_RM_IDS_MAX && ++ remove_anno_list_by_saddr(msk, &entry->addr)) { + alist.ids[alist.nr++] = entry->addr.id; + } + } + + if (alist.nr) { + spin_lock_bh(&msk->pm.lock); ++ msk->pm.add_addr_signaled -= alist.nr; + mptcp_pm_remove_addr(msk, &alist); + spin_unlock_bh(&msk->pm.lock); + } +diff --git a/net/mptcp/protocol.c b/net/mptcp/protocol.c +index 081c8d00472d44..9273316cdbde15 100644 +--- a/net/mptcp/protocol.c ++++ b/net/mptcp/protocol.c +@@ -288,8 +288,10 @@ static bool __mptcp_move_skb(struct mptcp_sock *msk, struct sock *ssk, + if (!sk_rmem_schedule(sk, skb, skb->truesize)) { + int amount = sk_mem_pages(skb->truesize) << SK_MEM_QUANTUM_SHIFT; + +- if (ssk->sk_forward_alloc < amount) ++ if (ssk->sk_forward_alloc < amount) { ++ MPTCP_INC_STATS(sock_net(sk), MPTCP_MIB_RCVPRUNED); + goto drop; ++ } + + ssk->sk_forward_alloc -= amount; + sk->sk_forward_alloc += amount; +@@ -774,10 +776,8 @@ void mptcp_data_ready(struct sock *sk, struct sock *ssk) + sk_rbuf = ssk_rbuf; + + /* over limit? can't append more skbs to msk, Also, no need to wake-up*/ +- if (__mptcp_rmem(sk) > sk_rbuf) { +- MPTCP_INC_STATS(sock_net(sk), MPTCP_MIB_RCVPRUNED); ++ if (__mptcp_rmem(sk) > sk_rbuf) + return; +- } + + /* Wake-up the reader only for in-sequence data */ + mptcp_data_lock(sk); +@@ -1514,13 +1514,15 @@ static struct sock *mptcp_subflow_get_send(struct mptcp_sock *msk) + send_info[i].ratio = -1; + } + mptcp_for_each_subflow(msk, subflow) { ++ bool backup = subflow->backup || subflow->request_bkup; ++ + trace_mptcp_subflow_get_send(subflow); + ssk = mptcp_subflow_tcp_sock(subflow); + if (!mptcp_subflow_active(subflow)) + continue; + + tout = max(tout, mptcp_timeout_from_subflow(subflow)); +- nr_active += !subflow->backup; ++ nr_active += !backup; + if (!sk_stream_memory_free(subflow->tcp_sock) || !tcp_sk(ssk)->snd_wnd) + continue; + +@@ -1530,9 +1532,9 @@ static struct sock *mptcp_subflow_get_send(struct mptcp_sock *msk) + + ratio = div_u64((u64)READ_ONCE(ssk->sk_wmem_queued) << 32, + pace); +- if (ratio < send_info[subflow->backup].ratio) { +- send_info[subflow->backup].ssk = ssk; +- send_info[subflow->backup].ratio = ratio; ++ if (ratio < send_info[backup].ratio) { ++ send_info[backup].ssk = ssk; ++ send_info[backup].ratio = ratio; + } + } + __mptcp_set_timeout(sk, tout); +diff --git a/net/mptcp/protocol.h b/net/mptcp/protocol.h +index b4ccae4f684971..234cf918db97fe 100644 +--- a/net/mptcp/protocol.h ++++ b/net/mptcp/protocol.h +@@ -370,6 +370,7 @@ struct mptcp_subflow_request_sock { + u16 mp_capable : 1, + mp_join : 1, + backup : 1, ++ request_bkup : 1, + csum_reqd : 1, + allow_join_id0 : 1; + u8 local_id; +@@ -582,6 +583,7 @@ void mptcp_subflow_send_ack(struct sock *ssk); + void mptcp_subflow_reset(struct sock *ssk); + void mptcp_sock_graft(struct sock *sk, struct socket *parent); + struct socket *__mptcp_nmpc_socket(const struct mptcp_sock *msk); ++void mptcp_local_address(const struct sock_common *skc, struct mptcp_addr_info *addr); + + /* called with sk socket lock held */ + int __mptcp_subflow_connect(struct sock *sk, const struct mptcp_addr_info *loc, +@@ -819,6 +821,7 @@ bool mptcp_pm_add_addr_signal(struct mptcp_sock *msk, struct sk_buff *skb, + bool mptcp_pm_rm_addr_signal(struct mptcp_sock *msk, unsigned int remaining, + struct mptcp_rm_list *rm_list); + int mptcp_pm_get_local_id(struct mptcp_sock *msk, struct sock_common *skc); ++bool mptcp_pm_is_backup(struct mptcp_sock *msk, struct sock_common *skc); + + void __init mptcp_pm_nl_init(void); + void mptcp_pm_nl_data_init(struct mptcp_sock *msk); +@@ -826,6 +829,7 @@ void mptcp_pm_nl_work(struct mptcp_sock *msk); + void mptcp_pm_nl_rm_subflow_received(struct mptcp_sock *msk, + const struct mptcp_rm_list *rm_list); + int mptcp_pm_nl_get_local_id(struct mptcp_sock *msk, struct sock_common *skc); ++bool mptcp_pm_nl_is_backup(struct mptcp_sock *msk, struct mptcp_addr_info *skc); + unsigned int mptcp_pm_get_add_addr_signal_max(struct mptcp_sock *msk); + unsigned int mptcp_pm_get_add_addr_accept_max(struct mptcp_sock *msk); + unsigned int mptcp_pm_get_subflows_max(struct mptcp_sock *msk); +diff --git a/net/mptcp/subflow.c b/net/mptcp/subflow.c +index ff7239fe3d2cd6..2f94387f2ade92 100644 +--- a/net/mptcp/subflow.c ++++ b/net/mptcp/subflow.c +@@ -97,6 +97,7 @@ static struct mptcp_sock *subflow_token_join_request(struct request_sock *req) + return NULL; + } + subflow_req->local_id = local_id; ++ subflow_req->request_bkup = mptcp_pm_is_backup(msk, (struct sock_common *)req); + + return msk; + } +@@ -163,6 +164,9 @@ static int subflow_check_req(struct request_sock *req, + return 0; + } else if (opt_mp_join) { + SUBFLOW_REQ_INC_STATS(req, MPTCP_MIB_JOINSYNRX); ++ ++ if (mp_opt.backup) ++ SUBFLOW_REQ_INC_STATS(req, MPTCP_MIB_JOINSYNBACKUPRX); + } + + if (opt_mp_capable && listener->request_mptcp) { +@@ -462,6 +466,9 @@ static void subflow_finish_connect(struct sock *sk, const struct sk_buff *skb) + subflow->mp_join = 1; + MPTCP_INC_STATS(sock_net(sk), MPTCP_MIB_JOINSYNACKRX); + ++ if (subflow->backup) ++ MPTCP_INC_STATS(sock_net(sk), MPTCP_MIB_JOINSYNACKBACKUPRX); ++ + if (subflow_use_different_dport(mptcp_sk(parent), sk)) { + pr_debug("synack inet_dport=%d %d", + ntohs(inet_sk(sk)->inet_dport), +@@ -1099,14 +1106,22 @@ static void mptcp_subflow_discard_data(struct sock *ssk, struct sk_buff *skb, + { + struct mptcp_subflow_context *subflow = mptcp_subflow_ctx(ssk); + bool fin = TCP_SKB_CB(skb)->tcp_flags & TCPHDR_FIN; +- u32 incr; ++ struct tcp_sock *tp = tcp_sk(ssk); ++ u32 offset, incr, avail_len; ++ ++ offset = tp->copied_seq - TCP_SKB_CB(skb)->seq; ++ if (WARN_ON_ONCE(offset > skb->len)) ++ goto out; + +- incr = limit >= skb->len ? skb->len + fin : limit; ++ avail_len = skb->len - offset; ++ incr = limit >= avail_len ? avail_len + fin : limit; + +- pr_debug("discarding=%d len=%d seq=%d", incr, skb->len, +- subflow->map_subflow_seq); ++ pr_debug("discarding=%d len=%d offset=%d seq=%d", incr, skb->len, ++ offset, subflow->map_subflow_seq); + MPTCP_INC_STATS(sock_net(ssk), MPTCP_MIB_DUPDATA); + tcp_sk(ssk)->copied_seq += incr; ++ ++out: + if (!before(tcp_sk(ssk)->copied_seq, TCP_SKB_CB(skb)->end_seq)) + sk_eat_skb(ssk, skb); + if (mptcp_subflow_get_map_offset(subflow) >= subflow->map_data_len) +@@ -1758,6 +1773,7 @@ static void subflow_ulp_clone(const struct request_sock *req, + new_ctx->mp_join = 1; + new_ctx->fully_established = 1; + new_ctx->backup = subflow_req->backup; ++ new_ctx->request_bkup = subflow_req->request_bkup; + new_ctx->local_id = subflow_req->local_id; + new_ctx->remote_id = subflow_req->remote_id; + new_ctx->token = subflow_req->token; +diff --git a/net/netfilter/ipset/ip_set_list_set.c b/net/netfilter/ipset/ip_set_list_set.c +index e839c356bcb56b..902ff2f3bc72b5 100644 +--- a/net/netfilter/ipset/ip_set_list_set.c ++++ b/net/netfilter/ipset/ip_set_list_set.c +@@ -547,6 +547,9 @@ list_set_cancel_gc(struct ip_set *set) + + if (SET_WITH_TIMEOUT(set)) + del_timer_sync(&map->gc); ++ ++ /* Flush list to drop references to other ipsets */ ++ list_set_flush(set); + } + + static const struct ip_set_type_variant set_variant = { +diff --git a/net/netfilter/ipvs/ip_vs_proto_sctp.c b/net/netfilter/ipvs/ip_vs_proto_sctp.c +index 1e689c71412716..83e452916403d5 100644 +--- a/net/netfilter/ipvs/ip_vs_proto_sctp.c ++++ b/net/netfilter/ipvs/ip_vs_proto_sctp.c +@@ -126,7 +126,7 @@ sctp_snat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp, + if (sctph->source != cp->vport || payload_csum || + skb->ip_summed == CHECKSUM_PARTIAL) { + sctph->source = cp->vport; +- if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb)) ++ if (!skb_is_gso(skb)) + sctp_nat_csum(skb, sctph, sctphoff); + } else { + skb->ip_summed = CHECKSUM_UNNECESSARY; +@@ -175,7 +175,7 @@ sctp_dnat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp, + (skb->ip_summed == CHECKSUM_PARTIAL && + !(skb_dst(skb)->dev->features & NETIF_F_SCTP_CRC))) { + sctph->dest = cp->dport; +- if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb)) ++ if (!skb_is_gso(skb)) + sctp_nat_csum(skb, sctph, sctphoff); + } else if (skb->ip_summed != CHECKSUM_PARTIAL) { + skb->ip_summed = CHECKSUM_UNNECESSARY; +diff --git a/net/netfilter/nf_conntrack_netlink.c b/net/netfilter/nf_conntrack_netlink.c +index 1466015bc56dc7..b429ffde25b1ae 100644 +--- a/net/netfilter/nf_conntrack_netlink.c ++++ b/net/netfilter/nf_conntrack_netlink.c +@@ -3426,7 +3426,8 @@ static int ctnetlink_del_expect(struct sk_buff *skb, + + if (cda[CTA_EXPECT_ID]) { + __be32 id = nla_get_be32(cda[CTA_EXPECT_ID]); +- if (ntohl(id) != (u32)(unsigned long)exp) { ++ ++ if (id != nf_expect_get_id(exp)) { + nf_ct_expect_put(exp); + return -ENOENT; + } +diff --git a/net/netfilter/nf_tables_api.c b/net/netfilter/nf_tables_api.c +index 6e4ce511f51bab..8ded61a3f93e8e 100644 +--- a/net/netfilter/nf_tables_api.c ++++ b/net/netfilter/nf_tables_api.c +@@ -3049,18 +3049,17 @@ static struct nft_expr *nft_expr_init(const struct nft_ctx *ctx, + return ERR_PTR(err); + } + +-int nft_expr_clone(struct nft_expr *dst, struct nft_expr *src) ++int nft_expr_clone(struct nft_expr *dst, struct nft_expr *src, gfp_t gfp) + { + int err; + +- if (src->ops->clone) { +- dst->ops = src->ops; +- err = src->ops->clone(dst, src); +- if (err < 0) +- return err; +- } else { +- memcpy(dst, src, src->ops->size); +- } ++ if (WARN_ON_ONCE(!src->ops->clone)) ++ return -EINVAL; ++ ++ dst->ops = src->ops; ++ err = src->ops->clone(dst, src, gfp); ++ if (err < 0) ++ return err; + + __module_get(src->ops->type->owner); + +@@ -3446,6 +3445,15 @@ static void nf_tables_rule_release(const struct nft_ctx *ctx, struct nft_rule *r + nf_tables_rule_destroy(ctx, rule); + } + ++/** nft_chain_validate - loop detection and hook validation ++ * ++ * @ctx: context containing call depth and base chain ++ * @chain: chain to validate ++ * ++ * Walk through the rules of the given chain and chase all jumps/gotos ++ * and set lookups until either the jump limit is hit or all reachable ++ * chains have been validated. ++ */ + int nft_chain_validate(const struct nft_ctx *ctx, const struct nft_chain *chain) + { + struct nft_expr *expr, *last; +@@ -3464,6 +3472,9 @@ int nft_chain_validate(const struct nft_ctx *ctx, const struct nft_chain *chain) + if (!expr->ops->validate) + continue; + ++ /* This may call nft_chain_validate() recursively, ++ * callers that do so must increment ctx->level. ++ */ + err = expr->ops->validate(ctx, expr, &data); + if (err < 0) + return err; +@@ -5769,8 +5780,10 @@ static int nf_tables_getsetelem(struct sk_buff *skb, + + nla_for_each_nested(attr, nla[NFTA_SET_ELEM_LIST_ELEMENTS], rem) { + err = nft_get_set_elem(&ctx, set, attr); +- if (err < 0) ++ if (err < 0) { ++ NL_SET_BAD_ATTR(extack, attr); + break; ++ } + } + + return err; +@@ -5953,7 +5966,7 @@ int nft_set_elem_expr_clone(const struct nft_ctx *ctx, struct nft_set *set, + if (!expr) + goto err_expr; + +- err = nft_expr_clone(expr, set->exprs[i]); ++ err = nft_expr_clone(expr, set->exprs[i], GFP_KERNEL_ACCOUNT); + if (err < 0) { + kfree(expr); + goto err_expr; +@@ -5981,7 +5994,7 @@ static int nft_set_elem_expr_setup(struct nft_ctx *ctx, + + for (i = 0; i < num_exprs; i++) { + expr = nft_setelem_expr_at(elem_expr, elem_expr->size); +- err = nft_expr_clone(expr, expr_array[i]); ++ err = nft_expr_clone(expr, expr_array[i], GFP_KERNEL_ACCOUNT); + if (err < 0) + goto err_elem_expr_setup; + +@@ -6589,8 +6602,10 @@ static int nf_tables_newsetelem(struct sk_buff *skb, + + nla_for_each_nested(attr, nla[NFTA_SET_ELEM_LIST_ELEMENTS], rem) { + err = nft_add_set_elem(&ctx, set, attr, info->nlh->nlmsg_flags); +- if (err < 0) ++ if (err < 0) { ++ NL_SET_BAD_ATTR(extack, attr); + return err; ++ } + } + + if (nft_net->validate_state == NFT_VALIDATE_DO) +@@ -6866,8 +6881,10 @@ static int nf_tables_delsetelem(struct sk_buff *skb, + + nla_for_each_nested(attr, nla[NFTA_SET_ELEM_LIST_ELEMENTS], rem) { + err = nft_del_setelem(&ctx, set, attr); +- if (err < 0) ++ if (err < 0) { ++ NL_SET_BAD_ATTR(extack, attr); + break; ++ } + } + return err; + } +@@ -9179,6 +9196,7 @@ struct nft_trans_gc *nft_trans_gc_catchall_async(struct nft_trans_gc *gc, + struct nft_trans_gc *nft_trans_gc_catchall_sync(struct nft_trans_gc *gc) + { + struct nft_set_elem_catchall *catchall, *next; ++ u64 tstamp = nft_net_tstamp(gc->net); + const struct nft_set *set = gc->set; + struct nft_set_elem elem; + struct nft_set_ext *ext; +@@ -9188,7 +9206,7 @@ struct nft_trans_gc *nft_trans_gc_catchall_sync(struct nft_trans_gc *gc) + list_for_each_entry_safe(catchall, next, &set->catchall_list, list) { + ext = nft_set_elem_ext(set, catchall->elem); + +- if (!nft_set_elem_expired(ext)) ++ if (!__nft_set_elem_expired(ext, tstamp)) + continue; + + gc = nft_trans_gc_queue_sync(gc, GFP_KERNEL); +@@ -9940,6 +9958,7 @@ static bool nf_tables_valid_genid(struct net *net, u32 genid) + bool genid_ok; + + mutex_lock(&nft_net->commit_mutex); ++ nft_net->tstamp = get_jiffies_64(); + + genid_ok = genid == 0 || nft_net->base_seq == genid; + if (!genid_ok) +@@ -9992,143 +10011,6 @@ int nft_chain_validate_hooks(const struct nft_chain *chain, + } + EXPORT_SYMBOL_GPL(nft_chain_validate_hooks); + +-/* +- * Loop detection - walk through the ruleset beginning at the destination chain +- * of a new jump until either the source chain is reached (loop) or all +- * reachable chains have been traversed. +- * +- * The loop check is performed whenever a new jump verdict is added to an +- * expression or verdict map or a verdict map is bound to a new chain. +- */ +- +-static int nf_tables_check_loops(const struct nft_ctx *ctx, +- const struct nft_chain *chain); +- +-static int nft_check_loops(const struct nft_ctx *ctx, +- const struct nft_set_ext *ext) +-{ +- const struct nft_data *data; +- int ret; +- +- data = nft_set_ext_data(ext); +- switch (data->verdict.code) { +- case NFT_JUMP: +- case NFT_GOTO: +- ret = nf_tables_check_loops(ctx, data->verdict.chain); +- break; +- default: +- ret = 0; +- break; +- } +- +- return ret; +-} +- +-static int nf_tables_loop_check_setelem(const struct nft_ctx *ctx, +- struct nft_set *set, +- const struct nft_set_iter *iter, +- struct nft_set_elem *elem) +-{ +- const struct nft_set_ext *ext = nft_set_elem_ext(set, elem->priv); +- +- if (nft_set_ext_exists(ext, NFT_SET_EXT_FLAGS) && +- *nft_set_ext_flags(ext) & NFT_SET_ELEM_INTERVAL_END) +- return 0; +- +- return nft_check_loops(ctx, ext); +-} +- +-static int nft_set_catchall_loops(const struct nft_ctx *ctx, +- struct nft_set *set) +-{ +- u8 genmask = nft_genmask_next(ctx->net); +- struct nft_set_elem_catchall *catchall; +- struct nft_set_ext *ext; +- int ret = 0; +- +- list_for_each_entry_rcu(catchall, &set->catchall_list, list) { +- ext = nft_set_elem_ext(set, catchall->elem); +- if (!nft_set_elem_active(ext, genmask)) +- continue; +- +- ret = nft_check_loops(ctx, ext); +- if (ret < 0) +- return ret; +- } +- +- return ret; +-} +- +-static int nf_tables_check_loops(const struct nft_ctx *ctx, +- const struct nft_chain *chain) +-{ +- const struct nft_rule *rule; +- const struct nft_expr *expr, *last; +- struct nft_set *set; +- struct nft_set_binding *binding; +- struct nft_set_iter iter; +- +- if (ctx->chain == chain) +- return -ELOOP; +- +- list_for_each_entry(rule, &chain->rules, list) { +- nft_rule_for_each_expr(expr, last, rule) { +- struct nft_immediate_expr *priv; +- const struct nft_data *data; +- int err; +- +- if (strcmp(expr->ops->type->name, "immediate")) +- continue; +- +- priv = nft_expr_priv(expr); +- if (priv->dreg != NFT_REG_VERDICT) +- continue; +- +- data = &priv->data; +- switch (data->verdict.code) { +- case NFT_JUMP: +- case NFT_GOTO: +- err = nf_tables_check_loops(ctx, +- data->verdict.chain); +- if (err < 0) +- return err; +- break; +- default: +- break; +- } +- } +- } +- +- list_for_each_entry(set, &ctx->table->sets, list) { +- if (!nft_is_active_next(ctx->net, set)) +- continue; +- if (!(set->flags & NFT_SET_MAP) || +- set->dtype != NFT_DATA_VERDICT) +- continue; +- +- list_for_each_entry(binding, &set->bindings, list) { +- if (!(binding->flags & NFT_SET_MAP) || +- binding->chain != chain) +- continue; +- +- iter.genmask = nft_genmask_next(ctx->net); +- iter.skip = 0; +- iter.count = 0; +- iter.err = 0; +- iter.fn = nf_tables_loop_check_setelem; +- +- set->ops->walk(ctx, set, &iter); +- if (!iter.err) +- iter.err = nft_set_catchall_loops(ctx, set); +- +- if (iter.err < 0) +- return iter.err; +- } +- } +- +- return 0; +-} +- + /** + * nft_parse_u32_check - fetch u32 attribute and check for maximum value + * +@@ -10241,7 +10123,7 @@ static int nft_validate_register_store(const struct nft_ctx *ctx, + if (data != NULL && + (data->verdict.code == NFT_GOTO || + data->verdict.code == NFT_JUMP)) { +- err = nf_tables_check_loops(ctx, data->verdict.chain); ++ err = nft_chain_validate(ctx, data->verdict.chain); + if (err < 0) + return err; + } +diff --git a/net/netfilter/nft_connlimit.c b/net/netfilter/nft_connlimit.c +index f5df535bcbd08f..403fffa14fa3bb 100644 +--- a/net/netfilter/nft_connlimit.c ++++ b/net/netfilter/nft_connlimit.c +@@ -209,12 +209,12 @@ static void nft_connlimit_destroy(const struct nft_ctx *ctx, + nft_connlimit_do_destroy(ctx, priv); + } + +-static int nft_connlimit_clone(struct nft_expr *dst, const struct nft_expr *src) ++static int nft_connlimit_clone(struct nft_expr *dst, const struct nft_expr *src, gfp_t gfp) + { + struct nft_connlimit *priv_dst = nft_expr_priv(dst); + struct nft_connlimit *priv_src = nft_expr_priv(src); + +- priv_dst->list = kmalloc(sizeof(*priv_dst->list), GFP_ATOMIC); ++ priv_dst->list = kmalloc(sizeof(*priv_dst->list), gfp); + if (!priv_dst->list) + return -ENOMEM; + +diff --git a/net/netfilter/nft_counter.c b/net/netfilter/nft_counter.c +index 9f78f8ad4ee106..1b468a16b52375 100644 +--- a/net/netfilter/nft_counter.c ++++ b/net/netfilter/nft_counter.c +@@ -225,7 +225,7 @@ static void nft_counter_destroy(const struct nft_ctx *ctx, + nft_counter_do_destroy(priv); + } + +-static int nft_counter_clone(struct nft_expr *dst, const struct nft_expr *src) ++static int nft_counter_clone(struct nft_expr *dst, const struct nft_expr *src, gfp_t gfp) + { + struct nft_counter_percpu_priv *priv = nft_expr_priv(src); + struct nft_counter_percpu_priv *priv_clone = nft_expr_priv(dst); +@@ -235,7 +235,7 @@ static int nft_counter_clone(struct nft_expr *dst, const struct nft_expr *src) + + nft_counter_fetch(priv, &total); + +- cpu_stats = alloc_percpu_gfp(struct nft_counter, GFP_ATOMIC); ++ cpu_stats = alloc_percpu_gfp(struct nft_counter, gfp); + if (cpu_stats == NULL) + return -ENOMEM; + +diff --git a/net/netfilter/nft_dynset.c b/net/netfilter/nft_dynset.c +index e714e0efa73631..ecdd4a60db9c58 100644 +--- a/net/netfilter/nft_dynset.c ++++ b/net/netfilter/nft_dynset.c +@@ -35,7 +35,7 @@ static int nft_dynset_expr_setup(const struct nft_dynset *priv, + + for (i = 0; i < priv->num_exprs; i++) { + expr = nft_setelem_expr_at(elem_expr, elem_expr->size); +- if (nft_expr_clone(expr, priv->expr_array[i]) < 0) ++ if (nft_expr_clone(expr, priv->expr_array[i], GFP_ATOMIC) < 0) + return -1; + + elem_expr->size += priv->expr_array[i]->ops->size; +diff --git a/net/netfilter/nft_last.c b/net/netfilter/nft_last.c +index 63145a5e69ef68..0959e5adfe96ad 100644 +--- a/net/netfilter/nft_last.c ++++ b/net/netfilter/nft_last.c +@@ -101,12 +101,12 @@ static void nft_last_destroy(const struct nft_ctx *ctx, + kfree(priv->last); + } + +-static int nft_last_clone(struct nft_expr *dst, const struct nft_expr *src) ++static int nft_last_clone(struct nft_expr *dst, const struct nft_expr *src, gfp_t gfp) + { + struct nft_last_priv *priv_dst = nft_expr_priv(dst); + struct nft_last_priv *priv_src = nft_expr_priv(src); + +- priv_dst->last = kzalloc(sizeof(*priv_dst->last), GFP_ATOMIC); ++ priv_dst->last = kzalloc(sizeof(*priv_dst->last), gfp); + if (!priv_dst->last) + return -ENOMEM; + +diff --git a/net/netfilter/nft_limit.c b/net/netfilter/nft_limit.c +index b23a671fa9d8f6..9f69be2016c4a1 100644 +--- a/net/netfilter/nft_limit.c ++++ b/net/netfilter/nft_limit.c +@@ -150,7 +150,7 @@ static void nft_limit_destroy(const struct nft_ctx *ctx, + } + + static int nft_limit_clone(struct nft_limit_priv *priv_dst, +- const struct nft_limit_priv *priv_src) ++ const struct nft_limit_priv *priv_src, gfp_t gfp) + { + priv_dst->tokens_max = priv_src->tokens_max; + priv_dst->rate = priv_src->rate; +@@ -158,7 +158,7 @@ static int nft_limit_clone(struct nft_limit_priv *priv_dst, + priv_dst->burst = priv_src->burst; + priv_dst->invert = priv_src->invert; + +- priv_dst->limit = kmalloc(sizeof(*priv_dst->limit), GFP_ATOMIC); ++ priv_dst->limit = kmalloc(sizeof(*priv_dst->limit), gfp); + if (!priv_dst->limit) + return -ENOMEM; + +@@ -222,14 +222,15 @@ static void nft_limit_pkts_destroy(const struct nft_ctx *ctx, + nft_limit_destroy(ctx, &priv->limit); + } + +-static int nft_limit_pkts_clone(struct nft_expr *dst, const struct nft_expr *src) ++static int nft_limit_pkts_clone(struct nft_expr *dst, const struct nft_expr *src, ++ gfp_t gfp) + { + struct nft_limit_priv_pkts *priv_dst = nft_expr_priv(dst); + struct nft_limit_priv_pkts *priv_src = nft_expr_priv(src); + + priv_dst->cost = priv_src->cost; + +- return nft_limit_clone(&priv_dst->limit, &priv_src->limit); ++ return nft_limit_clone(&priv_dst->limit, &priv_src->limit, gfp); + } + + static struct nft_expr_type nft_limit_type; +@@ -279,12 +280,13 @@ static void nft_limit_bytes_destroy(const struct nft_ctx *ctx, + nft_limit_destroy(ctx, priv); + } + +-static int nft_limit_bytes_clone(struct nft_expr *dst, const struct nft_expr *src) ++static int nft_limit_bytes_clone(struct nft_expr *dst, const struct nft_expr *src, ++ gfp_t gfp) + { + struct nft_limit_priv *priv_dst = nft_expr_priv(dst); + struct nft_limit_priv *priv_src = nft_expr_priv(src); + +- return nft_limit_clone(priv_dst, priv_src); ++ return nft_limit_clone(priv_dst, priv_src, gfp); + } + + static const struct nft_expr_ops nft_limit_bytes_ops = { +diff --git a/net/netfilter/nft_quota.c b/net/netfilter/nft_quota.c +index 73de40007dfe9a..586a6df645bcba 100644 +--- a/net/netfilter/nft_quota.c ++++ b/net/netfilter/nft_quota.c +@@ -232,7 +232,7 @@ static void nft_quota_destroy(const struct nft_ctx *ctx, + return nft_quota_do_destroy(ctx, priv); + } + +-static int nft_quota_clone(struct nft_expr *dst, const struct nft_expr *src) ++static int nft_quota_clone(struct nft_expr *dst, const struct nft_expr *src, gfp_t gfp) + { + struct nft_quota *priv_dst = nft_expr_priv(dst); + struct nft_quota *priv_src = nft_expr_priv(src); +@@ -240,7 +240,7 @@ static int nft_quota_clone(struct nft_expr *dst, const struct nft_expr *src) + priv_dst->quota = priv_src->quota; + priv_dst->flags = priv_src->flags; + +- priv_dst->consumed = kmalloc(sizeof(*priv_dst->consumed), GFP_ATOMIC); ++ priv_dst->consumed = kmalloc(sizeof(*priv_dst->consumed), gfp); + if (!priv_dst->consumed) + return -ENOMEM; + +diff --git a/net/netfilter/nft_set_hash.c b/net/netfilter/nft_set_hash.c +index 2013de934cef09..1fd3b413350dcc 100644 +--- a/net/netfilter/nft_set_hash.c ++++ b/net/netfilter/nft_set_hash.c +@@ -35,6 +35,7 @@ struct nft_rhash_cmp_arg { + const struct nft_set *set; + const u32 *key; + u8 genmask; ++ u64 tstamp; + }; + + static inline u32 nft_rhash_key(const void *data, u32 len, u32 seed) +@@ -61,7 +62,7 @@ static inline int nft_rhash_cmp(struct rhashtable_compare_arg *arg, + return 1; + if (nft_set_elem_is_dead(&he->ext)) + return 1; +- if (nft_set_elem_expired(&he->ext)) ++ if (__nft_set_elem_expired(&he->ext, x->tstamp)) + return 1; + if (!nft_set_elem_active(&he->ext, x->genmask)) + return 1; +@@ -86,6 +87,7 @@ bool nft_rhash_lookup(const struct net *net, const struct nft_set *set, + .genmask = nft_genmask_cur(net), + .set = set, + .key = key, ++ .tstamp = get_jiffies_64(), + }; + + he = rhashtable_lookup(&priv->ht, &arg, nft_rhash_params); +@@ -104,6 +106,7 @@ static void *nft_rhash_get(const struct net *net, const struct nft_set *set, + .genmask = nft_genmask_cur(net), + .set = set, + .key = elem->key.val.data, ++ .tstamp = get_jiffies_64(), + }; + + he = rhashtable_lookup(&priv->ht, &arg, nft_rhash_params); +@@ -127,6 +130,7 @@ static bool nft_rhash_update(struct nft_set *set, const u32 *key, + .genmask = NFT_GENMASK_ANY, + .set = set, + .key = key, ++ .tstamp = get_jiffies_64(), + }; + + he = rhashtable_lookup(&priv->ht, &arg, nft_rhash_params); +@@ -170,6 +174,7 @@ static int nft_rhash_insert(const struct net *net, const struct nft_set *set, + .genmask = nft_genmask_next(net), + .set = set, + .key = elem->key.val.data, ++ .tstamp = nft_net_tstamp(net), + }; + struct nft_rhash_elem *prev; + +@@ -212,6 +217,7 @@ static void *nft_rhash_deactivate(const struct net *net, + .genmask = nft_genmask_next(net), + .set = set, + .key = elem->key.val.data, ++ .tstamp = nft_net_tstamp(net), + }; + + rcu_read_lock(); +diff --git a/net/netfilter/nft_set_pipapo.c b/net/netfilter/nft_set_pipapo.c +index 2299ced939c47f..d9c1c467ea6848 100644 +--- a/net/netfilter/nft_set_pipapo.c ++++ b/net/netfilter/nft_set_pipapo.c +@@ -360,7 +360,7 @@ + * Return: -1 on no match, bit position on 'match_only', 0 otherwise. + */ + int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst, +- union nft_pipapo_map_bucket *mt, bool match_only) ++ const union nft_pipapo_map_bucket *mt, bool match_only) + { + unsigned long bitset; + int k, ret = -1; +@@ -412,9 +412,9 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set, + struct nft_pipapo_scratch *scratch; + unsigned long *res_map, *fill_map; + u8 genmask = nft_genmask_cur(net); ++ const struct nft_pipapo_match *m; ++ const struct nft_pipapo_field *f; + const u8 *rp = (const u8 *)key; +- struct nft_pipapo_match *m; +- struct nft_pipapo_field *f; + bool map_index; + int i; + +@@ -432,7 +432,7 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set, + res_map = scratch->map + (map_index ? m->bsize_max : 0); + fill_map = scratch->map + (map_index ? 0 : m->bsize_max); + +- memset(res_map, 0xff, m->bsize_max * sizeof(*res_map)); ++ pipapo_resmap_init(m, res_map); + + nft_pipapo_for_each_field(f, i, m) { + bool last = i == m->field_count - 1; +@@ -504,6 +504,7 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set, + * @set: nftables API set representation + * @data: Key data to be matched against existing elements + * @genmask: If set, check that element is active in given genmask ++ * @tstamp: timestamp to check for expired elements + * + * This is essentially the same as the lookup function, except that it matches + * key data against the uncommitted copy and doesn't use preallocated maps for +@@ -513,15 +514,18 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set, + */ + static struct nft_pipapo_elem *pipapo_get(const struct net *net, + const struct nft_set *set, +- const u8 *data, u8 genmask) ++ const u8 *data, u8 genmask, ++ u64 tstamp) + { + struct nft_pipapo_elem *ret = ERR_PTR(-ENOENT); + struct nft_pipapo *priv = nft_set_priv(set); +- struct nft_pipapo_match *m = priv->clone; + unsigned long *res_map, *fill_map = NULL; +- struct nft_pipapo_field *f; ++ const struct nft_pipapo_match *m; ++ const struct nft_pipapo_field *f; + int i; + ++ m = priv->clone; ++ + res_map = kmalloc_array(m->bsize_max, sizeof(*res_map), GFP_ATOMIC); + if (!res_map) { + ret = ERR_PTR(-ENOMEM); +@@ -534,7 +538,7 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net, + goto out; + } + +- memset(res_map, 0xff, m->bsize_max * sizeof(*res_map)); ++ pipapo_resmap_init(m, res_map); + + nft_pipapo_for_each_field(f, i, m) { + bool last = i == m->field_count - 1; +@@ -566,7 +570,7 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net, + goto out; + + if (last) { +- if (nft_set_elem_expired(&f->mt[b].e->ext)) ++ if (__nft_set_elem_expired(&f->mt[b].e->ext, tstamp)) + goto next_match; + if ((genmask && + !nft_set_elem_active(&f->mt[b].e->ext, genmask))) +@@ -603,7 +607,7 @@ static void *nft_pipapo_get(const struct net *net, const struct nft_set *set, + const struct nft_set_elem *elem, unsigned int flags) + { + return pipapo_get(net, set, (const u8 *)elem->key.val.data, +- nft_genmask_cur(net)); ++ nft_genmask_cur(net), get_jiffies_64()); + } + + /** +@@ -1197,6 +1201,7 @@ static int nft_pipapo_insert(const struct net *net, const struct nft_set *set, + struct nft_pipapo *priv = nft_set_priv(set); + struct nft_pipapo_match *m = priv->clone; + u8 genmask = nft_genmask_next(net); ++ u64 tstamp = nft_net_tstamp(net); + struct nft_pipapo_field *f; + const u8 *start_p, *end_p; + int i, bsize_max, err = 0; +@@ -1206,7 +1211,7 @@ static int nft_pipapo_insert(const struct net *net, const struct nft_set *set, + else + end = start; + +- dup = pipapo_get(net, set, start, genmask); ++ dup = pipapo_get(net, set, start, genmask, tstamp); + if (!IS_ERR(dup)) { + /* Check if we already have the same exact entry */ + const struct nft_data *dup_key, *dup_end; +@@ -1228,7 +1233,7 @@ static int nft_pipapo_insert(const struct net *net, const struct nft_set *set, + + if (PTR_ERR(dup) == -ENOENT) { + /* Look for partially overlapping entries */ +- dup = pipapo_get(net, set, end, nft_genmask_next(net)); ++ dup = pipapo_get(net, set, end, nft_genmask_next(net), tstamp); + } + + if (PTR_ERR(dup) != -ENOENT) { +@@ -1581,6 +1586,7 @@ static void pipapo_gc(const struct nft_set *_set, struct nft_pipapo_match *m) + struct nft_set *set = (struct nft_set *) _set; + struct nft_pipapo *priv = nft_set_priv(set); + struct net *net = read_pnet(&set->net); ++ u64 tstamp = nft_net_tstamp(net); + int rules_f0, first_rule = 0; + struct nft_pipapo_elem *e; + struct nft_trans_gc *gc; +@@ -1591,7 +1597,7 @@ static void pipapo_gc(const struct nft_set *_set, struct nft_pipapo_match *m) + + while ((rules_f0 = pipapo_rules_same_key(m->f, first_rule))) { + union nft_pipapo_map_bucket rulemap[NFT_PIPAPO_MAX_FIELDS]; +- struct nft_pipapo_field *f; ++ const struct nft_pipapo_field *f; + int i, start, rules_fx; + + start = first_rule; +@@ -1615,7 +1621,7 @@ static void pipapo_gc(const struct nft_set *_set, struct nft_pipapo_match *m) + /* synchronous gc never fails, there is no need to set on + * NFT_SET_ELEM_DEAD_BIT. + */ +- if (nft_set_elem_expired(&e->ext)) { ++ if (__nft_set_elem_expired(&e->ext, tstamp)) { + priv->dirty = true; + + gc = nft_trans_gc_queue_sync(gc, GFP_ATOMIC); +@@ -1786,7 +1792,7 @@ static void *pipapo_deactivate(const struct net *net, const struct nft_set *set, + { + struct nft_pipapo_elem *e; + +- e = pipapo_get(net, set, data, nft_genmask_next(net)); ++ e = pipapo_get(net, set, data, nft_genmask_next(net), nft_net_tstamp(net)); + if (IS_ERR(e)) + return NULL; + +@@ -2037,8 +2043,8 @@ static void nft_pipapo_walk(const struct nft_ctx *ctx, struct nft_set *set, + { + struct nft_pipapo *priv = nft_set_priv(set); + struct net *net = read_pnet(&set->net); +- struct nft_pipapo_match *m; +- struct nft_pipapo_field *f; ++ const struct nft_pipapo_match *m; ++ const struct nft_pipapo_field *f; + int i, r; + + rcu_read_lock(); +diff --git a/net/netfilter/nft_set_pipapo.h b/net/netfilter/nft_set_pipapo.h +index 30a3d092cd841c..519a2e6dc206f0 100644 +--- a/net/netfilter/nft_set_pipapo.h ++++ b/net/netfilter/nft_set_pipapo.h +@@ -185,7 +185,7 @@ struct nft_pipapo_elem { + }; + + int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst, +- union nft_pipapo_map_bucket *mt, bool match_only); ++ const union nft_pipapo_map_bucket *mt, bool match_only); + + /** + * pipapo_and_field_buckets_4bit() - Intersect 4-bit buckets +@@ -193,7 +193,7 @@ int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst, + * @dst: Area to store result + * @data: Input data selecting table buckets + */ +-static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f, ++static inline void pipapo_and_field_buckets_4bit(const struct nft_pipapo_field *f, + unsigned long *dst, + const u8 *data) + { +@@ -221,7 +221,7 @@ static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f, + * @dst: Area to store result + * @data: Input data selecting table buckets + */ +-static inline void pipapo_and_field_buckets_8bit(struct nft_pipapo_field *f, ++static inline void pipapo_and_field_buckets_8bit(const struct nft_pipapo_field *f, + unsigned long *dst, + const u8 *data) + { +@@ -285,4 +285,25 @@ static u64 pipapo_estimate_size(const struct nft_set_desc *desc) + return size; + } + ++/** ++ * pipapo_resmap_init() - Initialise result map before first use ++ * @m: Matching data, including mapping table ++ * @res_map: Result map ++ * ++ * Initialize all bits covered by the first field to one, so that after ++ * the first step, only the matching bits of the first bit group remain. ++ * ++ * If other fields have a large bitmap, set remainder of res_map to 0. ++ */ ++static inline void pipapo_resmap_init(const struct nft_pipapo_match *m, unsigned long *res_map) ++{ ++ const struct nft_pipapo_field *f = m->f; ++ int i; ++ ++ for (i = 0; i < f->bsize; i++) ++ res_map[i] = ULONG_MAX; ++ ++ for (i = f->bsize; i < m->bsize_max; i++) ++ res_map[i] = 0ul; ++} + #endif /* _NFT_SET_PIPAPO_H */ +diff --git a/net/netfilter/nft_set_pipapo_avx2.c b/net/netfilter/nft_set_pipapo_avx2.c +index 0d9f8e79eb00ed..dfae90cd34939d 100644 +--- a/net/netfilter/nft_set_pipapo_avx2.c ++++ b/net/netfilter/nft_set_pipapo_avx2.c +@@ -212,8 +212,9 @@ static int nft_pipapo_avx2_refill(int offset, unsigned long *map, + * word index to be checked next (i.e. first filled word). + */ + static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill, +- struct nft_pipapo_field *f, int offset, +- const u8 *pkt, bool first, bool last) ++ const struct nft_pipapo_field *f, ++ int offset, const u8 *pkt, ++ bool first, bool last) + { + int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b; + u8 pg[2] = { pkt[0] >> 4, pkt[0] & 0xf }; +@@ -274,8 +275,9 @@ static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill, + * word index to be checked next (i.e. first filled word). + */ + static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill, +- struct nft_pipapo_field *f, int offset, +- const u8 *pkt, bool first, bool last) ++ const struct nft_pipapo_field *f, ++ int offset, const u8 *pkt, ++ bool first, bool last) + { + int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b; + u8 pg[4] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf }; +@@ -350,8 +352,9 @@ static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill, + * word index to be checked next (i.e. first filled word). + */ + static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill, +- struct nft_pipapo_field *f, int offset, +- const u8 *pkt, bool first, bool last) ++ const struct nft_pipapo_field *f, ++ int offset, const u8 *pkt, ++ bool first, bool last) + { + u8 pg[8] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf, + pkt[2] >> 4, pkt[2] & 0xf, pkt[3] >> 4, pkt[3] & 0xf, +@@ -445,8 +448,9 @@ static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill, + * word index to be checked next (i.e. first filled word). + */ + static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill, +- struct nft_pipapo_field *f, int offset, +- const u8 *pkt, bool first, bool last) ++ const struct nft_pipapo_field *f, ++ int offset, const u8 *pkt, ++ bool first, bool last) + { + u8 pg[12] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf, + pkt[2] >> 4, pkt[2] & 0xf, pkt[3] >> 4, pkt[3] & 0xf, +@@ -534,8 +538,9 @@ static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill, + * word index to be checked next (i.e. first filled word). + */ + static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill, +- struct nft_pipapo_field *f, int offset, +- const u8 *pkt, bool first, bool last) ++ const struct nft_pipapo_field *f, ++ int offset, const u8 *pkt, ++ bool first, bool last) + { + u8 pg[32] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf, + pkt[2] >> 4, pkt[2] & 0xf, pkt[3] >> 4, pkt[3] & 0xf, +@@ -669,8 +674,9 @@ static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill, + * word index to be checked next (i.e. first filled word). + */ + static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill, +- struct nft_pipapo_field *f, int offset, +- const u8 *pkt, bool first, bool last) ++ const struct nft_pipapo_field *f, ++ int offset, const u8 *pkt, ++ bool first, bool last) + { + int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b; + unsigned long *lt = f->lt, bsize = f->bsize; +@@ -726,8 +732,9 @@ static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill, + * word index to be checked next (i.e. first filled word). + */ + static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill, +- struct nft_pipapo_field *f, int offset, +- const u8 *pkt, bool first, bool last) ++ const struct nft_pipapo_field *f, ++ int offset, const u8 *pkt, ++ bool first, bool last) + { + int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b; + unsigned long *lt = f->lt, bsize = f->bsize; +@@ -790,8 +797,9 @@ static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill, + * word index to be checked next (i.e. first filled word). + */ + static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill, +- struct nft_pipapo_field *f, int offset, +- const u8 *pkt, bool first, bool last) ++ const struct nft_pipapo_field *f, ++ int offset, const u8 *pkt, ++ bool first, bool last) + { + int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b; + unsigned long *lt = f->lt, bsize = f->bsize; +@@ -865,8 +873,9 @@ static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill, + * word index to be checked next (i.e. first filled word). + */ + static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill, +- struct nft_pipapo_field *f, int offset, +- const u8 *pkt, bool first, bool last) ++ const struct nft_pipapo_field *f, ++ int offset, const u8 *pkt, ++ bool first, bool last) + { + int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b; + unsigned long *lt = f->lt, bsize = f->bsize; +@@ -950,8 +959,9 @@ static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill, + * word index to be checked next (i.e. first filled word). + */ + static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill, +- struct nft_pipapo_field *f, int offset, +- const u8 *pkt, bool first, bool last) ++ const struct nft_pipapo_field *f, ++ int offset, const u8 *pkt, ++ bool first, bool last) + { + int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b; + unsigned long *lt = f->lt, bsize = f->bsize; +@@ -1026,6 +1036,7 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill, + + /** + * nft_pipapo_avx2_lookup_slow() - Fallback function for uncommon field sizes ++ * @mdata: Matching data, including mapping table + * @map: Previous match result, used as initial bitmap + * @fill: Destination bitmap to be filled with current match result + * @f: Field, containing lookup and mapping tables +@@ -1041,9 +1052,11 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill, + * Return: -1 on no match, rule index of match if @last, otherwise first long + * word index to be checked next (i.e. first filled word). + */ +-static int nft_pipapo_avx2_lookup_slow(unsigned long *map, unsigned long *fill, +- struct nft_pipapo_field *f, int offset, +- const u8 *pkt, bool first, bool last) ++static int nft_pipapo_avx2_lookup_slow(const struct nft_pipapo_match *mdata, ++ unsigned long *map, unsigned long *fill, ++ const struct nft_pipapo_field *f, ++ int offset, const u8 *pkt, ++ bool first, bool last) + { + unsigned long *lt = f->lt, bsize = f->bsize; + int i, ret = -1, b; +@@ -1051,7 +1064,7 @@ static int nft_pipapo_avx2_lookup_slow(unsigned long *map, unsigned long *fill, + lt += offset * NFT_PIPAPO_LONGS_PER_M256; + + if (first) +- memset(map, 0xff, bsize * sizeof(*map)); ++ pipapo_resmap_init(mdata, map); + + for (i = offset; i < bsize; i++) { + if (f->bb == 8) +@@ -1121,15 +1134,21 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set, + struct nft_pipapo *priv = nft_set_priv(set); + struct nft_pipapo_scratch *scratch; + u8 genmask = nft_genmask_cur(net); ++ const struct nft_pipapo_match *m; ++ const struct nft_pipapo_field *f; + const u8 *rp = (const u8 *)key; +- struct nft_pipapo_match *m; +- struct nft_pipapo_field *f; + unsigned long *res, *fill; + bool map_index; + int i, ret = 0; + +- if (unlikely(!irq_fpu_usable())) +- return nft_pipapo_lookup(net, set, key, ext); ++ local_bh_disable(); ++ ++ if (unlikely(!irq_fpu_usable())) { ++ bool fallback_res = nft_pipapo_lookup(net, set, key, ext); ++ ++ local_bh_enable(); ++ return fallback_res; ++ } + + m = rcu_dereference(priv->match); + +@@ -1144,6 +1163,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set, + scratch = *raw_cpu_ptr(m->scratch); + if (unlikely(!scratch)) { + kernel_fpu_end(); ++ local_bh_enable(); + return false; + } + +@@ -1177,7 +1197,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set, + } else if (f->groups == 16) { + NFT_SET_PIPAPO_AVX2_LOOKUP(8, 16); + } else { +- ret = nft_pipapo_avx2_lookup_slow(res, fill, f, ++ ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f, + ret, rp, + first, last); + } +@@ -1193,7 +1213,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set, + } else if (f->groups == 32) { + NFT_SET_PIPAPO_AVX2_LOOKUP(4, 32); + } else { +- ret = nft_pipapo_avx2_lookup_slow(res, fill, f, ++ ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f, + ret, rp, + first, last); + } +@@ -1224,6 +1244,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set, + if (i % 2) + scratch->map_index = !map_index; + kernel_fpu_end(); ++ local_bh_enable(); + + return ret >= 0; + } +diff --git a/net/netfilter/nft_set_rbtree.c b/net/netfilter/nft_set_rbtree.c +index 5bf5572e945cc3..021d9e76129a5e 100644 +--- a/net/netfilter/nft_set_rbtree.c ++++ b/net/netfilter/nft_set_rbtree.c +@@ -314,6 +314,7 @@ static int __nft_rbtree_insert(const struct net *net, const struct nft_set *set, + struct nft_rbtree *priv = nft_set_priv(set); + u8 cur_genmask = nft_genmask_cur(net); + u8 genmask = nft_genmask_next(net); ++ u64 tstamp = nft_net_tstamp(net); + int d; + + /* Descend the tree to search for an existing element greater than the +@@ -361,7 +362,7 @@ static int __nft_rbtree_insert(const struct net *net, const struct nft_set *set, + /* perform garbage collection to avoid bogus overlap reports + * but skip new elements in this transaction. + */ +- if (nft_set_elem_expired(&rbe->ext) && ++ if (__nft_set_elem_expired(&rbe->ext, tstamp) && + nft_set_elem_active(&rbe->ext, cur_genmask)) { + const struct nft_rbtree_elem *removed_end; + +@@ -548,6 +549,7 @@ static void *nft_rbtree_deactivate(const struct net *net, + const struct rb_node *parent = priv->root.rb_node; + struct nft_rbtree_elem *rbe, *this = elem->priv; + u8 genmask = nft_genmask_next(net); ++ u64 tstamp = nft_net_tstamp(net); + int d; + + while (parent != NULL) { +@@ -568,7 +570,7 @@ static void *nft_rbtree_deactivate(const struct net *net, + nft_rbtree_interval_end(this)) { + parent = parent->rb_right; + continue; +- } else if (nft_set_elem_expired(&rbe->ext)) { ++ } else if (__nft_set_elem_expired(&rbe->ext, tstamp)) { + break; + } else if (!nft_set_elem_active(&rbe->ext, genmask)) { + parent = parent->rb_left; +diff --git a/net/packet/af_packet.c b/net/packet/af_packet.c +index 8d0feb9ad5a523..d1ae1d9133d304 100644 +--- a/net/packet/af_packet.c ++++ b/net/packet/af_packet.c +@@ -505,6 +505,61 @@ static void *packet_current_frame(struct packet_sock *po, + return packet_lookup_frame(po, rb, rb->head, status); + } + ++static u16 vlan_get_tci(struct sk_buff *skb, struct net_device *dev) ++{ ++ u8 *skb_orig_data = skb->data; ++ int skb_orig_len = skb->len; ++ struct vlan_hdr vhdr, *vh; ++ unsigned int header_len; ++ ++ if (!dev) ++ return 0; ++ ++ /* In the SOCK_DGRAM scenario, skb data starts at the network ++ * protocol, which is after the VLAN headers. The outer VLAN ++ * header is at the hard_header_len offset in non-variable ++ * length link layer headers. If it's a VLAN device, the ++ * min_header_len should be used to exclude the VLAN header ++ * size. ++ */ ++ if (dev->min_header_len == dev->hard_header_len) ++ header_len = dev->hard_header_len; ++ else if (is_vlan_dev(dev)) ++ header_len = dev->min_header_len; ++ else ++ return 0; ++ ++ skb_push(skb, skb->data - skb_mac_header(skb)); ++ vh = skb_header_pointer(skb, header_len, sizeof(vhdr), &vhdr); ++ if (skb_orig_data != skb->data) { ++ skb->data = skb_orig_data; ++ skb->len = skb_orig_len; ++ } ++ if (unlikely(!vh)) ++ return 0; ++ ++ return ntohs(vh->h_vlan_TCI); ++} ++ ++static __be16 vlan_get_protocol_dgram(struct sk_buff *skb) ++{ ++ __be16 proto = skb->protocol; ++ ++ if (unlikely(eth_type_vlan(proto))) { ++ u8 *skb_orig_data = skb->data; ++ int skb_orig_len = skb->len; ++ ++ skb_push(skb, skb->data - skb_mac_header(skb)); ++ proto = __vlan_get_protocol(skb, proto, NULL); ++ if (skb_orig_data != skb->data) { ++ skb->data = skb_orig_data; ++ skb->len = skb_orig_len; ++ } ++ } ++ ++ return proto; ++} ++ + static void prb_del_retire_blk_timer(struct tpacket_kbdq_core *pkc) + { + del_timer_sync(&pkc->retire_blk_timer); +@@ -974,10 +1029,16 @@ static void prb_clear_rxhash(struct tpacket_kbdq_core *pkc, + static void prb_fill_vlan_info(struct tpacket_kbdq_core *pkc, + struct tpacket3_hdr *ppd) + { ++ struct packet_sock *po = container_of(pkc, struct packet_sock, rx_ring.prb_bdqc); ++ + if (skb_vlan_tag_present(pkc->skb)) { + ppd->hv1.tp_vlan_tci = skb_vlan_tag_get(pkc->skb); + ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->vlan_proto); + ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; ++ } else if (unlikely(po->sk.sk_type == SOCK_DGRAM && eth_type_vlan(pkc->skb->protocol))) { ++ ppd->hv1.tp_vlan_tci = vlan_get_tci(pkc->skb, pkc->skb->dev); ++ ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->protocol); ++ ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; + } else { + ppd->hv1.tp_vlan_tci = 0; + ppd->hv1.tp_vlan_tpid = 0; +@@ -2393,6 +2454,10 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev, + h.h2->tp_vlan_tci = skb_vlan_tag_get(skb); + h.h2->tp_vlan_tpid = ntohs(skb->vlan_proto); + status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; ++ } else if (unlikely(sk->sk_type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) { ++ h.h2->tp_vlan_tci = vlan_get_tci(skb, skb->dev); ++ h.h2->tp_vlan_tpid = ntohs(skb->protocol); ++ status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; + } else { + h.h2->tp_vlan_tci = 0; + h.h2->tp_vlan_tpid = 0; +@@ -2422,7 +2487,8 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev, + sll->sll_halen = dev_parse_header(skb, sll->sll_addr); + sll->sll_family = AF_PACKET; + sll->sll_hatype = dev->type; +- sll->sll_protocol = skb->protocol; ++ sll->sll_protocol = (sk->sk_type == SOCK_DGRAM) ? ++ vlan_get_protocol_dgram(skb) : skb->protocol; + sll->sll_pkttype = skb->pkt_type; + if (unlikely(packet_sock_flag(po, PACKET_SOCK_ORIGDEV))) + sll->sll_ifindex = orig_dev->ifindex; +@@ -3447,7 +3513,8 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len, + /* Original length was stored in sockaddr_ll fields */ + origlen = PACKET_SKB_CB(skb)->sa.origlen; + sll->sll_family = AF_PACKET; +- sll->sll_protocol = skb->protocol; ++ sll->sll_protocol = (sock->type == SOCK_DGRAM) ? ++ vlan_get_protocol_dgram(skb) : skb->protocol; + } + + sock_recv_ts_and_drops(msg, sk, skb); +@@ -3502,6 +3569,21 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len, + aux.tp_vlan_tci = skb_vlan_tag_get(skb); + aux.tp_vlan_tpid = ntohs(skb->vlan_proto); + aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; ++ } else if (unlikely(sock->type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) { ++ struct sockaddr_ll *sll = &PACKET_SKB_CB(skb)->sa.ll; ++ struct net_device *dev; ++ ++ rcu_read_lock(); ++ dev = dev_get_by_index_rcu(sock_net(sk), sll->sll_ifindex); ++ if (dev) { ++ aux.tp_vlan_tci = vlan_get_tci(skb, dev); ++ aux.tp_vlan_tpid = ntohs(skb->protocol); ++ aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; ++ } else { ++ aux.tp_vlan_tci = 0; ++ aux.tp_vlan_tpid = 0; ++ } ++ rcu_read_unlock(); + } else { + aux.tp_vlan_tci = 0; + aux.tp_vlan_tpid = 0; +diff --git a/net/sched/act_ct.c b/net/sched/act_ct.c +index c602b0d698f294..a6c3b7145a105b 100644 +--- a/net/sched/act_ct.c ++++ b/net/sched/act_ct.c +@@ -41,6 +41,8 @@ static DEFINE_MUTEX(zones_mutex); + struct zones_ht_key { + struct net *net; + u16 zone; ++ /* Note : pad[] must be the last field. */ ++ u8 pad[]; + }; + + struct tcf_ct_flow_table { +@@ -57,7 +59,7 @@ struct tcf_ct_flow_table { + static const struct rhashtable_params zones_params = { + .head_offset = offsetof(struct tcf_ct_flow_table, node), + .key_offset = offsetof(struct tcf_ct_flow_table, key), +- .key_len = sizeof_field(struct tcf_ct_flow_table, key), ++ .key_len = offsetof(struct zones_ht_key, pad), + .automatic_shrinking = true, + }; + +diff --git a/net/sctp/input.c b/net/sctp/input.c +index d16b3885dcccba..4ee9374dcfb92f 100644 +--- a/net/sctp/input.c ++++ b/net/sctp/input.c +@@ -748,23 +748,25 @@ static int __sctp_hash_endpoint(struct sctp_endpoint *ep) + struct sock *sk = ep->base.sk; + struct net *net = sock_net(sk); + struct sctp_hashbucket *head; +- struct sctp_ep_common *epb; ++ int err = 0; + +- epb = &ep->base; +- epb->hashent = sctp_ep_hashfn(net, epb->bind_addr.port); +- head = &sctp_ep_hashtable[epb->hashent]; ++ ep->hashent = sctp_ep_hashfn(net, ep->base.bind_addr.port); ++ head = &sctp_ep_hashtable[ep->hashent]; + ++ write_lock(&head->lock); + if (sk->sk_reuseport) { + bool any = sctp_is_ep_boundall(sk); +- struct sctp_ep_common *epb2; ++ struct sctp_endpoint *ep2; + struct list_head *list; +- int cnt = 0, err = 1; ++ int cnt = 0; ++ ++ err = 1; + + list_for_each(list, &ep->base.bind_addr.address_list) + cnt++; + +- sctp_for_each_hentry(epb2, &head->chain) { +- struct sock *sk2 = epb2->sk; ++ sctp_for_each_hentry(ep2, &head->chain) { ++ struct sock *sk2 = ep2->base.sk; + + if (!net_eq(sock_net(sk2), net) || sk2 == sk || + !uid_eq(sock_i_uid(sk2), sock_i_uid(sk)) || +@@ -776,24 +778,24 @@ static int __sctp_hash_endpoint(struct sctp_endpoint *ep) + if (!err) { + err = reuseport_add_sock(sk, sk2, any); + if (err) +- return err; ++ goto out; + break; + } else if (err < 0) { +- return err; ++ goto out; + } + } + + if (err) { + err = reuseport_alloc(sk, any); + if (err) +- return err; ++ goto out; + } + } + +- write_lock(&head->lock); +- hlist_add_head(&epb->node, &head->chain); ++ hlist_add_head(&ep->node, &head->chain); ++out: + write_unlock(&head->lock); +- return 0; ++ return err; + } + + /* Add an endpoint to the hash. Local BH-safe. */ +@@ -813,19 +815,15 @@ static void __sctp_unhash_endpoint(struct sctp_endpoint *ep) + { + struct sock *sk = ep->base.sk; + struct sctp_hashbucket *head; +- struct sctp_ep_common *epb; +- +- epb = &ep->base; + +- epb->hashent = sctp_ep_hashfn(sock_net(sk), epb->bind_addr.port); ++ ep->hashent = sctp_ep_hashfn(sock_net(sk), ep->base.bind_addr.port); + +- head = &sctp_ep_hashtable[epb->hashent]; ++ head = &sctp_ep_hashtable[ep->hashent]; + ++ write_lock(&head->lock); + if (rcu_access_pointer(sk->sk_reuseport_cb)) + reuseport_detach_sock(sk); +- +- write_lock(&head->lock); +- hlist_del_init(&epb->node); ++ hlist_del_init(&ep->node); + write_unlock(&head->lock); + } + +@@ -858,7 +856,6 @@ static struct sctp_endpoint *__sctp_rcv_lookup_endpoint( + const union sctp_addr *paddr) + { + struct sctp_hashbucket *head; +- struct sctp_ep_common *epb; + struct sctp_endpoint *ep; + struct sock *sk; + __be16 lport; +@@ -868,8 +865,7 @@ static struct sctp_endpoint *__sctp_rcv_lookup_endpoint( + hash = sctp_ep_hashfn(net, ntohs(lport)); + head = &sctp_ep_hashtable[hash]; + read_lock(&head->lock); +- sctp_for_each_hentry(epb, &head->chain) { +- ep = sctp_ep(epb); ++ sctp_for_each_hentry(ep, &head->chain) { + if (sctp_endpoint_is_match(ep, net, laddr)) + goto hit; + } +diff --git a/net/sctp/proc.c b/net/sctp/proc.c +index 963b94517ec20f..ec00ee75d59a65 100644 +--- a/net/sctp/proc.c ++++ b/net/sctp/proc.c +@@ -161,7 +161,6 @@ static void *sctp_eps_seq_next(struct seq_file *seq, void *v, loff_t *pos) + static int sctp_eps_seq_show(struct seq_file *seq, void *v) + { + struct sctp_hashbucket *head; +- struct sctp_ep_common *epb; + struct sctp_endpoint *ep; + struct sock *sk; + int hash = *(loff_t *)v; +@@ -171,18 +170,17 @@ static int sctp_eps_seq_show(struct seq_file *seq, void *v) + + head = &sctp_ep_hashtable[hash]; + read_lock_bh(&head->lock); +- sctp_for_each_hentry(epb, &head->chain) { +- ep = sctp_ep(epb); +- sk = epb->sk; ++ sctp_for_each_hentry(ep, &head->chain) { ++ sk = ep->base.sk; + if (!net_eq(sock_net(sk), seq_file_net(seq))) + continue; + seq_printf(seq, "%8pK %8pK %-3d %-3d %-4d %-5d %5u %5lu ", ep, sk, + sctp_sk(sk)->type, sk->sk_state, hash, +- epb->bind_addr.port, ++ ep->base.bind_addr.port, + from_kuid_munged(seq_user_ns(seq), sock_i_uid(sk)), + sock_i_ino(sk)); + +- sctp_seq_dump_local_addrs(seq, epb); ++ sctp_seq_dump_local_addrs(seq, &ep->base); + seq_printf(seq, "\n"); + } + read_unlock_bh(&head->lock); +diff --git a/net/sctp/socket.c b/net/sctp/socket.c +index 967b330ffd4e3f..9fe13de66b2728 100644 +--- a/net/sctp/socket.c ++++ b/net/sctp/socket.c +@@ -5303,14 +5303,14 @@ int sctp_for_each_endpoint(int (*cb)(struct sctp_endpoint *, void *), + void *p) { + int err = 0; + int hash = 0; +- struct sctp_ep_common *epb; ++ struct sctp_endpoint *ep; + struct sctp_hashbucket *head; + + for (head = sctp_ep_hashtable; hash < sctp_ep_hashsize; + hash++, head++) { + read_lock_bh(&head->lock); +- sctp_for_each_hentry(epb, &head->chain) { +- err = cb(sctp_ep(epb), p); ++ sctp_for_each_hentry(ep, &head->chain) { ++ err = cb(ep, p); + if (err) + break; + } +diff --git a/net/smc/smc_core.c b/net/smc/smc_core.c +index b84896acd4732c..0b32612b86aa27 100644 +--- a/net/smc/smc_core.c ++++ b/net/smc/smc_core.c +@@ -1772,7 +1772,6 @@ int smc_conn_create(struct smc_sock *smc, struct smc_init_info *ini) + */ + static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb) + { +- const unsigned int max_scat = SG_MAX_SINGLE_ALLOC * PAGE_SIZE; + u8 compressed; + + if (size <= SMC_BUF_MIN_SIZE) +@@ -1782,9 +1781,11 @@ static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb) + compressed = min_t(u8, ilog2(size) + 1, + is_smcd ? SMCD_DMBE_SIZES : SMCR_RMBE_SIZES); + ++#ifdef CONFIG_ARCH_NO_SG_CHAIN + if (!is_smcd && is_rmb) + /* RMBs are backed by & limited to max size of scatterlists */ +- compressed = min_t(u8, compressed, ilog2(max_scat >> 14)); ++ compressed = min_t(u8, compressed, ilog2((SG_MAX_SINGLE_ALLOC * PAGE_SIZE) >> 14)); ++#endif + + return compressed; + } +diff --git a/net/sunrpc/auth_gss/gss_krb5_keys.c b/net/sunrpc/auth_gss/gss_krb5_keys.c +index 726c076950c042..fc4639687c0fde 100644 +--- a/net/sunrpc/auth_gss/gss_krb5_keys.c ++++ b/net/sunrpc/auth_gss/gss_krb5_keys.c +@@ -161,7 +161,7 @@ u32 krb5_derive_key(const struct gss_krb5_enctype *gk5e, + if (IS_ERR(cipher)) + goto err_return; + if (crypto_sync_skcipher_setkey(cipher, inkey->data, inkey->len)) +- goto err_return; ++ goto err_free_cipher; + + /* allocate and set up buffers */ + +diff --git a/net/sunrpc/clnt.c b/net/sunrpc/clnt.c +index f73d4593625cdf..38071a6780211b 100644 +--- a/net/sunrpc/clnt.c ++++ b/net/sunrpc/clnt.c +@@ -2226,12 +2226,13 @@ call_transmit_status(struct rpc_task *task) + task->tk_action = call_transmit; + task->tk_status = 0; + break; +- case -ECONNREFUSED: + case -EHOSTDOWN: + case -ENETDOWN: + case -EHOSTUNREACH: + case -ENETUNREACH: + case -EPERM: ++ break; ++ case -ECONNREFUSED: + if (RPC_IS_SOFTCONN(task)) { + if (!task->tk_msg.rpc_proc->p_proc) + trace_xprt_ping(task->tk_xprt, +diff --git a/net/sunrpc/sched.c b/net/sunrpc/sched.c +index a00890962e1153..540220264b31e2 100644 +--- a/net/sunrpc/sched.c ++++ b/net/sunrpc/sched.c +@@ -348,8 +348,10 @@ static void rpc_make_runnable(struct workqueue_struct *wq, + if (RPC_IS_ASYNC(task)) { + INIT_WORK(&task->u.tk_work, rpc_async_schedule); + queue_work(wq, &task->u.tk_work); +- } else ++ } else { ++ smp_mb__after_atomic(); + wake_up_bit(&task->tk_runstate, RPC_TASK_QUEUED); ++ } + } + + /* +diff --git a/net/sunrpc/xprtrdma/frwr_ops.c b/net/sunrpc/xprtrdma/frwr_ops.c +index f700b34a5bfd24..551f3dd4e62377 100644 +--- a/net/sunrpc/xprtrdma/frwr_ops.c ++++ b/net/sunrpc/xprtrdma/frwr_ops.c +@@ -96,7 +96,8 @@ static void frwr_mr_put(struct rpcrdma_mr *mr) + rpcrdma_mr_push(mr, &mr->mr_req->rl_free_mrs); + } + +-/* frwr_reset - Place MRs back on the free list ++/** ++ * frwr_reset - Place MRs back on @req's free list + * @req: request to reset + * + * Used after a failed marshal. For FRWR, this means the MRs +diff --git a/net/sunrpc/xprtrdma/verbs.c b/net/sunrpc/xprtrdma/verbs.c +index 34413d4ab0e527..b61ade10254d4b 100644 +--- a/net/sunrpc/xprtrdma/verbs.c ++++ b/net/sunrpc/xprtrdma/verbs.c +@@ -924,6 +924,8 @@ static int rpcrdma_reqs_setup(struct rpcrdma_xprt *r_xprt) + + static void rpcrdma_req_reset(struct rpcrdma_req *req) + { ++ struct rpcrdma_mr *mr; ++ + /* Credits are valid for only one connection */ + req->rl_slot.rq_cong = 0; + +@@ -933,7 +935,19 @@ static void rpcrdma_req_reset(struct rpcrdma_req *req) + rpcrdma_regbuf_dma_unmap(req->rl_sendbuf); + rpcrdma_regbuf_dma_unmap(req->rl_recvbuf); + +- frwr_reset(req); ++ /* The verbs consumer can't know the state of an MR on the ++ * req->rl_registered list unless a successful completion ++ * has occurred, so they cannot be re-used. ++ */ ++ while ((mr = rpcrdma_mr_pop(&req->rl_registered))) { ++ struct rpcrdma_buffer *buf = &mr->mr_xprt->rx_buf; ++ ++ spin_lock(&buf->rb_lock); ++ list_del(&mr->mr_all); ++ spin_unlock(&buf->rb_lock); ++ ++ frwr_mr_release(mr); ++ } + } + + /* ASSUMPTION: the rb_allreqs list is stable for the duration, +diff --git a/net/tipc/udp_media.c b/net/tipc/udp_media.c +index 0a85244fd61885..73e461dc12d7b4 100644 +--- a/net/tipc/udp_media.c ++++ b/net/tipc/udp_media.c +@@ -135,8 +135,11 @@ static int tipc_udp_addr2str(struct tipc_media_addr *a, char *buf, int size) + snprintf(buf, size, "%pI4:%u", &ua->ipv4, ntohs(ua->port)); + else if (ntohs(ua->proto) == ETH_P_IPV6) + snprintf(buf, size, "%pI6:%u", &ua->ipv6, ntohs(ua->port)); +- else ++ else { + pr_err("Invalid UDP media address\n"); ++ return 1; ++ } ++ + return 0; + } + +diff --git a/net/tls/tls_sw.c b/net/tls/tls_sw.c +index 90f6cbe5cd5d2f..c17c3a14b9c19f 100644 +--- a/net/tls/tls_sw.c ++++ b/net/tls/tls_sw.c +@@ -468,7 +468,6 @@ static void tls_encrypt_done(struct crypto_async_request *req, int err) + struct scatterlist *sge; + struct sk_msg *msg_en; + struct tls_rec *rec; +- bool ready = false; + + if (err == -EINPROGRESS) /* see the comment in tls_decrypt_done() */ + return; +@@ -502,19 +501,16 @@ static void tls_encrypt_done(struct crypto_async_request *req, int err) + /* If received record is at head of tx_list, schedule tx */ + first_rec = list_first_entry(&ctx->tx_list, + struct tls_rec, list); +- if (rec == first_rec) +- ready = true; ++ if (rec == first_rec) { ++ /* Schedule the transmission */ ++ if (!test_and_set_bit(BIT_TX_SCHEDULED, ++ &ctx->tx_bitmask)) ++ schedule_delayed_work(&ctx->tx_work.work, 1); ++ } + } + + if (atomic_dec_and_test(&ctx->encrypt_pending)) + complete(&ctx->async_wait.completion); +- +- if (!ready) +- return; +- +- /* Schedule the transmission */ +- if (!test_and_set_bit(BIT_TX_SCHEDULED, &ctx->tx_bitmask)) +- schedule_delayed_work(&ctx->tx_work.work, 1); + } + + static int tls_encrypt_async_wait(struct tls_sw_context_tx *ctx) +diff --git a/net/wireless/nl80211.c b/net/wireless/nl80211.c +index d758ec56558928..a46278cf67da97 100644 +--- a/net/wireless/nl80211.c ++++ b/net/wireless/nl80211.c +@@ -438,6 +438,10 @@ sar_policy[NL80211_SAR_ATTR_MAX + 1] = { + [NL80211_SAR_ATTR_SPECS] = NLA_POLICY_NESTED_ARRAY(sar_specs_policy), + }; + ++static struct netlink_range_validation q_range = { ++ .max = INT_MAX, ++}; ++ + static const struct nla_policy nl80211_policy[NUM_NL80211_ATTR] = { + [0] = { .strict_start_type = NL80211_ATTR_HE_OBSS_PD }, + [NL80211_ATTR_WIPHY] = { .type = NLA_U32 }, +@@ -720,7 +724,7 @@ static const struct nla_policy nl80211_policy[NUM_NL80211_ATTR] = { + + [NL80211_ATTR_TXQ_LIMIT] = { .type = NLA_U32 }, + [NL80211_ATTR_TXQ_MEMORY_LIMIT] = { .type = NLA_U32 }, +- [NL80211_ATTR_TXQ_QUANTUM] = { .type = NLA_U32 }, ++ [NL80211_ATTR_TXQ_QUANTUM] = NLA_POLICY_FULL_RANGE(NLA_U32, &q_range), + [NL80211_ATTR_HE_CAPABILITY] = + NLA_POLICY_RANGE(NLA_BINARY, + NL80211_HE_MIN_CAPABILITY_LEN, +@@ -4137,10 +4141,7 @@ static void get_key_callback(void *c, struct key_params *params) + struct nlattr *key; + struct get_key_cookie *cookie = c; + +- if ((params->key && +- nla_put(cookie->msg, NL80211_ATTR_KEY_DATA, +- params->key_len, params->key)) || +- (params->seq && ++ if ((params->seq && + nla_put(cookie->msg, NL80211_ATTR_KEY_SEQ, + params->seq_len, params->seq)) || + (params->cipher && +@@ -4152,10 +4153,7 @@ static void get_key_callback(void *c, struct key_params *params) + if (!key) + goto nla_put_failure; + +- if ((params->key && +- nla_put(cookie->msg, NL80211_KEY_DATA, +- params->key_len, params->key)) || +- (params->seq && ++ if ((params->seq && + nla_put(cookie->msg, NL80211_KEY_SEQ, + params->seq_len, params->seq)) || + (params->cipher && +diff --git a/net/wireless/util.c b/net/wireless/util.c +index d40c2cf777dc0e..6ebc6567b2875a 100644 +--- a/net/wireless/util.c ++++ b/net/wireless/util.c +@@ -1363,7 +1363,7 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate) + 5120, /* 0.833333... */ + }; + u32 rates_160M[3] = { 960777777, 907400000, 816666666 }; +- u32 rates_969[3] = { 480388888, 453700000, 408333333 }; ++ u32 rates_996[3] = { 480388888, 453700000, 408333333 }; + u32 rates_484[3] = { 229411111, 216666666, 195000000 }; + u32 rates_242[3] = { 114711111, 108333333, 97500000 }; + u32 rates_106[3] = { 40000000, 37777777, 34000000 }; +@@ -1383,12 +1383,14 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate) + if (WARN_ON_ONCE(rate->nss < 1 || rate->nss > 8)) + return 0; + +- if (rate->bw == RATE_INFO_BW_160) ++ if (rate->bw == RATE_INFO_BW_160 || ++ (rate->bw == RATE_INFO_BW_HE_RU && ++ rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_2x996)) + result = rates_160M[rate->he_gi]; + else if (rate->bw == RATE_INFO_BW_80 || + (rate->bw == RATE_INFO_BW_HE_RU && + rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_996)) +- result = rates_969[rate->he_gi]; ++ result = rates_996[rate->he_gi]; + else if (rate->bw == RATE_INFO_BW_40 || + (rate->bw == RATE_INFO_BW_HE_RU && + rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_484)) +diff --git a/scripts/gcc-x86_32-has-stack-protector.sh b/scripts/gcc-x86_32-has-stack-protector.sh +index 825c75c5b71505..9459ca4f0f11fb 100755 +--- a/scripts/gcc-x86_32-has-stack-protector.sh ++++ b/scripts/gcc-x86_32-has-stack-protector.sh +@@ -5,4 +5,4 @@ + # -mstack-protector-guard-reg, added by + # https://gcc.gnu.org/bugzilla/show_bug.cgi?id=81708 + +-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs" ++echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs" +diff --git a/scripts/gcc-x86_64-has-stack-protector.sh b/scripts/gcc-x86_64-has-stack-protector.sh +index 75e4e22b986adc..f680bb01aeeb30 100755 +--- a/scripts/gcc-x86_64-has-stack-protector.sh ++++ b/scripts/gcc-x86_64-has-stack-protector.sh +@@ -1,4 +1,4 @@ + #!/bin/sh + # SPDX-License-Identifier: GPL-2.0 + +-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs" ++echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs" +diff --git a/security/apparmor/lsm.c b/security/apparmor/lsm.c +index 10274eb90fa37c..cf26ffe8cccb7d 100644 +--- a/security/apparmor/lsm.c ++++ b/security/apparmor/lsm.c +@@ -1057,6 +1057,13 @@ static int apparmor_socket_sock_rcv_skb(struct sock *sk, struct sk_buff *skb) + if (!skb->secmark) + return 0; + ++ /* ++ * If reach here before socket_post_create hook is called, in which ++ * case label is null, drop the packet. ++ */ ++ if (!ctx->label) ++ return -EACCES; ++ + return apparmor_secmark_check(ctx->label, OP_RECVMSG, AA_MAY_RECEIVE, + skb->secmark, sk); + } +diff --git a/security/apparmor/policy.c b/security/apparmor/policy.c +index fcf22577f606c8..e59bdb750ef00c 100644 +--- a/security/apparmor/policy.c ++++ b/security/apparmor/policy.c +@@ -187,7 +187,7 @@ static void aa_free_data(void *ptr, void *arg) + { + struct aa_data *data = ptr; + +- kfree_sensitive(data->data); ++ kvfree_sensitive(data->data, data->size); + kfree_sensitive(data->key); + kfree_sensitive(data); + } +diff --git a/security/apparmor/policy_unpack.c b/security/apparmor/policy_unpack.c +index d1a385b44d6318..851fd621283159 100644 +--- a/security/apparmor/policy_unpack.c ++++ b/security/apparmor/policy_unpack.c +@@ -915,6 +915,7 @@ static struct aa_profile *unpack_profile(struct aa_ext *e, char **ns_name) + + if (rhashtable_insert_fast(profile->data, &data->head, + profile->data->p)) { ++ kvfree_sensitive(data->data, data->size); + kfree_sensitive(data->key); + kfree_sensitive(data); + info = "failed to insert data to table"; +diff --git a/security/keys/keyctl.c b/security/keys/keyctl.c +index cfb5000876922d..255115251ce53d 100644 +--- a/security/keys/keyctl.c ++++ b/security/keys/keyctl.c +@@ -1694,7 +1694,7 @@ long keyctl_session_to_parent(void) + goto unlock; + + /* cancel an already pending keyring replacement */ +- oldwork = task_work_cancel(parent, key_change_session_keyring); ++ oldwork = task_work_cancel_func(parent, key_change_session_keyring); + + /* the replacement session keyring is applied just prior to userspace + * restarting */ +diff --git a/security/landlock/cred.c b/security/landlock/cred.c +index ec6c37f04a1919..e215607fd46c74 100644 +--- a/security/landlock/cred.c ++++ b/security/landlock/cred.c +@@ -14,8 +14,8 @@ + #include "ruleset.h" + #include "setup.h" + +-static int hook_cred_prepare(struct cred *const new, +- const struct cred *const old, const gfp_t gfp) ++static void hook_cred_transfer(struct cred *const new, ++ const struct cred *const old) + { + struct landlock_ruleset *const old_dom = landlock_cred(old)->domain; + +@@ -23,6 +23,12 @@ static int hook_cred_prepare(struct cred *const new, + landlock_get_ruleset(old_dom); + landlock_cred(new)->domain = old_dom; + } ++} ++ ++static int hook_cred_prepare(struct cred *const new, ++ const struct cred *const old, const gfp_t gfp) ++{ ++ hook_cred_transfer(new, old); + return 0; + } + +@@ -36,6 +42,7 @@ static void hook_cred_free(struct cred *const cred) + + static struct security_hook_list landlock_hooks[] __lsm_ro_after_init = { + LSM_HOOK_INIT(cred_prepare, hook_cred_prepare), ++ LSM_HOOK_INIT(cred_transfer, hook_cred_transfer), + LSM_HOOK_INIT(cred_free, hook_cred_free), + }; + +diff --git a/sound/firewire/amdtp-stream.c b/sound/firewire/amdtp-stream.c +index 8753125683692b..842fe127c53781 100644 +--- a/sound/firewire/amdtp-stream.c ++++ b/sound/firewire/amdtp-stream.c +@@ -77,6 +77,8 @@ + // overrun. Actual device can skip more, then this module stops the packet streaming. + #define IR_JUMBO_PAYLOAD_MAX_SKIP_CYCLES 5 + ++static void pcm_period_work(struct work_struct *work); ++ + /** + * amdtp_stream_init - initialize an AMDTP stream structure + * @s: the AMDTP stream to initialize +@@ -105,6 +107,7 @@ int amdtp_stream_init(struct amdtp_stream *s, struct fw_unit *unit, + s->flags = flags; + s->context = ERR_PTR(-1); + mutex_init(&s->mutex); ++ INIT_WORK(&s->period_work, pcm_period_work); + s->packet_index = 0; + + init_waitqueue_head(&s->ready_wait); +@@ -343,6 +346,7 @@ EXPORT_SYMBOL(amdtp_stream_get_max_payload); + */ + void amdtp_stream_pcm_prepare(struct amdtp_stream *s) + { ++ cancel_work_sync(&s->period_work); + s->pcm_buffer_pointer = 0; + s->pcm_period_pointer = 0; + } +@@ -609,19 +613,21 @@ static void update_pcm_pointers(struct amdtp_stream *s, + // The program in user process should periodically check the status of intermediate + // buffer associated to PCM substream to process PCM frames in the buffer, instead + // of receiving notification of period elapsed by poll wait. +- if (!pcm->runtime->no_period_wakeup) { +- if (in_softirq()) { +- // In software IRQ context for 1394 OHCI. +- snd_pcm_period_elapsed(pcm); +- } else { +- // In process context of ALSA PCM application under acquired lock of +- // PCM substream. +- snd_pcm_period_elapsed_under_stream_lock(pcm); +- } +- } ++ if (!pcm->runtime->no_period_wakeup) ++ queue_work(system_highpri_wq, &s->period_work); + } + } + ++static void pcm_period_work(struct work_struct *work) ++{ ++ struct amdtp_stream *s = container_of(work, struct amdtp_stream, ++ period_work); ++ struct snd_pcm_substream *pcm = READ_ONCE(s->pcm); ++ ++ if (pcm) ++ snd_pcm_period_elapsed(pcm); ++} ++ + static int queue_packet(struct amdtp_stream *s, struct fw_iso_packet *params, + bool sched_irq) + { +@@ -1738,11 +1744,14 @@ unsigned long amdtp_domain_stream_pcm_pointer(struct amdtp_domain *d, + { + struct amdtp_stream *irq_target = d->irq_target; + +- // Process isochronous packets queued till recent isochronous cycle to handle PCM frames. + if (irq_target && amdtp_stream_running(irq_target)) { +- // In software IRQ context, the call causes dead-lock to disable the tasklet +- // synchronously. +- if (!in_softirq()) ++ // use wq to prevent AB/BA deadlock competition for ++ // substream lock: ++ // fw_iso_context_flush_completions() acquires ++ // lock by ohci_flush_iso_completions(), ++ // amdtp-stream process_rx_packets() attempts to ++ // acquire same lock by snd_pcm_elapsed() ++ if (current_work() != &s->period_work) + fw_iso_context_flush_completions(irq_target->context); + } + +@@ -1798,6 +1807,7 @@ static void amdtp_stream_stop(struct amdtp_stream *s) + return; + } + ++ cancel_work_sync(&s->period_work); + fw_iso_context_stop(s->context); + fw_iso_context_destroy(s->context); + s->context = ERR_PTR(-1); +diff --git a/sound/firewire/amdtp-stream.h b/sound/firewire/amdtp-stream.h +index cf9ab347277f2a..011d0f0c39415a 100644 +--- a/sound/firewire/amdtp-stream.h ++++ b/sound/firewire/amdtp-stream.h +@@ -190,6 +190,7 @@ struct amdtp_stream { + + /* For a PCM substream processing. */ + struct snd_pcm_substream *pcm; ++ struct work_struct period_work; + snd_pcm_uframes_t pcm_buffer_pointer; + unsigned int pcm_period_pointer; + +diff --git a/sound/pci/hda/patch_conexant.c b/sound/pci/hda/patch_conexant.c +index 876380ad2ed136..09a272c65be111 100644 +--- a/sound/pci/hda/patch_conexant.c ++++ b/sound/pci/hda/patch_conexant.c +@@ -21,12 +21,6 @@ + #include "hda_jack.h" + #include "hda_generic.h" + +-enum { +- CX_HEADSET_NOPRESENT = 0, +- CX_HEADSET_PARTPRESENT, +- CX_HEADSET_ALLPRESENT, +-}; +- + struct conexant_spec { + struct hda_gen_spec gen; + +@@ -48,7 +42,6 @@ struct conexant_spec { + unsigned int gpio_led; + unsigned int gpio_mute_led_mask; + unsigned int gpio_mic_led_mask; +- unsigned int headset_present_flag; + bool is_cx8070_sn6140; + }; + +@@ -250,48 +243,19 @@ static void cx_process_headset_plugin(struct hda_codec *codec) + } + } + +-static void cx_update_headset_mic_vref(struct hda_codec *codec, unsigned int res) ++static void cx_update_headset_mic_vref(struct hda_codec *codec, struct hda_jack_callback *event) + { +- unsigned int phone_present, mic_persent, phone_tag, mic_tag; +- struct conexant_spec *spec = codec->spec; ++ unsigned int mic_present; + + /* In cx8070 and sn6140, the node 16 can only be config to headphone or disabled, + * the node 19 can only be config to microphone or disabled. + * Check hp&mic tag to process headset pulgin&plugout. + */ +- phone_tag = snd_hda_codec_read(codec, 0x16, 0, AC_VERB_GET_UNSOLICITED_RESPONSE, 0x0); +- mic_tag = snd_hda_codec_read(codec, 0x19, 0, AC_VERB_GET_UNSOLICITED_RESPONSE, 0x0); +- if ((phone_tag & (res >> AC_UNSOL_RES_TAG_SHIFT)) || +- (mic_tag & (res >> AC_UNSOL_RES_TAG_SHIFT))) { +- phone_present = snd_hda_codec_read(codec, 0x16, 0, AC_VERB_GET_PIN_SENSE, 0x0); +- if (!(phone_present & AC_PINSENSE_PRESENCE)) {/* headphone plugout */ +- spec->headset_present_flag = CX_HEADSET_NOPRESENT; +- snd_hda_codec_write(codec, 0x19, 0, AC_VERB_SET_PIN_WIDGET_CONTROL, 0x20); +- return; +- } +- if (spec->headset_present_flag == CX_HEADSET_NOPRESENT) { +- spec->headset_present_flag = CX_HEADSET_PARTPRESENT; +- } else if (spec->headset_present_flag == CX_HEADSET_PARTPRESENT) { +- mic_persent = snd_hda_codec_read(codec, 0x19, 0, +- AC_VERB_GET_PIN_SENSE, 0x0); +- /* headset is present */ +- if ((phone_present & AC_PINSENSE_PRESENCE) && +- (mic_persent & AC_PINSENSE_PRESENCE)) { +- cx_process_headset_plugin(codec); +- spec->headset_present_flag = CX_HEADSET_ALLPRESENT; +- } +- } +- } +-} +- +-static void cx_jack_unsol_event(struct hda_codec *codec, unsigned int res) +-{ +- struct conexant_spec *spec = codec->spec; +- +- if (spec->is_cx8070_sn6140) +- cx_update_headset_mic_vref(codec, res); +- +- snd_hda_jack_unsol_event(codec, res); ++ mic_present = snd_hda_codec_read(codec, 0x19, 0, AC_VERB_GET_PIN_SENSE, 0x0); ++ if (!(mic_present & AC_PINSENSE_PRESENCE)) /* mic plugout */ ++ snd_hda_codec_write(codec, 0x19, 0, AC_VERB_SET_PIN_WIDGET_CONTROL, 0x20); ++ else ++ cx_process_headset_plugin(codec); + } + + #ifdef CONFIG_PM +@@ -307,7 +271,7 @@ static const struct hda_codec_ops cx_auto_patch_ops = { + .build_pcms = snd_hda_gen_build_pcms, + .init = cx_auto_init, + .free = cx_auto_free, +- .unsol_event = cx_jack_unsol_event, ++ .unsol_event = snd_hda_jack_unsol_event, + #ifdef CONFIG_PM + .suspend = cx_auto_suspend, + .check_power_status = snd_hda_gen_check_power_status, +@@ -1167,7 +1131,7 @@ static int patch_conexant_auto(struct hda_codec *codec) + case 0x14f11f86: + case 0x14f11f87: + spec->is_cx8070_sn6140 = true; +- spec->headset_present_flag = CX_HEADSET_NOPRESENT; ++ snd_hda_jack_detect_enable_callback(codec, 0x19, cx_update_headset_mic_vref); + break; + } + +diff --git a/sound/pci/hda/patch_hdmi.c b/sound/pci/hda/patch_hdmi.c +index 20a899db2f1558..81025d45306d38 100644 +--- a/sound/pci/hda/patch_hdmi.c ++++ b/sound/pci/hda/patch_hdmi.c +@@ -1960,6 +1960,8 @@ static int hdmi_add_cvt(struct hda_codec *codec, hda_nid_t cvt_nid) + } + + static const struct snd_pci_quirk force_connect_list[] = { ++ SND_PCI_QUIRK(0x103c, 0x83e2, "HP EliteDesk 800 G4", 1), ++ SND_PCI_QUIRK(0x103c, 0x83ef, "HP MP9 G4 Retail System AMS", 1), + SND_PCI_QUIRK(0x103c, 0x870f, "HP", 1), + SND_PCI_QUIRK(0x103c, 0x871a, "HP", 1), + SND_PCI_QUIRK(0x103c, 0x8711, "HP", 1), +diff --git a/sound/pci/hda/patch_realtek.c b/sound/pci/hda/patch_realtek.c +index 18fda6eb279009..8729896c7f9cd5 100644 +--- a/sound/pci/hda/patch_realtek.c ++++ b/sound/pci/hda/patch_realtek.c +@@ -8958,6 +8958,7 @@ static const struct snd_pci_quirk alc269_fixup_tbl[] = { + SND_PCI_QUIRK(0x1025, 0x079b, "Acer Aspire V5-573G", ALC282_FIXUP_ASPIRE_V5_PINS), + SND_PCI_QUIRK(0x1025, 0x080d, "Acer Aspire V5-122P", ALC269_FIXUP_ASPIRE_HEADSET_MIC), + SND_PCI_QUIRK(0x1025, 0x0840, "Acer Aspire E1", ALC269VB_FIXUP_ASPIRE_E1_COEF), ++ SND_PCI_QUIRK(0x1025, 0x100c, "Acer Aspire E5-574G", ALC255_FIXUP_ACER_LIMIT_INT_MIC_BOOST), + SND_PCI_QUIRK(0x1025, 0x101c, "Acer Veriton N2510G", ALC269_FIXUP_LIFEBOOK), + SND_PCI_QUIRK(0x1025, 0x102b, "Acer Aspire C24-860", ALC286_FIXUP_ACER_AIO_MIC_NO_PRESENCE), + SND_PCI_QUIRK(0x1025, 0x1065, "Acer Aspire C20-820", ALC269VC_FIXUP_ACER_HEADSET_MIC), +diff --git a/sound/soc/codecs/max98088.c b/sound/soc/codecs/max98088.c +index f8e49e45ce33f1..a71fbfddc29a7c 100644 +--- a/sound/soc/codecs/max98088.c ++++ b/sound/soc/codecs/max98088.c +@@ -1319,6 +1319,7 @@ static int max98088_set_bias_level(struct snd_soc_component *component, + enum snd_soc_bias_level level) + { + struct max98088_priv *max98088 = snd_soc_component_get_drvdata(component); ++ int ret; + + switch (level) { + case SND_SOC_BIAS_ON: +@@ -1334,10 +1335,13 @@ static int max98088_set_bias_level(struct snd_soc_component *component, + */ + if (!IS_ERR(max98088->mclk)) { + if (snd_soc_component_get_bias_level(component) == +- SND_SOC_BIAS_ON) ++ SND_SOC_BIAS_ON) { + clk_disable_unprepare(max98088->mclk); +- else +- clk_prepare_enable(max98088->mclk); ++ } else { ++ ret = clk_prepare_enable(max98088->mclk); ++ if (ret) ++ return ret; ++ } + } + break; + +diff --git a/sound/soc/codecs/wcd938x-sdw.c b/sound/soc/codecs/wcd938x-sdw.c +index 84a67bd98dc051..cfe694fddd139d 100644 +--- a/sound/soc/codecs/wcd938x-sdw.c ++++ b/sound/soc/codecs/wcd938x-sdw.c +@@ -250,12 +250,12 @@ static int wcd9380_probe(struct sdw_slave *pdev, + SDW_SCP_INT1_PARITY; + pdev->prop.lane_control_support = true; + if (wcd->is_tx) { +- pdev->prop.source_ports = GENMASK(WCD938X_MAX_SWR_PORTS, 0); ++ pdev->prop.source_ports = GENMASK(WCD938X_MAX_SWR_PORTS - 1, 0); + pdev->prop.src_dpn_prop = wcd938x_dpn_prop; + wcd->ch_info = &wcd938x_sdw_tx_ch_info[0]; + pdev->prop.wake_capable = true; + } else { +- pdev->prop.sink_ports = GENMASK(WCD938X_MAX_SWR_PORTS, 0); ++ pdev->prop.sink_ports = GENMASK(WCD938X_MAX_SWR_PORTS - 1, 0); + pdev->prop.sink_dpn_prop = wcd938x_dpn_prop; + wcd->ch_info = &wcd938x_sdw_rx_ch_info[0]; + } +diff --git a/sound/soc/codecs/wsa881x.c b/sound/soc/codecs/wsa881x.c +index 85590476948730..c8d3dc63410378 100644 +--- a/sound/soc/codecs/wsa881x.c ++++ b/sound/soc/codecs/wsa881x.c +@@ -1120,7 +1120,7 @@ static int wsa881x_probe(struct sdw_slave *pdev, + wsa881x->sconfig.frame_rate = 48000; + wsa881x->sconfig.direction = SDW_DATA_DIR_RX; + wsa881x->sconfig.type = SDW_STREAM_PDM; +- pdev->prop.sink_ports = GENMASK(WSA881X_MAX_SWR_PORTS, 0); ++ pdev->prop.sink_ports = GENMASK(WSA881X_MAX_SWR_PORTS - 1, 0); + pdev->prop.sink_dpn_prop = wsa_sink_dpn_prop; + pdev->prop.scp_int1_mask = SDW_SCP_INT1_BUS_CLASH | SDW_SCP_INT1_PARITY; + gpiod_direction_output(wsa881x->sd_n, 1); +diff --git a/sound/soc/intel/common/soc-intel-quirks.h b/sound/soc/intel/common/soc-intel-quirks.h +index de4e550c5b34dc..42bd51456b945d 100644 +--- a/sound/soc/intel/common/soc-intel-quirks.h ++++ b/sound/soc/intel/common/soc-intel-quirks.h +@@ -11,7 +11,7 @@ + + #include <linux/platform_data/x86/soc.h> + +-#if IS_ENABLED(CONFIG_X86) ++#if IS_REACHABLE(CONFIG_IOSF_MBI) + + #include <linux/dmi.h> + #include <asm/iosf_mbi.h> +diff --git a/sound/soc/meson/axg-fifo.c b/sound/soc/meson/axg-fifo.c +index 94b169a5493b5f..5218e40aeb1bbc 100644 +--- a/sound/soc/meson/axg-fifo.c ++++ b/sound/soc/meson/axg-fifo.c +@@ -207,25 +207,18 @@ static irqreturn_t axg_fifo_pcm_irq_block(int irq, void *dev_id) + status = FIELD_GET(STATUS1_INT_STS, status); + axg_fifo_ack_irq(fifo, status); + +- /* Use the thread to call period elapsed on nonatomic links */ +- if (status & FIFO_INT_COUNT_REPEAT) +- return IRQ_WAKE_THREAD; ++ if (status & ~FIFO_INT_COUNT_REPEAT) ++ dev_dbg(axg_fifo_dev(ss), "unexpected irq - STS 0x%02x\n", ++ status); + +- dev_dbg(axg_fifo_dev(ss), "unexpected irq - STS 0x%02x\n", +- status); ++ if (status & FIFO_INT_COUNT_REPEAT) { ++ snd_pcm_period_elapsed(ss); ++ return IRQ_HANDLED; ++ } + + return IRQ_NONE; + } + +-static irqreturn_t axg_fifo_pcm_irq_block_thread(int irq, void *dev_id) +-{ +- struct snd_pcm_substream *ss = dev_id; +- +- snd_pcm_period_elapsed(ss); +- +- return IRQ_HANDLED; +-} +- + int axg_fifo_pcm_open(struct snd_soc_component *component, + struct snd_pcm_substream *ss) + { +@@ -251,8 +244,9 @@ int axg_fifo_pcm_open(struct snd_soc_component *component, + if (ret) + return ret; + +- ret = request_threaded_irq(fifo->irq, axg_fifo_pcm_irq_block, +- axg_fifo_pcm_irq_block_thread, ++ /* Use the threaded irq handler only with non-atomic links */ ++ ret = request_threaded_irq(fifo->irq, NULL, ++ axg_fifo_pcm_irq_block, + IRQF_ONESHOT, dev_name(dev), ss); + if (ret) + return ret; +diff --git a/sound/soc/pxa/spitz.c b/sound/soc/pxa/spitz.c +index 7c1384a869ca48..44303b6eb228bf 100644 +--- a/sound/soc/pxa/spitz.c ++++ b/sound/soc/pxa/spitz.c +@@ -14,13 +14,12 @@ + #include <linux/timer.h> + #include <linux/interrupt.h> + #include <linux/platform_device.h> +-#include <linux/gpio.h> ++#include <linux/gpio/consumer.h> + #include <sound/core.h> + #include <sound/pcm.h> + #include <sound/soc.h> + + #include <asm/mach-types.h> +-#include <mach/spitz.h> + #include "../codecs/wm8750.h" + #include "pxa2xx-i2s.h" + +@@ -37,7 +36,7 @@ + + static int spitz_jack_func; + static int spitz_spk_func; +-static int spitz_mic_gpio; ++static struct gpio_desc *gpiod_mic, *gpiod_mute_l, *gpiod_mute_r; + + static void spitz_ext_control(struct snd_soc_dapm_context *dapm) + { +@@ -56,8 +55,8 @@ static void spitz_ext_control(struct snd_soc_dapm_context *dapm) + snd_soc_dapm_disable_pin_unlocked(dapm, "Mic Jack"); + snd_soc_dapm_disable_pin_unlocked(dapm, "Line Jack"); + snd_soc_dapm_enable_pin_unlocked(dapm, "Headphone Jack"); +- gpio_set_value(SPITZ_GPIO_MUTE_L, 1); +- gpio_set_value(SPITZ_GPIO_MUTE_R, 1); ++ gpiod_set_value(gpiod_mute_l, 1); ++ gpiod_set_value(gpiod_mute_r, 1); + break; + case SPITZ_MIC: + /* enable mic jack and bias, mute hp */ +@@ -65,8 +64,8 @@ static void spitz_ext_control(struct snd_soc_dapm_context *dapm) + snd_soc_dapm_disable_pin_unlocked(dapm, "Headset Jack"); + snd_soc_dapm_disable_pin_unlocked(dapm, "Line Jack"); + snd_soc_dapm_enable_pin_unlocked(dapm, "Mic Jack"); +- gpio_set_value(SPITZ_GPIO_MUTE_L, 0); +- gpio_set_value(SPITZ_GPIO_MUTE_R, 0); ++ gpiod_set_value(gpiod_mute_l, 0); ++ gpiod_set_value(gpiod_mute_r, 0); + break; + case SPITZ_LINE: + /* enable line jack, disable mic bias and mute hp */ +@@ -74,8 +73,8 @@ static void spitz_ext_control(struct snd_soc_dapm_context *dapm) + snd_soc_dapm_disable_pin_unlocked(dapm, "Headset Jack"); + snd_soc_dapm_disable_pin_unlocked(dapm, "Mic Jack"); + snd_soc_dapm_enable_pin_unlocked(dapm, "Line Jack"); +- gpio_set_value(SPITZ_GPIO_MUTE_L, 0); +- gpio_set_value(SPITZ_GPIO_MUTE_R, 0); ++ gpiod_set_value(gpiod_mute_l, 0); ++ gpiod_set_value(gpiod_mute_r, 0); + break; + case SPITZ_HEADSET: + /* enable and unmute headset jack enable mic bias, mute L hp */ +@@ -83,8 +82,8 @@ static void spitz_ext_control(struct snd_soc_dapm_context *dapm) + snd_soc_dapm_enable_pin_unlocked(dapm, "Mic Jack"); + snd_soc_dapm_disable_pin_unlocked(dapm, "Line Jack"); + snd_soc_dapm_enable_pin_unlocked(dapm, "Headset Jack"); +- gpio_set_value(SPITZ_GPIO_MUTE_L, 0); +- gpio_set_value(SPITZ_GPIO_MUTE_R, 1); ++ gpiod_set_value(gpiod_mute_l, 0); ++ gpiod_set_value(gpiod_mute_r, 1); + break; + case SPITZ_HP_OFF: + +@@ -93,8 +92,8 @@ static void spitz_ext_control(struct snd_soc_dapm_context *dapm) + snd_soc_dapm_disable_pin_unlocked(dapm, "Headset Jack"); + snd_soc_dapm_disable_pin_unlocked(dapm, "Mic Jack"); + snd_soc_dapm_disable_pin_unlocked(dapm, "Line Jack"); +- gpio_set_value(SPITZ_GPIO_MUTE_L, 0); +- gpio_set_value(SPITZ_GPIO_MUTE_R, 0); ++ gpiod_set_value(gpiod_mute_l, 0); ++ gpiod_set_value(gpiod_mute_r, 0); + break; + } + +@@ -199,7 +198,7 @@ static int spitz_set_spk(struct snd_kcontrol *kcontrol, + static int spitz_mic_bias(struct snd_soc_dapm_widget *w, + struct snd_kcontrol *k, int event) + { +- gpio_set_value_cansleep(spitz_mic_gpio, SND_SOC_DAPM_EVENT_ON(event)); ++ gpiod_set_value_cansleep(gpiod_mic, SND_SOC_DAPM_EVENT_ON(event)); + return 0; + } + +@@ -287,39 +286,28 @@ static int spitz_probe(struct platform_device *pdev) + struct snd_soc_card *card = &snd_soc_spitz; + int ret; + +- if (machine_is_akita()) +- spitz_mic_gpio = AKITA_GPIO_MIC_BIAS; +- else +- spitz_mic_gpio = SPITZ_GPIO_MIC_BIAS; +- +- ret = gpio_request(spitz_mic_gpio, "MIC GPIO"); +- if (ret) +- goto err1; +- +- ret = gpio_direction_output(spitz_mic_gpio, 0); +- if (ret) +- goto err2; ++ gpiod_mic = devm_gpiod_get(&pdev->dev, "mic", GPIOD_OUT_LOW); ++ if (IS_ERR(gpiod_mic)) ++ return PTR_ERR(gpiod_mic); ++ gpiod_mute_l = devm_gpiod_get(&pdev->dev, "mute-l", GPIOD_OUT_LOW); ++ if (IS_ERR(gpiod_mute_l)) ++ return PTR_ERR(gpiod_mute_l); ++ gpiod_mute_r = devm_gpiod_get(&pdev->dev, "mute-r", GPIOD_OUT_LOW); ++ if (IS_ERR(gpiod_mute_r)) ++ return PTR_ERR(gpiod_mute_r); + + card->dev = &pdev->dev; + + ret = devm_snd_soc_register_card(&pdev->dev, card); +- if (ret) { ++ if (ret) + dev_err(&pdev->dev, "snd_soc_register_card() failed: %d\n", + ret); +- goto err2; +- } +- +- return 0; + +-err2: +- gpio_free(spitz_mic_gpio); +-err1: + return ret; + } + + static int spitz_remove(struct platform_device *pdev) + { +- gpio_free(spitz_mic_gpio); + return 0; + } + +diff --git a/sound/usb/line6/driver.c b/sound/usb/line6/driver.c +index f4437015d43a75..9df49a880b750d 100644 +--- a/sound/usb/line6/driver.c ++++ b/sound/usb/line6/driver.c +@@ -286,12 +286,14 @@ static void line6_data_received(struct urb *urb) + { + struct usb_line6 *line6 = (struct usb_line6 *)urb->context; + struct midi_buffer *mb = &line6->line6midi->midibuf_in; ++ unsigned long flags; + int done; + + if (urb->status == -ESHUTDOWN) + return; + + if (line6->properties->capabilities & LINE6_CAP_CONTROL_MIDI) { ++ spin_lock_irqsave(&line6->line6midi->lock, flags); + done = + line6_midibuf_write(mb, urb->transfer_buffer, urb->actual_length); + +@@ -300,12 +302,15 @@ static void line6_data_received(struct urb *urb) + dev_dbg(line6->ifcdev, "%d %d buffer overflow - message skipped\n", + done, urb->actual_length); + } ++ spin_unlock_irqrestore(&line6->line6midi->lock, flags); + + for (;;) { ++ spin_lock_irqsave(&line6->line6midi->lock, flags); + done = + line6_midibuf_read(mb, line6->buffer_message, + LINE6_MIDI_MESSAGE_MAXLEN, + LINE6_MIDIBUF_READ_RX); ++ spin_unlock_irqrestore(&line6->line6midi->lock, flags); + + if (done <= 0) + break; +diff --git a/sound/usb/mixer.c b/sound/usb/mixer.c +index d818eee53c90a6..9906785a02e928 100644 +--- a/sound/usb/mixer.c ++++ b/sound/usb/mixer.c +@@ -1212,6 +1212,13 @@ static void volume_control_quirks(struct usb_mixer_elem_info *cval, + cval->res = 16; + } + break; ++ case USB_ID(0x1bcf, 0x2281): /* HD Webcam */ ++ if (!strcmp(kctl->id.name, "Mic Capture Volume")) { ++ usb_audio_info(chip, ++ "set resolution quirk: cval->res = 16\n"); ++ cval->res = 16; ++ } ++ break; + } + } + +diff --git a/sound/usb/quirks-table.h b/sound/usb/quirks-table.h +index 6d332c9eb44452..b03d671f218d63 100644 +--- a/sound/usb/quirks-table.h ++++ b/sound/usb/quirks-table.h +@@ -2594,6 +2594,10 @@ YAMAHA_DEVICE(0x7010, "UB99"), + } + }, + ++/* Stanton ScratchAmp */ ++{ USB_DEVICE(0x103d, 0x0100) }, ++{ USB_DEVICE(0x103d, 0x0101) }, ++ + /* Novation EMS devices */ + { + USB_DEVICE_VENDOR_SPEC(0x1235, 0x0001), +diff --git a/sound/usb/quirks.c b/sound/usb/quirks.c +index 1226ce5d5a3042..cf1ba2837d10f4 100644 +--- a/sound/usb/quirks.c ++++ b/sound/usb/quirks.c +@@ -1810,6 +1810,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = { + QUIRK_FLAG_CTL_MSG_DELAY_1M), + DEVICE_FLG(0x0b0e, 0x0349, /* Jabra 550a */ + QUIRK_FLAG_CTL_MSG_DELAY_1M), ++ DEVICE_FLG(0x0c45, 0x6340, /* Sonix HD USB Camera */ ++ QUIRK_FLAG_GET_SAMPLE_RATE), + DEVICE_FLG(0x0ecb, 0x205c, /* JBL Quantum610 Wireless */ + QUIRK_FLAG_FIXED_RATE), + DEVICE_FLG(0x0ecb, 0x2069, /* JBL Quantum810 Wireless */ +@@ -1850,6 +1852,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = { + QUIRK_FLAG_GET_SAMPLE_RATE), + DEVICE_FLG(0x19f7, 0x0035, /* RODE NT-USB+ */ + QUIRK_FLAG_GET_SAMPLE_RATE), ++ DEVICE_FLG(0x1bcf, 0x2281, /* HD Webcam */ ++ QUIRK_FLAG_GET_SAMPLE_RATE), + DEVICE_FLG(0x1bcf, 0x2283, /* NexiGo N930AF FHD Webcam */ + QUIRK_FLAG_GET_SAMPLE_RATE), + DEVICE_FLG(0x2040, 0x7200, /* Hauppauge HVR-950Q */ +diff --git a/sound/usb/stream.c b/sound/usb/stream.c +index d5409f38794559..e14c725acebf2c 100644 +--- a/sound/usb/stream.c ++++ b/sound/usb/stream.c +@@ -244,8 +244,8 @@ static struct snd_pcm_chmap_elem *convert_chmap(int channels, unsigned int bits, + SNDRV_CHMAP_FR, /* right front */ + SNDRV_CHMAP_FC, /* center front */ + SNDRV_CHMAP_LFE, /* LFE */ +- SNDRV_CHMAP_SL, /* left surround */ +- SNDRV_CHMAP_SR, /* right surround */ ++ SNDRV_CHMAP_RL, /* left surround */ ++ SNDRV_CHMAP_RR, /* right surround */ + SNDRV_CHMAP_FLC, /* left of center */ + SNDRV_CHMAP_FRC, /* right of center */ + SNDRV_CHMAP_RC, /* surround */ +diff --git a/tools/lib/bpf/btf_dump.c b/tools/lib/bpf/btf_dump.c +index b91dd7cd4ffb08..c2bf996fcba82b 100644 +--- a/tools/lib/bpf/btf_dump.c ++++ b/tools/lib/bpf/btf_dump.c +@@ -1458,10 +1458,12 @@ static void btf_dump_emit_type_chain(struct btf_dump *d, + * Clang for BPF target generates func_proto with no + * args as a func_proto with a single void arg (e.g., + * `int (*f)(void)` vs just `int (*f)()`). We are +- * going to pretend there are no args for such case. ++ * going to emit valid empty args (void) syntax for ++ * such case. Similarly and conveniently, valid ++ * no args case can be special-cased here as well. + */ +- if (vlen == 1 && p->type == 0) { +- btf_dump_printf(d, ")"); ++ if (vlen == 0 || (vlen == 1 && p->type == 0)) { ++ btf_dump_printf(d, "void)"); + return; + } + +diff --git a/tools/lib/bpf/linker.c b/tools/lib/bpf/linker.c +index 6b2f59ddb69183..bfe0c30841b9bf 100644 +--- a/tools/lib/bpf/linker.c ++++ b/tools/lib/bpf/linker.c +@@ -2193,10 +2193,17 @@ static int linker_fixup_btf(struct src_obj *obj) + vi = btf_var_secinfos(t); + for (j = 0, m = btf_vlen(t); j < m; j++, vi++) { + const struct btf_type *vt = btf__type_by_id(obj->btf, vi->type); +- const char *var_name = btf__str_by_offset(obj->btf, vt->name_off); +- int var_linkage = btf_var(vt)->linkage; ++ const char *var_name; ++ int var_linkage; + Elf64_Sym *sym; + ++ /* could be a variable or function */ ++ if (!btf_is_var(vt)) ++ continue; ++ ++ var_name = btf__str_by_offset(obj->btf, vt->name_off); ++ var_linkage = btf_var(vt)->linkage; ++ + /* no need to patch up static or extern vars */ + if (var_linkage != BTF_VAR_GLOBAL_ALLOCATED) + continue; +diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat +index 6b52f365d73ac4..9f3b5b38221bf8 100644 +--- a/tools/memory-model/lock.cat ++++ b/tools/memory-model/lock.cat +@@ -102,19 +102,19 @@ let rf-lf = rfe-lf | rfi-lf + * within one of the lock's critical sections returns False. + *) + +-(* rfi for RU events: an RU may read from the last po-previous UL *) +-let rfi-ru = ([UL] ; po-loc ; [RU]) \ ([UL] ; po-loc ; [LKW] ; po-loc) +- +-(* rfe for RU events: an RU may read from an external UL or the initial write *) +-let all-possible-rfe-ru = +- let possible-rfe-ru r = ++(* ++ * rf for RU events: an RU may read from an external UL or the initial write, ++ * or from the last po-previous UL ++ *) ++let all-possible-rf-ru = ++ let possible-rf-ru r = + let pair-to-relation p = p ++ 0 +- in map pair-to-relation (((UL | IW) * {r}) & loc & ext) +- in map possible-rfe-ru RU ++ in map pair-to-relation ((((UL | IW) * {r}) & loc & ext) | ++ (((UL * {r}) & po-loc) \ ([UL] ; po-loc ; [LKW] ; po-loc))) ++ in map possible-rf-ru RU + + (* Generate all rf relations for RU events *) +-with rfe-ru from cross(all-possible-rfe-ru) +-let rf-ru = rfe-ru | rfi-ru ++with rf-ru from cross(all-possible-rf-ru) + + (* Final rf relation *) + let rf = rf | rf-lf | rf-ru +diff --git a/tools/perf/arch/x86/util/intel-pt.c b/tools/perf/arch/x86/util/intel-pt.c +index 6df0dc00d73abe..7cb21803455a99 100644 +--- a/tools/perf/arch/x86/util/intel-pt.c ++++ b/tools/perf/arch/x86/util/intel-pt.c +@@ -31,6 +31,7 @@ + #include "../../../util/tsc.h" + #include <internal/lib.h> // page_size + #include "../../../util/intel-pt.h" ++#include <api/fs/fs.h> + + #define KiB(x) ((x) * 1024) + #define MiB(x) ((x) * 1024 * 1024) +@@ -438,6 +439,16 @@ static int intel_pt_track_switches(struct evlist *evlist) + return 0; + } + ++static bool intel_pt_exclude_guest(void) ++{ ++ int pt_mode; ++ ++ if (sysfs__read_int("module/kvm_intel/parameters/pt_mode", &pt_mode)) ++ pt_mode = 0; ++ ++ return pt_mode == 1; ++} ++ + static void intel_pt_valid_str(char *str, size_t len, u64 valid) + { + unsigned int val, last = 0, state = 1; +@@ -641,6 +652,7 @@ static int intel_pt_recording_options(struct auxtrace_record *itr, + } + evsel->core.attr.freq = 0; + evsel->core.attr.sample_period = 1; ++ evsel->core.attr.exclude_guest = intel_pt_exclude_guest(); + evsel->no_aux_samples = true; + intel_pt_evsel = evsel; + opts->full_auxtrace = true; +@@ -777,7 +789,8 @@ static int intel_pt_recording_options(struct auxtrace_record *itr, + } + + if (!opts->auxtrace_snapshot_mode && !opts->auxtrace_sample_mode) { +- u32 aux_watermark = opts->auxtrace_mmap_pages * page_size / 4; ++ size_t aw = opts->auxtrace_mmap_pages * (size_t)page_size / 4; ++ u32 aux_watermark = aw > UINT_MAX ? UINT_MAX : aw; + + intel_pt_evsel->core.attr.aux_watermark = aux_watermark; + } +diff --git a/tools/perf/util/sort.c b/tools/perf/util/sort.c +index a4f2ffe2bdb6d2..d5133786d3e175 100644 +--- a/tools/perf/util/sort.c ++++ b/tools/perf/util/sort.c +@@ -275,7 +275,7 @@ sort__sym_cmp(struct hist_entry *left, struct hist_entry *right) + * comparing symbol address alone is not enough since it's a + * relative address within a dso. + */ +- if (!hists__has(left->hists, dso) || hists__has(right->hists, dso)) { ++ if (!hists__has(left->hists, dso)) { + ret = sort__dso_cmp(left, right); + if (ret != 0) + return ret; +diff --git a/tools/testing/selftests/bpf/prog_tests/send_signal.c b/tools/testing/selftests/bpf/prog_tests/send_signal.c +index 776916b61c4067..7b1343f70e65ad 100644 +--- a/tools/testing/selftests/bpf/prog_tests/send_signal.c ++++ b/tools/testing/selftests/bpf/prog_tests/send_signal.c +@@ -149,7 +149,8 @@ static void test_send_signal_tracepoint(bool signal_thread) + static void test_send_signal_perf(bool signal_thread) + { + struct perf_event_attr attr = { +- .sample_period = 1, ++ .freq = 1, ++ .sample_freq = 1000, + .type = PERF_TYPE_SOFTWARE, + .config = PERF_COUNT_SW_CPU_CLOCK, + }; +diff --git a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c +index 6db07401bc4937..651c23d6836bc9 100644 +--- a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c ++++ b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c +@@ -964,7 +964,7 @@ static void drop_on_reuseport(const struct test *t) + + err = update_lookup_map(t->sock_map, SERVER_A, server1); + if (err) +- goto detach; ++ goto close_srv1; + + /* second server on destination address we should never reach */ + server2 = make_server(t->sotype, t->connect_to.ip, t->connect_to.port, +diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c +index ba97165bdb2822..a657651eba523e 100644 +--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c ++++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c +@@ -14,9 +14,9 @@ typedef int *ptr_arr_t[6]; + + typedef int *ptr_multiarr_t[7][8][9][10]; + +-typedef int * (*fn_ptr_arr_t[11])(); ++typedef int * (*fn_ptr_arr_t[11])(void); + +-typedef int * (*fn_ptr_multiarr_t[12][13])(); ++typedef int * (*fn_ptr_multiarr_t[12][13])(void); + + struct root_struct { + arr_t _1; +diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c +index 970598dda7322d..7fda004c153a6c 100644 +--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c ++++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c +@@ -67,7 +67,7 @@ typedef void (*printf_fn_t)(const char *, ...); + * `int -> char *` function and returns pointer to a char. Equivalent: + * typedef char * (*fn_input_t)(int); + * typedef char * (*fn_output_outer_t)(fn_input_t); +- * typedef const fn_output_outer_t (* fn_output_inner_t)(); ++ * typedef const fn_output_outer_t (* fn_output_inner_t)(void); + * typedef const fn_output_inner_t fn_ptr_arr2_t[5]; + */ + /* ----- START-EXPECTED-OUTPUT ----- */ +@@ -94,7 +94,7 @@ typedef void (* (*signal_t)(int, void (*)(int)))(int); + + typedef char * (*fn_ptr_arr1_t[10])(int **); + +-typedef char * (* (* const fn_ptr_arr2_t[5])())(char * (*)(int)); ++typedef char * (* (* const fn_ptr_arr2_t[5])(void))(char * (*)(int)); + + struct struct_w_typedefs { + int_t a; +diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c +index 7465cbe19bb08e..230ca335a99194 100644 +--- a/tools/testing/selftests/bpf/test_sockmap.c ++++ b/tools/testing/selftests/bpf/test_sockmap.c +@@ -65,7 +65,7 @@ int passed; + int failed; + int map_fd[9]; + struct bpf_map *maps[9]; +-int prog_fd[11]; ++int prog_fd[9]; + + int txmsg_pass; + int txmsg_redir; +@@ -663,7 +663,8 @@ static int msg_loop(int fd, int iov_count, int iov_length, int cnt, + } + } + +- s->bytes_recvd += recv; ++ if (recv > 0) ++ s->bytes_recvd += recv; + + if (data) { + int chunk_sz = opt->sendpage ? +@@ -1708,8 +1709,6 @@ int prog_attach_type[] = { + BPF_SK_MSG_VERDICT, + BPF_SK_MSG_VERDICT, + BPF_SK_MSG_VERDICT, +- BPF_SK_MSG_VERDICT, +- BPF_SK_MSG_VERDICT, + }; + + int prog_type[] = { +@@ -1722,8 +1721,6 @@ int prog_type[] = { + BPF_PROG_TYPE_SK_MSG, + BPF_PROG_TYPE_SK_MSG, + BPF_PROG_TYPE_SK_MSG, +- BPF_PROG_TYPE_SK_MSG, +- BPF_PROG_TYPE_SK_MSG, + }; + + static int populate_progs(char *bpf_file) +diff --git a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh +index 616d3581419ca0..21d0f419cc6d77 100755 +--- a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh ++++ b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh +@@ -11,7 +11,7 @@ ALL_TESTS="single_mask_test identical_filters_test two_masks_test \ + multiple_masks_test ctcam_edge_cases_test delta_simple_test \ + delta_two_masks_one_key_test delta_simple_rehash_test \ + bloom_simple_test bloom_complex_test bloom_delta_test \ +- max_erp_entries_test max_group_size_test" ++ max_erp_entries_test max_group_size_test collision_test" + NUM_NETIFS=2 + source $lib_dir/lib.sh + source $lib_dir/tc_common.sh +@@ -457,7 +457,7 @@ delta_two_masks_one_key_test() + { + # If 2 keys are the same and only differ in mask in a way that + # they belong under the same ERP (second is delta of the first), +- # there should be no C-TCAM spill. ++ # there should be C-TCAM spill. + + RET=0 + +@@ -474,8 +474,8 @@ delta_two_masks_one_key_test() + tp_record "mlxsw:*" "tc filter add dev $h2 ingress protocol ip \ + pref 2 handle 102 flower $tcflags dst_ip 192.0.2.2 \ + action drop" +- tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 0 +- check_err $? "incorrect C-TCAM spill while inserting the second rule" ++ tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 1 ++ check_err $? "C-TCAM spill did not happen while inserting the second rule" + + $MZ $h1 -c 1 -p 64 -a $h1mac -b $h2mac -A 192.0.2.1 -B 192.0.2.2 \ + -t ip -q +@@ -1087,6 +1087,53 @@ max_group_size_test() + log_test "max ACL group size test ($tcflags). max size $max_size" + } + ++collision_test() ++{ ++ # Filters cannot share an eRP if in the common unmasked part (i.e., ++ # without the delta bits) they have the same values. If the driver does ++ # not prevent such configuration (by spilling into the C-TCAM), then ++ # multiple entries will be present in the device with the same key, ++ # leading to collisions and a reduced scale. ++ # ++ # Create such a scenario and make sure all the filters are successfully ++ # added. ++ ++ RET=0 ++ ++ local ret ++ ++ if [[ "$tcflags" != "skip_sw" ]]; then ++ return 0; ++ fi ++ ++ # Add a single dst_ip/24 filter and multiple dst_ip/32 filters that all ++ # have the same values in the common unmasked part (dst_ip/24). ++ ++ tc filter add dev $h2 ingress pref 1 proto ipv4 handle 101 \ ++ flower $tcflags dst_ip 198.51.100.0/24 \ ++ action drop ++ ++ for i in {0..255}; do ++ tc filter add dev $h2 ingress pref 2 proto ipv4 \ ++ handle $((102 + i)) \ ++ flower $tcflags dst_ip 198.51.100.${i}/32 \ ++ action drop ++ ret=$? ++ [[ $ret -ne 0 ]] && break ++ done ++ ++ check_err $ret "failed to add all the filters" ++ ++ for i in {255..0}; do ++ tc filter del dev $h2 ingress pref 2 proto ipv4 \ ++ handle $((102 + i)) flower ++ done ++ ++ tc filter del dev $h2 ingress pref 1 proto ipv4 handle 101 flower ++ ++ log_test "collision test ($tcflags)" ++} ++ + setup_prepare() + { + h1=${NETIFS[p1]} +diff --git a/tools/testing/selftests/landlock/base_test.c b/tools/testing/selftests/landlock/base_test.c +index 35f64832b869cc..1a8fa6b0c887c8 100644 +--- a/tools/testing/selftests/landlock/base_test.c ++++ b/tools/testing/selftests/landlock/base_test.c +@@ -9,6 +9,7 @@ + #define _GNU_SOURCE + #include <errno.h> + #include <fcntl.h> ++#include <linux/keyctl.h> + #include <linux/landlock.h> + #include <string.h> + #include <sys/prctl.h> +@@ -356,4 +357,77 @@ TEST(ruleset_fd_transfer) + ASSERT_EQ(EXIT_SUCCESS, WEXITSTATUS(status)); + } + ++TEST(cred_transfer) ++{ ++ struct landlock_ruleset_attr ruleset_attr = { ++ .handled_access_fs = LANDLOCK_ACCESS_FS_READ_DIR, ++ }; ++ int ruleset_fd, dir_fd; ++ pid_t child; ++ int status; ++ ++ drop_caps(_metadata); ++ ++ dir_fd = open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC); ++ EXPECT_LE(0, dir_fd); ++ EXPECT_EQ(0, close(dir_fd)); ++ ++ /* Denies opening directories. */ ++ ruleset_fd = ++ landlock_create_ruleset(&ruleset_attr, sizeof(ruleset_attr), 0); ++ ASSERT_LE(0, ruleset_fd); ++ EXPECT_EQ(0, prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0)); ++ ASSERT_EQ(0, landlock_restrict_self(ruleset_fd, 0)); ++ EXPECT_EQ(0, close(ruleset_fd)); ++ ++ /* Checks ruleset enforcement. */ ++ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC)); ++ EXPECT_EQ(EACCES, errno); ++ ++ /* Needed for KEYCTL_SESSION_TO_PARENT permission checks */ ++ EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING, NULL, 0, ++ 0, 0)) ++ { ++ TH_LOG("Failed to join session keyring: %s", strerror(errno)); ++ } ++ ++ child = fork(); ++ ASSERT_LE(0, child); ++ if (child == 0) { ++ /* Checks ruleset enforcement. */ ++ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC)); ++ EXPECT_EQ(EACCES, errno); ++ ++ /* ++ * KEYCTL_SESSION_TO_PARENT is a no-op unless we have a ++ * different session keyring in the child, so make that happen. ++ */ ++ EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING, ++ NULL, 0, 0, 0)); ++ ++ /* ++ * KEYCTL_SESSION_TO_PARENT installs credentials on the parent ++ * that never go through the cred_prepare hook, this path uses ++ * cred_transfer instead. ++ */ ++ EXPECT_EQ(0, syscall(__NR_keyctl, KEYCTL_SESSION_TO_PARENT, 0, ++ 0, 0, 0)); ++ ++ /* Re-checks ruleset enforcement. */ ++ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC)); ++ EXPECT_EQ(EACCES, errno); ++ ++ _exit(_metadata->passed ? EXIT_SUCCESS : EXIT_FAILURE); ++ return; ++ } ++ ++ EXPECT_EQ(child, waitpid(child, &status, 0)); ++ EXPECT_EQ(1, WIFEXITED(status)); ++ EXPECT_EQ(EXIT_SUCCESS, WEXITSTATUS(status)); ++ ++ /* Re-checks ruleset enforcement. */ ++ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC)); ++ EXPECT_EQ(EACCES, errno); ++} ++ + TEST_HARNESS_MAIN +diff --git a/tools/testing/selftests/landlock/config b/tools/testing/selftests/landlock/config +index 0f0a65287bacf1..177f4878bdf33d 100644 +--- a/tools/testing/selftests/landlock/config ++++ b/tools/testing/selftests/landlock/config +@@ -1,7 +1,8 @@ ++CONFIG_KEYS=y + CONFIG_OVERLAY_FS=y ++CONFIG_SECURITY=y + CONFIG_SECURITY_LANDLOCK=y + CONFIG_SECURITY_PATH=y +-CONFIG_SECURITY=y + CONFIG_SHMEM=y +-CONFIG_TMPFS_XATTR=y + CONFIG_TMPFS=y ++CONFIG_TMPFS_XATTR=y +diff --git a/tools/testing/selftests/net/forwarding/devlink_lib.sh b/tools/testing/selftests/net/forwarding/devlink_lib.sh +index 2c14a86adaaae4..6bb0f929dad789 100644 +--- a/tools/testing/selftests/net/forwarding/devlink_lib.sh ++++ b/tools/testing/selftests/net/forwarding/devlink_lib.sh +@@ -122,6 +122,8 @@ devlink_reload() + still_pending=$(devlink resource show "$DEVLINK_DEV" | \ + grep -c "size_new") + check_err $still_pending "Failed reload - There are still unset sizes" ++ ++ udevadm settle + } + + declare -A DEVLINK_ORIG +diff --git a/tools/testing/selftests/net/mptcp/mptcp_join.sh b/tools/testing/selftests/net/mptcp/mptcp_join.sh +index e725285298a02f..145749460bec31 100755 +--- a/tools/testing/selftests/net/mptcp/mptcp_join.sh ++++ b/tools/testing/selftests/net/mptcp/mptcp_join.sh +@@ -925,6 +925,8 @@ chk_prio_nr() + { + local mp_prio_nr_tx=$1 + local mp_prio_nr_rx=$2 ++ local mpj_syn=$3 ++ local mpj_syn_ack=$4 + local count + local dump_stats + +@@ -952,6 +954,30 @@ chk_prio_nr() + echo "[ ok ]" + fi + ++ printf "%-39s %s" " " "bkp syn" ++ count=$(get_counter ${ns1} "MPTcpExtMPJoinSynBackupRx") ++ if [ -z "$count" ]; then ++ echo -n "[skip]" ++ elif [ "$count" != "$mpj_syn" ]; then ++ echo "[fail] got $count JOIN[s] syn with Backup expected $mpj_syn" ++ ret=1 ++ dump_stats=1 ++ else ++ echo -n "[ ok ]" ++ fi ++ ++ echo -n " - synack " ++ count=$(get_counter ${ns2} "MPTcpExtMPJoinSynAckBackupRx") ++ if [ -z "$count" ]; then ++ echo "[skip]" ++ elif [ "$count" != "$mpj_syn_ack" ]; then ++ echo "[fail] got $count JOIN[s] synack with Backup expected $mpj_syn_ack" ++ ret=1 ++ dump_stats=1 ++ else ++ echo "[ ok ]" ++ fi ++ + if [ "${dump_stats}" = 1 ]; then + echo Server ns stats + ip netns exec $ns1 nstat -as | grep MPTcp +@@ -1557,17 +1583,26 @@ backup_tests() + ip netns exec $ns2 ./pm_nl_ctl add 10.0.3.2 flags subflow,backup + run_tests $ns1 $ns2 10.0.1.1 0 0 0 slow nobackup + chk_join_nr "single subflow, backup" 1 1 1 +- chk_prio_nr 0 1 ++ chk_prio_nr 0 1 1 0 + + # single address, backup ++ reset ++ ip netns exec $ns1 ./pm_nl_ctl limits 0 1 ++ ip netns exec $ns1 ./pm_nl_ctl add 10.0.2.1 flags signal,backup ++ ip netns exec $ns2 ./pm_nl_ctl limits 1 1 ++ run_tests $ns1 $ns2 10.0.1.1 0 0 0 slow nobackup ++ chk_join_nr "single address, backup" 1 1 1 ++ chk_add_nr 1 1 ++ chk_prio_nr 1 0 0 1 ++ + reset + ip netns exec $ns1 ./pm_nl_ctl limits 0 1 + ip netns exec $ns1 ./pm_nl_ctl add 10.0.2.1 flags signal + ip netns exec $ns2 ./pm_nl_ctl limits 1 1 + run_tests $ns1 $ns2 10.0.1.1 0 0 0 slow backup +- chk_join_nr "single address, backup" 1 1 1 ++ chk_join_nr "single address, switch to backup" 1 1 1 + chk_add_nr 1 1 +- chk_prio_nr 1 0 ++ chk_prio_nr 1 0 0 0 + } + + add_addr_ports_tests() +diff --git a/tools/testing/selftests/rcutorture/bin/torture.sh b/tools/testing/selftests/rcutorture/bin/torture.sh +index 66f0f724a1a6dd..d9513e50f24c26 100755 +--- a/tools/testing/selftests/rcutorture/bin/torture.sh ++++ b/tools/testing/selftests/rcutorture/bin/torture.sh +@@ -386,16 +386,16 @@ fi + + if test "$do_clocksourcewd" = "yes" + then +- torture_bootargs="rcupdate.rcu_cpu_stall_suppress_at_boot=1 torture.disable_onoff_at_boot rcupdate.rcu_task_stall_timeout=30000" ++ torture_bootargs="rcupdate.rcu_cpu_stall_suppress_at_boot=1 torture.disable_onoff_at_boot rcupdate.rcu_task_stall_timeout=30000 tsc=watchdog" + torture_set "clocksourcewd-1" tools/testing/selftests/rcutorture/bin/kvm.sh --allcpus --duration 45s --configs TREE03 --kconfig "CONFIG_TEST_CLOCKSOURCE_WATCHDOG=y" --trust-make + +- torture_bootargs="rcupdate.rcu_cpu_stall_suppress_at_boot=1 torture.disable_onoff_at_boot rcupdate.rcu_task_stall_timeout=30000 clocksource.max_cswd_read_retries=1" ++ torture_bootargs="rcupdate.rcu_cpu_stall_suppress_at_boot=1 torture.disable_onoff_at_boot rcupdate.rcu_task_stall_timeout=30000 tsc=watchdog" + torture_set "clocksourcewd-2" tools/testing/selftests/rcutorture/bin/kvm.sh --allcpus --duration 45s --configs TREE03 --kconfig "CONFIG_TEST_CLOCKSOURCE_WATCHDOG=y" --trust-make + + # In case our work is already done... + if test "$do_rcutorture" != "yes" + then +- torture_bootargs="rcupdate.rcu_cpu_stall_suppress_at_boot=1 torture.disable_onoff_at_boot rcupdate.rcu_task_stall_timeout=30000" ++ torture_bootargs="rcupdate.rcu_cpu_stall_suppress_at_boot=1 torture.disable_onoff_at_boot rcupdate.rcu_task_stall_timeout=30000 tsc=watchdog" + torture_set "clocksourcewd-3" tools/testing/selftests/rcutorture/bin/kvm.sh --allcpus --duration 45s --configs TREE03 --trust-make + fi + fi +diff --git a/tools/testing/selftests/sigaltstack/current_stack_pointer.h b/tools/testing/selftests/sigaltstack/current_stack_pointer.h +index ea9bdf3a90b164..09da8f1011ce4c 100644 +--- a/tools/testing/selftests/sigaltstack/current_stack_pointer.h ++++ b/tools/testing/selftests/sigaltstack/current_stack_pointer.h +@@ -8,7 +8,7 @@ register unsigned long sp asm("sp"); + register unsigned long sp asm("esp"); + #elif __loongarch64 + register unsigned long sp asm("$sp"); +-#elif __ppc__ ++#elif __powerpc__ + register unsigned long sp asm("r1"); + #elif __s390x__ + register unsigned long sp asm("%15"); |